{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "03490ffc-1a42-40fd-a6e5-9c194d4142e8", "code": "533681", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/533681", "code_system": "PUBCHEM", "references": [ "87aca4ef-940a-4695-99c0-2109653f332e" ] }, { "uuid": "a4ef6a86-2176-4124-902c-5e786d313d39", "code": "56750-76-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=56750-76-6", "code_system": "CAS", "references": [ "87aca4ef-940a-4695-99c0-2109653f332e", "9d76c85f-14c8-401a-bff2-48bb8e4d1bf1" ] }, { "uuid": "8cff1104-de70-4f86-a9a8-d895a2a51d2c", "code": "608502", "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL", "type": "PRIMARY", "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:846", "code_system": "EPA PESTICIDE CODE", "references": [ "87aca4ef-940a-4695-99c0-2109653f332e" ] }, { "uuid": "2f35fa1b-6d04-483f-8536-2f53fd69429d", "code": "B5732HV5JS", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "9d76c85f-14c8-401a-bff2-48bb8e4d1bf1" ] }, { "uuid": "bcd91507-1168-b2c5-f7ab-29b5f15e05c5", "code": "DTXSID7074741", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7074741", "code_system": "EPA CompTox", "references": [ "88a4311f-e592-0eea-a031-faa717639a13" ] } ], "substance_class": "chemical", "names": [ { "uuid": "c3299485-3676-4fcb-98d5-a6ae30d1a2c9", "name": "4-(Hydroxymethyl)pendimethalin", "stdName": "4-(HYDROXYMETHYL)PENDIMETHALIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9d76c85f-14c8-401a-bff2-48bb8e4d1bf1" ], "display_name": true }, { "uuid": "4b07ebe0-3999-4cf6-99fd-f79519bc3024", "name": "4-[(1-Ethylpropyl)amino]-2-methyl-3,5-dinitrobenzenemethanol", "stdName": "4-((1-ETHYLPROPYL)AMINO)-2-METHYL-3,5-DINITROBENZENEMETHANOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9d76c85f-14c8-401a-bff2-48bb8e4d1bf1" ], "display_name": false }, { "uuid": "967b3b85-f187-47f4-a22a-a08d700a46dd", "name": "Benzenemethanol, 4-[(1-ethylpropyl)amino]-2-methyl-3,5-dinitro-", "stdName": "BENZENEMETHANOL, 4-((1-ETHYLPROPYL)AMINO)-2-METHYL-3,5-DINITRO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9d76c85f-14c8-401a-bff2-48bb8e4d1bf1" ], "display_name": false }, { "uuid": "e2af04ef-ca67-4691-8044-99c5831c1bc4", "name": "Hydroxymethyl pendimethalin, 4-", "stdName": "HYDROXYMETHYL PENDIMETHALIN, 4-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "99ed1e14-b024-4169-bc04-65865cf0c6bd" ], "display_name": false } ], "references": [ { "uuid": "99ed1e14-b024-4169-bc04-65865cf0c6bd", "citation": "ICSAS BATCH 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "87aca4ef-940a-4695-99c0-2109653f332e", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390933000, "tags": [ "NOMEN" ] }, { "uuid": "87ce3a4a-b5a4-407d-9922-f9466b4d069c", "citation": "CHEMID 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "88a4311f-e592-0eea-a031-faa717639a13", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=56750-76-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "9d76c85f-14c8-401a-bff2-48bb8e4d1bf1", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "eafef579-8b11-4283-a0ac-8fbd2a057f4d", "id": "eafef579-8b11-4283-a0ac-8fbd2a057f4d", "molfile": "\n Marvin 01132112092D \n\n 21 21 0 0 0 0 999 V2000\n 5.2833 -2.8771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0931 -2.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8983 -2.8811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7083 -2.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5094 -2.8653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8983 -3.8079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9103 -4.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6176 -5.1209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6176 -5.9459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9103 -6.3646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9103 -7.1818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6078 -7.5861 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1981 -5.9617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4947 -6.3957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1981 -5.1486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4789 -4.7417 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 4.7714 -5.1645 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 5.2134 -3.8698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3489 -4.6868 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 8.3489 -3.8468 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 9.0332 -5.1097 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 6 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 15 2 0 0 0 0\n 9 8 2 0 0 0 0\n 8 19 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 13 10 2 0 0 0 0\n 11 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 13 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 2 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 2 0 0 0 0\nM CHG 4 16 1 17 -1 19 1 20 -1\nM END", "smiles": "CCC(CC)Nc1c(cc(CO)c(C)c1[N+](=O)[O-])[N+](=O)[O-]", "formula": "C13H19N3O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a81ff8ad-d709-4c3b-9e3b-48cc9d5410cb" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "297.3076", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "501ff84b-13b5-42be-8e3b-1d459bbcf3fa", "version": "5", "structure": { "id": "273e9d29-f3f3-46ff-9c18-48fbd69f623a", "molfile": "\n Marvin 01132102102D \n\n 21 21 0 0 0 0 999 V2000\n 6.9103 -4.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1981 -5.1486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1981 -5.9617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9103 -6.3646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9103 -7.1818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6078 -7.5861 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6176 -5.9459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6176 -5.1209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3489 -4.6868 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 8.3489 -3.8468 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 9.0332 -5.1097 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4947 -6.3957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4789 -4.7417 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 4.7714 -5.1645 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 5.2134 -3.8698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8983 -3.8079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8983 -2.8811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0931 -2.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2833 -2.8771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7083 -2.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5094 -2.8653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 4 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 1 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 2 0 0 0 0\n 3 12 1 0 0 0 0\n 2 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 2 0 0 0 0\n 1 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 17 20 1 0 0 0 0\n 20 21 1 0 0 0 0\nM CHG 4 9 1 10 -1 13 1 14 -1\nM END", "smiles": "CCC(CC)Nc1c(cc(CO)c(C)c1[N+](=O)[O-])[N+](=O)[O-]", "formula": "C13H19N3O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "297.3076", "optical_activity": "NONE", "references": [ "87ce3a4a-b5a4-407d-9922-f9466b4d069c" ], "stereo_centers": 0 }, "unii": "B5732HV5JS" } ] }