{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a5d67f22-b688-4a15-b773-ab3c171efa64",
          "code": "26748-47-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=26748-47-0",
          "code_system": "CAS",
          "references": [
            "2f3e5fae-b73c-403f-9124-bb6ac4862f34",
            "e1bd0824-6cb9-4979-821a-90e12383168c"
          ]
        },
        {
          "uuid": "d87fe8d6-40b8-4602-9393-0d70cd6e49e0",
          "code": "247-956-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.043.582",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2f3e5fae-b73c-403f-9124-bb6ac4862f34"
          ]
        },
        {
          "uuid": "b579945f-6ca3-71dc-919a-aa9c1a8f412b",
          "code": "DTXSID6029337",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6029337",
          "code_system": "EPA CompTox",
          "references": [
            "441a6877-0a2c-523c-f537-8d84ec3b8d31"
          ]
        },
        {
          "uuid": "569b78a9-80ee-2392-77b2-6fd99cba075f",
          "code": "101871127",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/101871127",
          "code_system": "PUBCHEM",
          "references": [
            "31609937-0ea3-c90f-e3d1-694e4a0be2d3"
          ]
        },
        {
          "uuid": "b03a3456-d80a-4bd6-b4f3-9e45e0932a6b",
          "code": "B05YK2NN7H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1332e020-c62a-487d-b3f9-a38a05ed3160",
          "name": "ALPHA-CUMYL PEROXNEODECANOATE",
          "stdName": "ALPHA-CUMYL PEROXNEODECANOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec8f18b7-5b64-43bb-b6c1-5b513f53174e"
          ],
          "display_name": false
        },
        {
          "uuid": "c204b64a-10a9-4d70-9dc7-c964532e8f4d",
          "name": "ALPHA-CUMYL-PEROXYNEODECANOATE",
          "stdName": "ALPHA-CUMYL-PEROXYNEODECANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb57bf32-5a61-48b5-ba41-71751dbd6e29"
          ],
          "display_name": true
        },
        {
          "uuid": "4aef7413-2f1a-4280-8835-0d1e18421bab",
          "name": "BENZYL ALCOHOL, .ALPHA.,.ALPHA.-DIMETHYL-, PEROXYNEODECANOATE",
          "stdName": "BENZYL ALCOHOL, .ALPHA.,.ALPHA.-DIMETHYL-, PEROXYNEODECANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f787276-0f0e-48de-bd0f-fcaea44cc27c"
          ],
          "display_name": false
        },
        {
          "uuid": "58d178bc-6b99-4eaf-9390-6c8b0fbb7356",
          "name": "ESPEROX 939M",
          "stdName": "ESPEROX 939M",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "517e58e8-628e-453d-8c10-53d38767f2c3"
          ],
          "display_name": false
        },
        {
          "uuid": "dc227623-23cd-4a26-b8e5-f1ee51ba0ea7",
          "name": "KAYAESTER CND",
          "stdName": "KAYAESTER CND",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b202fdb-6e04-4534-8a6a-7aa747aa00cb"
          ],
          "display_name": false
        },
        {
          "uuid": "ec6f2278-c4a1-435a-8a28-6aef3e786390",
          "name": "LUPEROX 188",
          "stdName": "LUPEROX 188",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "517e58e8-628e-453d-8c10-53d38767f2c3"
          ],
          "display_name": false
        },
        {
          "uuid": "3a70fed1-1344-470a-b688-f6da5e09bbc8",
          "name": "LUPERSOL 188",
          "stdName": "LUPERSOL 188",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "517e58e8-628e-453d-8c10-53d38767f2c3"
          ],
          "display_name": false
        },
        {
          "uuid": "e41e7711-792c-4907-be45-c99a92ca9ae0",
          "name": "NEODECANEPEROXOIC ACID, 1-METHYL-1-PHENYLETHYL ESTER",
          "stdName": "NEODECANEPEROXOIC ACID, 1-METHYL-1-PHENYLETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "517e58e8-628e-453d-8c10-53d38767f2c3"
          ],
          "display_name": false
        },
        {
          "uuid": "5c1f06c5-46d7-4af5-a983-e87a85029416",
          "name": "PEROXYNEODECANOIC ACID, .ALPHA.,.ALPHA.-DIMETHYLBENZYL ESTER",
          "stdName": "PEROXYNEODECANOIC ACID, .ALPHA.,.ALPHA.-DIMETHYLBENZYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f787276-0f0e-48de-bd0f-fcaea44cc27c"
          ],
          "display_name": false
        },
        {
          "uuid": "05486d31-e176-4ab0-b012-2e15e098b67f",
          "name": "TRIGONOX 99",
          "stdName": "TRIGONOX 99",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "517e58e8-628e-453d-8c10-53d38767f2c3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "fb57bf32-5a61-48b5-ba41-71751dbd6e29",
          "citation": "cfsan",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3b202fdb-6e04-4534-8a6a-7aa747aa00cb",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "517e58e8-628e-453d-8c10-53d38767f2c3",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec8f18b7-5b64-43bb-b6c1-5b513f53174e",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f787276-0f0e-48de-bd0f-fcaea44cc27c",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f3e5fae-b73c-403f-9124-bb6ac4862f34",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392324000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c200802-d489-42e5-b440-30db28b89fcb",
          "citation": "SRS import [B05YK2NN7H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=B05YK2NN7H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392324000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "441a6877-0a2c-523c-f537-8d84ec3b8d31",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=26748-47-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "31609937-0ea3-c90f-e3d1-694e4a0be2d3",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "e1bd0824-6cb9-4979-821a-90e12383168c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d48285e8-d2bd-49df-bb2d-19ffc8d7f646",
          "id": "d48285e8-d2bd-49df-bb2d-19ffc8d7f646",
          "molfile": "\n  Marvin  01132111012D          \n\n 22 22  0  0  0  0            999 V2000\n    2.3719   -4.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0864   -4.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8008   -4.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5153   -4.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2298   -4.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9442   -4.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6587   -4.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2462   -5.5850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0713   -5.5850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3732   -4.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3732   -3.6330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0877   -4.8706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8022   -4.4580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5167   -4.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9291   -5.5850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1041   -5.5850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2311   -4.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2311   -3.6330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9456   -3.2205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6601   -3.6330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6600   -4.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9456   -4.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n 10  7  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 22  2  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCC(C)(C)C(=O)OOC(C)(C)c1ccccc1",
          "formula": "C19H30O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "dd70e5d1-f0a4-4c8e-a52a-8677afcb7b77"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "306.4404",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "REPRESENTATIVE",
      "uuid": "55875b45-3699-490e-bd99-d4449f08be64",
      "version": "5",
      "structure": {
        "id": "fc1234b8-86a3-4fa4-83f6-afaac4153f37",
        "molfile": "\n  Marvin  01132113032D          \n\n 22 22  0  0  0  0            999 V2000\n    7.3732   -4.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0877   -4.8706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8022   -4.4580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5167   -4.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9291   -5.5850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2311   -4.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2311   -3.6330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9456   -3.2205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6601   -3.6330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6600   -4.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9456   -4.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1041   -5.5850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3732   -3.6330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6587   -4.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2462   -5.5850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0713   -5.5850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9442   -4.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2298   -4.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5153   -4.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8008   -4.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0864   -4.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3719   -4.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n  6 11  1  0  0  0  0\n  4 12  1  0  0  0  0\n  1 13  2  0  0  0  0\n  1 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCC(C)(C)C(=O)OOC(C)(C)c1ccccc1",
        "formula": "C19H30O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "306.4404",
        "optical_activity": "NONE",
        "references": [
          "8c200802-d489-42e5-b440-30db28b89fcb",
          "3b202fdb-6e04-4534-8a6a-7aa747aa00cb"
        ],
        "stereo_centers": 0
      },
      "unii": "B05YK2NN7H"
    }
  ]
}