{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "92528713-203c-4c0a-9b16-f872943d4025",
          "code": "26086-33-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=26086-33-9",
          "code_system": "CAS",
          "references": [
            "bd7ba8dc-67cb-4269-8ddd-ae6448621815",
            "279bfddd-7039-4b7f-b3f1-3c6fe92331ca"
          ]
        },
        {
          "uuid": "741250a6-da9e-4770-b08f-e6279d4a21ba",
          "code": "1314295",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1314295/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "bd7ba8dc-67cb-4269-8ddd-ae6448621815"
          ]
        },
        {
          "uuid": "4bda406d-8134-450b-941f-89a8cc7a8b96",
          "code": "14366844",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14366844",
          "code_system": "PUBCHEM",
          "references": [
            "bd7ba8dc-67cb-4269-8ddd-ae6448621815"
          ]
        },
        {
          "uuid": "aaad2a79-ba30-4e66-ab67-df53ca6adc39",
          "code": "B952ZGW1IL",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fa2286e3-f598-10e4-e0dc-68d7a8eb1193",
          "code": "DTXSID601021948",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID601021948",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "7c558286-86c5-3cbb-9f6b-8d8576775b0f",
          "code": "B952ZGW1IL",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=B952ZGW1IL",
          "code_system": "DAILYMED",
          "references": [
            "c75c4a44-cb43-cc28-7931-99be5f0c5e44"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b4925567-6ed7-46ac-a0dc-43845dd51310",
          "name": "1,1,1-TRIMETHYLOLPROPANE TRIS(2-ETHYLHEXANOATE)",
          "stdName": "1,1,1-TRIMETHYLOLPROPANE TRIS(2-ETHYLHEXANOATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41a209ad-f402-44a3-b1d3-b50206bf4712"
          ],
          "display_name": false
        },
        {
          "uuid": "d116ba4b-1325-4b72-8f16-54196a7b11d6",
          "name": "2-ETHYL-2-(((1-OXO-2-ETHYLHEXYL)OXY)METHYL)-1,3-PROPANEDIYL 2-ETHYLHEXANOATE",
          "stdName": "2-ETHYL-2-(((1-OXO-2-ETHYLHEXYL)OXY)METHYL)-1,3-PROPANEDIYL 2-ETHYLHEXANOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c11514c-ff48-4912-936e-94b5d54ed176"
          ],
          "display_name": false
        },
        {
          "uuid": "d84e6be3-fbf7-448d-a6ae-f3d8aed3237e",
          "name": "HEXANOIC ACID, 2-ETHYL-, 1,1'-(2-ETHYL-2-(((2-ETHYL-1-OXOHEXYL)OXY)METHYL)-1,3-PROPANEDIYL) ESTER",
          "stdName": "HEXANOIC ACID, 2-ETHYL-, 1,1'-(2-ETHYL-2-(((2-ETHYL-1-OXOHEXYL)OXY)METHYL)-1,3-PROPANEDIYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41a209ad-f402-44a3-b1d3-b50206bf4712"
          ],
          "display_name": false
        },
        {
          "uuid": "a889ee77-cb2d-4045-aa69-d601ad4fa5cc",
          "name": "HEXANOIC ACID, 2-ETHYL-, 2-ETHYL-2-(((2-ETHYL-1-OXOHEXYL)OXY)METHYL)-1,3-PROPANEDIYL ESTER",
          "stdName": "HEXANOIC ACID, 2-ETHYL-, 2-ETHYL-2-(((2-ETHYL-1-OXOHEXYL)OXY)METHYL)-1,3-PROPANEDIYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41a209ad-f402-44a3-b1d3-b50206bf4712"
          ],
          "display_name": false
        },
        {
          "uuid": "785baccb-b0ac-4f12-a9cb-a742ea58ee29",
          "name": "HEXANOIC ACID, 2-ETHYL-, TRIESTER WITH 2-ETHYL-2-(HYDROXYMETHYL)-1,3-PROPANEDIOL",
          "stdName": "HEXANOIC ACID, 2-ETHYL-, TRIESTER WITH 2-ETHYL-2-(HYDROXYMETHYL)-1,3-PROPANEDIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41a209ad-f402-44a3-b1d3-b50206bf4712"
          ],
          "display_name": false
        },
        {
          "uuid": "031b85a3-daed-4898-8a59-4dca89e10e49",
          "name": "NIKKOL TRIALAN-308",
          "stdName": "NIKKOL TRIALAN-308",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6bb1e556-4182-44b6-b605-1506917061c9"
          ],
          "display_name": false
        },
        {
          "uuid": "620a306b-9598-4652-9eac-a790500e19ff",
          "name": "NS-308",
          "stdName": "NS-308",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6bb1e556-4182-44b6-b605-1506917061c9"
          ],
          "display_name": false
        },
        {
          "uuid": "26264451-f097-4393-872a-e2b653758876",
          "name": "PELEMOL TMPO",
          "stdName": "PELEMOL TMPO",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6bb1e556-4182-44b6-b605-1506917061c9"
          ],
          "display_name": false
        },
        {
          "uuid": "6f0da546-55c9-4028-a319-3f1e14a91711",
          "name": "TRIMETHYLOLPROPANE TRIETHYLHEXANOATE",
          "stdName": "TRIMETHYLOLPROPANE TRIETHYLHEXANOATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa87d752-ab6a-4def-bc5c-2a291d50575c",
            "6bb1e556-4182-44b6-b605-1506917061c9",
            "62d28b79-9f7a-415e-a019-11c6a1c4c8af"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "51352dba-2009-438b-8d57-5af1ef30aa6d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "ff8ffa97-ea91-4835-9709-04eefeac4ab4",
          "name": "TRIMETHYLOLPROPANE TRIOCTANOATE",
          "stdName": "TRIMETHYLOLPROPANE TRIOCTANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a64555ae-011c-4b49-8fb4-593a6996d72a",
            "6bb1e556-4182-44b6-b605-1506917061c9"
          ],
          "display_name": false
        },
        {
          "uuid": "ad1bac5f-4b7e-4c1a-a842-df92215a79a1",
          "name": "TRIMETHYLOLPROPANE TRIS(2-ETHYLHEXANOATE)",
          "stdName": "TRIMETHYLOLPROPANE TRIS(2-ETHYLHEXANOATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41a209ad-f402-44a3-b1d3-b50206bf4712"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6bb1e556-4182-44b6-b605-1506917061c9",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a64555ae-011c-4b49-8fb4-593a6996d72a",
          "citation": "CTFA",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c11514c-ff48-4912-936e-94b5d54ed176",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "41a209ad-f402-44a3-b1d3-b50206bf4712",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "62d28b79-9f7a-415e-a019-11c6a1c4c8af",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd7ba8dc-67cb-4269-8ddd-ae6448621815",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390967000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf0e3416-5533-4ef2-9494-6126c3234d59",
          "citation": "SRS import [B952ZGW1IL]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=B952ZGW1IL",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390967000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa87d752-ab6a-4def-bc5c-2a291d50575c",
          "citation": "TRIMETHYLOLPROPANE TRIETHYLHEXANOATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "279bfddd-7039-4b7f-b3f1-3c6fe92331ca",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c75c4a44-cb43-cc28-7931-99be5f0c5e44",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "acb22ea2-b554-4363-8801-4ad7277f2155",
          "id": "acb22ea2-b554-4363-8801-4ad7277f2155",
          "molfile": "\n  Marvin  01132108582D          \n\n 36 35  0  0  0  0            999 V2000\n    2.2187   -8.2698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0437   -8.2698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4539   -7.5521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2789   -7.5521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6937   -6.8389    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.2789   -6.1257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4539   -6.1257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5187   -6.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9289   -7.5521    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9289   -6.1257    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7539   -6.1257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1687   -5.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4510   -4.9978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7332   -5.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8820   -5.8228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5950   -5.4080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3128   -5.8228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3128   -6.7477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0260   -5.4080    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   10.0260   -4.5830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7438   -4.1728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7438   -5.8228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4568   -5.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1701   -5.8228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8832   -5.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5789   -4.6948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1687   -3.9770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5789   -3.2639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4039   -3.2639    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1687   -2.5508    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.3437   -2.5508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9289   -3.2639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5789   -1.8329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1687   -1.1199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5789   -0.4110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1687    0.3021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 15  1  0  0  0  0\n 26 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 22  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 26 27  1  0  0  0  0\n 28 27  1  0  0  0  0\n 28 29  2  0  0  0  0\n 28 30  1  0  0  0  0\n 30 31  1  0  0  0  0\n 30 33  1  0  0  0  0\n 31 32  1  0  0  0  0\n 33 34  1  0  0  0  0\n 34 35  1  0  0  0  0\n 35 36  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)C(=O)OCC(CC)(COC(=O)C(CC)CCCC)COC(=O)C(CC)CCCC",
          "formula": "C30H56O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4d087b4c-a72a-47d0-b9e0-74047017e676"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "512.7632",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "dfce2c39-35dd-49e8-8c4f-a28d34afc7e2",
      "version": "5",
      "structure": {
        "id": "24c0e9e4-d84f-446e-9dfa-2529dbab97b2",
        "molfile": "\n  Marvin  01132102032D          \n\n 36 35  0  0  0  0            999 V2000\n    3.4539   -6.1257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2789   -6.1257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6937   -6.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2789   -7.5521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4539   -7.5521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0437   -8.2698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2187   -8.2698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5187   -6.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9289   -6.1257    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7539   -6.1257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1687   -5.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4510   -4.9978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7332   -5.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8820   -5.8228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5950   -5.4080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3128   -5.8228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0260   -5.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0260   -4.5830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7438   -4.1728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7438   -5.8228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4568   -5.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1701   -5.8228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8832   -5.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3128   -6.7477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5789   -4.6948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1687   -3.9770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5789   -3.2639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4039   -3.2639    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1687   -2.5508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3437   -2.5508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9289   -3.2639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5789   -1.8329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1687   -1.1199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5789   -0.4110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1687    0.3021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9289   -7.5521    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  3  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 16 24  2  0  0  0  0\n 25 11  1  0  0  0  0\n 25 26  1  0  0  0  0\n 27 26  1  0  0  0  0\n 27 28  2  0  0  0  0\n 27 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  1  0  0  0  0\n 29 32  1  0  0  0  0\n 32 33  1  0  0  0  0\n 33 34  1  0  0  0  0\n 34 35  1  0  0  0  0\n  8 36  2  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)C(=O)OCC(CC)(COC(=O)C(CC)CCCC)COC(=O)C(CC)CCCC",
        "formula": "C30H56O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "512.7632",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "cf0e3416-5533-4ef2-9494-6126c3234d59",
          "6bb1e556-4182-44b6-b605-1506917061c9"
        ],
        "stereo_centers": 3
      },
      "unii": "B952ZGW1IL"
    }
  ]
}