{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b19ea042-7336-41a3-b088-f523842972f2",
          "code": "15299-99-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=15299-99-7",
          "code_system": "CAS",
          "references": [
            "cccc6781-b85b-47d5-b9d6-2aab5c74da44",
            "904b947d-eaa3-4b4b-9a91-00c3b1bd3a17"
          ]
        },
        {
          "uuid": "a7ab672e-57fc-4701-a52e-99ba29f98fcc",
          "code": "103001",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3019",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "cccc6781-b85b-47d5-b9d6-2aab5c74da44"
          ]
        },
        {
          "uuid": "93238952-efb1-40dc-b6bd-ce4e8335d7fc",
          "code": "239-333-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.035.742",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "cccc6781-b85b-47d5-b9d6-2aab5c74da44"
          ]
        },
        {
          "uuid": "211d96db-68cd-4422-8d61-39192dd2e117",
          "code": "m7767",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7767?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "cccc6781-b85b-47d5-b9d6-2aab5c74da44"
          ]
        },
        {
          "uuid": "53ac9d91-3589-440d-8965-86679baf90ad",
          "code": "27189",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/27189",
          "code_system": "PUBCHEM",
          "references": [
            "cccc6781-b85b-47d5-b9d6-2aab5c74da44"
          ]
        },
        {
          "uuid": "09f9f5b2-fd13-2791-2d29-c363cc7aaf6c",
          "code": "6710",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6710",
          "code_system": "HSDB",
          "references": [
            "99cd066f-e122-8cd0-99e5-96034709f876"
          ]
        },
        {
          "uuid": "9015d7c7-d52b-6886-1338-53829a7ad63e",
          "code": "DTXSID5024211",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5024211",
          "code_system": "EPA CompTox",
          "references": [
            "989997ce-8f62-90c3-0ff2-fe3a3336cab6"
          ]
        },
        {
          "uuid": "a7c104e1-504a-401e-8142-4acd01f4538d",
          "code": "B56M9401K6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2dcf26ec-ff0f-8949-0f67-94fd40e42092",
          "code": "300000017393",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "bf91c8cb-39a6-7568-d245-56c37e52473d"
          ]
        },
        {
          "uuid": "ac73f2cb-f708-128e-1402-547a706c41ef",
          "code": "napropamide",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/napropamide.html",
          "code_system": "ALANWOOD",
          "references": [
            "83809ab0-5a37-de30-d42b-f30db0152a1c"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "18fd1034-d040-42ef-bfa5-ebf6095b34a6",
          "name": "2-(.ALPHA.-NAPHTHOXY)-N,N-DIETHYLPROPIONAMIDE",
          "stdName": "2-(.ALPHA.-NAPHTHOXY)-N,N-DIETHYLPROPIONAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50a87361-a6bd-4d99-afe7-db01c45bf476",
            "fc938b21-f34e-40b0-9964-884ed6c0ffd6"
          ],
          "display_name": false
        },
        {
          "uuid": "5e06f4c4-9143-4b59-8d0d-a9d5eab2eeab",
          "name": "2-(1-NAPHTHOXY)-N,N-DIETHYLPROPIONAMIDE",
          "stdName": "2-(1-NAPHTHOXY)-N,N-DIETHYLPROPIONAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50a87361-a6bd-4d99-afe7-db01c45bf476",
            "fc938b21-f34e-40b0-9964-884ed6c0ffd6"
          ],
          "display_name": false
        },
        {
          "uuid": "77172133-7f40-476d-8996-f1020a997996",
          "name": "DEVRINOL [HSDB]",
          "stdName": "DEVRINOL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50a87361-a6bd-4d99-afe7-db01c45bf476",
            "fc938b21-f34e-40b0-9964-884ed6c0ffd6"
          ],
          "display_name": false
        },
        {
          "uuid": "86a059a8-cfc0-4efc-9203-e9ec824d8eaa",
          "name": "DEVRINOL, (±)-",
          "stdName": "DEVRINOL, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50a87361-a6bd-4d99-afe7-db01c45bf476",
            "2cfc17f5-6820-40b4-b9d8-a4ef254f10e5"
          ],
          "display_name": false
        },
        {
          "uuid": "fc47dfdd-2b40-44ed-b7d0-a1bffb1ab445",
          "name": "N,N-DIETHYL-2-(1-NAPHTHALENYLOXY)PROPANAMIDE",
          "stdName": "N,N-DIETHYL-2-(1-NAPHTHALENYLOXY)PROPANAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50a87361-a6bd-4d99-afe7-db01c45bf476",
            "fc938b21-f34e-40b0-9964-884ed6c0ffd6"
          ],
          "display_name": false
        },
        {
          "uuid": "277c39e8-ec2c-4039-8b3b-ff3eaeef66b8",
          "name": "N,N-DIETHYL-2-(1-NAPHTHALENYLOXY)PROPIONAMIDE",
          "stdName": "N,N-DIETHYL-2-(1-NAPHTHALENYLOXY)PROPIONAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50a87361-a6bd-4d99-afe7-db01c45bf476",
            "fc938b21-f34e-40b0-9964-884ed6c0ffd6"
          ],
          "display_name": false
        },
        {
          "uuid": "76947fea-dcf0-4e2f-a718-5b29db4d2313",
          "name": "N,N-DIETHYL-2-(1-NAPHTHYLOXY)PROPIONAMIDE",
          "stdName": "N,N-DIETHYL-2-(1-NAPHTHYLOXY)PROPIONAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50a87361-a6bd-4d99-afe7-db01c45bf476",
            "fc938b21-f34e-40b0-9964-884ed6c0ffd6"
          ],
          "display_name": false
        },
        {
          "uuid": "84cfea5e-c426-4ee1-8194-e183363c8a7b",
          "name": "NAPROPAMID",
          "stdName": "NAPROPAMID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50a87361-a6bd-4d99-afe7-db01c45bf476",
            "fc938b21-f34e-40b0-9964-884ed6c0ffd6"
          ],
          "display_name": false
        },
        {
          "uuid": "1697f8ba-4f1b-4aab-8d9a-fdebff2d7d53",
          "name": "NAPROPAMIDE",
          "stdName": "NAPROPAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5d57f32-314f-4305-a7fb-d886264417a4",
            "50a87361-a6bd-4d99-afe7-db01c45bf476",
            "dd013f41-70f6-4a29-ab73-9f8083324504",
            "dfeceb0b-7068-469e-8906-3754a65eafe5",
            "3890d914-9778-440f-b04b-8a286671cf6f",
            "fc938b21-f34e-40b0-9964-884ed6c0ffd6"
          ],
          "display_name": true
        },
        {
          "uuid": "a41b609e-3cf8-4eeb-9475-6ced4b72411a",
          "name": "NAPROPAMIDE [ISO]",
          "stdName": "NAPROPAMIDE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50a87361-a6bd-4d99-afe7-db01c45bf476",
            "dfeceb0b-7068-469e-8906-3754a65eafe5"
          ],
          "display_name": false
        },
        {
          "uuid": "b21df961-b0fc-495d-9808-a92cea509f14",
          "name": "NAPROPAMIDE [MI]",
          "stdName": "NAPROPAMIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50a87361-a6bd-4d99-afe7-db01c45bf476",
            "dd013f41-70f6-4a29-ab73-9f8083324504"
          ],
          "display_name": false
        },
        {
          "uuid": "aeaacba5-df52-44d0-a918-b64b3e4ebd6e",
          "name": "PROPANAMIDE, N,N-DIETHYL-2-(1-NAPHTHALENYLOXY)-",
          "stdName": "PROPANAMIDE, N,N-DIETHYL-2-(1-NAPHTHALENYLOXY)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50a87361-a6bd-4d99-afe7-db01c45bf476",
            "fc938b21-f34e-40b0-9964-884ed6c0ffd6"
          ],
          "display_name": false
        },
        {
          "uuid": "b4f21fe6-dea1-45cc-aae3-5caa34bd20be",
          "name": "PROPIONAMIDE, N,N-DIETHYL-2-(1-NAPHTHYLOXY)-",
          "stdName": "PROPIONAMIDE, N,N-DIETHYL-2-(1-NAPHTHYLOXY)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50a87361-a6bd-4d99-afe7-db01c45bf476",
            "fc938b21-f34e-40b0-9964-884ed6c0ffd6"
          ],
          "display_name": false
        },
        {
          "uuid": "c35982d4-d2c1-4afb-b69c-18e0f2aad27a",
          "name": "RACEMIC DEVRINOL",
          "stdName": "RACEMIC DEVRINOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50a87361-a6bd-4d99-afe7-db01c45bf476",
            "2cfc17f5-6820-40b4-b9d8-a4ef254f10e5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "fc938b21-f34e-40b0-9964-884ed6c0ffd6",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "50a87361-a6bd-4d99-afe7-db01c45bf476",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2cfc17f5-6820-40b4-b9d8-a4ef254f10e5",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dfeceb0b-7068-469e-8906-3754a65eafe5",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd013f41-70f6-4a29-ab73-9f8083324504",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cccc6781-b85b-47d5-b9d6-2aab5c74da44",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392188000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "185a721a-9be7-47b7-827c-ae0b5dba6806",
          "citation": "SRS import [B56M9401K6]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=B56M9401K6",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392188000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5d57f32-314f-4305-a7fb-d886264417a4",
          "citation": "NAPROPAMIDE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3890d914-9778-440f-b04b-8a286671cf6f",
          "citation": "NAPROPAMIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "99cd066f-e122-8cd0-99e5-96034709f876",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+15299-99-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "989997ce-8f62-90c3-0ff2-fe3a3336cab6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=15299-99-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "83809ab0-5a37-de30-d42b-f30db0152a1c",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "904b947d-eaa3-4b4b-9a91-00c3b1bd3a17",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "bf91c8cb-39a6-7568-d245-56c37e52473d",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ee762adf-6d44-4cd9-8fcf-8b5ede2a7348",
          "id": "ee762adf-6d44-4cd9-8fcf-8b5ede2a7348",
          "molfile": "\n  Marvin  01132112212D          \n\n 20 21  0  0  0  0            999 V2000\n    3.0279   -1.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3120   -0.5953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6086   -1.0012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6086   -1.8107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3120   -2.2082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8865   -0.5953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8865    0.2204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1810   -1.0012    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.1769   -1.8606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5244   -0.5953    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5244    0.2204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1914    0.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1914    1.4564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5244    1.8665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2486    1.4564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9645    1.8665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6886    1.4564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6886    0.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9645    0.2204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2486    0.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  6  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 20 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 20 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
          "smiles": "CCN(CC)C(=O)C(C)Oc1cccc2ccccc21",
          "formula": "C17H21NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "33970d2b-4a5c-4589-af28-f21de1c3c047"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "271.3548",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "63d2f252-c29d-4995-ab2e-0821c3e79fdf",
      "version": "6",
      "structure": {
        "id": "b5fc4538-d6cb-4916-94f6-7cdc97fd0499",
        "molfile": "\n  Marvin  01132109252D          \n\n 20 21  0  0  0  0            999 V2000\n   -1.2486    0.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5244    0.2204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2486    1.4564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9645    0.2204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5244   -0.5953    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1914    0.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5244    1.8665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9645    1.8665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6886    0.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1810   -1.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1914    1.4564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6886    1.4564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8865   -0.5953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1769   -1.8606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6086   -1.0012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8865    0.2204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3120   -0.5953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6086   -1.8107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0279   -1.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3120   -2.2082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  2  0  0  0  0\n  3  8  1  0  0  0  0\n  4  9  2  0  0  0  0\n  5 10  1  0  0  0  0\n  6 11  2  0  0  0  0\n  8 12  2  0  0  0  0\n 10 13  1  0  0  0  0\n 10 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n  7 11  1  0  0  0  0\n  9 12  1  0  0  0  0\nM  END",
        "smiles": "CCN(CC)C(=O)C(C)Oc1cccc2ccccc21",
        "formula": "C17H21NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "271.3548",
        "optical_activity": "( + / - )",
        "references": [
          "185a721a-9be7-47b7-827c-ae0b5dba6806",
          "fc938b21-f34e-40b0-9964-884ed6c0ffd6"
        ],
        "stereo_centers": 1
      },
      "unii": "B56M9401K6"
    }
  ]
}