{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b7c047e7-3c9a-44ab-bbbd-eeac64b49acc",
          "code": "2095-06-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2095-06-9",
          "code_system": "CAS",
          "references": [
            "8b7f7e63-5745-4da8-8b95-ef88fa5f2f38",
            "09a9a27f-f7d7-497e-b64e-35175f6e93aa"
          ]
        },
        {
          "uuid": "3019a2a1-1cb9-4b9f-8e18-13b794f3c963",
          "code": "218-259-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.016.599",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8b7f7e63-5745-4da8-8b95-ef88fa5f2f38"
          ]
        },
        {
          "uuid": "1680b2e8-51ab-4d18-b993-7df1b56b0014",
          "code": "16412",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16412",
          "code_system": "PUBCHEM",
          "references": [
            "8b7f7e63-5745-4da8-8b95-ef88fa5f2f38"
          ]
        },
        {
          "uuid": "a293bf63-7445-7549-4c28-de256673928d",
          "code": "DTXSID50862832",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50862832",
          "code_system": "EPA CompTox",
          "references": [
            "60bcabde-0505-6431-47b5-e19f7603aed1"
          ]
        },
        {
          "uuid": "8858ec52-8de2-41e6-b071-67b8669ab748",
          "code": "AZG5ZPK0BD",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4416daf7-b81e-3970-1d32-170050267d8c",
          "code": "35364",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=35364",
          "code_system": "NSC",
          "references": [
            "d04535a0-fc8c-b39c-3d77-9c8fb0f516d9"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "41d01ed5-c7c1-42c5-b19d-d33b0ed7e2a8",
          "name": "2-OXIRANEMETHANAMINE, N-(2-OXIRANYLMETHYL)-N-PHENYL-",
          "stdName": "2-OXIRANEMETHANAMINE, N-(2-OXIRANYLMETHYL)-N-PHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f649a1d-f2a6-4a49-84f7-e89da514ea97"
          ],
          "display_name": false
        },
        {
          "uuid": "c10be9a5-4389-43ba-83a5-9da6ccedb21a",
          "name": "DIGLYCIDYLANILINE",
          "stdName": "DIGLYCIDYLANILINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c194d091-9a69-42c2-9155-7a976e0e0dd4"
          ],
          "display_name": true
        },
        {
          "uuid": "5df4b4bd-121f-4292-a6e8-2a67b1b574c6",
          "name": "N,N-DIGLYCIDYLANILINE",
          "stdName": "N,N-DIGLYCIDYLANILINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f649a1d-f2a6-4a49-84f7-e89da514ea97"
          ],
          "display_name": false
        },
        {
          "uuid": "b0a0942f-7a8e-47df-9fd8-8784caff5cf5",
          "name": "N,N-DIGLYCIDYLPHENYLAMINE",
          "stdName": "N,N-DIGLYCIDYLPHENYLAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f649a1d-f2a6-4a49-84f7-e89da514ea97"
          ],
          "display_name": false
        },
        {
          "uuid": "c8e2ee95-92ea-49cc-8925-c24f024a57d3",
          "name": "N-(2-OXIRANYLMETHYL)-N-PHENYL-2-OXIRANEMETHANAMINE",
          "stdName": "N-(2-OXIRANYLMETHYL)-N-PHENYL-2-OXIRANEMETHANAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f649a1d-f2a6-4a49-84f7-e89da514ea97"
          ],
          "display_name": false
        },
        {
          "uuid": "b2debd24-d7cd-4d99-b8fe-24daef357c35",
          "name": "NSC-35364",
          "stdName": "NSC-35364",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f649a1d-f2a6-4a49-84f7-e89da514ea97"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c194d091-9a69-42c2-9155-7a976e0e0dd4",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0f649a1d-f2a6-4a49-84f7-e89da514ea97",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b7f7e63-5745-4da8-8b95-ef88fa5f2f38",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392314000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe463cdf-2d28-484a-b6fa-bd589d6eff64",
          "citation": "SRS import [AZG5ZPK0BD]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=AZG5ZPK0BD",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392314000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d04535a0-fc8c-b39c-3d77-9c8fb0f516d9",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "60bcabde-0505-6431-47b5-e19f7603aed1",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "09a9a27f-f7d7-497e-b64e-35175f6e93aa",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "cd248613-3d26-4b24-940a-4cea8b35aeda",
          "id": "cd248613-3d26-4b24-940a-4cea8b35aeda",
          "molfile": "\n  Marvin  01132110362D          \n\n 15 17  0  0  0  0            999 V2000\n    2.2130   -2.7819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8800   -3.2096    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.6922   -3.1939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2724   -3.9237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1776   -1.9579    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8800   -1.5107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9153   -0.7102    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.5190    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3587   -0.0275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4400   -1.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4400   -0.7180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7298   -0.2982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.7180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7298   -1.9658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  5  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 15  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)N(CC2CO2)CC3CO3",
          "formula": "C12H15NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f33731fc-833b-4ad7-88f5-9c5db3f29fc2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "205.2535",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d6f550f9-7425-4c30-9da2-8aad3504308b",
      "version": "6",
      "structure": {
        "id": "8e177efb-c678-46b0-a082-ca2fb3462d78",
        "molfile": "\n  Marvin  01132107222D          \n\n 15 17  0  0  0  0            999 V2000\n    3.3587   -0.0275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2724   -3.9237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1776   -1.9579    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9153   -0.7102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8800   -3.2096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5190    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6922   -3.1939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2130   -2.7819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8800   -1.5107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4400   -1.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7298   -1.9658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4400   -0.7180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7298   -0.2982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.7180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  4  1  0  0  0  0\n  1  6  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  7  1  0  0  0  0\n  3  9  1  0  0  0  0\n  3  8  1  0  0  0  0\n  3 10  1  0  0  0  0\n  4  9  1  0  0  0  0\n  4  6  1  0  0  0  0\n  5  8  1  0  0  0  0\n  5  7  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n 11 14  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 15  2  0  0  0  0\n 14 15  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)N(CC2CO2)CC3CO3",
        "formula": "C12H15NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "205.2535",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "c194d091-9a69-42c2-9155-7a976e0e0dd4",
          "fe463cdf-2d28-484a-b6fa-bd589d6eff64"
        ],
        "stereo_centers": 2
      },
      "unii": "AZG5ZPK0BD"
    }
  ]
}