{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "69b43ebb-863c-4188-8768-9b7ad2effefa",
          "code": "57524-50-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=57524-50-2",
          "code_system": "CAS",
          "references": [
            "ea583880-b11b-4672-8b5d-5eede49ae0ac",
            "ed80dde9-c3ef-446f-9cdf-5e8eb437693e"
          ]
        },
        {
          "uuid": "3eaf788b-e809-4583-b869-742e011ee3ad",
          "code": "310-204-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.100.118",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ea583880-b11b-4672-8b5d-5eede49ae0ac"
          ]
        },
        {
          "uuid": "7ca621ae-7026-41e7-8590-a47f49171034",
          "code": "C99807",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C99807",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ea583880-b11b-4672-8b5d-5eede49ae0ac"
          ]
        },
        {
          "uuid": "724a5008-88d5-414f-8184-9bbdc93e6a43",
          "code": "20234790",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/20234790",
          "code_system": "PUBCHEM",
          "references": [
            "ea583880-b11b-4672-8b5d-5eede49ae0ac"
          ]
        },
        {
          "uuid": "0cba312b-3a5a-8d8e-898f-3757d0205cd4",
          "code": "DTXSID10206132",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10206132",
          "code_system": "EPA CompTox",
          "references": [
            "50459a03-1406-9a72-1bf3-f043fc318a58"
          ]
        },
        {
          "uuid": "5bc6b8a7-e76e-0ac7-1f37-df34926665e8",
          "code": "C461",
          "comments": "Industrial Aid[C45678]|Dye",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C461",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5a15481b-1034-7082-39c7-10c2719f4b77"
          ]
        },
        {
          "uuid": "fc704bb9-e0fe-4336-adb5-37192c1d20f1",
          "code": "B5EP670141",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d221c4cc-acce-4f70-a941-0501c65034bb",
          "name": "9,10-ANTHRACENEDIONE, 2-((2-AMINOETHYL)AMINO)-, HYDROCHLORIDE",
          "stdName": "9,10-ANTHRACENEDIONE, 2-((2-AMINOETHYL)AMINO)-, HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "159907ca-aeb9-40f1-aabe-3445507b9941",
            "5e9cb629-2c30-4f15-934a-7061654766e6"
          ],
          "display_name": false
        },
        {
          "uuid": "4dab4b39-fe3e-4048-b1e9-4145839f255d",
          "name": "9,10-ANTHRACENEDIONE, 2-((2-AMINOETHYL)AMINO)-, MONOHYDROCHLORIDE",
          "stdName": "9,10-ANTHRACENEDIONE, 2-((2-AMINOETHYL)AMINO)-, MONOHYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "159907ca-aeb9-40f1-aabe-3445507b9941",
            "5e9cb629-2c30-4f15-934a-7061654766e6"
          ],
          "display_name": false
        },
        {
          "uuid": "4e544751-27b1-49ba-a8e1-34d3f86e195f",
          "name": "HC ORANGE 5",
          "stdName": "HC ORANGE 5",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "159907ca-aeb9-40f1-aabe-3445507b9941",
            "5e9cb629-2c30-4f15-934a-7061654766e6"
          ],
          "display_name": false
        },
        {
          "uuid": "e50cc842-dba8-44f5-a014-fcfba4b60729",
          "name": "HC ORANGE NO. 5",
          "stdName": "HC ORANGE NO. 5",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56597be7-ea67-4d62-90d8-c577787cacdc",
            "4b3caa2b-55b7-4363-9622-fcf4eb36e2ce",
            "159907ca-aeb9-40f1-aabe-3445507b9941"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f0743d07-f169-4039-8963-793284a7bbda",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "8f05bef7-b3e0-4247-9f4d-69968d221a22",
          "name": "IMEXINE BH",
          "stdName": "IMEXINE BH",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b3caa2b-55b7-4363-9622-fcf4eb36e2ce",
            "159907ca-aeb9-40f1-aabe-3445507b9941"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4b3caa2b-55b7-4363-9622-fcf4eb36e2ce",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "159907ca-aeb9-40f1-aabe-3445507b9941",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e9cb629-2c30-4f15-934a-7061654766e6",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea583880-b11b-4672-8b5d-5eede49ae0ac",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391502000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b17ca3a-24eb-4c4a-8abb-900a98effe17",
          "citation": "SRS import [B5EP670141]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=B5EP670141",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391502000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56597be7-ea67-4d62-90d8-c577787cacdc",
          "citation": "HC ORANGE NO. 5 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "50459a03-1406-9a72-1bf3-f043fc318a58",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=57524-50-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5a15481b-1034-7082-39c7-10c2719f4b77",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ed80dde9-c3ef-446f-9cdf-5e8eb437693e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "691e0325-0d53-4ef4-ac60-7b76413e97ac",
          "id": "691e0325-0d53-4ef4-ac60-7b76413e97ac",
          "molfile": "\n  Marvin  01132105282D          \n\n  1  0  0  0  0  0            999 V2000\n   10.4336   -7.6615    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "11669c7c-970c-4b0f-a8ee-391239381757"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "e599bb7d-ae6a-4e0a-9bbc-616aa1c00ea4",
          "id": "e599bb7d-ae6a-4e0a-9bbc-616aa1c00ea4",
          "molfile": "\n  Marvin  01132111532D          \n\n 20 22  0  0  0  0            999 V2000\n   13.4784   -5.3624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7631   -4.9515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0495   -5.3656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3342   -4.9547    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6206   -5.3688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6224   -6.1938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9089   -6.6078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1935   -6.1969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4800   -6.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4819   -7.4360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7647   -6.2001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0511   -6.6141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3357   -6.2032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3339   -5.3782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0475   -4.9642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7628   -5.3751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4763   -4.9610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4745   -4.1361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1917   -5.3719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9052   -4.9579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 20  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 19  2  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 16  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 17  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)C(=O)c3ccc(cc3C2=O)NCCN",
          "formula": "C16H14N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "65199fbb-c539-46b4-ae92-d8ad26ca6838"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "266.2952",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "832ae7ed-1c8f-49f9-9578-6db7bec55b58",
      "version": "5",
      "structure": {
        "id": "aa5a40a0-2069-4f0e-96c5-7f2fc4599b95",
        "molfile": "\n  Marvin  01132108502D          \n\n 21 22  0  0  0  0            999 V2000\n    6.3339   -5.3782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0475   -4.9642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7628   -5.3751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7647   -6.2001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0511   -6.6141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3357   -6.2032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4763   -4.9610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1917   -5.3719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1935   -6.1969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4800   -6.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9052   -4.9579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6206   -5.3688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6224   -6.1938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9089   -6.6078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4745   -4.1361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4819   -7.4360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3342   -4.9547    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0495   -5.3656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7631   -4.9515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4784   -5.3624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4336   -7.6615    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n  4 10  1  0  0  0  0\n  3  7  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n  9 14  1  0  0  0  0\n  8 11  1  0  0  0  0\n  7 15  2  0  0  0  0\n 10 16  2  0  0  0  0\n 12 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)C(=O)c3ccc(cc3C2=O)NCCN.Cl",
        "formula": "C16H14N2O2.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "302.756",
        "optical_activity": "NONE",
        "references": [
          "5e9cb629-2c30-4f15-934a-7061654766e6",
          "1b17ca3a-24eb-4c4a-8abb-900a98effe17"
        ],
        "stereo_centers": 0
      },
      "unii": "B5EP670141"
    }
  ]
}