{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7c5fe448-cbf3-408c-beb5-a4620d8ee002",
          "code": "84-79-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=84-79-7",
          "code_system": "CAS",
          "references": [
            "324ba988-86db-4e71-9738-43ec62670602",
            "b5c176ca-79a1-4c02-9da1-ff2c63eaca86"
          ]
        },
        {
          "uuid": "64669526-9bd3-4e3f-8fa8-21dd1edb1c96",
          "code": "C008252",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67008252",
          "code_system": "MESH",
          "references": [
            "324ba988-86db-4e71-9738-43ec62670602"
          ]
        },
        {
          "uuid": "862befd1-7998-42ea-9d54-c9ffe5d095d1",
          "code": "LAPACHOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Lapachol",
          "code_system": "WIKIPEDIA",
          "references": [
            "324ba988-86db-4e71-9738-43ec62670602"
          ]
        },
        {
          "uuid": "1ddafac5-def7-42a7-950e-2f2f8dda4e40",
          "code": "m6687",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6687?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "324ba988-86db-4e71-9738-43ec62670602"
          ]
        },
        {
          "uuid": "a5db1042-ad71-47ba-9d2e-d9043e1eae39",
          "code": "201-563-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.421",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "324ba988-86db-4e71-9738-43ec62670602"
          ]
        },
        {
          "uuid": "732f47c2-1601-5baf-de7f-d46f46364c10",
          "code": "DTXSID6049430",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6049430",
          "code_system": "EPA CompTox",
          "references": [
            "c54d874b-fd9e-036b-6cac-264c5a4f6700"
          ]
        },
        {
          "uuid": "5b32c925-10f2-49ce-9cbf-3bf4d5f94c34",
          "code": "B221938VB6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5c31cbf5-45a9-ed15-2c22-c1a831c96973",
          "code": "11905",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=11905",
          "code_system": "NSC",
          "references": [
            "bd788797-fc24-1549-e97e-74bd56c369b7"
          ]
        },
        {
          "uuid": "d84244ed-6898-f1c4-b09f-0755448b099b",
          "code": "629756",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=629756",
          "code_system": "NSC",
          "references": [
            "bd788797-fc24-1549-e97e-74bd56c369b7"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "33dba085-65e7-4fce-8577-bef00a04019b",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "542eb721-24dc-4e5b-b03c-7cf60eb1d4e3",
            "refuuid": "c0e4c40f-13ce-4087-a593-217dd6a1235f",
            "name": "LAPACHOL",
            "unii": "B221938VB6",
            "linking_id": "B221938VB6",
            "ref_pname": "LAPACHOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "21a1bff7-95f5-4b30-8ea2-c86219fcc9fb",
          "amount": {
            "uuid": "bc122474-1a35-4b82-82e0-d6a0aa7bc38d"
          },
          "type": "PARENT->ACTIVE CONSTITUENT ALWAYS PRESENT",
          "references": [
            "2a7745af-e832-4f6b-a89b-e424bb152faa"
          ],
          "related_substance": {
            "uuid": "f33c0bab-acae-4651-b1ef-4a4e0347d960",
            "refuuid": "ffa524d1-4af1-4af5-8aeb-68b56d6423fd",
            "name": "HANDROANTHUS IMPETIGINOSUS BARK",
            "unii": "6GLA1946WX",
            "linking_id": "6GLA1946WX",
            "ref_pname": "HANDROANTHUS IMPETIGINOSUS BARK",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "26930ec3-d886-4f62-a2c0-fd955a98340c",
          "name": "1,4-NAPHTHALENEDIONE, 2-HYDROXY-3-(3-METHYL-2-BUTENYL)-",
          "stdName": "1,4-NAPHTHALENEDIONE, 2-HYDROXY-3-(3-METHYL-2-BUTENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f079be2-d6d4-45ca-8a59-a7b8033688aa",
            "f44695d0-e50b-4c7e-ae8e-56c21b349cb6"
          ],
          "display_name": false
        },
        {
          "uuid": "929e102c-2849-443c-9090-2425e9d5f5f6",
          "name": "2-HYDROXY-3-(3-METHYL-2-BUTEN-1-YL)-1,4-NAPHTHALENEDIONE",
          "stdName": "2-HYDROXY-3-(3-METHYL-2-BUTEN-1-YL)-1,4-NAPHTHALENEDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90d342d7-7050-43b4-90f0-e7d089b5b006",
            "0f079be2-d6d4-45ca-8a59-a7b8033688aa"
          ],
          "display_name": false
        },
        {
          "uuid": "63f49329-37b7-4a9b-b7f4-9c341f6c9fe6",
          "name": "C.I. 75490",
          "stdName": "C.I. 75490",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f079be2-d6d4-45ca-8a59-a7b8033688aa",
            "f44695d0-e50b-4c7e-ae8e-56c21b349cb6"
          ],
          "display_name": false
        },
        {
          "uuid": "35570759-f1cc-43a7-bada-d6fc61bfbaad",
          "name": "C.I. NATURAL YELLOW 16",
          "stdName": "C.I. NATURAL YELLOW 16",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f079be2-d6d4-45ca-8a59-a7b8033688aa",
            "f44695d0-e50b-4c7e-ae8e-56c21b349cb6"
          ],
          "display_name": false
        },
        {
          "uuid": "13484135-f081-4352-84a5-540dd9de908d",
          "name": "CI 75490",
          "stdName": "CI 75490",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f079be2-d6d4-45ca-8a59-a7b8033688aa",
            "f44695d0-e50b-4c7e-ae8e-56c21b349cb6"
          ],
          "display_name": false
        },
        {
          "uuid": "3834bf0d-c32a-4ff5-8699-a9ed84feea99",
          "name": "GREENHARTIN",
          "stdName": "GREENHARTIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90d342d7-7050-43b4-90f0-e7d089b5b006",
            "0f079be2-d6d4-45ca-8a59-a7b8033688aa"
          ],
          "display_name": false
        },
        {
          "uuid": "7e78739e-d03c-4d92-971c-38eb450db6a2",
          "name": "LAPACHIC ACID",
          "stdName": "LAPACHIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90d342d7-7050-43b4-90f0-e7d089b5b006",
            "0f079be2-d6d4-45ca-8a59-a7b8033688aa"
          ],
          "display_name": false
        },
        {
          "uuid": "75c745af-6ea2-455c-b045-632d31acd4b0",
          "name": "LAPACHOL",
          "stdName": "LAPACHOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "daaf2956-95ba-4ca6-8586-0732a4eda3f5",
            "90d342d7-7050-43b4-90f0-e7d089b5b006",
            "0f079be2-d6d4-45ca-8a59-a7b8033688aa",
            "15cf36d1-573d-4a77-8f5c-f12b208aa71d"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "0a5e2583-39ad-44cd-adb1-48e19d99bef9",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "ea277e3d-842b-487c-ad7b-b94a29a2a788",
          "name": "LAPACHOL [MI]",
          "stdName": "LAPACHOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "daaf2956-95ba-4ca6-8586-0732a4eda3f5",
            "0f079be2-d6d4-45ca-8a59-a7b8033688aa"
          ],
          "display_name": false
        },
        {
          "uuid": "6e59d79d-3a63-4003-a5cc-202ddc9524d5",
          "name": "NSC-11905",
          "stdName": "NSC-11905",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90d342d7-7050-43b4-90f0-e7d089b5b006",
            "0f079be2-d6d4-45ca-8a59-a7b8033688aa"
          ],
          "display_name": false
        },
        {
          "uuid": "6f6e3810-6292-41ed-b20b-b1cb9dde649a",
          "name": "NSC-629756",
          "stdName": "NSC-629756",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f079be2-d6d4-45ca-8a59-a7b8033688aa",
            "f44695d0-e50b-4c7e-ae8e-56c21b349cb6"
          ],
          "display_name": false
        },
        {
          "uuid": "edb0e92a-3743-4213-abe7-b0e18fe8216a",
          "name": "TAIGUIC ACID",
          "stdName": "TAIGUIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90d342d7-7050-43b4-90f0-e7d089b5b006",
            "0f079be2-d6d4-45ca-8a59-a7b8033688aa"
          ],
          "display_name": false
        },
        {
          "uuid": "61f2d212-0a13-4bd9-af52-bb283fc71d31",
          "name": "TECOMIN",
          "stdName": "TECOMIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90d342d7-7050-43b4-90f0-e7d089b5b006",
            "0f079be2-d6d4-45ca-8a59-a7b8033688aa"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "90d342d7-7050-43b4-90f0-e7d089b5b006",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0f079be2-d6d4-45ca-8a59-a7b8033688aa",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "daaf2956-95ba-4ca6-8586-0732a4eda3f5",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f44695d0-e50b-4c7e-ae8e-56c21b349cb6",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "324ba988-86db-4e71-9738-43ec62670602",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389709000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "044ce322-b8d1-4f8c-aa88-e19619488661",
          "citation": "SRS import [B221938VB6]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=B221938VB6",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389709000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d065b278-97ab-49bd-8c0d-f11cc4ccc6f6",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15cf36d1-573d-4a77-8f5c-f12b208aa71d",
          "citation": "LAPACHOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c54d874b-fd9e-036b-6cac-264c5a4f6700",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=84-79-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2a7745af-e832-4f6b-a89b-e424bb152faa",
          "citation": "https://www.verywellhealth.com/what-is-pau-darco-89494",
          "url": "https://www.verywellhealth.com/what-is-pau-darco-89494",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "b5c176ca-79a1-4c02-9da1-ff2c63eaca86",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "bd788797-fc24-1549-e97e-74bd56c369b7",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "355bedd6-f311-47dd-8e16-67886d7796f9",
          "id": "355bedd6-f311-47dd-8e16-67886d7796f9",
          "molfile": "\n  Marvin  01132102512D          \n\n 18 19  0  0  0  0            999 V2000\n    0.7164    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7164   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4353   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4353   -2.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1439   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1439   -3.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4353   -3.7163    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8551   -3.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8551   -4.5413    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5637   -3.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2827   -3.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0042   -3.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0042   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2827   -2.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5637   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8551   -2.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8551   -1.2362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n 17  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 16  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\nM  END",
          "smiles": "CC(=CCC1=C(C(=O)c2ccccc2C1=O)O)C",
          "formula": "C15H14O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "809a0f19-10f0-4bd2-9a5e-fb43b8035c0b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "242.2704",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c0e4c40f-13ce-4087-a593-217dd6a1235f",
      "version": "10",
      "structure": {
        "id": "dadb46f1-a71b-467e-a9e8-5e306e44f0b0",
        "molfile": "\n  Marvin  01132111212D          \n\n 18 19  0  0  0  0            999 V2000\n    2.1439   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1439   -3.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8551   -2.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8551   -3.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5637   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5637   -3.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4353   -2.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4353   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8551   -1.2362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8551   -4.5413    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7164   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4353   -3.7163    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2827   -2.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2827   -3.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7164    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0042   -3.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0042   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  1  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  3  2  0  0  0  0\n 10  4  2  0  0  0  0\n 11  8  2  0  0  0  0\n 12  2  1  0  0  0  0\n 13  5  1  0  0  0  0\n 14  6  1  0  0  0  0\n 15 11  1  0  0  0  0\n 16 11  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 13  2  0  0  0  0\n  4  6  1  0  0  0  0\n 14 17  2  0  0  0  0\nM  END",
        "smiles": "CC(=CCC1=C(C(=O)c2ccccc2C1=O)O)C",
        "formula": "C15H14O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "242.2704",
        "optical_activity": "NONE",
        "references": [
          "044ce322-b8d1-4f8c-aa88-e19619488661",
          "d065b278-97ab-49bd-8c0d-f11cc4ccc6f6"
        ],
        "stereo_centers": 0
      },
      "unii": "B221938VB6"
    }
  ]
}