{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "2daf72cc-f4fc-419a-bd6a-cde639ed0829", "code": "161802-03-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=161802-03-5", "code_system": "CAS", "references": [ "d08e8783-abc6-4730-8eca-4e6f21c93a7b" ] }, { "uuid": "48a9911f-24db-9d38-e0dd-0f5c4b5bb747", "code": "9873850", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9873850", "code_system": "PUBCHEM", "references": [ "f0cafcab-2449-0500-a7ad-e9fa0627c405" ] }, { "uuid": "39858ae0-3bd5-4422-b1ab-ac6b6f874229", "code": "AR8RR3M6N9", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "e3c327d2-9244-49e2-007b-60a107bda621", "code": "2549747", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2549747/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "4603a35a-90a6-2234-f5ac-a8e10a526b45" ] }, { "uuid": "29de29e9-0c0a-2488-837e-d446c1ac846a", "code": "AR8RR3M6N9", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=AR8RR3M6N9", "code_system": "DAILYMED", "references": [ "de45c9ee-d362-401e-398d-42774bb9db04" ] } ], "substance_class": "chemical", "names": [ { "uuid": "a9abb7a5-c2da-4780-bebf-507c9580f84c", "name": ".ALPHA.-D-GLUCOPYRANOSIDE, 4-((2R,3R)-3,4-DIHYDRO-5,7-DIHYDROXY-3-((3,4,5-TRIHYDROXYBENZOYL)OXY)-2H-1-BENZOPYRAN-2-YL)-2,6-DIHYDROXYPHENYL-", "stdName": ".ALPHA.-D-GLUCOPYRANOSIDE, 4-((2R,3R)-3,4-DIHYDRO-5,7-DIHYDROXY-3-((3,4,5-TRIHYDROXYBENZOYL)OXY)-2H-1-BENZOPYRAN-2-YL)-2,6-DIHYDROXYPHENYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d08e8783-abc6-4730-8eca-4e6f21c93a7b" ], "display_name": false }, { "uuid": "e093d409-ac79-4f56-b090-eb12cdd3003b", "name": ".ALPHA.-D-GLUCOPYRANOSIDE, 4-(3,4-DIHYDRO-5,7-DIHYDROXY-3-((3,4,5-TRIHYDROXYBENZOYL)OXY)-2H-1-BENZOPYRAN-2-YL)-2,6-DIHYDROXYPHENYL, (2R-CIS)-", "stdName": ".ALPHA.-D-GLUCOPYRANOSIDE, 4-(3,4-DIHYDRO-5,7-DIHYDROXY-3-((3,4,5-TRIHYDROXYBENZOYL)OXY)-2H-1-BENZOPYRAN-2-YL)-2,6-DIHYDROXYPHENYL, (2R-CIS)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d08e8783-abc6-4730-8eca-4e6f21c93a7b" ], "display_name": false }, { "uuid": "1110422e-6409-4102-bc94-75e72b7af3c0", "name": "4-((2R,3R)-3,4-DIHYDRO-5,7-DIHYDROXY-3-((3,4,5-TRIHYDROXYBENZOYL)OXY)-2H-1-BENZOPYRAN-2-YL)-2,6-DIHYDROXYPHENYL .ALPHA.-D-GLUCOPYRANOSIDE", "stdName": "4-((2R,3R)-3,4-DIHYDRO-5,7-DIHYDROXY-3-((3,4,5-TRIHYDROXYBENZOYL)OXY)-2H-1-BENZOPYRAN-2-YL)-2,6-DIHYDROXYPHENYL .ALPHA.-D-GLUCOPYRANOSIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d08e8783-abc6-4730-8eca-4e6f21c93a7b" ], "display_name": false }, { "uuid": "7bc3ac9b-79bd-4e4a-9854-1f493721a37b", "name": "EPIGALLOCATECHIN GALLATYL GLUCOSIDE", "stdName": "EPIGALLOCATECHIN GALLATYL GLUCOSIDE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "faaefd50-0fed-4746-b94d-23150b6e1b20" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "24115806-a756-43f2-a220-6ba1558b95d6", "name_org": "INCI" } ] }, { "uuid": "c1a34094-3c65-442d-b4aa-1bcbbafb57d0", "name": "INOVEOL EGCG", "stdName": "INOVEOL EGCG", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "faaefd50-0fed-4746-b94d-23150b6e1b20" ], "display_name": false } ], "references": [ { "uuid": "f0cafcab-2449-0500-a7ad-e9fa0627c405", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "d08e8783-abc6-4730-8eca-4e6f21c93a7b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "faaefd50-0fed-4746-b94d-23150b6e1b20", "citation": "PCPC", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4603a35a-90a6-2234-f5ac-a8e10a526b45", "citation": "RXNORM", "doc_type": "NLM", "public_domain": true }, { "uuid": "de45c9ee-d362-401e-398d-42774bb9db04", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d2230d9b-d0e7-4c3f-b52d-49b6ac85f551", "id": "d2230d9b-d0e7-4c3f-b52d-49b6ac85f551", "molfile": "\n Marvin 01132110522D \n\n 44 48 0 0 1 0 999 V2000\n 8.5330 -5.6454 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5330 -6.4704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8185 -6.8829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2475 -6.8829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2475 -7.7079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9619 -8.1204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9619 -8.9454 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6764 -7.7079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6764 -6.8829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9619 -6.4704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3909 -6.4704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3909 -8.1204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8185 -5.2329 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.8185 -4.4079 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.1040 -3.9954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3895 -4.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3895 -5.2329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1040 -5.6454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6750 -5.6454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6750 -6.4704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9606 -5.2329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9606 -4.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6750 -3.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2461 -3.9954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5330 -3.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5330 -3.1704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2474 -2.7579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2474 -1.9329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9619 -3.1704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9619 -3.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2474 -4.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6764 -4.4079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6764 -2.7579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3908 -3.1704 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.3908 -3.9954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1053 -4.4079 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.1053 -5.2329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8198 -5.6454 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8198 -3.9954 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.8198 -3.1704 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 12.1053 -2.7579 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 12.1053 -1.9329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5342 -2.7579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5342 -4.4079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 13 1 1 6 0 0 0\n 2 3 2 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 4 10 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 2 0 0 0 0\n 9 8 1 0 0 0 0\n 8 12 1 0 0 0 0\n 10 9 2 0 0 0 0\n 9 11 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 18 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 25 1 6 0 0 0\n 15 16 1 0 0 0 0\n 17 16 1 0 0 0 0\n 16 23 2 0 0 0 0\n 18 17 1 0 0 0 0\n 17 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 23 22 1 0 0 0 0\n 22 24 1 0 0 0 0\n 25 26 2 0 0 0 0\n 25 31 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 2 0 0 0 0\n 30 29 1 0 0 0 0\n 29 33 1 0 0 0 0\n 31 30 2 0 0 0 0\n 30 32 1 0 0 0 0\n 34 33 1 6 0 0 0\n 34 35 1 0 0 0 0\n 34 41 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 1 0 0 0\n 36 39 1 0 0 0 0\n 37 38 1 0 0 0 0\n 40 39 1 0 0 0 0\n 39 44 1 6 0 0 0\n 41 40 1 0 0 0 0\n 40 43 1 1 0 0 0\n 41 42 1 6 0 0 0\nM END", "smiles": "c1c(cc(c(c1O)O[C@@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)O)[C@@H]3[C@@H](Cc4c(cc(cc4O3)O)O)OC(=O)c5cc(c(c(c5)O)O)O", "formula": "C28H28O16", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e41ee316-e10d-47b8-aee2-a92e998ba76d" }, "defined_stereo": 7, "ez_centers": 0, "molecular_weight": "620.5134", "optical_activity": "UNSPECIFIED", "stereo_centers": 7 } ], "definition_level": "COMPLETE", "uuid": "e3725548-03a3-4c70-810d-090b665239ee", "version": "8", "structure": { "id": "20a62ac4-98c2-4b73-bfe4-84401fb67033", "molfile": ".alpha.-D-Glucopyranoside, 4-[(2R,3R)-3,4-dihydro-5,7-dihydroxy-3-[(3,4,5-tri...\n Marvin 01132101512D \n\n 44 48 0 0 1 0 999 V2000\n 13.8071 -4.5374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8071 -5.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0926 -5.7749 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5216 -5.7749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5216 -6.5999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2361 -7.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2361 -7.8375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9505 -6.5999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9505 -5.7749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2361 -5.3624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6651 -5.3624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6651 -7.0125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0926 -4.1250 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.0926 -3.3000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.3782 -2.8874 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6637 -3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6637 -4.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3782 -4.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9492 -4.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9492 -5.3625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2348 -4.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2348 -3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9492 -2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5203 -2.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8071 -2.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8071 -2.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5215 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5215 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2361 -2.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2361 -2.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5215 -3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9505 -3.3000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9505 -1.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6649 -2.0624 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.6649 -2.8874 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3795 -3.3000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 17.3795 -4.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0939 -4.5374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0939 -2.8874 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 18.0939 -2.0624 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 17.3795 -1.6500 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 17.3795 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8084 -1.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8084 -3.3000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 4 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 8 12 1 0 0 0 0\n 13 1 1 6 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 13 18 1 0 0 0 0\n 17 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 23 22 1 0 0 0 0\n 16 23 2 0 0 0 0\n 22 24 1 0 0 0 0\n 14 25 1 6 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 2 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 2 0 0 0 0\n 25 31 1 0 0 0 0\n 30 32 1 0 0 0 0\n 29 33 1 0 0 0 0\n 34 33 1 6 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 1 0 0 0\n 37 38 1 0 0 0 0\n 36 39 1 0 0 0 0\n 40 39 1 0 0 0 0\n 41 40 1 0 0 0 0\n 34 41 1 0 0 0 0\n 41 42 1 6 0 0 0\n 40 43 1 1 0 0 0\n 39 44 1 6 0 0 0\nM END", "smiles": "c1c(cc(c(c1O)O[C@@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)O)[C@@H]3[C@@H](Cc4c(cc(cc4O3)O)O)OC(=O)c5cc(c(c(c5)O)O)O", "formula": "C28H28O16", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 7, "ez_centers": 0, "molecular_weight": "620.5134", "optical_activity": "UNSPECIFIED", "references": [ "faaefd50-0fed-4746-b94d-23150b6e1b20", "d08e8783-abc6-4730-8eca-4e6f21c93a7b" ], "stereo_centers": 7 }, "modifications": { "uuid": "ca137c2f-6db6-4f51-89d7-83f52aafd21e" }, "unii": "AR8RR3M6N9" } ] }