{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "72ad5d09-d489-4fc3-b87f-f16ed3d58eb4",
          "code": "101-68-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=101-68-8",
          "code_system": "CAS",
          "references": [
            "a3494310-8f6c-49c0-a533-00cc55ecd41d"
          ]
        },
        {
          "uuid": "b9238da9-5f67-447c-870c-185e2f712e16",
          "code": "202-966-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.697",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "6070a0d8-90aa-4c82-879e-e84098ddf3b2"
          ]
        },
        {
          "uuid": "cd051a79-2f8f-4830-8dc6-7793f65993a8",
          "code": "7570",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7570",
          "code_system": "PUBCHEM",
          "references": [
            "6070a0d8-90aa-4c82-879e-e84098ddf3b2"
          ]
        },
        {
          "uuid": "05d9249c-9c0b-8b15-8424-48ea57ef1b40",
          "code": "2630",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2630",
          "code_system": "HSDB",
          "references": [
            "425f55f4-c261-070e-c8fb-7968553d21b3"
          ]
        },
        {
          "uuid": "f50e67ef-a329-bdb1-2beb-e26f27ded15f",
          "code": "DTXSID7025180",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7025180",
          "code_system": "EPA CompTox",
          "references": [
            "1957fb0d-5dbd-6ae0-3320-77d70aed4c13"
          ]
        },
        {
          "uuid": "0b85d835-fb54-45c5-a7f3-4364f040e6b8",
          "code": "SUB36201",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e80f847c-9d2b-3843-b617-acce0f9f23ca"
          ]
        },
        {
          "uuid": "fe64d980-17fe-4f49-8f39-9d6c1274eb36",
          "code": "B0LO6BBS8C",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "530679c7-fd1a-8e67-89b6-1755a801d435",
          "code": "53218",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:53218",
          "code_system": "CHEBI",
          "references": [
            "d60f4310-fd01-00db-d1f0-593312745cbe"
          ]
        },
        {
          "uuid": "7313a0fb-7a9b-ccfd-0c3f-fd3814e7088f",
          "code": "Methylene diphenyl diisocyanate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Methylene_diphenyl_diisocyanate",
          "code_system": "WIKIPEDIA",
          "references": [
            "323608ba-d34e-5dcc-295e-b354d1dc0840"
          ]
        },
        {
          "uuid": "b7990eef-e883-a9bb-0807-eab45969f4ad",
          "code": "100000128741",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "62e55ed6-ee62-34bd-5885-d1981f22b1a2"
          ]
        },
        {
          "uuid": "f5f51a96-8891-8165-6b13-e31d262d2231",
          "code": "9596",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=9596",
          "code_system": "NSC",
          "references": [
            "c4c0d0e8-dc03-31c8-c7a4-39f53dfcb538"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2bba686d-877a-40f4-91f4-3e3f96fc1da7",
          "name": "1,1'-METHYLENEBIS(4-ISOCYANATOBENZENE)",
          "stdName": "1,1'-METHYLENEBIS(4-ISOCYANATOBENZENE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f20e864-2f11-49e4-a2c3-dbcf44567a7b"
          ],
          "display_name": false
        },
        {
          "uuid": "f060428a-ae0f-4bd5-aaa4-d3a88ec6b52a",
          "name": "4,4'-METHYLENEDIPHENYLDIISOCYANATE",
          "stdName": "4,4'-METHYLENEDIPHENYLDIISOCYANATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1affb087-f5e9-4804-a7eb-c2acf6c6b5f0"
          ],
          "display_name": true
        },
        {
          "uuid": "9704aad3-66ca-4bc6-8d4f-82926f53cad7",
          "name": "DESMODUR 44",
          "stdName": "DESMODUR 44",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ed09052-4561-4e23-bf3c-cbc8701cffab"
          ],
          "display_name": false
        },
        {
          "uuid": "f3dc4a6d-28cc-434f-8b86-354d0320af43",
          "name": "DIPHENYLMETHANE 4,4'-DIISOCYANATE",
          "stdName": "DIPHENYLMETHANE 4,4'-DIISOCYANATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97b7cb11-b64b-483a-b6fb-6712c278cb12"
          ],
          "display_name": false
        },
        {
          "uuid": "c39215f2-1c91-420d-998f-a3d0addcb38d",
          "name": "METHYLENE BISPHENYL DIISOCYANATE [HSDB]",
          "stdName": "METHYLENE BISPHENYL DIISOCYANATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6bf4437-fbbe-46fa-83b1-850dc624882d"
          ],
          "display_name": false
        },
        {
          "uuid": "9d29eb95-b119-7330-6d88-7cc51e346123",
          "name": "METHYLENE DIPHENYL DIISOCYANATE",
          "stdName": "METHYLENE DIPHENYL DIISOCYANATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "47e03667-0e6c-0fa6-5a66-eef9040074e7"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "50b715ea-a02c-4ae0-92c4-bb443d6768d4",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "64bf84e1-9b17-4b74-8b56-c98a7ee1c92f",
          "name": "METHYLENEBIS(4-PHENYL ISOCYANATE)",
          "stdName": "METHYLENEBIS(4-PHENYL ISOCYANATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f20e864-2f11-49e4-a2c3-dbcf44567a7b"
          ],
          "display_name": false
        },
        {
          "uuid": "0abeb6cd-3f23-4c43-8db0-66b0373862d3",
          "name": "METHYLENEDIPHENYLDIISOCYANATE, 4,4'-",
          "stdName": "METHYLENEDIPHENYLDIISOCYANATE, 4,4'-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55ddb376-b101-4ba5-9315-5ec954ffe68d"
          ],
          "display_name": false
        },
        {
          "uuid": "cf7dd3eb-2ac8-469a-ab4f-cef549a1a091",
          "name": "NSC-9596",
          "stdName": "NSC-9596",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dcee3953-eaa4-490f-acc5-e7b1a1f5ea64"
          ],
          "display_name": false
        },
        {
          "uuid": "6bcdebd8-c27e-4bda-95a4-aa317dc8172f",
          "name": "PURE MDI",
          "stdName": "PURE MDI",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ed09052-4561-4e23-bf3c-cbc8701cffab"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "55ddb376-b101-4ba5-9315-5ec954ffe68d",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1affb087-f5e9-4804-a7eb-c2acf6c6b5f0",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ed09052-4561-4e23-bf3c-cbc8701cffab",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f20e864-2f11-49e4-a2c3-dbcf44567a7b",
          "citation": "DOSE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6bf4437-fbbe-46fa-83b1-850dc624882d",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "97b7cb11-b64b-483a-b6fb-6712c278cb12",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dcee3953-eaa4-490f-acc5-e7b1a1f5ea64",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6070a0d8-90aa-4c82-879e-e84098ddf3b2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390877000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6510c13f-7c52-4408-aced-c01038cb8144",
          "citation": "SRS import [B0LO6BBS8C]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=B0LO6BBS8C",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390877000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a308ebaa-5db6-4b45-9cc2-c35ea917fef4",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "425f55f4-c261-070e-c8fb-7968553d21b3",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+101-68-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1957fb0d-5dbd-6ae0-3320-77d70aed4c13",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=101-68-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a3494310-8f6c-49c0-a533-00cc55ecd41d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e80f847c-9d2b-3843-b617-acce0f9f23ca",
          "citation": "EUTCT",
          "doc_type": "EVMPD",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "47e03667-0e6c-0fa6-5a66-eef9040074e7",
          "citation": "PCPC-DB",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "323608ba-d34e-5dcc-295e-b354d1dc0840",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "d60f4310-fd01-00db-d1f0-593312745cbe",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c4c0d0e8-dc03-31c8-c7a4-39f53dfcb538",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "62e55ed6-ee62-34bd-5885-d1981f22b1a2",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1d6cceeb-8950-43e6-9a35-be35588192b0",
          "id": "1d6cceeb-8950-43e6-9a35-be35588192b0",
          "molfile": "\n  Marvin  01132101422D          \n\n 19 20  0  0  0  0            999 V2000\n    9.6646   -2.9438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6646   -3.7688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6646   -4.5938    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9502   -5.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9502   -5.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2357   -6.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5212   -5.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8068   -6.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0923   -5.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0923   -5.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3778   -4.5938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6634   -5.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6634   -5.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3778   -6.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9489   -4.5938    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2344   -5.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5200   -5.4187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5212   -5.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2357   -4.5938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 19  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7 18  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 14  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 15  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  2  0  0  0  0\n 19 18  1  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1Cc2ccc(cc2)N=C=O)N=C=O",
          "formula": "C15H10N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7b8c6033-1b89-48b0-be3b-764a7df4101a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "250.2527",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b72b7a21-d90e-4ade-bec5-f306762fe390",
      "version": "13",
      "structure": {
        "id": "934722b3-4164-4113-9b1a-1f0128d42c2e",
        "molfile": "\n  Marvin  01132107382D          \n\n 19 20  0  0  0  0            999 V2000\n    6.8068   -6.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5212   -5.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2357   -6.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9502   -5.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9502   -5.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2357   -4.5938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5212   -5.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6646   -4.5938    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6646   -3.7688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6646   -2.9438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0923   -5.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0923   -5.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3778   -4.5938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6634   -5.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6634   -5.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3778   -6.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9489   -4.5938    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2344   -5.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5200   -5.4187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  2  7  2  0  0  0  0\n  5  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  2  0  0  0  0\n  1 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 11 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  2  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1Cc2ccc(cc2)N=C=O)N=C=O",
        "formula": "C15H10N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "250.2527",
        "optical_activity": "NONE",
        "references": [
          "a308ebaa-5db6-4b45-9cc2-c35ea917fef4",
          "6510c13f-7c52-4408-aced-c01038cb8144"
        ],
        "stereo_centers": 0
      },
      "unii": "B0LO6BBS8C"
    }
  ]
}