{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "538d202e-6d98-4283-a2db-51b12c5aa306", "code": "88371-89-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=88371-89-5", "code_system": "CAS", "references": [ "c832bdcb-9d92-48fa-aa35-5e16ea312e9e", "1f4d43ee-2388-4a65-9503-18e80287adee" ] }, { "uuid": "e74350e1-1704-4d83-ba10-0a9ebc1f742f", "code": "4064185", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4064185", "code_system": "PUBCHEM", "references": [ "c832bdcb-9d92-48fa-aa35-5e16ea312e9e" ] }, { "uuid": "afd9b3a8-2b95-4759-8658-3138a049cf84", "code": "B3D3GT4MTM", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "e80c0c32-2e54-4b86-91bc-aabf3781cacd", "name": "1,1,3,5,5,7-Hexanitro-3,7-diazacyclooctane", "stdName": "1,1,3,5,5,7-HEXANITRO-3,7-DIAZACYCLOOCTANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1f4d43ee-2388-4a65-9503-18e80287adee" ], "display_name": false }, { "uuid": "7e963eaa-adab-45eb-9498-45391ab49877", "name": "1,3,3,5,7,7-Hexanitro-1,5-diazacyclooctane", "stdName": "1,3,3,5,7,7-HEXANITRO-1,5-DIAZACYCLOOCTANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1f4d43ee-2388-4a65-9503-18e80287adee" ], "display_name": true }, { "uuid": "d31490bc-2ced-4188-91d6-1ff9e1c2678e", "name": "1,5-Diazocine, octahydro-1,3,3,5,7,7-hexanitro-", "stdName": "1,5-DIAZOCINE, OCTAHYDRO-1,3,3,5,7,7-HEXANITRO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1f4d43ee-2388-4a65-9503-18e80287adee" ], "display_name": false }, { "uuid": "89be6040-5af8-4fac-bde5-29243a479238", "name": "HCO", "stdName": "HCO", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f35c64a1-1b43-4867-a6b2-95d51283f4a3", "ca63b21a-c981-4016-a3c4-bec791f79699" ], "display_name": false }, { "uuid": "09f07794-a0b4-488f-b672-37cc1989505d", "name": "Octahydro-1,3,3,5,7,7-hexanitro-1,5-diazocine", "stdName": "OCTAHYDRO-1,3,3,5,7,7-HEXANITRO-1,5-DIAZOCINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1f4d43ee-2388-4a65-9503-18e80287adee" ], "display_name": false } ], "references": [ { "uuid": "f35c64a1-1b43-4867-a6b2-95d51283f4a3", "citation": "CHEMID 2011 Drugportal", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ca63b21a-c981-4016-a3c4-bec791f79699", "citation": "DRUGPORTAL 2011", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c832bdcb-9d92-48fa-aa35-5e16ea312e9e", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391212000, "tags": [ "NOMEN" ] }, { "uuid": "8d74ad69-a846-40a5-9ae8-243df8b53cb5", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1f4d43ee-2388-4a65-9503-18e80287adee", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "1cd57bee-f2ea-42cc-accf-fccee6bcc5ae", "id": "1cd57bee-f2ea-42cc-accf-fccee6bcc5ae", "molfile": "\n Marvin 01132101402D \n\n 26 26 0 0 0 0 999 V2000\n 0.3971 1.1291 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n -0.4209 1.0215 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n -0.9231 1.6760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7366 0.2593 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1532 -0.3241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1532 -1.1491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7366 -1.7325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5616 -1.7325 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1450 -1.1491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1450 -0.3241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5616 0.2593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3585 0.4728 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n -3.1554 0.6863 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n -2.1450 1.2697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9419 -0.5376 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n -3.1554 -1.3345 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n -3.5252 0.0457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9741 -2.4469 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n -1.5616 -3.1614 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n -2.7991 -2.4469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0603 -1.9460 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n -0.5231 -2.5294 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 0.8572 -2.1595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6973 -1.1407 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 1.3128 -0.5913 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 1.3095 -1.6938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 4 11 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 6 21 1 0 0 0 0\n 6 24 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 18 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 10 12 1 0 0 0 0\n 10 15 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 2 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 2 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 2 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 2 0 0 0 0\n 24 25 1 0 0 0 0\n 24 26 2 0 0 0 0\nM CHG 8 1 -1 2 1 12 1 13 -1 15 1 16 -1 18 1 19 -1\nM CHG 4 21 1 22 -1 24 1 25 -1\nM END", "smiles": "C1C(CN(CC(CN1[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-]", "formula": "C6H8N8O12", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a0905664-5e29-4a2d-91a7-f06328dcede3" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "384.1744", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "308900db-aabb-4406-819e-1f52c22dc1db", "version": "5", "structure": { "id": "ae0510c1-0403-4007-ad42-28f93e09a562", "molfile": "\n Marvin 01132109022D \n\n 26 26 0 0 0 0 999 V2000\n -0.1532 -0.3241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7366 0.2593 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5616 0.2593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1450 -0.3241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1450 -1.1491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5616 -1.7325 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7366 -1.7325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1532 -1.1491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4209 1.0215 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 0.3971 1.1291 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n -0.9231 1.6760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6973 -1.1407 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 0.0603 -1.9460 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n -0.5231 -2.5294 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 0.8572 -2.1595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3128 -0.5913 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3095 -1.6938 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n -1.9741 -2.4469 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n -1.5616 -3.1614 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n -2.7991 -2.4469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9419 -0.5376 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n -2.3585 0.4728 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n -3.1554 0.6863 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n -2.1450 1.2697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1554 -1.3345 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n -3.5252 0.0457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 1 1 0 0 0 0\n 2 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 2 0 0 0 0\n 8 12 1 0 0 0 0\n 8 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 2 0 0 0 0\n 12 16 2 0 0 0 0\n 12 17 1 0 0 0 0\n 6 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 2 0 0 0 0\n 4 21 1 0 0 0 0\n 4 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 24 2 0 0 0 0\n 21 25 1 0 0 0 0\n 21 26 2 0 0 0 0\nM CHG 8 9 1 10 -1 12 1 13 1 14 -1 17 -1 18 1 19 -1\nM CHG 4 21 1 22 1 23 -1 25 -1\nM END", "smiles": "C1C(CN(CC(CN1[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-]", "formula": "C6H8N8O12", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "384.1744", "optical_activity": "NONE", "references": [ "8d74ad69-a846-40a5-9ae8-243df8b53cb5" ], "stereo_centers": 0 }, "unii": "B3D3GT4MTM" } ] }