{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "345cc195-463e-64b2-b8d5-c8ec598fd132", "code": "DTXSID1074545", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1074545", "code_system": "EPA CompTox", "references": [ "fbc923da-e7d2-5295-2e1f-f9d839eea67e" ] }, { "uuid": "6e4c784a-0dee-43f3-a8da-5205452966d8", "code": "B27SPN7XME", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "180bb9bf-368c-4e6f-413f-8a640f3559f1", "code": "161111", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/161111", "code_system": "PUBCHEM", "references": [ "360531ed-125b-f18d-6bc4-959d520596e5" ] }, { "uuid": "2ce3d26f-3f82-48e1-8941-f2e6b0ce1ed2", "code": "15163-36-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=15163-36-7", "code_system": "CAS" } ], "substance_class": "chemical", "names": [ { "uuid": "7a20a11b-311f-4871-9022-5ba4a706d908", "name": "1-Decanaminium, N,N-dimethyl-N-(3-sulfopropyl)-, inner salt", "stdName": "1-DECANAMINIUM, N,N-DIMETHYL-N-(3-SULFOPROPYL)-, INNER SALT", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "01c86ae6-3c0a-4ca2-8454-49ed8b2bfe5a" ], "display_name": false }, { "uuid": "cdfb3a2a-b2bb-4b37-a37a-0df67412c309", "name": "N-Capryl sulfobetaine", "stdName": "N-CAPRYL SULFOBETAINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "01c86ae6-3c0a-4ca2-8454-49ed8b2bfe5a" ], "display_name": false }, { "uuid": "066c88b9-97e0-4d82-bf32-4f173729f4b6", "name": "Sulfobetaine 10", "stdName": "SULFOBETAINE 10", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "01c86ae6-3c0a-4ca2-8454-49ed8b2bfe5a" ], "display_name": true } ], "references": [ { "uuid": "360531ed-125b-f18d-6bc4-959d520596e5", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "fbc923da-e7d2-5295-2e1f-f9d839eea67e", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "01c86ae6-3c0a-4ca2-8454-49ed8b2bfe5a", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "99b9428a-9913-47bf-8f25-936aeadec1a4", "id": "99b9428a-9913-47bf-8f25-936aeadec1a4", "molfile": "\n Marvin 05202213412D \n\n 20 19 0 0 0 0 999 V2000\n 15.8106 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0962 -4.0700 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 16.5251 -4.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3817 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5087 -4.7845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6837 -4.7845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2395 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6672 -4.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9540 -4.0700 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9528 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3665 -3.3555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5415 -4.7845 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6685 -4.4825 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 12.2383 -4.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5238 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8093 -4.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0949 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3805 -4.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6660 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9515 -4.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 2 5 1 0 0 0 0\n 2 6 1 0 0 0 0\n 3 7 1 0 0 0 0\n 4 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 9 11 2 0 0 0 0\n 9 12 2 0 0 0 0\n 9 13 1 0 0 0 0\n 10 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\nM CHG 2 2 1 13 -1\nM END", "smiles": "CCCCCCCCCC[N+](C)(C)CCCS(=O)(=O)[O-]", "formula": "C15H33NO3S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "66c992d5-f6ff-441a-afcc-033c7ea696e6" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "307.4941", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "b109e60c-409b-47fd-9359-7e5cb9c2c174", "version": "5", "structure": { "id": "31862d42-d9d6-4464-be5d-e4bf679bb84f", "molfile": "N-Decyl-N,N-dimethyl-3-ammonio-1-propanesulfonate\n JSDraw205202213412D\n\n 20 19 0 0 0 0 0 V2000\n 29.8965 -6.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5455 -7.6960 0.0000 N 0 3 0 0 0 0 4 0 0 0 0 0\n 31.2475 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1945 -6.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3255 -9.0470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7655 -9.0470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.5984 -6.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8435 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.9494 -7.6960 0.0000 S 0 0 0 0 0 0 6 0 0 0 0 0\n 24.4925 -6.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.7294 -6.3450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 33.1694 -9.0470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 35.3004 -8.4760 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 23.1415 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7905 -6.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4395 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0885 -6.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7376 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3866 -6.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0356 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 2 5 1 0 0 0 0\n 2 6 1 0 0 0 0\n 3 7 1 0 0 0 0\n 4 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 9 11 2 0 0 0 0\n 9 12 2 0 0 0 0\n 9 13 1 0 0 0 0\n 10 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\nM CHG 2 2 1 13 -1\nM END", "smiles": "CCCCCCCCCC[N+](C)(C)CCCS(=O)(=O)[O-]", "formula": "C15H33NO3S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "307.4941", "optical_activity": "NONE", "references": [ "01c86ae6-3c0a-4ca2-8454-49ed8b2bfe5a" ], "stereo_centers": 0 }, "unii": "B27SPN7XME" } ] }