{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9f4a8011-889f-4728-9bee-5363e25ae78b",
          "code": "110235-47-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=110235-47-7",
          "code_system": "CAS",
          "references": [
            "574097d7-e469-4407-8de4-20409de5af44",
            "3925bf0d-04c7-4462-8bfa-107eed548cb0"
          ]
        },
        {
          "uuid": "a840b924-65eb-471d-8e7c-07d6eeed205b",
          "code": "C104083",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67104083",
          "code_system": "MESH",
          "references": [
            "574097d7-e469-4407-8de4-20409de5af44"
          ]
        },
        {
          "uuid": "e53c9a9e-66d3-4d90-9b3e-302437926134",
          "code": "288203",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2754",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "574097d7-e469-4407-8de4-20409de5af44"
          ]
        },
        {
          "uuid": "687a3526-9304-4cdc-902d-4006b8c1ca14",
          "code": "m7182",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7182?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "574097d7-e469-4407-8de4-20409de5af44"
          ]
        },
        {
          "uuid": "080ed7d4-38ef-4348-8d14-85a9583f7958",
          "code": "86296",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/86296",
          "code_system": "PUBCHEM",
          "references": [
            "574097d7-e469-4407-8de4-20409de5af44"
          ]
        },
        {
          "uuid": "b32a6af4-6771-9afc-9e92-659a4736fadf",
          "code": "DTXSID4042121",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4042121",
          "code_system": "EPA CompTox",
          "references": [
            "51f7f9e5-0f65-72e8-f050-09daecdcddbe"
          ]
        },
        {
          "uuid": "e8fc83aa-3055-4893-a229-ad0703be0cbd",
          "code": "B150X76OJY",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "aef94f91-4e6c-c976-04ba-42508148cd46",
          "code": "6751",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:6751",
          "code_system": "CHEBI",
          "references": [
            "604766b8-dd77-41b1-bdbb-4010ba411d60"
          ]
        },
        {
          "uuid": "bba97a6c-f38b-9481-3308-95f38ad45517",
          "code": "mepanipyrim",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/mepanipyrim.html",
          "code_system": "ALANWOOD",
          "references": [
            "07b75c67-ddf4-fd3b-e5dd-9ed565c09758"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d347c75b-a845-4124-adf8-bab3ca0a96b1",
          "name": "2-ANILINO-4-METHYL-6-(1-PROPYNYL)PYRIMIDINE",
          "stdName": "2-ANILINO-4-METHYL-6-(1-PROPYNYL)PYRIMIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dc95ae7c-91c8-4f71-bb23-c4937ebd3081",
            "0ab78e0d-8b84-48e6-8ead-75e6842aeedf"
          ],
          "display_name": false
        },
        {
          "uuid": "6e6002ed-658d-4731-a1c1-28f48528b87e",
          "name": "4-METHYL-N-PHENYL-6-(1-PROPYNYL)-2-PYRIMIDINAMINE",
          "stdName": "4-METHYL-N-PHENYL-6-(1-PROPYNYL)-2-PYRIMIDINAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5d396c79-5b97-4d5e-82fe-6176e1879f0f",
            "fe08a185-102d-4cf4-804e-7ea763a42eef"
          ],
          "display_name": false
        },
        {
          "uuid": "1d63acad-0540-4787-89a9-003fdd55c54d",
          "name": "FRUPICA",
          "stdName": "FRUPICA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ab78e0d-8b84-48e6-8ead-75e6842aeedf",
            "ba000bab-376b-43ea-babe-6c3356624562"
          ],
          "display_name": false
        },
        {
          "uuid": "5cef11ee-7eb4-4922-9b25-ffe169590a99",
          "name": "KIF-3535",
          "stdName": "KIF-3535",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dc95ae7c-91c8-4f71-bb23-c4937ebd3081",
            "0ab78e0d-8b84-48e6-8ead-75e6842aeedf"
          ],
          "display_name": false
        },
        {
          "uuid": "6d28bae4-1aae-42b2-9276-57284b36d13b",
          "name": "KUF-6201",
          "stdName": "KUF-6201",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dc95ae7c-91c8-4f71-bb23-c4937ebd3081",
            "0ab78e0d-8b84-48e6-8ead-75e6842aeedf"
          ],
          "display_name": false
        },
        {
          "uuid": "a82b2799-0d17-40c1-8261-0d2d247225bc",
          "name": "MEPANIPYRIM",
          "stdName": "MEPANIPYRIM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c74d4c83-8be3-4c0c-b297-f64a2a1b04bc",
            "74b14e7c-4c9f-4ce2-b8f7-c8fafd55b941",
            "bdbc5799-71c3-4f62-9185-16362f33764b",
            "b95d8ed9-6274-42de-8d93-534e6bd8376c",
            "0ab78e0d-8b84-48e6-8ead-75e6842aeedf",
            "ac3f67a9-3612-4e9d-8140-2504be5ff459"
          ],
          "display_name": true
        },
        {
          "uuid": "9765b4a8-96b0-44b8-9a0f-04841788411f",
          "name": "MEPANIPYRIM [ISO]",
          "stdName": "MEPANIPYRIM [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac3f67a9-3612-4e9d-8140-2504be5ff459",
            "0ab78e0d-8b84-48e6-8ead-75e6842aeedf"
          ],
          "display_name": false
        },
        {
          "uuid": "2a5193a4-6d5d-4dc2-909f-c12a71be0873",
          "name": "MEPANIPYRIM [MI]",
          "stdName": "MEPANIPYRIM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c74d4c83-8be3-4c0c-b297-f64a2a1b04bc",
            "0ab78e0d-8b84-48e6-8ead-75e6842aeedf"
          ],
          "display_name": false
        },
        {
          "uuid": "68586b64-71b4-41e5-847d-686a8e5fd716",
          "name": "N-(4-METHYL-6-PROP-1-YNYLPYRIMIDIN-2-YL)ANILINE",
          "stdName": "N-(4-METHYL-6-PROP-1-YNYLPYRIMIDIN-2-YL)ANILINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5d396c79-5b97-4d5e-82fe-6176e1879f0f",
            "ac1ac546-6a24-430d-abdb-e9374d2a14a5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b95d8ed9-6274-42de-8d93-534e6bd8376c",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5d396c79-5b97-4d5e-82fe-6176e1879f0f",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe08a185-102d-4cf4-804e-7ea763a42eef",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac1ac546-6a24-430d-abdb-e9374d2a14a5",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c74d4c83-8be3-4c0c-b297-f64a2a1b04bc",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ab78e0d-8b84-48e6-8ead-75e6842aeedf",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dc95ae7c-91c8-4f71-bb23-c4937ebd3081",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba000bab-376b-43ea-babe-6c3356624562",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac3f67a9-3612-4e9d-8140-2504be5ff459",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "574097d7-e469-4407-8de4-20409de5af44",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "64b4b29a-9617-4013-b97e-22e6f4f1d85d",
          "citation": "SRS import [B150X76OJY]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=B150X76OJY",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2c2cddc-37b4-4f6e-ba1e-edceefda8f1b",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bdbc5799-71c3-4f62-9185-16362f33764b",
          "citation": "MEPANIPYRIM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "74b14e7c-4c9f-4ce2-b8f7-c8fafd55b941",
          "citation": "MEPANIPYRIM [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "51f7f9e5-0f65-72e8-f050-09daecdcddbe",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=110235-47-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "07b75c67-ddf4-fd3b-e5dd-9ed565c09758",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "3925bf0d-04c7-4462-8bfa-107eed548cb0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "604766b8-dd77-41b1-bdbb-4010ba411d60",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8f620b68-880e-4cf0-96ff-d4837c56209c",
          "id": "8f620b68-880e-4cf0-96ff-d4837c56209c",
          "molfile": "\n  Marvin  01132107262D          \n\n 17 18  0  0  0  0            999 V2000\n    9.0066   -3.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1815   -3.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3565   -3.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5315   -3.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1168   -3.1339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2918   -3.1339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8831   -2.4173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8814   -3.8402    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2916   -4.5602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8758   -5.2725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2850   -5.9888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8682   -6.7050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2764   -7.4198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1015   -7.4198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5182   -6.7149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1099   -5.9888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1166   -4.5602    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  3  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n 17  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n  9 17  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 16 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "CC#Cc1cc(C)nc(Nc2ccccc2)n1",
          "formula": "C14H13N3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d4610b32-0dd6-461f-8f00-befd2c35da27"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "223.2736",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2324baf5-f118-4abb-9b93-68371b4ebf9a",
      "version": "6",
      "structure": {
        "id": "dfe4c457-d644-4160-a5dd-5dece0e435b4",
        "molfile": "\n  Marvin  01132111362D          \n\n 17 18  0  0  0  0            999 V2000\n    6.1166   -4.5602    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5315   -3.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3565   -3.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1815   -3.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0066   -3.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1168   -3.1339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2918   -3.1339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8831   -2.4173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8814   -3.8402    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2916   -4.5602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8758   -5.2725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2850   -5.9888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8682   -6.7050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2764   -7.4198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1015   -7.4198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5182   -6.7149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1099   -5.9888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  3  0  0  0  0\n  4  5  1  0  0  0  0\n  2  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10  1  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 12  2  0  0  0  0\nM  END",
        "smiles": "CC#Cc1cc(C)nc(Nc2ccccc2)n1",
        "formula": "C14H13N3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "223.2736",
        "optical_activity": "NONE",
        "references": [
          "e2c2cddc-37b4-4f6e-ba1e-edceefda8f1b",
          "64b4b29a-9617-4013-b97e-22e6f4f1d85d"
        ],
        "stereo_centers": 0
      },
      "unii": "B150X76OJY"
    }
  ]
}