{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ebc8e714-d20a-46bd-9155-d15f13cb8c4c",
          "code": "88671-89-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=88671-89-0",
          "code_system": "CAS",
          "references": [
            "3605eac5-7d11-4fee-bf13-da99b289d0dd",
            "cd0ed1c8-bc6d-4082-9875-d25514374835"
          ]
        },
        {
          "uuid": "d4a9cb8c-01d3-4769-805f-106d2247f571",
          "code": "128857",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2934",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "3605eac5-7d11-4fee-bf13-da99b289d0dd"
          ]
        },
        {
          "uuid": "688e4875-b52e-428d-b15d-a901b46623ff",
          "code": "m7676",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7676?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "3605eac5-7d11-4fee-bf13-da99b289d0dd"
          ]
        },
        {
          "uuid": "c6d90242-32d0-4ba3-9be7-37530c84cf88",
          "code": "6336",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6336",
          "code_system": "PUBCHEM",
          "references": [
            "3605eac5-7d11-4fee-bf13-da99b289d0dd"
          ]
        },
        {
          "uuid": "d0c76c90-6c5c-741e-df6a-cd7cb313416f",
          "code": "Myclobutanil",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Myclobutanil",
          "code_system": "WIKIPEDIA",
          "references": [
            "ba2cb181-0130-aa37-7b1d-4a1bca222b2f"
          ]
        },
        {
          "uuid": "58d70a0e-1c49-de46-7166-b9d7f161461f",
          "code": "6708",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6708",
          "code_system": "HSDB",
          "references": [
            "37e765ca-a9d8-e348-1ffa-fe1542003d5c"
          ]
        },
        {
          "uuid": "659a9936-c8e0-e2a5-8643-cde7d0bf6542",
          "code": "DTXSID8024315",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8024315",
          "code_system": "EPA CompTox",
          "references": [
            "a001690d-538e-5580-7461-21beefc3c751"
          ]
        },
        {
          "uuid": "25201028-43a9-43fe-b0e2-fdc72384c75a",
          "code": "B6T1JTM6KZ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0b06a480-9620-aad9-e290-311ca5b15b60",
          "code": "75281",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:75281",
          "code_system": "CHEBI",
          "references": [
            "d7ea87da-6b39-1def-80be-8695cf89bc20"
          ]
        },
        {
          "uuid": "2c5560fc-554e-ee9b-2b14-fdb9e3eb5371",
          "code": "myclobutanil",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/myclobutanil.html",
          "code_system": "ALANWOOD",
          "references": [
            "bbcb2d55-1da2-d6d7-fe86-8b0c144c33aa"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e9db910b-6c54-4985-b14e-1763b435c2bd",
          "name": "(±)-MYCLOBUTANIL [HSDB]",
          "stdName": "(+/-)-MYCLOBUTANIL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7c14802-8f19-4d60-82b9-56d9d6284fe0",
            "f1a2972b-25cf-4192-9df3-4b3c57589f7a"
          ],
          "display_name": false
        },
        {
          "uuid": "082e1b4d-7013-4c5c-944f-d79acd7752ae",
          "name": ".ALPHA.-BUTYL-.ALPHA.-(4-CHLOROPHENYL)-1H-1,2,4-TRIAZOLE-1- PROPANENITRILE",
          "stdName": ".ALPHA.-BUTYL-.ALPHA.-(4-CHLOROPHENYL)-1H-1,2,4-TRIAZOLE-1- PROPANENITRILE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7c14802-8f19-4d60-82b9-56d9d6284fe0",
            "f1a2972b-25cf-4192-9df3-4b3c57589f7a"
          ],
          "display_name": false
        },
        {
          "uuid": "5ed995e0-699b-4307-95fb-f960e56f55d6",
          "name": "1H-1,2,4-TRIAZOLE-1-PROPANENITRILE, .ALPHA.-BUTYL-.ALPHA.-(4- CHLOROPHENYL)-",
          "stdName": "1H-1,2,4-TRIAZOLE-1-PROPANENITRILE, .ALPHA.-BUTYL-.ALPHA.-(4- CHLOROPHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7c14802-8f19-4d60-82b9-56d9d6284fe0",
            "f1a2972b-25cf-4192-9df3-4b3c57589f7a"
          ],
          "display_name": false
        },
        {
          "uuid": "2be44c05-3b40-4d81-a301-c94791867193",
          "name": "2-(4-CHLOROPHENYL)-2-(1H-1,2,4-TRIAZOL-1- YLMETHYL)HEXANENITRILE",
          "stdName": "2-(4-CHLOROPHENYL)-2-(1H-1,2,4-TRIAZOL-1- YLMETHYL)HEXANENITRILE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7c14802-8f19-4d60-82b9-56d9d6284fe0",
            "f1a2972b-25cf-4192-9df3-4b3c57589f7a"
          ],
          "display_name": false
        },
        {
          "uuid": "97d4e67b-a2d4-400a-a948-9cb217c39cb3",
          "name": "2-P-CHLOROPHENYL-2-(1H-1,2,4-TRIAZOL-1- YLMETHYL)HEXANENITRILE",
          "stdName": "2-P-CHLOROPHENYL-2-(1H-1,2,4-TRIAZOL-1- YLMETHYL)HEXANENITRILE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7c14802-8f19-4d60-82b9-56d9d6284fe0",
            "f1a2972b-25cf-4192-9df3-4b3c57589f7a"
          ],
          "display_name": false
        },
        {
          "uuid": "1aabf3ae-25a6-4073-8b0b-ff7070e503cf",
          "name": "HOE 39304F",
          "stdName": "HOE 39304F",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7c14802-8f19-4d60-82b9-56d9d6284fe0",
            "f1a2972b-25cf-4192-9df3-4b3c57589f7a"
          ],
          "display_name": false
        },
        {
          "uuid": "aeec3955-3eb6-4052-b4c8-9abd71519f44",
          "name": "MYCLOBUTANIL",
          "stdName": "MYCLOBUTANIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7c14802-8f19-4d60-82b9-56d9d6284fe0",
            "ffc46a00-a2bd-4297-b4b8-37fe40f6713a",
            "d47accc2-a757-45e9-8d86-e68595bf9505",
            "f1a2972b-25cf-4192-9df3-4b3c57589f7a",
            "83f1bbfe-e843-4353-b5ec-85f37c7e069b"
          ],
          "display_name": true
        },
        {
          "uuid": "7ccfefe3-5cb4-4658-aff4-8e431f7bc4fd",
          "name": "MYCLOBUTANIL [ISO]",
          "stdName": "MYCLOBUTANIL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7c14802-8f19-4d60-82b9-56d9d6284fe0",
            "f1a2972b-25cf-4192-9df3-4b3c57589f7a"
          ],
          "display_name": false
        },
        {
          "uuid": "2e81f297-c7a1-4825-ac5e-5bc4918094d0",
          "name": "MYCLOBUTANIL [MI]",
          "stdName": "MYCLOBUTANIL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7c14802-8f19-4d60-82b9-56d9d6284fe0",
            "d47accc2-a757-45e9-8d86-e68595bf9505"
          ],
          "display_name": false
        },
        {
          "uuid": "c201be4b-6f74-404b-b8ec-69a985268584",
          "name": "NOVA",
          "stdName": "NOVA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7c14802-8f19-4d60-82b9-56d9d6284fe0",
            "f1a2972b-25cf-4192-9df3-4b3c57589f7a"
          ],
          "display_name": false
        },
        {
          "uuid": "de3b0d3e-3b9a-41fa-8906-dbd309e3da68",
          "name": "RALLY",
          "stdName": "RALLY",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7c14802-8f19-4d60-82b9-56d9d6284fe0",
            "f1a2972b-25cf-4192-9df3-4b3c57589f7a"
          ],
          "display_name": false
        },
        {
          "uuid": "b0ee12bb-a046-4fc9-b867-4ade4fc815dd",
          "name": "SYNTHANE 12E",
          "stdName": "SYNTHANE 12E",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7c14802-8f19-4d60-82b9-56d9d6284fe0",
            "f1a2972b-25cf-4192-9df3-4b3c57589f7a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f1a2972b-25cf-4192-9df3-4b3c57589f7a",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b7c14802-8f19-4d60-82b9-56d9d6284fe0",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d47accc2-a757-45e9-8d86-e68595bf9505",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3605eac5-7d11-4fee-bf13-da99b289d0dd",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392235000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34db7111-65ae-48f0-aa6d-9b09e6101152",
          "citation": "SRS import [B6T1JTM6KZ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=B6T1JTM6KZ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392235000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "83f1bbfe-e843-4353-b5ec-85f37c7e069b",
          "citation": "MYCLOBUTANIL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ffc46a00-a2bd-4297-b4b8-37fe40f6713a",
          "citation": "MYCLOBUTANIL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ba2cb181-0130-aa37-7b1d-4a1bca222b2f",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Systhane",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "37e765ca-a9d8-e348-1ffa-fe1542003d5c",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+88671-89-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a001690d-538e-5580-7461-21beefc3c751",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=88671-89-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bbcb2d55-1da2-d6d7-fe86-8b0c144c33aa",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "d7ea87da-6b39-1def-80be-8695cf89bc20",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "cd0ed1c8-bc6d-4082-9875-d25514374835",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6ad1e8fe-f72f-411c-897d-5effc1aac9ee",
          "id": "6ad1e8fe-f72f-411c-897d-5effc1aac9ee",
          "molfile": "\n  Marvin  01132105332D          \n\n 20 21  0  0  0  0            999 V2000\n   -2.9427   -0.6617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2357   -1.0796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5149   -0.6756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8079   -1.0935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0906   -0.6860    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -0.8010   -0.2717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8010    0.5502    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4521    0.9263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4521    1.6820    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1567    1.6820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1567    0.9263    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4910   -1.2641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1283   -1.8491    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6233   -0.2717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6268    0.5537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3408    0.9647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0511    0.5572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7650    0.9716    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.0547   -0.2717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3408   -0.6860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 12  1  0  0  0  0\n  5 14  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 11  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 13  3  0  0  0  0\n 14 15  1  0  0  0  0\n 14 20  2  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 17  2  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(C#N)(Cn1cncn1)c2ccc(cc2)Cl",
          "formula": "C15H17ClN4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4b1652d3-065a-45e2-88e2-34f7bbda8523"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "288.7758",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6166006e-a9e1-4741-945d-6e32513bcc78",
      "version": "9",
      "structure": {
        "id": "bd48553c-6a40-4e2c-9fc3-c8df42c6c0b3",
        "molfile": "\n  Marvin  01132109472D          \n\n 20 21  0  0  0  0            999 V2000\n   -0.0906   -0.6860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6233   -0.2717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8010   -0.2717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8079   -1.0935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4910   -1.2641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6268    0.5537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3408   -0.6860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8010    0.5502    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5149   -0.6756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1283   -1.8491    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3408    0.9647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0547   -0.2717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4521    0.9263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1567    0.9263    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2357   -1.0796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0511    0.5572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4521    1.6820    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1567    1.6820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9427   -0.6617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7650    0.9716    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  2  6  2  0  0  0  0\n  2  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  4  9  1  0  0  0  0\n  5 10  3  0  0  0  0\n  6 11  1  0  0  0  0\n  7 12  2  0  0  0  0\n  8 13  1  0  0  0  0\n  8 14  1  0  0  0  0\n  9 15  1  0  0  0  0\n 11 16  2  0  0  0  0\n 13 17  2  0  0  0  0\n 14 18  2  0  0  0  0\n 15 19  1  0  0  0  0\n 16 20  1  0  0  0  0\n 12 16  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(C#N)(Cn1cncn1)c2ccc(cc2)Cl",
        "formula": "C15H17ClN4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "288.7758",
        "optical_activity": "( + / - )",
        "references": [
          "34db7111-65ae-48f0-aa6d-9b09e6101152",
          "f1a2972b-25cf-4192-9df3-4b3c57589f7a"
        ],
        "stereo_centers": 1
      },
      "unii": "B6T1JTM6KZ"
    }
  ]
}