{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "24149e89-859f-41d3-8f11-784f84c34993",
          "code": "90982-32-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=90982-32-4",
          "code_system": "CAS",
          "references": [
            "eeef380a-f43e-4ed8-bf04-219d32e84aab",
            "d2304856-4e13-494e-b4f6-4dde9779a350"
          ]
        },
        {
          "uuid": "f98340da-91fc-46b6-8d37-e266e185aaac",
          "code": "C112343",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67112343",
          "code_system": "MESH",
          "references": [
            "eeef380a-f43e-4ed8-bf04-219d32e84aab"
          ]
        },
        {
          "uuid": "9820e660-cea8-4d63-a37d-802b1731c77d",
          "code": "m3364",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3364?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "eeef380a-f43e-4ed8-bf04-219d32e84aab"
          ]
        },
        {
          "uuid": "bea0a93a-88ad-43c9-bb19-53619a9d2a84",
          "code": "56160",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/56160",
          "code_system": "PUBCHEM",
          "references": [
            "eeef380a-f43e-4ed8-bf04-219d32e84aab"
          ]
        },
        {
          "uuid": "9863557d-5dcb-42a9-9aed-c99e4b56f3f6",
          "code": "6850",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6850",
          "code_system": "HSDB",
          "references": [
            "4c69fe9f-73fc-0670-81c5-8007f4d7702f"
          ]
        },
        {
          "uuid": "2bef2539-051e-39f4-b8ce-14cf2f430efe",
          "code": "DTXSID0023955",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0023955",
          "code_system": "EPA CompTox",
          "references": [
            "8d3c498b-725f-4908-473a-cf5e0c2986c8"
          ]
        },
        {
          "uuid": "ffcda903-a94b-4ae5-b93e-7c8f2dc5ae84",
          "code": "B00AW0IM5Q",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2010ee64-79d8-c341-724f-d321945768a4",
          "code": "47319",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:47319",
          "code_system": "CHEBI",
          "references": [
            "f214b1c0-92e6-4622-11d7-3a89a8303321"
          ]
        },
        {
          "uuid": "baa5d0b2-fa39-e626-e93c-b5d6b683df55",
          "code": "chlorimuron-ethyl",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/chlorimuron-ethyl.html",
          "code_system": "ALANWOOD",
          "references": [
            "35c70d73-ba7f-846f-6a81-07f6c2feddf1"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "60bc5940-52a6-4308-b491-86cac29bf79b",
          "name": "CHLORIMURON ETHYL ESTER",
          "stdName": "CHLORIMURON ETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f697f86b-74a1-4b9f-9c24-5d5671cc3080",
            "969f67e1-1a0e-4d23-a93b-c8387210ff45"
          ],
          "display_name": false
        },
        {
          "uuid": "9f155625-07d8-416f-b4be-f94c77a5a5aa",
          "name": "CHLORIMURON-ETHYL",
          "stdName": "CHLORIMURON-ETHYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f697f86b-74a1-4b9f-9c24-5d5671cc3080",
            "4f689d08-af16-4eb9-9c38-deb53361ee73",
            "8ac946b0-5832-4a1a-864b-e84c3c7769c8",
            "d423b089-edd0-4897-8635-e980a03ccc7a",
            "ad5807af-ed3a-4501-a638-a0899710d549",
            "84af24cc-b9ca-42e6-be1d-53450494c05a",
            "cba4cbee-2209-4099-b15b-3881089739bf",
            "37ab9deb-647a-4f0f-9af1-70c8c656233b"
          ],
          "display_name": true
        },
        {
          "uuid": "a2715135-9c13-4f6d-ab4e-edc0dd6bb00c",
          "name": "CHLORIMURON-ETHYL [HSDB]",
          "stdName": "CHLORIMURON-ETHYL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f697f86b-74a1-4b9f-9c24-5d5671cc3080",
            "d423b089-edd0-4897-8635-e980a03ccc7a"
          ],
          "display_name": false
        },
        {
          "uuid": "af465ffd-2dd8-4dc3-97cd-56f9df2d62e7",
          "name": "CHLORIMURON-ETHYL [ISO]",
          "stdName": "CHLORIMURON-ETHYL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f697f86b-74a1-4b9f-9c24-5d5671cc3080",
            "cba4cbee-2209-4099-b15b-3881089739bf"
          ],
          "display_name": false
        },
        {
          "uuid": "dd5435de-a4d0-42dd-8174-213c37b8b8c6",
          "name": "CHLORIMURON-ETHYL [MI]",
          "stdName": "CHLORIMURON-ETHYL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f697f86b-74a1-4b9f-9c24-5d5671cc3080",
            "ad5807af-ed3a-4501-a638-a0899710d549"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4f689d08-af16-4eb9-9c38-deb53361ee73",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ad5807af-ed3a-4501-a638-a0899710d549",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f697f86b-74a1-4b9f-9c24-5d5671cc3080",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d423b089-edd0-4897-8635-e980a03ccc7a",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "969f67e1-1a0e-4d23-a93b-c8387210ff45",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cba4cbee-2209-4099-b15b-3881089739bf",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eeef380a-f43e-4ed8-bf04-219d32e84aab",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390916000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d9fdec4d-104e-4b15-9bdc-de0f895830f2",
          "citation": "SRS import [B00AW0IM5Q]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=B00AW0IM5Q",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390916000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aec01d16-2411-4c3e-b7bd-79cc15520f90",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "84af24cc-b9ca-42e6-be1d-53450494c05a",
          "citation": "CHLORIMURON-ETHYL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8ac946b0-5832-4a1a-864b-e84c3c7769c8",
          "citation": "CHLORIMURON-ETHYL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "37ab9deb-647a-4f0f-9af1-70c8c656233b",
          "citation": "CHLORIMURON-ETHYL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4c69fe9f-73fc-0670-81c5-8007f4d7702f",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+90982-32-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8d3c498b-725f-4908-473a-cf5e0c2986c8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=90982-32-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "35c70d73-ba7f-846f-6a81-07f6c2feddf1",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "f214b1c0-92e6-4622-11d7-3a89a8303321",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d2304856-4e13-494e-b4f6-4dde9779a350",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fbb715cf-e04d-4a70-857f-5a679e6cad85",
          "id": "fbb715cf-e04d-4a70-857f-5a679e6cad85",
          "molfile": "\n  Marvin  01132113022D          \n\n 27 28  0  0  0  0            999 V2000\n    2.5861   -4.1464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3002   -4.5597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0219   -4.1425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7397   -4.5558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4461   -4.1349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7397   -5.3785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0256   -5.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0256   -6.6146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7397   -7.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4500   -6.6146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4500   -5.7803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1640   -5.3710    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4461   -4.9577    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8735   -4.9538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8735   -5.7803    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5837   -5.3710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5837   -4.5444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2978   -5.7803    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0195   -5.3710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0195   -4.5444    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7183   -4.1349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7183   -3.3122    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   10.4361   -4.5444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4361   -5.3710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1578   -5.7803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8681   -5.3710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7220   -5.7803    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 11  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  2  0  0  0  0\n 12 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 27  2  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 24 23  2  0  0  0  0\n 24 25  1  0  0  0  0\n 27 24  1  0  0  0  0\n 25 26  1  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)c1ccccc1S(=O)(=O)NC(=O)Nc2nc(cc(n2)OC)Cl",
          "formula": "C15H15ClN4O6S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1d05954b-063a-4520-b16d-6420d1fb8fd4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "414.8224",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e9c302a3-129b-477f-a471-e73809cb3099",
      "version": "6",
      "structure": {
        "id": "4ae74762-6f52-48a8-baef-d0755f46d1c0",
        "molfile": "\n  Marvin  01132103552D          \n\n 27 28  0  0  0  0            999 V2000\n    4.7397   -5.3785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4500   -5.7803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1640   -5.3710    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8735   -5.7803    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5837   -5.3710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2978   -5.7803    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0195   -5.3710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7220   -5.7803    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4361   -5.3710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4361   -4.5444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7183   -4.1349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0195   -4.5444    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7183   -3.3122    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   11.1578   -5.7803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8681   -5.3710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5837   -4.5444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4461   -4.9577    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8735   -4.9538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4500   -6.6146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7397   -7.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0256   -6.6146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0256   -5.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7397   -4.5558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0219   -4.1425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3002   -4.5597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5861   -4.1464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4461   -4.1349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n  7 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n  9 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n  5 16  2  0  0  0  0\n  3 17  2  0  0  0  0\n  3 18  2  0  0  0  0\n  2 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n  1 22  1  0  0  0  0\n  1 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 23 27  2  0  0  0  0\nM  END",
        "smiles": "CCOC(=O)c1ccccc1S(=O)(=O)NC(=O)Nc2nc(cc(n2)OC)Cl",
        "formula": "C15H15ClN4O6S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "414.8224",
        "optical_activity": "NONE",
        "references": [
          "aec01d16-2411-4c3e-b7bd-79cc15520f90",
          "d9fdec4d-104e-4b15-9bdc-de0f895830f2"
        ],
        "stereo_centers": 0
      },
      "unii": "B00AW0IM5Q"
    }
  ]
}