{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d2d436f4-922d-4d64-99fe-20bbdcd6db26", "code": "67924-13-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=67924-13-4", "code_system": "CAS", "references": [ "9d1f99fa-d5f6-402b-a967-71c6acbdd943", "e94d75ae-28ac-420c-b51c-70ce53685e7d" ] }, { "uuid": "670a1d32-832a-47b4-8a2f-9f05cd454673", "code": "267-798-2", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.061.616", "code_system": "ECHA (EC/EINECS)", "references": [ "9d1f99fa-d5f6-402b-a967-71c6acbdd943" ] }, { "uuid": "291c9230-bd72-44ba-90f1-59c55aca9ba6", "code": "AY7KR95P3W", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "e94d75ae-28ac-420c-b51c-70ce53685e7d" ] }, { "uuid": "98560f00-f0e3-a524-e47d-bd815e49cf7f", "code": "DTXSID5070860", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5070860", "code_system": "EPA CompTox", "references": [ "3400a4fc-d4e3-4d46-ec05-851455d8d821" ] }, { "uuid": "fa903a90-a6db-cabf-22f2-c339997a4f42", "code": "106164", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/106164", "code_system": "PUBCHEM", "references": [ "9dc66629-26c4-763c-3af6-c7a6f2d44ceb" ] } ], "substance_class": "chemical", "names": [ { "uuid": "f4456720-aba7-41ec-93de-e5e84bad40b9", "name": "BENZOIC ACID, 2-((2-(PHENYLMETHYLENE)OCTYLIDENE)AMINO)-, METHYL ESTER", "stdName": "BENZOIC ACID, 2-((2-(PHENYLMETHYLENE)OCTYLIDENE)AMINO)-, METHYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "eedb2b29-1679-4daa-820b-493495bc6fba" ], "display_name": false }, { "uuid": "d8813b8f-a6b8-48b2-9500-60316e6852db", "name": "Jasmea", "stdName": "JASMEA", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e94d75ae-28ac-420c-b51c-70ce53685e7d" ], "display_name": true }, { "uuid": "4752c56f-301c-4f27-a481-5d908a073938", "name": "Methyl 2-[[2-(phenylmethylene)octylidene]amino]benzoate", "stdName": "METHYL 2-((2-(PHENYLMETHYLENE)OCTYLIDENE)AMINO)BENZOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e94d75ae-28ac-420c-b51c-70ce53685e7d" ], "display_name": false } ], "references": [ { "uuid": "eedb2b29-1679-4daa-820b-493495bc6fba", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9d1f99fa-d5f6-402b-a967-71c6acbdd943", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392525000, "tags": [ "NOMEN" ] }, { "uuid": "aea68f7c-4044-453a-3008-5ee221e15194", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=67924-13-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e94d75ae-28ac-420c-b51c-70ce53685e7d", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "9dc66629-26c4-763c-3af6-c7a6f2d44ceb", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "3400a4fc-d4e3-4d46-ec05-851455d8d821", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "860e3529-a9fb-4d7d-a133-f79cc9ae3f26", "id": "860e3529-a9fb-4d7d-a133-f79cc9ae3f26", "molfile": "\n Marvin 03292310042D \n\n 26 27 0 0 0 0 999 V2000\n 2.8579 4.1251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 3.7126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2868 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0013 2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7158 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4303 2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1447 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8592 2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 5.3625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 4.1251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 5.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 5.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 6.1876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 6.1876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 6.6001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 3 0 0 0\n 1 15 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 3 0 0 0\n 3 5 1 0 0 0 0\n 4 21 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 2 0 0 0 0\n 11 16 1 0 0 0 0\n 12 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 15 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 17 19 2 0 0 0 0\n 18 20 2 0 0 0 0\n 19 20 1 0 0 0 0\n 21 22 2 0 0 0 0\n 21 23 1 0 0 0 0\n 22 24 1 0 0 0 0\n 23 25 2 0 0 0 0\n 24 26 2 0 0 0 0\n 25 26 1 0 0 0 0\nM END", "smiles": "CCCCCCC(=Cc1ccccc1)C=Nc2ccccc2C(=O)OC", "formula": "C23H27NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "93654ada-7c12-49c0-ad12-a30269cda5a5" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "349.4668", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "4dbbaefa-079b-4e40-b30c-3117a83d9af0", "version": "8", "structure": { "id": "c85b0ede-ec1f-4a8c-8c99-8f4def8a98be", "molfile": "Methyl 2-[[2-(phenylmethylene)octylidene]amino]benzoate\n JSDraw203292310042D\n\n 26 27 0 0 0 0 0 V2000\n 22.8494 -6.2400 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2004 -7.0200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2004 -8.5801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8494 -9.3601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.5514 -9.3601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.9023 -8.5801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2535 -9.3601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6044 -8.5801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.9554 -9.3601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.3065 -8.5801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.1473 -4.6801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7964 -3.9001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.1473 -6.2400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4454 -4.6801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8494 -4.6801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4983 -3.9001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2004 -3.9001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4983 -2.3400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2004 -2.3400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8494 -1.5600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8494 -10.9201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2004 -11.7001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4983 -11.7001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2004 -13.2602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4983 -13.2602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8494 -14.0402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 3 0 0 0\n 1 15 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 3 0 0 0\n 3 5 1 0 0 0 0\n 4 21 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 2 0 0 0 0\n 11 16 1 0 0 0 0\n 12 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 15 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 17 19 2 0 0 0 0\n 18 20 2 0 0 0 0\n 19 20 1 0 0 0 0\n 21 22 2 0 0 0 0\n 21 23 1 0 0 0 0\n 22 24 1 0 0 0 0\n 23 25 2 0 0 0 0\n 24 26 2 0 0 0 0\n 25 26 1 0 0 0 0\nM END", "smiles": "CCCCCCC(=Cc1ccccc1)C=Nc2ccccc2C(=O)OC", "formula": "C23H27NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "349.4668", "optical_activity": "NONE", "references": [ "eedb2b29-1679-4daa-820b-493495bc6fba", "e94d75ae-28ac-420c-b51c-70ce53685e7d" ], "stereo_centers": 0 }, "unii": "AY7KR95P3W" } ] }