{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "25251af7-9f32-4839-aef3-d8cf66046b79",
          "code": "6587-31-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6587-31-1",
          "code_system": "CAS",
          "references": [
            "74897acb-931a-4be7-a4df-31fe72702192",
            "37d5dfd3-002b-4ece-8411-fe449a64411e"
          ]
        },
        {
          "uuid": "613435e2-ed3d-4683-9adc-ce8e340aebc7",
          "code": "SUB181025",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "74897acb-931a-4be7-a4df-31fe72702192"
          ]
        },
        {
          "uuid": "628e83f1-a7d2-4450-a123-ec0e17d91c06",
          "code": "165512",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165512",
          "code_system": "PUBCHEM",
          "references": [
            "74897acb-931a-4be7-a4df-31fe72702192"
          ]
        },
        {
          "uuid": "ae248435-cf5e-a6ad-6ff7-be550b296dba",
          "code": "2607019",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2607019/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "6ffd2d88-6b69-b87b-4e1f-821698f400f2"
          ]
        },
        {
          "uuid": "182172de-5363-4955-ac47-df7ac7e5f948",
          "code": "B8CW1B3F6R",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5ad11e57-5d7a-06d2-a1ab-ad52330de57d",
          "code": "60948",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:60948",
          "code_system": "CHEBI",
          "references": [
            "e466557e-cc09-0193-83bc-a47cf2a13752"
          ]
        },
        {
          "uuid": "fd980515-97dd-7d2e-68d9-8ea6594754f2",
          "code": "100000166794",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "57ed5a00-dfc0-63dd-fbf3-8af5075ae083"
          ]
        },
        {
          "uuid": "b30261cc-3e26-85c0-b7e3-f8373ca2fd21",
          "code": "B8CW1B3F6R",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=B8CW1B3F6R",
          "code_system": "DAILYMED",
          "references": [
            "c52b7c92-1b4f-71e2-5d4d-b5e07914edb6"
          ]
        },
        {
          "uuid": "fca5e978-8fde-7c91-c86b-f3ec837169aa",
          "code": "DTXSID40891772",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40891772",
          "code_system": "EPA CompTox",
          "references": [
            "e466557e-cc09-0193-83bc-a47cf2a13752"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "38396fc0-39be-48bc-aa09-6374c7514f5c",
          "name": "4'-GALACTOSYLLACTOSE",
          "stdName": "4'-GALACTOSYLLACTOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58213633-8265-43e4-9211-7d3923edb0c9",
            "334f5181-eb2e-4151-8c09-96c47abf5cb4"
          ],
          "display_name": true
        },
        {
          "uuid": "7c0470ca-db0d-4260-a5ea-5af80a73c0f5",
          "name": "D-GLUCOSE, O-.BETA.-D-GALACTOPYRANOSYL-(1->4)-O-.BETA.-D-GALACTOPYRANOSYL-(1->4)-",
          "stdName": "D-GLUCOSE, O-.BETA.-D-GALACTOPYRANOSYL-(1->4)-O-.BETA.-D-GALACTOPYRANOSYL-(1->4)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58213633-8265-43e4-9211-7d3923edb0c9",
            "334f5181-eb2e-4151-8c09-96c47abf5cb4"
          ],
          "display_name": false
        },
        {
          "uuid": "2a34fac4-b1db-40e4-b51f-534603a0583f",
          "name": "GALACTOOLIGOSACCHARIDE",
          "stdName": "GALACTOOLIGOSACCHARIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0da6af72-d47e-44b1-9969-adc6c4168ee8",
            "334f5181-eb2e-4151-8c09-96c47abf5cb4"
          ],
          "display_name": false
        },
        {
          "uuid": "2383e16b-774c-4bf2-8549-8504d1d947e7",
          "name": "MUCOTRIOSE",
          "stdName": "MUCOTRIOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58213633-8265-43e4-9211-7d3923edb0c9",
            "334f5181-eb2e-4151-8c09-96c47abf5cb4"
          ],
          "display_name": false
        },
        {
          "uuid": "5b8e448d-962c-4be7-815f-a208f5dd9bf3",
          "name": "O-.BETA.-D-GALACTOPYRANOSYL-(1->4)-O-.BETA.-D-GALACTOPYRANOSYL-(1->4)-D-GLUCOSE",
          "stdName": "O-.BETA.-D-GALACTOPYRANOSYL-(1->4)-O-.BETA.-D-GALACTOPYRANOSYL-(1->4)-D-GLUCOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58213633-8265-43e4-9211-7d3923edb0c9",
            "334f5181-eb2e-4151-8c09-96c47abf5cb4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "58213633-8265-43e4-9211-7d3923edb0c9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "334f5181-eb2e-4151-8c09-96c47abf5cb4",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0da6af72-d47e-44b1-9969-adc6c4168ee8",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74897acb-931a-4be7-a4df-31fe72702192",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392206000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ffd2d88-6b69-b87b-4e1f-821698f400f2",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "37d5dfd3-002b-4ece-8411-fe449a64411e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e466557e-cc09-0193-83bc-a47cf2a13752",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c52b7c92-1b4f-71e2-5d4d-b5e07914edb6",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "57ed5a00-dfc0-63dd-fbf3-8af5075ae083",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8bb9d2af-9602-4212-9468-af6d682f3959",
          "id": "8bb9d2af-9602-4212-9468-af6d682f3959",
          "molfile": "\n  Marvin  01132107152D          \n\n 34 35  0  0  1  0            999 V2000\n    6.4231   -5.4603    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.4231   -4.6357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7085   -5.8726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9939   -5.4603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1377   -5.8726    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.1377   -6.6972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4231   -7.1094    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.7085   -6.6972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9939   -7.1094    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.2792   -6.6972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5646   -7.1094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9939   -7.9340    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.2792   -8.3463    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2792   -9.1708    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.9939   -9.5831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9939  -10.4077    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.7085  -10.8200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4231  -10.4077    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2792  -10.8200    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.2792  -11.6445    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5646  -10.4077    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.8500  -10.8200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5646   -9.5831    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.8500   -9.1708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7085   -8.3463    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.7085   -9.1708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4231   -7.9340    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.1377   -8.3463    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8523   -5.4603    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.8523   -4.6357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5669   -5.8726    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.5669   -6.6972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2816   -5.4603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9962   -5.8726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  6  0  0  0\n 29  5  1  0  0  0  0\n  7  6  1  1  0  0  0\n  7  8  1  0  0  0  0\n 27  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  1  0  0  0\n 12  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 13  1  1  0  0  0\n 25 12  1  0  0  0  0\n 14 13  1  6  0  0  0\n 14 15  1  0  0  0  0\n 23 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  6  0  0  0\n 19 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 20  1  6  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  6  0  0  0\n 21 23  1  0  0  0  0\n 23 24  1  1  0  0  0\n 25 26  1  1  0  0  0\n 27 25  1  0  0  0  0\n 27 28  1  6  0  0  0\n 29 30  1  6  0  0  0\n 31 29  1  0  0  0  0\n 31 32  1  6  0  0  0\n 31 33  1  0  0  0  0\n 34 33  2  0  0  0  0\nM  END",
          "smiles": "C(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O[C@H]2[C@@H]([C@H]([C@H]([C@@H](CO)O2)O)O)O)O)O)O)O",
          "formula": "C18H32O16",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "20c24d37-ceb8-4521-99d1-97b71b3341e7"
          },
          "defined_stereo": 14,
          "ez_centers": 0,
          "molecular_weight": "504.4378",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 14
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "16ac5b34-491e-434d-a88f-07d90b836509",
      "version": "10",
      "structure": {
        "id": "e91f0818-30dc-4bf2-8ad8-f8ac379b44b9",
        "molfile": "\n  Marvin  01132112042D          \n\n 34 35  0  0  1  0            999 V2000\n    9.9962   -5.8726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2816   -5.4603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5669   -5.8726    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.5669   -6.6972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8523   -5.4603    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.8523   -4.6357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1377   -5.8726    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.1377   -6.6972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4231   -7.1094    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4231   -7.9340    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.1377   -8.3463    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7085   -8.3463    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.7085   -9.1708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9939   -7.9340    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.2792   -8.3463    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2792   -9.1708    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.5646   -9.5831    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.8500   -9.1708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5646  -10.4077    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.8500  -10.8200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2792  -10.8200    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.2792  -11.6445    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9939  -10.4077    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.9939   -9.5831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7085  -10.8200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4231  -10.4077    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9939   -7.1094    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.7085   -6.6972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2792   -6.6972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5646   -7.1094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4231   -5.4603    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.4231   -4.6357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7085   -5.8726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9939   -5.4603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  6  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  6  0  0  0\n  9  8  1  1  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  6  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  1  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  1  0  0  0\n 16 15  1  6  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  1  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  6  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  6  0  0  0\n 21 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 16 24  1  0  0  0  0\n 23 25  1  6  0  0  0\n 25 26  1  0  0  0  0\n 14 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n  9 28  1  0  0  0  0\n 27 29  1  1  0  0  0\n 29 30  1  0  0  0  0\n  7 31  1  0  0  0  0\n 31 32  1  1  0  0  0\n 31 33  1  0  0  0  0\n 33 34  1  0  0  0  0\nM  END",
        "smiles": "C(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O[C@H]2[C@@H]([C@H]([C@H]([C@@H](CO)O2)O)O)O)O)O)O)O",
        "formula": "C18H32O16",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "EPIMERIC",
        "defined_stereo": 14,
        "ez_centers": 0,
        "molecular_weight": "504.4378",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "58213633-8265-43e4-9211-7d3923edb0c9"
        ],
        "stereo_centers": 14
      },
      "modifications": {
        "uuid": "b49b7cde-a26a-4e9b-982c-dffadce5923c"
      },
      "unii": "B8CW1B3F6R"
    }
  ]
}