{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "b1f30950-90a5-4ebb-bf16-f0ac3982be8d", "code": "35958-30-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=35958-30-6", "code_system": "CAS", "references": [ "f2dabd01-150e-4c31-9f4d-88c4f281fa64", "b5c751b5-dba7-4bc5-ae28-4c6800096d42" ] }, { "uuid": "97291e14-79ba-4cf5-862f-3ee2e2f2ccc1", "code": "118899", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/118899", "code_system": "PUBCHEM", "references": [ "f2dabd01-150e-4c31-9f4d-88c4f281fa64" ] }, { "uuid": "6c989c8c-475c-4ceb-8a46-4ed55fbf71e0", "code": "252-816-3", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.048.001", "code_system": "ECHA (EC/EINECS)", "references": [ "f2dabd01-150e-4c31-9f4d-88c4f281fa64" ] }, { "uuid": "d8a1e0e6-c2db-7cee-c8c2-f26641c0c612", "code": "DTXSID4038899", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4038899", "code_system": "EPA CompTox", "references": [ "56fbe141-8121-06c5-1322-4f9c1acaa411" ] }, { "uuid": "4ce30720-32ae-4576-87ff-7746b46fde92", "code": "AY30042JFF", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "e3cc6440-4c24-4162-9040-d1cc91b1e9d8", "name": "1,1-BIS(3,5-DI-TERT-BUTYL-2-HYDROXYPHENYL)ETHANE", "stdName": "1,1-BIS(3,5-DI-TERT-BUTYL-2-HYDROXYPHENYL)ETHANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "29810a2d-4762-4063-8c85-fd9b659bc2bf", "ad1f565f-1635-4f82-a4a4-88115a3a1571" ], "display_name": false }, { "uuid": "8c18aee6-3222-4cfc-bf9b-49b3b14622b0", "name": "2,2'-ETHYLIDENEBIS(4,6-DI-TERT- BUTYLPHENOL)", "stdName": "2,2'-ETHYLIDENEBIS(4,6-DI-TERT- BUTYLPHENOL)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ad1f565f-1635-4f82-a4a4-88115a3a1571", "5407ca45-cc09-430b-81b2-047399b64409" ], "display_name": false }, { "uuid": "535f692c-6203-424e-a92f-9c3fa2ec0a31", "name": "2,2'-ETHYLIDENEBIS(4,6-DI-TERT-BUTYLPHENOL)", "stdName": "2,2'-ETHYLIDENEBIS(4,6-DI-TERT-BUTYLPHENOL)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "29810a2d-4762-4063-8c85-fd9b659bc2bf", "ad1f565f-1635-4f82-a4a4-88115a3a1571" ], "display_name": false }, { "uuid": "97eb731e-e720-4681-ab64-4ecdab0da2a8", "name": "PHENOL, 2,2'-ETHYLLIDENEBIS(4,6-BIS(1,1-DIMETHYLETHYL)-", "stdName": "PHENOL, 2,2'-ETHYLLIDENEBIS(4,6-BIS(1,1-DIMETHYLETHYL)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ad1f565f-1635-4f82-a4a4-88115a3a1571", "b6e98f6e-1ee8-4650-afe3-05047e75b179" ], "display_name": false }, { "uuid": "b9a23644-3568-4a32-80b0-468403350a78", "name": "TETRABUTYL ETHYLIDENEBISPHENOL", "stdName": "TETRABUTYL ETHYLIDENEBISPHENOL", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "ad1f565f-1635-4f82-a4a4-88115a3a1571", "b6e98f6e-1ee8-4650-afe3-05047e75b179", "d5feed57-3a00-4962-970d-f9cf5bdb33d9" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "c9cc98d2-95b4-45b6-a7c7-6409eee955a3", "name_org": "INCI" } ] }, { "uuid": "632fbc8c-a859-4176-bc30-783cfae86741", "name": "TINOGARD NOA", "stdName": "TINOGARD NOA", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "ad1f565f-1635-4f82-a4a4-88115a3a1571", "b6e98f6e-1ee8-4650-afe3-05047e75b179" ], "display_name": false } ], "references": [ { "uuid": "b6e98f6e-1ee8-4650-afe3-05047e75b179", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "ad1f565f-1635-4f82-a4a4-88115a3a1571", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "29810a2d-4762-4063-8c85-fd9b659bc2bf", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5407ca45-cc09-430b-81b2-047399b64409", "citation": "CEDI", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f2dabd01-150e-4c31-9f4d-88c4f281fa64", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391624000, "tags": [ "NOMEN" ] }, { "uuid": "878ddd93-9226-4230-94be-1347094e0585", "citation": "SRS import [AY30042JFF]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=AY30042JFF", "doc_type": "SRS", "public_domain": true, "document_date": 1493391624000, "tags": [ "NOMEN" ] }, { "uuid": "d5feed57-3a00-4962-970d-f9cf5bdb33d9", "citation": "TETRABUTYL ETHYLIDENEBISPHENOL [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "56fbe141-8121-06c5-1322-4f9c1acaa411", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=35958-30-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "b5c751b5-dba7-4bc5-ae28-4c6800096d42", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "beb52c5d-fb95-41f0-8324-cf34ade276cf", "id": "beb52c5d-fb95-41f0-8324-cf34ade276cf", "molfile": "\n Marvin 01132109522D \n\n 32 33 0 0 0 0 999 V2000\n 9.3832 -2.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3832 -3.2975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0923 -3.7015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0923 -4.5265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8157 -4.9390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5361 -4.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5361 -3.6930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8043 -3.2890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8043 -2.4697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2481 -3.2890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9543 -2.8935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1715 -2.4679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9928 -3.8179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8157 -5.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5327 -6.0421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0484 -6.0858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8157 -6.5691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6712 -3.7100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6712 -4.5350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9564 -4.9503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2445 -4.5350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2445 -3.7100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9564 -3.2975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9564 -2.4781 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5325 -3.2975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8347 -2.8850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8771 -3.8263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7048 -2.3843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9564 -5.7668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7927 -5.9632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1484 -6.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9564 -6.6031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 18 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 8 2 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 5 14 1 0 0 0 0\n 7 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 7 10 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 10 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 14 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 23 2 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 20 29 1 0 0 0 0\n 22 21 2 0 0 0 0\n 23 22 1 0 0 0 0\n 22 25 1 0 0 0 0\n 23 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 27 1 0 0 0 0\n 25 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 31 1 0 0 0 0\n 29 32 1 0 0 0 0\nM END", "smiles": "CC(c1cc(cc(c1O)C(C)(C)C)C(C)(C)C)c2cc(cc(c2O)C(C)(C)C)C(C)(C)C", "formula": "C30H46O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "3088b9a0-7836-4017-bcde-89d554c91fb7" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "438.6862", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "2249d852-086f-4e58-8175-c64cd29852e1", "version": "5", "structure": { "id": "3623edba-9575-426e-9c60-1b851752113e", "molfile": "\n Marvin 01132102532D \n\n 32 33 0 0 0 0 999 V2000\n 8.6712 -3.7100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3832 -3.2975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0923 -3.7015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8043 -3.2890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5361 -3.6930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5361 -4.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8157 -4.9390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0923 -4.5265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8157 -5.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5327 -6.0421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0484 -6.0858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8157 -6.5691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2481 -3.2890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9543 -2.8935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1715 -2.4679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9928 -3.8179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8043 -2.4697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3832 -2.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9564 -3.2975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2445 -3.7100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2445 -4.5350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9564 -4.9503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6712 -4.5350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9564 -5.7668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7927 -5.9632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1484 -6.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9564 -6.6031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5325 -3.2975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8347 -2.8850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8771 -3.8263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7048 -2.3843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9564 -2.4781 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 7 6 1 0 0 0 0\n 3 8 1 0 0 0 0\n 8 7 2 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 9 12 1 0 0 0 0\n 5 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 13 16 1 0 0 0 0\n 4 17 1 0 0 0 0\n 2 18 1 0 0 0 0\n 1 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 22 21 2 0 0 0 0\n 1 23 2 0 0 0 0\n 23 22 1 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 26 1 0 0 0 0\n 24 27 1 0 0 0 0\n 20 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 28 30 1 0 0 0 0\n 28 31 1 0 0 0 0\n 19 32 1 0 0 0 0\nM END", "smiles": "CC(c1cc(cc(c1O)C(C)(C)C)C(C)(C)C)c2cc(cc(c2O)C(C)(C)C)C(C)(C)C", "formula": "C30H46O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "438.6862", "optical_activity": "NONE", "references": [ "29810a2d-4762-4063-8c85-fd9b659bc2bf", "878ddd93-9226-4230-94be-1347094e0585" ], "stereo_centers": 0 }, "unii": "AY30042JFF" } ] }