{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "3f2bef50-1df4-4a84-a904-5ae738172333", "code": "53188-23-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=53188-23-1", "code_system": "CAS", "references": [ "bf0e53af-7e64-486e-972f-e0acb6e28357", "3ff9e72d-7852-4954-a7d9-11553e540312" ] }, { "uuid": "b9ea55c0-6072-4acd-a964-2f5591f51a46", "code": "C81024", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81024", "code_system": "NCI_THESAURUS", "references": [ "bf0e53af-7e64-486e-972f-e0acb6e28357" ] }, { "uuid": "b7cb3a9b-6852-4134-81fd-58046cdf497f", "code": "439709", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439709", "code_system": "PUBCHEM", "references": [ "bf0e53af-7e64-486e-972f-e0acb6e28357" ] }, { "uuid": "fbebdc86-8ebe-67ef-a4c5-76680dccad7a", "code": "DTXSID20273991", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20273991", "code_system": "EPA CompTox", "references": [ "40f616b6-cd67-5103-70e3-7494ff9988ef" ] }, { "uuid": "93e03436-0b1e-4a60-8c1e-7042e0bf35c5", "code": "B986VTP17J", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "b3e3bb88-df9e-4801-82d9-fcc394e78d74", "name": ".BETA.-D-FRUCTOSE", "stdName": ".BETA.-D-FRUCTOSE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "92dffdfe-d35c-48f3-b314-7169eef435d8", "816eb7e8-8dd7-4b65-9e1b-9e019e1be06c" ], "display_name": false }, { "uuid": "e49ec5ba-fe7e-410d-9816-d9e8d0db143e", "name": ".BETA.-D.-FRUCTOFURANOSE", "stdName": ".BETA.-D.-FRUCTOFURANOSE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "afbadc17-0945-440d-a0eb-1c187e36e39a" ], "display_name": true } ], "references": [ { "uuid": "afbadc17-0945-440d-a0eb-1c187e36e39a", "citation": "USP DICTIONARY 2009", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "92dffdfe-d35c-48f3-b314-7169eef435d8", "citation": "STN 2007", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "816eb7e8-8dd7-4b65-9e1b-9e019e1be06c", "citation": "ChemIDplus 2008", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "bf0e53af-7e64-486e-972f-e0acb6e28357", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390733000, "tags": [ "NOMEN" ] }, { "uuid": "3826ba58-8a8e-4084-8e42-e252ec8d0f41", "citation": "SRS import [B986VTP17J]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=B986VTP17J", "doc_type": "SRS", "public_domain": true, "document_date": 1493390733000, "tags": [ "NOMEN" ] }, { "uuid": "40f616b6-cd67-5103-70e3-7494ff9988ef", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=53188-23-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "3ff9e72d-7852-4954-a7d9-11553e540312", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "b14ce880-471e-4167-b678-b01e675479c7", "id": "b14ce880-471e-4167-b678-b01e675479c7", "molfile": "\n Marvin 01132109112D \n\n 12 12 0 0 1 0 999 V2000\n 5.6000 -3.6945 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 5.0133 -4.2770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3503 -2.9082 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 4.7637 -2.3174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9649 -2.5296 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0118 -2.4256 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6816 -2.9082 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.3890 -2.4922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2642 -3.4907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9756 -3.0746 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4237 -3.6945 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 7.0021 -4.2770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 11 1 0 0 0 0\n 3 4 1 1 0 0 0\n 3 6 1 0 0 0 0\n 5 4 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 1 0 0 0\n 7 9 1 0 0 0 0\n 11 7 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 12 1 1 0 0 0\nM END", "smiles": "C([C@@H]1[C@H]([C@@H]([C@](CO)(O)O1)O)O)O", "formula": "C6H12O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "6c737f25-7048-4f84-9827-e96abad6dc07" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "180.1561", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "af4f0995-3ac3-4bc3-ac3b-f965317e097e", "version": "3", "structure": { "id": "c215133b-33e7-4646-ab9b-c72ba75aaec1", "molfile": "\n Marvin 01132110022D \n\n 12 12 0 0 1 0 999 V2000\n 6.6816 -2.9082 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.4237 -3.6945 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.0118 -2.4256 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6000 -3.6945 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.3503 -2.9082 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.3890 -2.4922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0021 -4.2770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2642 -3.4907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0133 -4.2770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7637 -2.3174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9756 -3.0746 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9649 -2.5296 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 1 1 0 0 0 0\n 4 2 1 0 0 0 0\n 5 3 1 0 0 0 0\n 1 6 1 1 0 0 0\n 2 7 1 1 0 0 0\n 1 8 1 6 0 0 0\n 4 9 1 6 0 0 0\n 5 10 1 1 0 0 0\n 11 8 1 0 0 0 0\n 12 10 1 0 0 0 0\n 4 5 1 0 0 0 0\nM END", "smiles": "C([C@@H]1[C@H]([C@@H]([C@](CO)(O)O1)O)O)O", "formula": "C6H12O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "180.1561", "optical_activity": "UNSPECIFIED", "references": [ "816eb7e8-8dd7-4b65-9e1b-9e019e1be06c", "3826ba58-8a8e-4084-8e42-e252ec8d0f41" ], "stereo_centers": 4 }, "unii": "B986VTP17J" } ] }