{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "0b3a96fd-433b-4713-9288-c1baf60eabed", "code": "1382749-08-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1382749-08-7", "code_system": "CAS", "references": [ "fc4f247b-95dd-401c-94da-4fe69a88b9b6", "06e81a60-547b-4780-8a69-c738d7d6b541" ] }, { "uuid": "dd6cc11e-756d-4aa3-91de-ed2663013af2", "code": "853126-60-0", "type": "NON-SPECIFIC STEREOCHEMISTRY", "url": "https://commonchemistry.cas.org/detail?cas_rn=853126-60-0", "code_system": "CAS", "references": [ "fc4f247b-95dd-401c-94da-4fe69a88b9b6", "f22b7a0a-960c-491a-9d7c-89db3e5c8da2" ] }, { "uuid": "d513fdde-f1cd-457f-ac06-301c737a225f", "code": "6068509", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6068509", "code_system": "PUBCHEM", "references": [ "fc4f247b-95dd-401c-94da-4fe69a88b9b6" ] }, { "uuid": "30c53171-f172-dc7c-919e-4e475dd113e0", "code": "2046111", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2046111/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "051b269c-30da-5c48-c37e-5623cb6792ce" ] }, { "uuid": "03cba6c0-825a-448c-bece-b4fa8f7ab7ad", "code": "B90L76CSCY", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "ac007b1d-de31-83cb-8b23-82c5cd80e9f5", "code": "B90L76CSCY", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=B90L76CSCY", "code_system": "DAILYMED", "references": [ "d4209b71-d43b-377d-fa40-c69cac02894b" ] } ], "substance_class": "chemical", "names": [ { "uuid": "0dc8dbad-d04e-4d6c-8d5b-74f2dfc26d04", "name": "BENZAMIDE, N-(3-ETHOXYPROPYL)-5-(((2E)-1-OXO-3-PHENYL-2-PROPEN-1-YL)AMINO)-2-(4-(PHENYLMETHYL)-1-PIPERIDINYL)-", "stdName": "BENZAMIDE, N-(3-ETHOXYPROPYL)-5-(((2E)-1-OXO-3-PHENYL-2-PROPEN-1-YL)AMINO)-2-(4-(PHENYLMETHYL)-1-PIPERIDINYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "eacb59f9-9d17-4858-8dd7-e26162e9448b", "ac78fa68-5563-4558-84dc-cc9e8e8f55cf" ], "display_name": false }, { "uuid": "9ea4be3a-7c09-441c-9e46-d4e0fc5baabc", "name": "CINNAMIDO BENZYLPIPERIDINYL ETHOXYPROPYLBENZAMIDE", "stdName": "CINNAMIDO BENZYLPIPERIDINYL ETHOXYPROPYLBENZAMIDE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "bd21f9a0-4a5d-4630-bab4-c2e81804d773", "61d7d41f-36ab-4e1b-93c2-fdd1f6d34451", "ac78fa68-5563-4558-84dc-cc9e8e8f55cf" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "73778654-7c10-4f88-967e-9eface6992c4", "name_org": "INCI" } ] } ], "references": [ { "uuid": "61d7d41f-36ab-4e1b-93c2-fdd1f6d34451", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "ac78fa68-5563-4558-84dc-cc9e8e8f55cf", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "eacb59f9-9d17-4858-8dd7-e26162e9448b", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fc4f247b-95dd-401c-94da-4fe69a88b9b6", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392818000, "tags": [ "NOMEN" ] }, { "uuid": "bcef86d5-b4f8-4931-abd6-10fc3d551ae0", "citation": "SRS import [B90L76CSCY]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=B90L76CSCY", "doc_type": "SRS", "public_domain": true, "document_date": 1493392818000, "tags": [ "NOMEN" ] }, { "uuid": "bd21f9a0-4a5d-4630-bab4-c2e81804d773", "citation": "CINNAMIDO BENZYLPIPERIDINYL ETHOXYPROPYLBENZAMIDE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "051b269c-30da-5c48-c37e-5623cb6792ce", "citation": "RXNORM", "doc_type": "NLM", "public_domain": true }, { "uuid": "f22b7a0a-960c-491a-9d7c-89db3e5c8da2", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "06e81a60-547b-4780-8a69-c738d7d6b541", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "d4209b71-d43b-377d-fa40-c69cac02894b", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "162e215c-93d5-4348-b968-ef70de9e6fab", "id": "162e215c-93d5-4348-b968-ef70de9e6fab", "molfile": "\n Marvin 01132101212D \n\n 39 42 0 0 0 0 999 V2000\n 8.3597 -5.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0742 -5.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7887 -5.5623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5031 -5.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2176 -5.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9321 -5.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6466 -5.5623 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3611 -5.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0756 -5.5623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3611 -6.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6466 -7.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6466 -8.0374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9321 -8.4499 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2176 -8.0374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2176 -7.2123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5031 -8.4499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7887 -8.0374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0742 -8.4499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0742 -9.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3597 -9.6874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6452 -9.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6452 -8.4499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3597 -8.0374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3611 -8.4499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0756 -8.0374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0756 -7.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7901 -6.7999 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7901 -5.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5046 -5.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2191 -5.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9336 -5.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6481 -5.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3625 -5.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0770 -5.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0770 -6.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3625 -7.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6481 -6.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2191 -6.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5046 -7.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 2 0 0 0 0\n 8 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 26 2 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 12 24 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 23 2 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 22 21 2 0 0 0 0\n 23 22 1 0 0 0 0\n 25 24 2 0 0 0 0\n 26 25 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 39 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 38 30 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 32 37 2 0 0 0 0\n 33 34 2 0 0 0 0\n 34 35 1 0 0 0 0\n 36 35 2 0 0 0 0\n 37 36 1 0 0 0 0\n 39 38 1 0 0 0 0\nM END", "smiles": "CCOCCCNC(=O)c1cc(ccc1N2CCC(CC2)Cc3ccccc3)NC(=O)/C=C/c4ccccc4", "formula": "C33H39N3O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "14a2b3ec-8f53-49eb-8251-880819cdf0cc" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "525.6823", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "d618c56e-3938-4e41-86a3-daac9d7afe74", "version": "6", "structure": { "id": "6d3f98aa-4847-434b-80cf-040053dd0c96", "molfile": "\n Marvin 01132105412D \n\n 39 42 0 0 0 0 999 V2000\n 13.3611 -5.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3611 -6.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6466 -7.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6466 -8.0374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9321 -8.4499 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2176 -8.0374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2176 -7.2123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5031 -8.4499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7887 -8.0374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0742 -8.4499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0742 -9.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3597 -9.6874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6452 -9.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6452 -8.4499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3597 -8.0374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3611 -8.4499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0756 -8.0374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0756 -7.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7901 -6.7999 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7901 -5.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5046 -5.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2191 -5.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9336 -5.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6481 -5.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3625 -5.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0770 -5.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0770 -6.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3625 -7.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6481 -6.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2191 -6.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5046 -7.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0756 -5.5623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6466 -5.5623 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9321 -5.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2176 -5.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5031 -5.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7887 -5.5623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0742 -5.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3597 -5.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 10 15 2 0 0 0 0\n 4 16 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 2 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 28 27 2 0 0 0 0\n 29 28 1 0 0 0 0\n 24 29 2 0 0 0 0\n 30 22 1 0 0 0 0\n 31 30 1 0 0 0 0\n 19 31 1 0 0 0 0\n 1 32 2 0 0 0 0\n 1 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 0 0 0 0\nM END", "smiles": "CCOCCCNC(=O)c1cc(ccc1N2CCC(CC2)Cc3ccccc3)NC(=O)/C=C/c4ccccc4", "formula": "C33H39N3O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "525.6823", "optical_activity": "NONE", "references": [ "eacb59f9-9d17-4858-8dd7-e26162e9448b", "bcef86d5-b4f8-4931-abd6-10fc3d551ae0" ], "stereo_centers": 0 }, "unii": "B90L76CSCY" } ] }