{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "753ba13c-780d-40fc-aac0-d9c74084a53f",
          "code": "58543-16-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=58543-16-1",
          "code_system": "CAS",
          "references": [
            "4d3151bf-3ba7-4c96-b91d-42eb5cb27a5c",
            "b2d6d315-aeb9-40fb-b13e-a4e6727f8d00"
          ]
        },
        {
          "uuid": "b255dc64-2072-410b-a2e5-be71ca46e0d3",
          "code": "C025474",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67025474",
          "code_system": "MESH",
          "references": [
            "4d3151bf-3ba7-4c96-b91d-42eb5cb27a5c"
          ]
        },
        {
          "uuid": "56402e23-f207-42b0-bfaf-c43b1c975a33",
          "code": "INS-960A",
          "comments": "Codex Alimentarius|Functional Classification|Sweetener",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=405",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "4d3151bf-3ba7-4c96-b91d-42eb5cb27a5c"
          ]
        },
        {
          "uuid": "c3ae2f06-5f05-456a-8404-66979601b694",
          "code": "INS-960A",
          "comments": "JECFA|Functional Classification|Sweetener",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=270",
          "code_system": "JECFA EVALUATION",
          "references": [
            "4d3151bf-3ba7-4c96-b91d-42eb5cb27a5c"
          ]
        },
        {
          "uuid": "9f371dbb-69d2-4dcc-9b7e-6a54669b888b",
          "code": "1667222",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1667222/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "4d3151bf-3ba7-4c96-b91d-42eb5cb27a5c"
          ]
        },
        {
          "uuid": "2c0fc75b-21bb-4a91-bcc3-39fcd60ea844",
          "code": "m9513",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9513?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4d3151bf-3ba7-4c96-b91d-42eb5cb27a5c"
          ]
        },
        {
          "uuid": "fa2ffd3b-ca2c-4c52-b6a8-73fbad85b748",
          "code": "SUB131052",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4d3151bf-3ba7-4c96-b91d-42eb5cb27a5c"
          ]
        },
        {
          "uuid": "b0ecc6b8-5ec1-45a0-9e24-50174bdb9312",
          "code": "6918840",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6918840",
          "code_system": "PUBCHEM",
          "references": [
            "4d3151bf-3ba7-4c96-b91d-42eb5cb27a5c"
          ]
        },
        {
          "uuid": "2bec450c-377f-ee7c-62dc-1eaf3c1b2508",
          "code": "282",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=282",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "9fac60e2-9b37-810c-3d64-0da39de323eb"
          ]
        },
        {
          "uuid": "06c46352-08e0-cfbd-b95d-5c063043e4a8",
          "code": "DTXSID8047898",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8047898",
          "code_system": "EPA CompTox",
          "references": [
            "099b330e-3a71-aa02-8051-7a1cabb09909"
          ]
        },
        {
          "uuid": "46189dfc-bd35-6e8a-366e-f86fcdb9f9cd",
          "code": "DB15136",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB15136",
          "code_system": "DRUG BANK",
          "references": [
            "9fac60e2-9b37-810c-3d64-0da39de323eb"
          ]
        },
        {
          "uuid": "0dddcf5c-31eb-40d7-b6dd-7736095bf306",
          "code": "B3FUD0528F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "28b765a3-1916-1209-19d7-70dc2e51d39c",
          "code": "145012",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:145012",
          "code_system": "CHEBI",
          "references": [
            "9fac60e2-9b37-810c-3d64-0da39de323eb"
          ]
        },
        {
          "uuid": "e9f5e203-444d-a30f-8c1c-d10225724d0f",
          "code": "1600121",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1600121",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "9fac60e2-9b37-810c-3d64-0da39de323eb"
          ]
        },
        {
          "uuid": "432c6cf8-12e7-5de4-c7fb-24d0160ff386",
          "code": "B3FUD0528F",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=B3FUD0528F",
          "code_system": "DAILYMED",
          "references": [
            "b9be67ea-75a6-62f7-6ffc-74a6f7e52b16"
          ]
        },
        {
          "uuid": "65daf981-834a-fe0d-4535-333b5dad2785",
          "code": "100000156901",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "3ac89834-3942-d955-5b33-4e71a7c24e01"
          ]
        },
        {
          "uuid": "f60c5da6-0e27-2112-888c-158a5a13c031",
          "code": "252",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=252",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "9fac60e2-9b37-810c-3d64-0da39de323eb"
          ]
        },
        {
          "uuid": "670cb8c1-07e1-cbfc-779b-17ea90cafe77",
          "code": "253",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=253",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "9fac60e2-9b37-810c-3d64-0da39de323eb"
          ]
        },
        {
          "uuid": "283f2474-ad80-f364-9fc4-1bbc6c8679f2",
          "code": "278",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=278",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "9fac60e2-9b37-810c-3d64-0da39de323eb"
          ]
        },
        {
          "uuid": "e6a14f47-168c-0732-e517-91ad92394a29",
          "code": "354",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=354",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "9fac60e2-9b37-810c-3d64-0da39de323eb"
          ]
        },
        {
          "uuid": "cb22ffc0-a534-701f-5d0a-f5f63d7f6bc4",
          "code": "388",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=388",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "9fac60e2-9b37-810c-3d64-0da39de323eb"
          ]
        },
        {
          "uuid": "f09d2214-5c36-5b3a-7874-f33a791a9745",
          "code": "369",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=369",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "9fac60e2-9b37-810c-3d64-0da39de323eb"
          ]
        },
        {
          "uuid": "71e8041c-1f72-fd52-1552-d9566e61bed2",
          "code": "393",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=393",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "9fac60e2-9b37-810c-3d64-0da39de323eb"
          ]
        },
        {
          "uuid": "01c368f7-2a72-f5be-0dfa-daf1e46ae0cc",
          "code": "329",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=329",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "9fac60e2-9b37-810c-3d64-0da39de323eb"
          ]
        },
        {
          "uuid": "eab982f6-817a-63fa-4dbd-8c96df36ebd5",
          "code": "303",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=303",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "9fac60e2-9b37-810c-3d64-0da39de323eb"
          ]
        },
        {
          "uuid": "e0ae991f-0b4e-7ae7-d645-2bd4e10b9e53",
          "code": "380",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=380",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "9fac60e2-9b37-810c-3d64-0da39de323eb"
          ]
        },
        {
          "uuid": "94eff208-6c15-30bc-6008-361d64cd2341",
          "code": "461",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=461",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "9fac60e2-9b37-810c-3d64-0da39de323eb"
          ]
        },
        {
          "uuid": "3d69a0a6-b497-1c97-fbc7-aa8aa0262afa",
          "code": "467",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=467",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "9fac60e2-9b37-810c-3d64-0da39de323eb"
          ]
        },
        {
          "uuid": "acddf3e7-af35-8215-766e-fe5fe87d7bd0",
          "code": "418",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=418",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "9fac60e2-9b37-810c-3d64-0da39de323eb"
          ]
        },
        {
          "uuid": "bbfa022d-c6d4-b95b-7750-7df5b9b78b7d",
          "code": "632",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=632",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "9fac60e2-9b37-810c-3d64-0da39de323eb"
          ]
        },
        {
          "uuid": "343a8396-00d3-df8e-15ac-ee183681792d",
          "code": "318",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=318",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "9fac60e2-9b37-810c-3d64-0da39de323eb"
          ]
        },
        {
          "uuid": "a12fb036-7478-0ee9-19aa-ad647480e05b",
          "code": "365",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=365",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "9fac60e2-9b37-810c-3d64-0da39de323eb"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "805907d3-9d87-465e-9d7d-fa4175f9842f",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2f1cd316-d36f-46bd-874b-239605af2c0c",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd280bda-774d-4ea8-997d-20245984a82b",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc201545-ffe8-4438-8518-20a5ad5de2b4",
          "citation": "http://www.ift.org/knowledge-center/focus-areas/product-development-and-ingredient-innovations/~/med",
          "url": "http://www.ift.org/knowledge-center/focus-areas/product-development-and-ingredient-innovations/~/med",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "996712ee-f299-4941-adc1-97a411cd7129",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "32d270d1-6f02-470f-9adc-c64e1516a4d6",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9164e60e-e548-481c-9819-fa6cc8e9fd66",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "54857d47-a8ed-4a4a-967f-ca1df2fc3e78",
          "citation": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=405",
          "url": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=405",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4d3151bf-3ba7-4c96-b91d-42eb5cb27a5c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391210000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6abf21fd-1609-485e-b3bd-109c2ae25f94",
          "citation": "KAKIGI, Y ET AL, CLASSIFICATION OF STEVIA SWEETENERS IN SOFT DRINKS USING LIQUID CHROMATOGRAPHY AND TIME-OF-FLIGHT MASS SPECTROMETRY, FOOD ADDITIVES & CONTAMINANTS. PART A., 30(12)2043-2049, 2013",
          "url": "http://www.tandfonline.com/doi/pdf/10.1080/19440049.2013.843101",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00d7fbd3-e5c3-43c7-82d1-936be07f1af2",
          "citation": "SRS import [B3FUD0528F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=B3FUD0528F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391210000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1241c0e0-3e01-4d9b-b211-f0fc611e72fd",
          "citation": "REBAUDIOSIDE A [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c277444b-06d2-48a4-a900-67b5dab6bad4",
          "citation": "REBAUDIOSIDE A [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a02f8678-bb12-4f95-b494-3100116fcd02",
          "citation": "REBAUDIOSIDE A [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6dd2ef53-f91e-4e67-84a8-ad2f424b294a",
          "citation": "REBAUDIOSIDE A [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "099b330e-3a71-aa02-8051-7a1cabb09909",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=58543-16-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9fac60e2-9b37-810c-3d64-0da39de323eb",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b2d6d315-aeb9-40fb-b13e-a4e6727f8d00",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4b7180e5-6d48-46bd-9c2e-6f6d0bf7e75d",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b9be67ea-75a6-62f7-6ffc-74a6f7e52b16",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "3ac89834-3942-d955-5b33-4e71a7c24e01",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3c19a832-106b-4cd1-ab3e-efcf827e0b8e",
          "id": "3c19a832-106b-4cd1-ab3e-efcf827e0b8e",
          "molfile": "\n  Marvin  01132103112D          \n\n 67 74  0  0  1  0            999 V2000\n    4.2410  -12.0267    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.4159  -12.0267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9922  -12.7275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6578  -11.3311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4841  -11.3311    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.9053  -10.6208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7029  -10.6208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3897  -11.3129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9188   -9.6165    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.4814  -10.5278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2267   -9.1923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2267   -8.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9447   -7.9820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6281   -8.3974    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.6281   -7.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3535   -7.9928    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.3535   -7.1703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0725   -6.7652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7875   -7.1764    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.7875   -8.0034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0583   -8.4128    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.7707   -8.8240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5410   -7.6276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3439   -7.4362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0583   -9.2309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3371   -9.6347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6281   -9.2147    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.9372   -5.9613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3578   -5.3817    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.6408   -5.7871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9339   -5.3693    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.2110   -5.7772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5019   -5.3565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9339   -4.5486    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.1315   -4.3295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6550   -4.1392    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.6550   -3.3149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8669   -3.1034    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.1522   -3.5135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4418   -3.1034    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.7253   -3.5188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0074   -3.1034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4418   -2.2790    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.7234   -1.8712    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1522   -1.8647    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.1522   -1.0361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8669   -2.2790    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.5811   -1.8712    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3578   -4.5547    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.0861   -4.1446    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9113   -4.1446    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   11.3149   -3.4368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1425   -3.4368    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   12.5600   -2.7218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3852   -2.7218    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5561   -4.1509    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   13.3814   -4.1509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1375   -4.8635    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   12.5494   -5.5793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3160   -4.8635    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.8161   -5.5582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8939  -12.0450    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.7191  -12.0450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4682  -12.7451    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.8743  -13.4757    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6418  -12.7451    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.2225  -13.4564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n 66  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n 62  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  1  0  0  0\n  9 11  1  0  0  0  0\n 27  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  6  0  0  0\n 14 16  1  0  0  0  0\n 27 14  1  0  0  0  0\n 16 17  1  6  0  0  0\n 16 21  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  6  0  0  0\n 19 23  1  0  0  0  0\n 19 28  1  0  0  0  0\n 21 20  1  6  0  0  0\n 21 22  1  0  0  0  0\n 21 25  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  2  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  6  0  0  0\n 29 28  1  6  0  0  0\n 29 30  1  0  0  0  0\n 49 29  1  0  0  0  0\n 31 30  1  0  0  0  0\n 31 32  1  6  0  0  0\n 31 34  1  0  0  0  0\n 32 33  1  0  0  0  0\n 34 35  1  1  0  0  0\n 34 36  1  0  0  0  0\n 36 37  1  6  0  0  0\n 36 49  1  0  0  0  0\n 38 37  1  6  0  0  0\n 38 39  1  0  0  0  0\n 47 38  1  0  0  0  0\n 40 39  1  0  0  0  0\n 40 41  1  6  0  0  0\n 43 40  1  0  0  0  0\n 41 42  1  0  0  0  0\n 43 44  1  1  0  0  0\n 45 43  1  0  0  0  0\n 45 46  1  6  0  0  0\n 45 47  1  0  0  0  0\n 47 48  1  1  0  0  0\n 49 50  1  1  0  0  0\n 51 50  1  6  0  0  0\n 51 52  1  0  0  0  0\n 51 60  1  0  0  0  0\n 53 52  1  0  0  0  0\n 53 54  1  6  0  0  0\n 56 53  1  0  0  0  0\n 54 55  1  0  0  0  0\n 56 57  1  1  0  0  0\n 58 56  1  0  0  0  0\n 58 59  1  6  0  0  0\n 60 58  1  0  0  0  0\n 60 61  1  1  0  0  0\n 62 63  1  6  0  0  0\n 62 64  1  0  0  0  0\n 64 65  1  1  0  0  0\n 64 66  1  0  0  0  0\n 66 67  1  6  0  0  0\nM  END",
          "smiles": "C=C1C[C@]23CC[C@H]4[C@@](C)(CCC[C@@]4(C)C(=O)O[C@H]5[C@@H]([C@H]([C@@H]([C@@H](CO)O5)O)O)O)[C@@H]3CC[C@@]1(C2)O[C@H]6[C@@H]([C@H]([C@@H]([C@@H](CO)O6)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@@H](CO)O7)O)O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@@H](CO)O8)O)O)O",
          "formula": "C44H70O23",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9304518f-bf2e-4909-bade-7565001366c6"
          },
          "defined_stereo": 26,
          "ez_centers": 0,
          "molecular_weight": "967.0145",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 26
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d0ba1584-cbde-40a9-8786-27ab34a65d5b",
      "version": "32",
      "structure": {
        "id": "89a895e2-bc19-40f9-9d33-d07cc604de20",
        "molfile": "\n  Marvin  01132107092D          \n\n 72 79  0  0  1  0            999 V2000\n    6.4418   -2.2790    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.4418   -3.1034    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.1522   -3.5135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8669   -3.1034    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.8669   -2.2790    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.1522   -1.8647    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.1522   -1.0361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7253   -3.5188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7234   -1.8712    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5811   -1.8712    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6550   -3.3149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6550   -4.1392    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.9339   -4.5486    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.9339   -5.3693    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.6408   -5.7871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3578   -5.3817    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.3578   -4.5547    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.0074   -3.1034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1315   -4.3295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0861   -4.1446    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3578   -6.0992    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9372   -5.9613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0725   -6.7652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3535   -7.1703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7875   -8.0034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7875   -7.1764    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.5410   -7.6276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7707   -8.8240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3439   -7.4362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0583   -8.4128    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.3535   -7.9928    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.3371   -9.6347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0583   -9.2309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6281   -9.2147    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.6281   -8.3974    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.9447   -7.9820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2267   -8.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2267   -9.1923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9188   -9.6165    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.2110   -5.7772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5019   -5.3565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9113   -4.1446    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.3160   -4.8635    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.1375   -4.8635    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.5561   -4.1509    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.1425   -3.4368    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.3149   -3.4368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6281   -7.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3535   -8.8199    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4844   -3.4375    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8161   -5.5582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3814   -4.1509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5600   -2.7218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5494   -5.5793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3852   -2.7218    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9808   -9.9401    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4814  -10.5278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7029  -10.6208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3897  -11.3129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9053  -10.6208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4841  -11.3311    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.6578  -11.3311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2410  -12.0267    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.6418  -12.7451    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.4682  -12.7451    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.8939  -12.0450    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.8743  -13.4757    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4159  -12.0267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7191  -12.0450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2225  -13.4564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9922  -12.7275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2919   -3.4706    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n 34 32  1  0  0  0  0\n 32 33  1  0  0  0  0\n 34 35  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n  1  9  1  1  0  0  0\n  8 18  1  0  0  0  0\n 34 39  1  0  0  0  0\n 35 36  1  0  0  0  0\n 36 37  1  0  0  0  0\n 37 38  1  0  0  0  0\n 38 39  1  0  0  0  0\n  2  3  1  0  0  0  0\n 14 40  1  6  0  0  0\n 13 19  1  1  0  0  0\n 40 41  1  0  0  0  0\n  5 10  1  1  0  0  0\n 20 42  1  0  0  0  0\n 42 43  1  0  0  0  0\n 17 20  1  1  0  0  0\n  3  4  1  0  0  0  0\n 16 21  1  1  0  0  0\n 16 22  1  0  0  0  0\n 42 47  1  0  0  0  0\n 43 44  1  0  0  0  0\n 44 45  1  0  0  0  0\n 45 46  1  0  0  0  0\n 46 47  1  0  0  0  0\n  4  5  1  0  0  0  0\n 35 48  1  6  0  0  0\n 31 49  1  1  0  0  0\n 23 24  1  0  0  0  0\n 42 50  1  1  0  0  0\n 43 51  1  1  0  0  0\n  5  6  1  0  0  0  0\n 45 52  1  1  0  0  0\n 11 12  1  0  0  0  0\n 46 53  1  6  0  0  0\n 23 26  1  0  0  0  0\n 44 54  1  6  0  0  0\n 24 31  1  0  0  0  0\n 53 55  1  0  0  0  0\n 30 25  1  0  0  0  0\n 34 56  1  1  0  0  0\n 25 26  1  0  0  0  0\n 39 57  1  0  0  0  0\n 12 13  1  0  0  0  0\n 39 58  1  6  0  0  0\n 26 27  1  0  0  0  0\n 58 59  2  0  0  0  0\n 58 60  1  0  0  0  0\n 30 28  1  1  0  0  0\n 61 62  1  0  0  0  0\n 27 28  1  0  0  0  0\n  6  7  1  6  0  0  0\n 27 29  2  0  0  0  0\n 30 31  1  0  0  0  0\n  1  2  1  0  0  0  0\n 61 66  1  0  0  0  0\n 62 63  1  0  0  0  0\n 63 64  1  0  0  0  0\n 64 65  1  0  0  0  0\n 65 66  1  0  0  0  0\n  2  8  1  6  0  0  0\n 65 67  1  1  0  0  0\n  1  6  1  0  0  0  0\n 63 68  1  1  0  0  0\n 12 17  1  0  0  0  0\n 66 69  1  6  0  0  0\n 30 33  1  0  0  0  0\n 64 70  1  6  0  0  0\n 31 35  1  0  0  0  0\n 68 71  1  0  0  0  0\n 12 72  1  1  0  0  0\n 61 60  1  1  0  0  0\n 26 22  1  6  0  0  0\n  4 11  1  6  0  0  0\nM  END",
        "smiles": "C=C1C[C@]23CC[C@@]4([H])[C@@](C)(CCC[C@@]4(C)C(=O)O[C@H]5[C@@H]([C@H]([C@@H]([C@@H](CO)O5)O)O)O)[C@]3([H])CC[C@@]1(C2)O[C@@]6([H])[C@@H]([C@]([H])([C@@H]([C@@H](CO)O6)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@@H](CO)O7)O)O)O)O[C@@]8([H])[C@@H]([C@H]([C@@H]([C@@H](CO)O8)O)O)O",
        "formula": "C44H70O23",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 26,
        "ez_centers": 0,
        "molecular_weight": "967.0145",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "00d7fbd3-e5c3-43c7-82d1-936be07f1af2",
          "805907d3-9d87-465e-9d7d-fa4175f9842f"
        ],
        "stereo_centers": 26
      },
      "unii": "B3FUD0528F",
      "relationships": [
        {
          "uuid": "c381b475-6bc3-4a1e-90be-972a9cd9ee70",
          "comments": "Isolated stevia sweetener, produced by the extraction of STEVIA REBAUDIANA leaves by hot water and powdering.",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "6abf21fd-1609-485e-b3bd-109c2ae25f94"
          ],
          "related_substance": {
            "uuid": "522122b2-e111-44e7-9073-92c1a13c0432",
            "refuuid": "9de3c1b3-dd78-4d38-9230-990ef6702535",
            "name": "STEVIA REBAUDIANA LEAF",
            "unii": "6TC6NN0876",
            "linking_id": "6TC6NN0876",
            "ref_pname": "STEVIA REBAUDIANA LEAF",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "d6c51d64-cb17-4972-8408-b3ca267c6823",
          "name": "(4.ALPHA.)-13-((O-.BETA.-D-GLUCOPYRANOSYL-(1->2)-O-(.BETA.-D-GLUCOPYRANOSYL-(1->3))-.BETA.-D-GLUCOPYRANOSYL)OXY)KAUR-16-EN-18-OIC ACID .BETA.-D-GLUCOPYRANOSYL ESTER",
          "stdName": "(4.ALPHA.)-13-((O-.BETA.-D-GLUCOPYRANOSYL-(1->2)-O-(.BETA.-D-GLUCOPYRANOSYL-(1->3))-.BETA.-D-GLUCOPYRANOSYL)OXY)KAUR-16-EN-18-OIC ACID .BETA.-D-GLUCOPYRANOSYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "805907d3-9d87-465e-9d7d-fa4175f9842f",
            "2f1cd316-d36f-46bd-874b-239605af2c0c"
          ],
          "display_name": false
        },
        {
          "uuid": "1972869d-abda-4589-bc98-82dcd9ac6351",
          "name": "E-960A",
          "stdName": "E-960A",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54857d47-a8ed-4a4a-967f-ca1df2fc3e78",
            "2f1cd316-d36f-46bd-874b-239605af2c0c"
          ],
          "display_name": false
        },
        {
          "uuid": "c2204b1f-d0dd-4c3a-a1d5-91e3db757873",
          "name": "FEMA NO. 4601",
          "stdName": "FEMA NO. 4601",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fc201545-ffe8-4438-8518-20a5ad5de2b4",
            "2f1cd316-d36f-46bd-874b-239605af2c0c"
          ],
          "display_name": false
        },
        {
          "uuid": "0c7fe8ce-edb3-4d7d-8e2d-a84148648da0",
          "name": "GLYCOSIDE X",
          "stdName": "GLYCOSIDE X",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9164e60e-e548-481c-9819-fa6cc8e9fd66",
            "2f1cd316-d36f-46bd-874b-239605af2c0c"
          ],
          "display_name": false
        },
        {
          "uuid": "c730b355-35bd-4098-84dc-14e294f29664",
          "name": "INS NO.960A",
          "stdName": "INS NO.960A",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54857d47-a8ed-4a4a-967f-ca1df2fc3e78",
            "2f1cd316-d36f-46bd-874b-239605af2c0c"
          ],
          "display_name": false
        },
        {
          "uuid": "cd092bbe-be05-4315-9bf6-c8b797d3485d",
          "name": "INS-960A",
          "stdName": "INS-960A",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54857d47-a8ed-4a4a-967f-ca1df2fc3e78",
            "2f1cd316-d36f-46bd-874b-239605af2c0c"
          ],
          "display_name": false
        },
        {
          "uuid": "98dfbc1e-c480-4ecd-91b1-520b062b5957",
          "name": "REB-A 97",
          "stdName": "REB-A 97",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9164e60e-e548-481c-9819-fa6cc8e9fd66",
            "2f1cd316-d36f-46bd-874b-239605af2c0c"
          ],
          "display_name": false
        },
        {
          "uuid": "02018b36-6c7a-4a7c-b6a7-c1501c4d9d0c",
          "name": "REBAUDIANA A",
          "stdName": "REBAUDIANA A",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9164e60e-e548-481c-9819-fa6cc8e9fd66",
            "2f1cd316-d36f-46bd-874b-239605af2c0c"
          ],
          "display_name": false
        },
        {
          "uuid": "03cd4834-1a95-46f9-bd42-b5c578303a83",
          "name": "REBAUDIOSIDE A",
          "stdName": "REBAUDIOSIDE A",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd280bda-774d-4ea8-997d-20245984a82b",
            "32d270d1-6f02-470f-9adc-c64e1516a4d6",
            "6dd2ef53-f91e-4e67-84a8-ad2f424b294a",
            "996712ee-f299-4941-adc1-97a411cd7129",
            "1241c0e0-3e01-4d9b-b211-f0fc611e72fd",
            "2f1cd316-d36f-46bd-874b-239605af2c0c",
            "a02f8678-bb12-4f95-b494-3100116fcd02",
            "805907d3-9d87-465e-9d7d-fa4175f9842f",
            "c277444b-06d2-48a4-a900-67b5dab6bad4"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "267a3ce2-881d-441f-83cb-86c96eb5c11e",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "9e83f7ff-a56a-4c7d-9886-361e91518283",
          "name": "REBAUDIOSIDE A [FCC]",
          "stdName": "REBAUDIOSIDE A [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd280bda-774d-4ea8-997d-20245984a82b",
            "2f1cd316-d36f-46bd-874b-239605af2c0c"
          ],
          "display_name": false
        },
        {
          "uuid": "2de2cb5e-4e7d-4de9-acdf-9cc993e5d67a",
          "name": "REBAUDIOSIDE A [MI]",
          "stdName": "REBAUDIOSIDE A [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "805907d3-9d87-465e-9d7d-fa4175f9842f",
            "2f1cd316-d36f-46bd-874b-239605af2c0c"
          ],
          "display_name": false
        },
        {
          "uuid": "c477bc0e-6a0e-4c94-a83d-8e004236392e",
          "name": "REBAUDIOSIDE A [USP-RS]",
          "stdName": "REBAUDIOSIDE A [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "996712ee-f299-4941-adc1-97a411cd7129",
            "2f1cd316-d36f-46bd-874b-239605af2c0c"
          ],
          "display_name": false
        },
        {
          "uuid": "5edb41ee-d64f-45cd-a2b5-47721df31c44",
          "name": "REBIANA",
          "stdName": "REBIANA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "805907d3-9d87-465e-9d7d-fa4175f9842f",
            "2f1cd316-d36f-46bd-874b-239605af2c0c"
          ],
          "display_name": false
        },
        {
          "uuid": "1173cc12-69ba-46c3-bc81-59ce405aab08",
          "name": "SOOOLITE!-PURE",
          "stdName": "SOOOLITE!-PURE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9164e60e-e548-481c-9819-fa6cc8e9fd66",
            "2f1cd316-d36f-46bd-874b-239605af2c0c"
          ],
          "display_name": false
        },
        {
          "uuid": "44778c04-8501-440d-924c-39591704e9ac",
          "name": "STEVIOSIDE A3",
          "stdName": "STEVIOSIDE A3",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "805907d3-9d87-465e-9d7d-fa4175f9842f",
            "2f1cd316-d36f-46bd-874b-239605af2c0c"
          ],
          "display_name": false
        },
        {
          "uuid": "29699c33-11b8-4b68-b4d3-316c14e96c6c",
          "name": "SWEETENER 4G-S",
          "stdName": "SWEETENER 4G-S",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9164e60e-e548-481c-9819-fa6cc8e9fd66",
            "2f1cd316-d36f-46bd-874b-239605af2c0c"
          ],
          "display_name": false
        },
        {
          "uuid": "1d5558c5-1386-415c-bcf0-4e559b912e99",
          "name": "TRUVIA",
          "stdName": "TRUVIA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "805907d3-9d87-465e-9d7d-fa4175f9842f",
            "2f1cd316-d36f-46bd-874b-239605af2c0c"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "67756369-fdc5-46d4-8356-78a2ad393540"
      }
    }
  ]
}