{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b02c02ef-efe6-480e-b1a0-b38c4678ea89",
          "code": "32588-76-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=32588-76-4",
          "code_system": "CAS",
          "references": [
            "8538d63e-7b9c-48b0-bea4-d592366055ba",
            "3c057638-df87-49a0-a719-bcfc073ed340"
          ]
        },
        {
          "uuid": "5d9704f2-cab7-4102-89b3-19246247bdc3",
          "code": "251-118-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.046.456",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8538d63e-7b9c-48b0-bea4-d592366055ba"
          ]
        },
        {
          "uuid": "64e77c57-c118-4c8a-8d8c-4cb71169946b",
          "code": "36183",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/36183",
          "code_system": "PUBCHEM",
          "references": [
            "8538d63e-7b9c-48b0-bea4-d592366055ba"
          ]
        },
        {
          "uuid": "e0d27303-c704-f761-2020-570d8f662142",
          "code": "7255",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7255",
          "code_system": "HSDB",
          "references": [
            "c992dd4c-b36d-f754-567e-278a4a7fd902"
          ]
        },
        {
          "uuid": "d67ca337-2a73-4c88-c241-920e84d85f41",
          "code": "DTXSID6024626",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6024626",
          "code_system": "EPA CompTox",
          "references": [
            "79735146-4e1c-1929-e1c4-0b257e10327d"
          ]
        },
        {
          "uuid": "eda3a322-0e6d-4216-a919-7162dfc48242",
          "code": "B14GGF3PP8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "27d0082b-0adb-4306-9a83-ef41475a0617",
          "name": "1,2-BIS(TETRABROMOPHTHALIMIDE)ETHANE",
          "stdName": "1,2-BIS(TETRABROMOPHTHALIMIDE)ETHANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1df5338b-8d8b-4578-9216-a4d8ca8d8fb3"
          ],
          "display_name": true
        },
        {
          "uuid": "d937d484-5c54-4ce3-b253-b2287b7c0c72",
          "name": "1,2-BIS(TETRABROMOPHTHALIMIDO)ETHANE",
          "stdName": "1,2-BIS(TETRABROMOPHTHALIMIDO)ETHANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70108e68-1ad0-41dc-b308-9bb880700e69",
            "cd305c99-8976-453c-ae39-dc64e022c0b0"
          ],
          "display_name": false
        },
        {
          "uuid": "529921bb-f8f4-4cdf-a1ab-2c06b4a3a737",
          "name": "1H-ISOINDOLE-1,3(2H)-DIONE, 2,2'-(1,2-ETHANEDIYL)BIS(4,5,6,7-TETRABROMO-",
          "stdName": "1H-ISOINDOLE-1,3(2H)-DIONE, 2,2'-(1,2-ETHANEDIYL)BIS(4,5,6,7-TETRABROMO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70108e68-1ad0-41dc-b308-9bb880700e69",
            "cd305c99-8976-453c-ae39-dc64e022c0b0"
          ],
          "display_name": false
        },
        {
          "uuid": "a6e3201c-8f51-4b62-97f5-4193e4bc6c7a",
          "name": "2,2'-(1,2-ETHANEDIYL)BIS(4,5,6,7-TETRABROMO-1H-ISOINDOLE-1,3(2H)-DIONE)",
          "stdName": "2,2'-(1,2-ETHANEDIYL)BIS(4,5,6,7-TETRABROMO-1H-ISOINDOLE-1,3(2H)-DIONE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a9162eb1-398e-4f2a-bc48-9c30fe74a534",
            "70108e68-1ad0-41dc-b308-9bb880700e69"
          ],
          "display_name": false
        },
        {
          "uuid": "9181e668-0c01-4411-971f-a00d13caba6a",
          "name": "ETHYLENE BIS(TETRABROMOPHTHALIMIDE) [HSDB]",
          "stdName": "ETHYLENE BIS(TETRABROMOPHTHALIMIDE) [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c025dced-24d0-4d03-9aa0-415d83e66627",
            "70108e68-1ad0-41dc-b308-9bb880700e69"
          ],
          "display_name": false
        },
        {
          "uuid": "cf39d6f6-8608-4f5a-91ff-62ce080707bc",
          "name": "N,N'-ETHYLENEBIS(TETRABROMOPHTHALIMIDE)",
          "stdName": "N,N'-ETHYLENEBIS(TETRABROMOPHTHALIMIDE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70108e68-1ad0-41dc-b308-9bb880700e69",
            "cd305c99-8976-453c-ae39-dc64e022c0b0"
          ],
          "display_name": false
        },
        {
          "uuid": "ac23ab68-9eda-4c27-b998-c23ff2fc9a69",
          "name": "PHTHALIMIDE, N,N'-ETHYLENEBIS(TETRABROMO-",
          "stdName": "PHTHALIMIDE, N,N'-ETHYLENEBIS(TETRABROMO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70108e68-1ad0-41dc-b308-9bb880700e69",
            "cd305c99-8976-453c-ae39-dc64e022c0b0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1df5338b-8d8b-4578-9216-a4d8ca8d8fb3",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c025dced-24d0-4d03-9aa0-415d83e66627",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "70108e68-1ad0-41dc-b308-9bb880700e69",
          "citation": "NLM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd305c99-8976-453c-ae39-dc64e022c0b0",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9162eb1-398e-4f2a-bc48-9c30fe74a534",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8538d63e-7b9c-48b0-bea4-d592366055ba",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390883000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c56e8519-7d81-4fec-b893-dba9577874e1",
          "citation": "SRS import [B14GGF3PP8]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=B14GGF3PP8",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390883000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7b1ee96-c2a8-453e-bd8d-2b30eb09262d",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c992dd4c-b36d-f754-567e-278a4a7fd902",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+32588-76-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "79735146-4e1c-1929-e1c4-0b257e10327d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=32588-76-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3c057638-df87-49a0-a719-bcfc073ed340",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "83be0612-f841-4cf0-9165-4499f2a08bf1",
          "id": "83be0612-f841-4cf0-9165-4499f2a08bf1",
          "molfile": "\n  Marvin  01132106502D          \n\n 32 35  0  0  0  0            999 V2000\n    9.7507   -6.3303    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    9.7507   -5.5053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0363   -5.0927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2517   -5.3477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9967   -6.1323    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7667   -4.6803    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9418   -4.6803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5293   -5.3947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7042   -5.3947    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2193   -6.0622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4742   -6.8468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4347   -5.8072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4347   -4.9823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2193   -4.7273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4742   -3.9427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7202   -4.5698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7202   -3.7447    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    3.0057   -4.9823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2913   -4.5698    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    3.0057   -5.8072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2913   -6.2197    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    3.7202   -6.2197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7202   -7.0448    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    8.2517   -4.0128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9967   -3.2283    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0363   -4.2678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7507   -3.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7507   -3.0303    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n   10.4652   -4.2678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1797   -3.8553    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n   10.4652   -5.0927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1797   -5.5053    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 31  2  0  0  0  0\n  4  3  1  0  0  0  0\n 26  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 24  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 14  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 22  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 16  2  0  0  0  0\n 14 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 18  2  0  0  0  0\n 20 21  1  0  0  0  0\n 22 20  1  0  0  0  0\n 22 23  1  0  0  0  0\n 24 25  2  0  0  0  0\n 24 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 27 29  2  0  0  0  0\n 29 30  1  0  0  0  0\n 29 31  1  0  0  0  0\n 31 32  1  0  0  0  0\nM  END",
          "smiles": "C(CN1C(=O)c2c(c(c(c(c2Br)Br)Br)Br)C1=O)N3C(=O)c4c(c(c(c(c4Br)Br)Br)Br)C3=O",
          "formula": "C18H4Br8N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "88fcc43f-2a2a-4a99-9bd7-52965aff69d7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "951.4643",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9af0692d-a8ee-4120-8bb6-144d43a96e49",
      "version": "6",
      "structure": {
        "id": "513ce211-ba4f-4e03-80af-a22d122bd2b6",
        "molfile": "\n  Marvin  01132104142D          \n\n 32 35  0  0  0  0            999 V2000\n    4.4347   -5.8072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4347   -4.9823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2193   -4.7273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4742   -3.9427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7042   -5.3947    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2193   -6.0622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4742   -6.8468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5293   -5.3947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9418   -4.6803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7667   -4.6803    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2517   -4.0128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0363   -4.2678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7507   -3.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4652   -4.2678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1797   -3.8553    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n   10.4652   -5.0927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7507   -5.5053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0363   -5.0927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2517   -5.3477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9967   -6.1323    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7507   -6.3303    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n   11.1797   -5.5053    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    9.7507   -3.0303    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    7.9967   -3.2283    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7202   -4.5698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0057   -4.9823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2913   -4.5698    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    3.0057   -5.8072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7202   -6.2197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7202   -7.0448    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    2.2913   -6.2197    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    3.7202   -3.7447    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  5  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 10 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 12 18  2  0  0  0  0\n 17 21  1  0  0  0  0\n 16 22  1  0  0  0  0\n 13 23  1  0  0  0  0\n 11 24  2  0  0  0  0\n  2 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 28 26  1  0  0  0  0\n 29 28  2  0  0  0  0\n  1 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 28 31  1  0  0  0  0\n 25 32  1  0  0  0  0\nM  END",
        "smiles": "C(CN1C(=O)c2c(c(c(c(c2Br)Br)Br)Br)C1=O)N3C(=O)c4c(c(c(c(c4Br)Br)Br)Br)C3=O",
        "formula": "C18H4Br8N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "951.4643",
        "optical_activity": "NONE",
        "references": [
          "f7b1ee96-c2a8-453e-bd8d-2b30eb09262d",
          "c56e8519-7d81-4fec-b893-dba9577874e1"
        ],
        "stereo_centers": 0
      },
      "unii": "B14GGF3PP8"
    }
  ]
}