{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7de95d60-169f-48ec-8742-2bcdc8304c91",
          "code": "ASL8EG8UB2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d9ad2322-b590-4b47-90a4-6d5d1955217a",
          "code": "5398-34-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5398-34-5",
          "code_system": "CAS",
          "references": [
            "618527d2-a8f7-4fdb-97ff-e0571fc8e406"
          ]
        },
        {
          "uuid": "741c936c-7bde-3add-6612-bf3dc393ef80",
          "code": "13152118",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13152118",
          "code_system": "PUBCHEM",
          "references": [
            "15ac12d2-f31b-ac14-956d-c4d6af4607a1"
          ]
        },
        {
          "uuid": "155e8aa9-5d72-a1cb-b866-01e3469dfc14",
          "code": "4460",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=4460",
          "code_system": "NSC",
          "references": [
            "cd6bb257-ac47-c0be-7ea8-1c4d436abb7e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "e25346f7-913e-4b4d-8f5b-03eda3596c14",
          "amount": {
            "uuid": "8eb17e22-392b-4494-9b03-bafef5fba087"
          },
          "type": "PARENT->SALT/SOLVATE",
          "references": [
            "618527d2-a8f7-4fdb-97ff-e0571fc8e406"
          ],
          "related_substance": {
            "uuid": "099c7263-28e4-4788-987d-5544f13231a4",
            "refuuid": "ea0c9b33-f750-457f-ac8c-9d0866519c11",
            "name": "8-AMINO-1,3,6-NAPHTHALENETRISULFONIC ACID",
            "unii": "D33V8NB7KB",
            "linking_id": "D33V8NB7KB",
            "ref_pname": "8-AMINO-1,3,6-NAPHTHALENETRISULFONIC ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3a9a1da8-b0c7-4830-86d5-6ef0e1ba0db3",
          "name": "1,3,6-NAPHTHALENETRISULFONIC ACID, 8-AMINO-, SODIUM SALT (1:2)",
          "stdName": "1,3,6-NAPHTHALENETRISULFONIC ACID, 8-AMINO-, SODIUM SALT (1:2)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "618527d2-a8f7-4fdb-97ff-e0571fc8e406"
          ],
          "display_name": false
        },
        {
          "uuid": "1c0b11c9-5303-444d-b4a2-73fde82845a6",
          "name": "8-AMINO-1,3,6-NAPHTHALENETRISULFONIC ACID DISODIUM SALT",
          "stdName": "8-AMINO-1,3,6-NAPHTHALENETRISULFONIC ACID DISODIUM SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "618527d2-a8f7-4fdb-97ff-e0571fc8e406"
          ],
          "display_name": false
        },
        {
          "uuid": "830a224e-67a6-4cd3-940b-6d3ccf6bbad7",
          "name": "ANTS",
          "stdName": "ANTS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "618527d2-a8f7-4fdb-97ff-e0571fc8e406"
          ],
          "display_name": false
        },
        {
          "uuid": "70838eb5-fc70-4e83-bc25-7c5fc324d31c",
          "name": "DISODIUM 1-AMINONAPHTHALENE-3,6,8-TRISULFONATE",
          "stdName": "DISODIUM 1-AMINONAPHTHALENE-3,6,8-TRISULFONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "618527d2-a8f7-4fdb-97ff-e0571fc8e406"
          ],
          "display_name": false
        },
        {
          "uuid": "a28865f1-b260-468a-b734-80754418a6aa",
          "name": "DISODIUM 8-AMINO-1,3,6-NAPHTHALENETRISULFONATE",
          "stdName": "DISODIUM 8-AMINO-1,3,6-NAPHTHALENETRISULFONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "618527d2-a8f7-4fdb-97ff-e0571fc8e406"
          ],
          "display_name": true
        },
        {
          "uuid": "7bc8b1ec-6628-423c-9c96-70a0cdb5b360",
          "name": "DISODIUM HYDROGEN 8-AMINONAPHTHALENE-1,3,6-TRISULPHONATE",
          "stdName": "DISODIUM HYDROGEN 8-AMINONAPHTHALENE-1,3,6-TRISULPHONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8071c09f-603b-4bf4-9aef-cfea64a4dcc8"
          ],
          "display_name": false
        },
        {
          "uuid": "fb06d474-8ef4-c502-cef3-c675ffcec6ed",
          "name": "NSC-4460",
          "stdName": "NSC-4460",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd6bb257-ac47-c0be-7ea8-1c4d436abb7e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "618527d2-a8f7-4fdb-97ff-e0571fc8e406",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8071c09f-603b-4bf4-9aef-cfea64a4dcc8",
          "citation": "ChemID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fef12293-8b0b-4a17-9f24-1ee96ee67190",
          "citation": "ChemID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15ac12d2-f31b-ac14-956d-c4d6af4607a1",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "cd6bb257-ac47-c0be-7ea8-1c4d436abb7e",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fe931b4b-b418-43d5-94e6-6777540a4e57",
          "id": "fe931b4b-b418-43d5-94e6-6777540a4e57",
          "molfile": "\n  Marvin  05042107162D          \n\n 23 24  0  0  0  0            999 V2000\n   14.0261   -5.2528    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0261   -4.4277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7404   -4.0151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7404   -3.1901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0261   -2.7776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3115   -3.1901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5969   -2.7776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8824   -3.1901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8824   -4.0151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5969   -4.4277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3115   -4.0151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5969   -5.2528    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4220   -5.2528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7718   -5.2528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5969   -6.0779    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   11.1678   -2.7776    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7554   -3.4921    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5804   -2.0630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4534   -2.3651    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   15.4551   -2.7776    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0426   -2.0630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8676   -3.4921    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1696   -2.3651    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 11  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4 20  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  6 11  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 16  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  2  0  0  0  0\n 12 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  2  0  0  0  0\n 16 19  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  2  0  0  0  0\n 20 23  1  0  0  0  0\nM  CHG  3  15  -1  19  -1  23  -1\nM  END",
          "smiles": "c1c2cc(cc(c2c(cc1S(=O)(=O)[O-])N)S(=O)(=O)[O-])S(=O)(=O)[O-]",
          "formula": "C10H6NO9S3",
          "atropisomerism": "No",
          "charge": -3,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d5b46812-ce96-483e-b5fe-4aad63088e2e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "380.3546",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "1ea51b49-470b-4726-9eaf-392500f00482",
          "id": "1ea51b49-470b-4726-9eaf-392500f00482",
          "molfile": "\n  Marvin  05042107162D          \n\n  1  0  0  0  0  0            999 V2000\n    8.2234   -3.6854    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "ed41d9a5-bce2-4396-a39d-db5ca77b51f5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "9eb9ca05-849d-40ec-b6f1-d644767fe6ba",
          "id": "9eb9ca05-849d-40ec-b6f1-d644767fe6ba",
          "molfile": "\n  Marvin  05042107162D          \n\n  1  0  0  0  0  0            999 V2000\n    9.1035   -5.9792    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "formula": "H",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fa0a6585-298c-4d47-8a80-8e6fd56d4584"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "1.0079",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e362df66-6338-403e-b6ae-993c13ad0d6d",
      "version": "10",
      "structure": {
        "id": "c7352bbe-2b80-4aa3-b17b-9f8434f39def",
        "molfile": "\n   JSDraw205042107162D\n\n 26 24  0  0  0  0              0 V2000\n   26.5191   -9.9314    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5191   -8.3714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8697   -7.5914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8697   -6.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5191   -5.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1680   -6.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8169   -5.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4661   -6.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4661   -7.5914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8169   -8.3714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1680   -7.5914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8169   -9.9314    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   25.3769   -9.9314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.2569   -9.9314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8169  -11.4914    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   21.1150   -5.2516    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   20.3352   -6.6025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.8950   -3.9006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7642   -4.4716    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   29.2210   -5.2516    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   28.4410   -3.9006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   30.0008   -6.6025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   30.5718   -4.4716    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   15.5480   -6.9680    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n   17.2120  -11.3048    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\n   15.5480   -6.9680    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n  2 11  2  0  0  0  0\n  6 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  2  0  0  0  0\n 12 15  1  0  0  0  0\n  8 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  2  0  0  0  0\n 16 19  1  0  0  0  0\n  4 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  2  0  0  0  0\n 20 23  1  0  0  0  0\nM  STY  1   1 MUL\nM  SAL   1  2  24  26\nM  SPA   1  1  24\nM  SDI   1  4   14.3520   -8.4240   14.3520   -5.7720\nM  SDI   1  4   16.7440   -5.7720   16.7440   -8.4240\nM  SMT   1 2\nM  CHG  6  15  -1  19  -1  23  -1  24   1  25   1  26   1\nM  END",
        "smiles": "c1c2cc(cc(c2c(cc1S(=O)(=O)[O-])N)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+].[H+]",
        "formula": "C10H6NO9S3.2Na.H",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "427.3421",
        "optical_activity": "NONE",
        "references": [
          "fef12293-8b0b-4a17-9f24-1ee96ee67190",
          "618527d2-a8f7-4fdb-97ff-e0571fc8e406"
        ],
        "stereo_centers": 0
      },
      "unii": "ASL8EG8UB2"
    }
  ]
}