{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f960d7a0-4d7c-4dd2-8b47-a2d9cc02d37f",
          "code": "53148-31-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=53148-31-5",
          "code_system": "CAS",
          "references": [
            "515d30a7-3328-4a91-93d6-8ee199605d2c",
            "0c32cd53-3fff-4ee7-9fe5-9c094943c24a"
          ]
        },
        {
          "uuid": "2cb196bc-5841-4158-b008-584c53032495",
          "code": "19972291",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/19972291",
          "code_system": "PUBCHEM",
          "references": [
            "515d30a7-3328-4a91-93d6-8ee199605d2c"
          ]
        },
        {
          "uuid": "12049b66-3fe9-476d-9663-a0936ecfad72",
          "code": "B8N9FDD3RE",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "cec93b50-fba7-49b8-9f81-fa8a3a776326",
          "name": "1,4-CYCLOHEXANEDIOL BIS-ETHYLHEXANOATE",
          "stdName": "1,4-CYCLOHEXANEDIOL BIS-ETHYLHEXANOATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac49cbc6-2275-4ed0-92ed-06fab40f03ea",
            "b8277346-994e-444a-be6b-9dd119d2a372",
            "9dd6c325-d2c3-4fad-91fb-40ccc15317d1"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "645296b6-da17-4019-86cc-046606803057",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "1d5746c8-41c9-434c-8598-b81b0d933adb",
          "name": "HEXANOIC ACID, 2-ETHYL-, 1,4-CYCLOHEXANEDIYL ESTER",
          "stdName": "HEXANOIC ACID, 2-ETHYL-, 1,4-CYCLOHEXANEDIYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac49cbc6-2275-4ed0-92ed-06fab40f03ea",
            "a6801ab5-d972-4f91-a97d-049fa371f1b6"
          ],
          "display_name": false
        },
        {
          "uuid": "74d06a2e-b6f4-4170-8031-07937faecf74",
          "name": "HEXANOIC ACID, 2-ETHYL-, 1,4-CYCLOHEXYLENE ESTER",
          "stdName": "HEXANOIC ACID, 2-ETHYL-, 1,4-CYCLOHEXYLENE ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac49cbc6-2275-4ed0-92ed-06fab40f03ea",
            "a6801ab5-d972-4f91-a97d-049fa371f1b6"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b8277346-994e-444a-be6b-9dd119d2a372",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ac49cbc6-2275-4ed0-92ed-06fab40f03ea",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6801ab5-d972-4f91-a97d-049fa371f1b6",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "515d30a7-3328-4a91-93d6-8ee199605d2c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391401000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "392584f2-aaca-49e9-8f29-8d06526dce7f",
          "citation": "SRS import [B8N9FDD3RE]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=B8N9FDD3RE",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391401000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9dd6c325-d2c3-4fad-91fb-40ccc15317d1",
          "citation": "1,4-CYCLOHEXANEDIOL BIS-ETHYLHEXANOATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0c32cd53-3fff-4ee7-9fe5-9c094943c24a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3b9ab135-b3ee-4722-8fcc-5514c905ef0d",
          "id": "3b9ab135-b3ee-4722-8fcc-5514c905ef0d",
          "molfile": "\n  Marvin  01132103102D          \n\n 26 26  0  0  0  0            999 V2000\n    4.9934   -3.4931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7078   -3.0806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4223   -3.4931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1368   -3.0806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8512   -3.4931    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.8512   -4.3181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1368   -4.7306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5657   -3.0806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5657   -2.2555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2801   -3.4931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2801   -4.3181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5657   -4.7306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5657   -5.5556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2801   -5.9681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9946   -5.5556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9946   -4.7306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2801   -6.7931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9946   -7.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9946   -8.0306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7091   -6.7931    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   10.7091   -5.9681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4235   -5.5556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4235   -7.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1381   -6.7931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8525   -7.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5669   -6.7931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 16 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 17  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 23  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)C(=O)OC1CCC(CC1)OC(=O)C(CC)CCCC",
          "formula": "C22H40O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5a743472-ccab-4a1a-a272-df6eb4d51b03"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "368.5514",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4b5a1191-e0b7-4a82-9435-ca0f1c8efb66",
      "version": "3",
      "structure": {
        "id": "8c9381b6-5472-474d-a468-f9646881398e",
        "molfile": "\n  Marvin  01132107182D          \n\n 26 26  0  0  0  0            999 V2000\n    8.5657   -4.7306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2801   -4.3181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9946   -4.7306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9946   -5.5556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2801   -5.9681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5657   -5.5556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2801   -3.4931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2801   -6.7931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5657   -3.0806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9946   -7.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5657   -2.2555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9946   -8.0306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8512   -3.4931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1368   -3.0806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4223   -3.4931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7078   -3.0806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9934   -3.4931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7091   -6.7931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4235   -7.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1381   -6.7931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8525   -7.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5669   -6.7931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8512   -4.3181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1368   -4.7306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7091   -5.9681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4235   -5.5556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n 10 12  2  0  0  0  0\n  9 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 10 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 13 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 18 25  1  0  0  0  0\n 25 26  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)C(=O)OC1CCC(CC1)OC(=O)C(CC)CCCC",
        "formula": "C22H40O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "368.5514",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "392584f2-aaca-49e9-8f29-8d06526dce7f",
          "b8277346-994e-444a-be6b-9dd119d2a372"
        ],
        "stereo_centers": 2
      },
      "unii": "B8N9FDD3RE"
    }
  ]
}