{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "16b7a7b1-686d-4fd3-8ab7-e3512b0d16c5",
          "code": "4261-80-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4261-80-7",
          "code_system": "CAS",
          "references": [
            "af25ab1b-d9c8-42df-9668-8d19980679e7",
            "2afdba5e-c3da-40aa-b018-17be3129805f"
          ]
        },
        {
          "uuid": "95b123e9-7591-406f-bb5b-b25d0416213b",
          "code": "224-241-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.022.038",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "af25ab1b-d9c8-42df-9668-8d19980679e7"
          ]
        },
        {
          "uuid": "e5385bcc-f493-4cfd-b0c8-64cb4c21dc17",
          "code": "107251",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/107251",
          "code_system": "PUBCHEM",
          "references": [
            "af25ab1b-d9c8-42df-9668-8d19980679e7"
          ]
        },
        {
          "uuid": "1e1840d4-57de-4cfb-87f6-2adc7cfd3af8",
          "code": "B4U3S8T62D",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "521b8ad6-54fb-1bea-efcd-fbba89d7c3b6",
          "code": "DTXSID40962613",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40962613",
          "code_system": "EPA CompTox"
        }
      ],
      "relationships": [
        {
          "uuid": "c77af225-d86a-4b0f-8734-08d33f864569",
          "type": "RACEMATE->ENANTIOMER",
          "related_substance": {
            "uuid": "74ff98c6-c2be-4d87-b451-4ed1aef85081",
            "refuuid": "d2c363b1-509c-477d-b03f-80381df8c426",
            "name": "2-ETHYLHEXYL 2-PYRROLIDONE-5-CARBOXYLATE",
            "unii": "20I7290RTM",
            "linking_id": "20I7290RTM",
            "ref_pname": "2-ETHYLHEXYL 2-PYRROLIDONE-5-CARBOXYLATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c88d7438-fd95-4c17-9b85-326ab2f7bc2e",
          "name": "2-ETHYLHEXYL 2-PYRROLIDONE-5-CARBOXYLATE, (S)-",
          "stdName": "2-ETHYLHEXYL 2-PYRROLIDONE-5-CARBOXYLATE, (S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd5656b0-0c36-4505-9f2c-95b3178fb338"
          ],
          "display_name": false
        },
        {
          "uuid": "291067b0-183a-4adc-aaa0-39b8671aa9d3",
          "name": "2-ETHYLHEXYL 5-OXO-L-PROLINATE",
          "stdName": "2-ETHYLHEXYL 5-OXO-L-PROLINATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fee9452c-6666-42ae-8ae0-8fea8b773509"
          ],
          "display_name": false
        },
        {
          "uuid": "a34b6da9-8122-4829-b0ab-fd8eb0f947a2",
          "name": "2-ETHYLHEXYL PYROGLUTAMATE",
          "stdName": "2-ETHYLHEXYL PYROGLUTAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e3e0f82-f73d-4081-b638-eecd6370f513"
          ],
          "display_name": true
        },
        {
          "uuid": "0df68646-ed5d-4352-a800-c6ac1f509234",
          "name": "L-PROLINE, 5-OXO-, 2-ETHYLHEXYL ESTER",
          "stdName": "L-PROLINE, 5-OXO-, 2-ETHYLHEXYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e3e0f82-f73d-4081-b638-eecd6370f513"
          ],
          "display_name": false
        },
        {
          "uuid": "5462e4c5-61e5-47d9-bd22-ca0d249108fc",
          "name": "PROLINE, 5-OXO-, 2-ETHYLHEXYL ESTER, L-",
          "stdName": "PROLINE, 5-OXO-, 2-ETHYLHEXYL ESTER, L-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e3e0f82-f73d-4081-b638-eecd6370f513"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "fee9452c-6666-42ae-8ae0-8fea8b773509",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8e3e0f82-f73d-4081-b638-eecd6370f513",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd5656b0-0c36-4505-9f2c-95b3178fb338",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af25ab1b-d9c8-42df-9668-8d19980679e7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392004000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71badd34-cb3f-42a6-83f7-c4fc3868e2f9",
          "citation": "SRS import [B4U3S8T62D]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=B4U3S8T62D",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392004000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2afdba5e-c3da-40aa-b018-17be3129805f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "cf39d192-91f4-4e24-9702-0f44b71099fc",
          "id": "cf39d192-91f4-4e24-9702-0f44b71099fc",
          "molfile": "\n  Marvin  01132110422D          \n\n 17 17  0  0  1  0            999 V2000\n    1.3989   -1.1504    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    0.6888   -0.7314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0852   -1.2782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4190   -2.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.7624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2356   -1.9670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1588   -0.8166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2440    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8263   -1.2995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5790   -0.9658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2536   -1.4416    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.1684   -2.2582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8431   -2.7411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0064   -1.1078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6810   -1.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4266   -1.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1012   -1.7327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  6  1  0  0  0  0\n  1  7  1  1  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 14  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)COC(=O)[C@@H]1CCC(=O)N1",
          "formula": "C13H23NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "710cb28c-3072-4870-9e4b-0d744e007de9"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "241.3271",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2420d896-0807-437b-aa69-629142d40c5f",
      "version": "3",
      "structure": {
        "id": "4a6fb51d-be98-40cb-aa73-3d68fc277e6c",
        "molfile": "\n  Marvin  01132103542D          \n\n 17 17  0  0  1  0            999 V2000\n    1.2356   -1.9670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1588   -0.8166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4190   -2.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3989   -1.1504    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.8263   -1.2995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2440    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.7624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6888   -0.7314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0852   -1.2782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5790   -0.9658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2536   -1.4416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1684   -2.2582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0064   -1.1078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4266   -1.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6810   -1.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8431   -2.7411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1012   -1.7327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  3  1  0  0  0  0\n  4  1  1  1  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  2  0  0  0  0\n  3  7  2  0  0  0  0\n  3  9  1  0  0  0  0\n  4  8  1  0  0  0  0\n  5 10  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 12 16  1  0  0  0  0\n 13 15  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 17  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)COC(=O)[C@@H]1CCC(=O)N1",
        "formula": "C13H23NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "EPIMERIC",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "241.3271",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "fee9452c-6666-42ae-8ae0-8fea8b773509",
          "71badd34-cb3f-42a6-83f7-c4fc3868e2f9"
        ],
        "stereo_centers": 2
      },
      "unii": "B4U3S8T62D"
    }
  ]
}