{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "edfae219-f3f0-4f9e-a79a-4e9ecadf1719",
          "code": "1,4-CINEOLE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=4716",
          "code_system": "JECFA EVALUATION",
          "references": [
            "35b78194-cc3f-4bb4-ab84-7172c86be63f"
          ]
        },
        {
          "uuid": "942b0434-9703-41a7-8534-3c17b1d22e8d",
          "code": "470-67-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=470-67-7",
          "code_system": "CAS",
          "references": [
            "35b78194-cc3f-4bb4-ab84-7172c86be63f",
            "73c43a7f-7013-4f95-9110-d12b08de4c72"
          ]
        },
        {
          "uuid": "94588993-b1d5-49b5-a780-c6bc90103ecb",
          "code": "C058951",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67058951",
          "code_system": "MESH",
          "references": [
            "35b78194-cc3f-4bb4-ab84-7172c86be63f"
          ]
        },
        {
          "uuid": "ce798075-0e0c-4344-ad61-8972845bd555",
          "code": "21 CFR 172.515",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart F--Flavoring Agents and Related Substances|Sec. 172.515 Synthetic flavoring substances and adjuvants.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=172.515",
          "code_system": "CFR",
          "references": [
            "35b78194-cc3f-4bb4-ab84-7172c86be63f"
          ]
        },
        {
          "uuid": "1d37b81e-e44c-401c-9bbc-34f5ed78db54",
          "code": "207-428-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.755",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "35b78194-cc3f-4bb4-ab84-7172c86be63f"
          ]
        },
        {
          "uuid": "3c9e4799-2d48-432f-b91f-2adb0401042f",
          "code": "10106",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10106",
          "code_system": "PUBCHEM",
          "references": [
            "35b78194-cc3f-4bb4-ab84-7172c86be63f"
          ]
        },
        {
          "uuid": "c4276524-d526-e502-b0fb-5f9a4771f257",
          "code": "5425",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5425",
          "code_system": "HSDB",
          "references": [
            "f8bfdedf-5ae7-edd5-b16f-8537c618815c"
          ]
        },
        {
          "uuid": "c397d1aa-f5b7-3749-01fb-8cc6d174dac7",
          "code": "DTXSID3047396",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3047396",
          "code_system": "EPA CompTox",
          "references": [
            "9297b763-c10e-6862-ffba-15d31035c99e"
          ]
        },
        {
          "uuid": "68081760-0a35-4105-9133-bdf7677ba8ee",
          "code": "B55JTU839B",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0ac6abca-b09d-3197-61bf-1f3f1a8260da",
          "code": "80788",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:80788",
          "code_system": "CHEBI",
          "references": [
            "acd97613-bfcb-7568-95b8-d1e14571a2f9"
          ]
        },
        {
          "uuid": "6b328042-2c50-936d-b010-0a337fd18b67",
          "code": "1242",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1242/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "08f57093-7b52-9d05-70d9-34ce4e381c0f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c5e52925-ff86-43d8-8f8a-609063c920ae",
          "name": "(±)-1,4-CINEOLE",
          "stdName": "(+/-)-1,4-CINEOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9228a08e-a69b-414e-a4cc-39f81eafe746"
          ],
          "display_name": false
        },
        {
          "uuid": "f3f94e41-b754-42ca-87bc-37560290e672",
          "name": "1,4-CINEOL",
          "stdName": "1,4-CINEOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0284944-d714-47cb-abc1-1a2d1f8f7ee6"
          ],
          "display_name": false
        },
        {
          "uuid": "ef0996cf-dfbe-486d-8153-030855508f9c",
          "name": "1,4-CINEOLE",
          "stdName": "1,4-CINEOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36c4247f-9903-4931-af1f-1ee43de4a5c5",
            "901e97ff-177e-4f74-bc1e-874a6f19b09b",
            "d2641540-da10-40c4-ace3-11a6d4265287"
          ],
          "display_name": true
        },
        {
          "uuid": "a0e2e2c9-31e1-40db-be7a-e69a18e40cc5",
          "name": "1,4-CINEOLE [FHFI]",
          "stdName": "1,4-CINEOLE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "901e97ff-177e-4f74-bc1e-874a6f19b09b"
          ],
          "display_name": false
        },
        {
          "uuid": "cad1784e-a8cf-4c19-b65f-99ab01d4826f",
          "name": "1,4-EPOXY-P-MENTHANE",
          "stdName": "1,4-EPOXY-P-MENTHANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3e569c9-7e46-4b7f-9bba-6a934de098ff",
            "d2641540-da10-40c4-ace3-11a6d4265287",
            "397a2cf1-fc23-4e3a-ad4f-ee94af0f1f71"
          ],
          "display_name": false
        },
        {
          "uuid": "0bc498e1-07ec-4695-960b-1c67e5e2be3f",
          "name": "1,4-EPOXY-P-MENTHANE [HSDB]",
          "stdName": "1,4-EPOXY-P-MENTHANE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "397a2cf1-fc23-4e3a-ad4f-ee94af0f1f71"
          ],
          "display_name": false
        },
        {
          "uuid": "1e5431c2-9db3-400e-bbf5-96677f1bbb03",
          "name": "1-METHYL-4-(1-METHYLETHYL)-7-OXABICYCLO(2.2.1)HEPTANE",
          "stdName": "1-METHYL-4-(1-METHYLETHYL)-7-OXABICYCLO(2.2.1)HEPTANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2641540-da10-40c4-ace3-11a6d4265287"
          ],
          "display_name": false
        },
        {
          "uuid": "c35d6862-2404-4f14-98b4-722a99f79545",
          "name": "7-OXABICYCLO(2.2.1)HEPTANE, 1-ISOPROPYL-4-METHYL-",
          "stdName": "7-OXABICYCLO(2.2.1)HEPTANE, 1-ISOPROPYL-4-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0284944-d714-47cb-abc1-1a2d1f8f7ee6"
          ],
          "display_name": false
        },
        {
          "uuid": "874cb79a-bb85-41ac-be1d-45029f60960c",
          "name": "7-OXABICYCLO(2.2.1)HEPTANE, 1-METHYL-4-(1-METHYLETHYL)-",
          "stdName": "7-OXABICYCLO(2.2.1)HEPTANE, 1-METHYL-4-(1-METHYLETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0284944-d714-47cb-abc1-1a2d1f8f7ee6"
          ],
          "display_name": false
        },
        {
          "uuid": "3d316915-4dd0-4984-b34f-af03e68830cf",
          "name": "FEMA NO. 3658",
          "stdName": "FEMA NO. 3658",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b252278a-55ed-4d66-bd48-5cd835edfe58"
          ],
          "display_name": false
        },
        {
          "uuid": "ad929b9c-53b1-4bb3-9535-b1c0014b292f",
          "name": "ISOCINEOLE",
          "stdName": "ISOCINEOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0284944-d714-47cb-abc1-1a2d1f8f7ee6"
          ],
          "display_name": false
        },
        {
          "uuid": "00b2f5ac-cced-47ce-8e87-74e29724ecd3",
          "name": "P-MENTHANE, 1,4-EPOXY-",
          "stdName": "P-MENTHANE, 1,4-EPOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0284944-d714-47cb-abc1-1a2d1f8f7ee6"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b252278a-55ed-4d66-bd48-5cd835edfe58",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9228a08e-a69b-414e-a4cc-39f81eafe746",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0284944-d714-47cb-abc1-1a2d1f8f7ee6",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d2641540-da10-40c4-ace3-11a6d4265287",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "901e97ff-177e-4f74-bc1e-874a6f19b09b",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "397a2cf1-fc23-4e3a-ad4f-ee94af0f1f71",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35b78194-cc3f-4bb4-ab84-7172c86be63f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391019000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de6e01be-2a9d-48ea-b877-f1d289b4c7aa",
          "citation": "SRS import [B55JTU839B]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=B55JTU839B",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391019000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36c4247f-9903-4931-af1f-1ee43de4a5c5",
          "citation": "1,4-CINEOLE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a3e569c9-7e46-4b7f-9bba-6a934de098ff",
          "citation": "1,4-EPOXY-P-MENTHANE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f8bfdedf-5ae7-edd5-b16f-8537c618815c",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+470-67-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9297b763-c10e-6862-ffba-15d31035c99e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=470-67-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "acd97613-bfcb-7568-95b8-d1e14571a2f9",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "73c43a7f-7013-4f95-9110-d12b08de4c72",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "08f57093-7b52-9d05-70d9-34ce4e381c0f",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1a28bd11-ac68-42c3-aeb5-128fbc0e9012",
          "id": "1a28bd11-ac68-42c3-aeb5-128fbc0e9012",
          "molfile": "\n  Marvin  01132101322D          \n\n 11 12  0  0  0  0            999 V2000\n    0.8144   -0.1032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4691   -0.6052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2312   -0.2890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3619   -1.4231    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.1587   -1.2096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1587   -2.0346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3619   -2.2481    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.7743   -2.9626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7785   -2.8315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7785   -2.0065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6482   -1.0121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 10  1  0  0  0  0\n  4 11  1  1  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 11  1  1  0  0  0\n 10  9  1  0  0  0  0\nM  END",
          "smiles": "CC(C)[C@@]12CC[C@@](C)(CC1)O2",
          "formula": "C10H18O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e4558dcc-c9d1-4c99-b3c7-6397cae88b80"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "154.2497",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a366368f-90f3-445b-96da-e1f3c5764f9a",
      "version": "6",
      "structure": {
        "id": "9ebdeb5e-a9cf-4fb2-bd21-a292e9986512",
        "molfile": "\n  Marvin  01132108152D          \n\n 11 12  0  0  1  0            999 V2000\n    1.3619   -1.4231    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.7785   -2.0065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7785   -2.8315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3619   -2.2481    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.7743   -2.9626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1587   -2.0346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1587   -1.2096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6482   -1.0121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4691   -0.6052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8144   -0.1032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2312   -0.2890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  1  7  1  0  0  0  0\n  4  8  1  1  0  0  0\n  1  8  1  1  0  0  0\n  1  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\nM  END",
        "smiles": "CC(C)[C@@]12CC[C@@](C)(CC1)O2",
        "formula": "C10H18O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "154.2497",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "de6e01be-2a9d-48ea-b877-f1d289b4c7aa",
          "b252278a-55ed-4d66-bd48-5cd835edfe58"
        ],
        "stereo_centers": 1
      },
      "unii": "B55JTU839B"
    }
  ]
}