{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "07760ce3-230b-456c-835c-d90b7971e2d4",
          "code": "58864-81-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=58864-81-6",
          "code_system": "CAS",
          "references": [
            "3b095e32-1e84-4cf9-8ab0-e1c2393ea6be",
            "8824eb24-beee-49db-ada7-98de61c01a24"
          ]
        },
        {
          "uuid": "c659ac8f-333f-4ba6-907d-0ced9c53242e",
          "code": "C082032",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67082032",
          "code_system": "MESH",
          "references": [
            "3b095e32-1e84-4cf9-8ab0-e1c2393ea6be"
          ]
        },
        {
          "uuid": "703ea64f-4136-4b27-83cc-9c454d7151f1",
          "code": "ALPHA-TOCOTRIENOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Alpha-Tocotrienol",
          "code_system": "WIKIPEDIA",
          "references": [
            "3b095e32-1e84-4cf9-8ab0-e1c2393ea6be"
          ]
        },
        {
          "uuid": "6aa2c99c-9aca-43db-ba7f-ebe8eeca7857",
          "code": "m10928",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10928?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "3b095e32-1e84-4cf9-8ab0-e1c2393ea6be"
          ]
        },
        {
          "uuid": "2c70c007-35f8-4120-8557-cae391316fee",
          "code": "5282347",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5282347",
          "code_system": "PUBCHEM",
          "references": [
            "3b095e32-1e84-4cf9-8ab0-e1c2393ea6be"
          ]
        },
        {
          "uuid": "ba85f624-db21-a35f-d6d4-23ce450f7388",
          "code": "4152 (Number of products:7)",
          "comments": "Dietary Supplement Label Database|TBD|Vitamin E (alpha-tocotrienol)",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=4152&item=Vitamin E (alpha-tocotrienol)",
          "code_system": "DSLD",
          "references": [
            "913d7064-5851-7872-fdf0-8a9d1fa8a6a2"
          ]
        },
        {
          "uuid": "edd5d675-4c2a-467c-ad2d-6da9d5bc833f",
          "code": "B6LXL1832Y",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d284f1fb-0a6f-2502-90d3-6d5630195b00",
          "code": "2732 (Number of products:21)",
          "comments": "Dietary Supplement Label Database|vitamin|Vitamin E (alpha-tocotrienol",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2732&item=Vitamin E (alpha-tocotrienol",
          "code_system": "DSLD",
          "references": [
            "913d7064-5851-7872-fdf0-8a9d1fa8a6a2"
          ]
        },
        {
          "uuid": "85737a40-c793-5fd9-a05c-400dd5386f6a",
          "code": "33270",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:33270",
          "code_system": "CHEBI",
          "references": [
            "913d7064-5851-7872-fdf0-8a9d1fa8a6a2"
          ]
        },
        {
          "uuid": "e15ac55f-c92a-5a55-30ca-0cbc708d56fe",
          "code": "DTXSID901019976",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID901019976",
          "code_system": "EPA CompTox",
          "references": [
            "913d7064-5851-7872-fdf0-8a9d1fa8a6a2"
          ]
        },
        {
          "uuid": "4b6a9a60-6c43-869a-f155-fc000009bed8",
          "code": "100000174212",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "756c7b75-ac96-e6d9-d242-11a4335614be"
          ]
        },
        {
          "uuid": "f4a93d72-7c1b-42f0-57ce-d4529c6ff3d3",
          "code": "B6LXL1832Y",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=B6LXL1832Y",
          "code_system": "DAILYMED",
          "references": [
            "b3f8e9c2-519e-e9bc-bdcd-5857e79722ff"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2744363c-6b42-4c82-a5a2-4118dc4dc7b1",
          "name": "(2R)-2,5,7,8-TETRAMETHYL-2-((3E,7E)-4,8,12-TRIMETHYLTRIDECA-3,7,11-TRIENYL)CHROMAN-6-OL",
          "stdName": "(2R)-2,5,7,8-TETRAMETHYL-2-((3E,7E)-4,8,12-TRIMETHYLTRIDECA-3,7,11-TRIENYL)CHROMAN-6-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "811885d2-f867-4b95-8125-047a5270ab69"
          ],
          "display_name": false
        },
        {
          "uuid": "9cf40391-588a-4a77-9826-c628d2fd6cb8",
          "name": "(2R,3'E,7'E)-.ALPHA.-TOCOTRIENOL",
          "stdName": "(2R,3'E,7'E)-.ALPHA.-TOCOTRIENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d91c20e-782e-4553-8c56-73aa3583ea65"
          ],
          "display_name": false
        },
        {
          "uuid": "528772d4-d9dc-42bd-8cae-42f64c98d33f",
          "name": "(R)-.ALPHA.-TOCOTRIENOL",
          "stdName": "(R)-.ALPHA.-TOCOTRIENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d91c20e-782e-4553-8c56-73aa3583ea65"
          ],
          "display_name": false
        },
        {
          "uuid": "5573ccc0-0fbc-4ce7-99da-d44b999b5823",
          "name": ".ALPHA.-TOCOTRIENOL",
          "stdName": ".ALPHA.-TOCOTRIENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "811885d2-f867-4b95-8125-047a5270ab69",
            "5d6e470c-8a23-4f08-86de-ef4c5f5653a8",
            "2487547c-27ca-4b9e-bb98-be1ffbd2922f"
          ],
          "display_name": true
        },
        {
          "uuid": "5dcc75b3-47bf-42f1-97d1-18cc92d79f8d",
          "name": ".ALPHA.-TOCOTRIENOL [MI]",
          "stdName": ".ALPHA.-TOCOTRIENOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5d6e470c-8a23-4f08-86de-ef4c5f5653a8"
          ],
          "display_name": false
        },
        {
          "uuid": "6f45f843-9cc5-4811-8bc2-83334bba84cb",
          "name": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2,5,7,8-TETRAMETHYL-2-((3E,7E)-4,8,12-TRIMETHYL-3,7,11-TRIDECATRIENYL)-, (2R)-",
          "stdName": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2,5,7,8-TETRAMETHYL-2-((3E,7E)-4,8,12-TRIMETHYL-3,7,11-TRIDECATRIENYL)-, (2R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d91c20e-782e-4553-8c56-73aa3583ea65"
          ],
          "display_name": false
        },
        {
          "uuid": "41431eed-63ff-4fbf-b7b5-7a6610241756",
          "name": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2,5,7,8-TETRAMETHYL-2-(4,8,12-TRIMETHYL-3,7,11-TRIDECATRIENYL)-, (R-(E,E))-",
          "stdName": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2,5,7,8-TETRAMETHYL-2-(4,8,12-TRIMETHYL-3,7,11-TRIDECATRIENYL)-, (R-(E,E))-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d91c20e-782e-4553-8c56-73aa3583ea65"
          ],
          "display_name": false
        },
        {
          "uuid": "7cdb25e5-c1c2-4037-95ba-eb97e4e66094",
          "name": "ALPHA-TOCOTRIENOL",
          "stdName": "ALPHA-TOCOTRIENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99054830-e7b6-434c-8252-beec4f713e7c",
            "ebd91d3e-3945-4138-88e9-538925a4639b",
            "c4dc0d1c-63d0-4cc8-8f13-da560b45f168"
          ],
          "display_name": false
        },
        {
          "uuid": "8f52702e-9a95-4dc6-be50-0d6382226280",
          "name": "Alpha-Tocotrienol [WHO-DD]",
          "stdName": "ALPHA-TOCOTRIENOL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e265bf67-3a26-55ea-2a2a-bff6966905be"
          ],
          "display_name": false
        },
        {
          "uuid": "d7709bed-cf8c-46c2-a1f8-0e5eb3f9264d",
          "name": "D-.ALPHA.-TOCOTRIENOL",
          "stdName": "D-.ALPHA.-TOCOTRIENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d91c20e-782e-4553-8c56-73aa3583ea65"
          ],
          "display_name": false
        },
        {
          "uuid": "fd18762f-0ac3-549d-a69a-aa6bacda0c7f",
          "name": "D-ALPHA TOCOTRIENOL",
          "stdName": "D-ALPHA TOCOTRIENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1c5be7f-6d85-4853-852b-2976205125e2"
          ],
          "display_name": false
        },
        {
          "uuid": "f48ae3db-4211-2a45-1000-8998177480b3",
          "name": "VITAMIN E (ALPHA-TOCOTRIENOL)",
          "stdName": "VITAMIN E (ALPHA-TOCOTRIENOL)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43d11136-3a44-a706-aea6-b38fd1f9e761"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c4dc0d1c-63d0-4cc8-8f13-da560b45f168",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "811885d2-f867-4b95-8125-047a5270ab69",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d91c20e-782e-4553-8c56-73aa3583ea65",
          "citation": "STN 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5d6e470c-8a23-4f08-86de-ef4c5f5653a8",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99054830-e7b6-434c-8252-beec4f713e7c",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b095e32-1e84-4cf9-8ab0-e1c2393ea6be",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391127000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1c5be7f-6d85-4853-852b-2976205125e2",
          "citation": "SRS import [B6LXL1832Y]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=B6LXL1832Y",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391127000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2487547c-27ca-4b9e-bb98-be1ffbd2922f",
          "citation": ".ALPHA.-TOCOTRIENOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ebd91d3e-3945-4138-88e9-538925a4639b",
          "citation": "ALPHA-TOCOTRIENOL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "913d7064-5851-7872-fdf0-8a9d1fa8a6a2",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8824eb24-beee-49db-ada7-98de61c01a24",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "43d11136-3a44-a706-aea6-b38fd1f9e761",
          "citation": "https://dsld.od.nih.gov/dsld/index.jsp",
          "url": "https://dsld.od.nih.gov/dsld/index.jsp",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "b3f8e9c2-519e-e9bc-bdcd-5857e79722ff",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "e265bf67-3a26-55ea-2a2a-bff6966905be",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "756c7b75-ac96-e6d9-d242-11a4335614be",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f8275ed2-d3f1-4403-b107-1c2efcb86ffd",
          "id": "f8275ed2-d3f1-4403-b107-1c2efcb86ffd",
          "molfile": "\n  Marvin  01132112522D          \n\n 31 32  0  0  1  0            999 V2000\n   -0.7062   -6.6143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0725   -6.0886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2166   -5.2748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7006   -6.3670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3342   -5.8412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1118   -6.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7409   -5.5939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5963   -4.7752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5185   -5.8723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1474   -5.3420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9251   -5.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5587   -5.0941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4095   -4.2805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3318   -5.3776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9654   -4.8422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7385   -5.1303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3720   -4.5948    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.7385   -4.0641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7842   -5.3110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6087   -5.3110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0208   -4.5948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8453   -4.5948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2029   -5.2176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2622   -3.8835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0867   -3.8835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8453   -3.1675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2622   -2.4565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0208   -3.1675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6087   -2.4565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6087   -3.8835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7842   -3.8835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  6  0  0  0\n 17 19  1  0  0  0  0\n 17 31  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 21 30  2  0  0  0  0\n 22 23  1  0  0  0  0\n 24 22  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 24  1  0  0  0  0\n 27 26  1  0  0  0  0\n 26 28  2  0  0  0  0\n 29 28  1  0  0  0  0\n 28 30  1  0  0  0  0\n 31 30  1  0  0  0  0\nM  END",
          "smiles": "CC(=CCC/C(=C/CC/C(=C/CC[C@]1(C)CCc2c(C)c(c(C)c(C)c2O1)O)/C)/C)C",
          "formula": "C29H44O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1b256c9d-3c06-4002-a1f4-43ea4e7b2a47"
          },
          "defined_stereo": 1,
          "ez_centers": 2,
          "molecular_weight": "424.6595",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7e24d582-33e4-479d-ac41-a64746d6d1fb",
      "version": "14",
      "structure": {
        "id": "f47087ca-d46e-4197-85c2-8dc3d1b64a4d",
        "molfile": "\n  Marvin  01132112412D          \n\n 31 32  0  0  1  0            999 V2000\n    9.6087   -2.4565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0208   -3.1675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8453   -3.1675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2622   -3.8835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0867   -3.8835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8453   -4.5948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0208   -4.5948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6087   -5.3110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7842   -5.3110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3720   -4.5948    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.7385   -4.0641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7385   -5.1303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9654   -4.8422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3318   -5.3776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5587   -5.0941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4095   -4.2805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9251   -5.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1474   -5.3420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5185   -5.8723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7409   -5.5939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5963   -4.7752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1118   -6.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3342   -5.8412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7006   -6.3670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0725   -6.0886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7062   -6.6143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2166   -5.2748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7842   -3.8835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6087   -3.8835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2029   -5.2176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2622   -2.4565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  6  0  0  0\n 10 12  1  1  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 20  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  2  0  0  0  0\n 26 25  1  0  0  0  0\n 27 25  1  0  0  0  0\n 10 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n  7 29  1  0  0  0  0\n  2 29  2  0  0  0  0\n  6 30  1  0  0  0  0\n 31  3  1  0  0  0  0\nM  END",
        "smiles": "CC(=CCC/C(=C/CC/C(=C/CC[C@]1(C)CCc2c(C)c(c(C)c(C)c2O1)O)/C)/C)C",
        "formula": "C29H44O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 2,
        "molecular_weight": "424.6595",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "f1c5be7f-6d85-4853-852b-2976205125e2",
          "c4dc0d1c-63d0-4cc8-8f13-da560b45f168"
        ],
        "stereo_centers": 1
      },
      "unii": "B6LXL1832Y"
    }
  ]
}