{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8d2bc58d-647e-4444-946c-0b79ee2e04db",
          "code": "51946-14-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=51946-14-6",
          "code_system": "CAS",
          "references": [
            "368efe82-235d-4a0b-a235-787e15e9b5be",
            "41dab629-7849-424b-b40b-32831844047a"
          ]
        },
        {
          "uuid": "ce6898fe-c532-40f8-8641-88be5cb4ae6f",
          "code": "23695318",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23695318",
          "code_system": "PUBCHEM",
          "references": [
            "368efe82-235d-4a0b-a235-787e15e9b5be"
          ]
        },
        {
          "uuid": "a0b420e2-208e-4338-0a4d-c51aa511b2ba",
          "code": "DTXSID20885977",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20885977",
          "code_system": "EPA CompTox",
          "references": [
            "10734cea-5775-46ce-22a7-4232b7b527aa"
          ]
        },
        {
          "uuid": "63727142-3e0a-490c-ab31-856e12c6c618",
          "code": "AP6892L90I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "80770315-731c-4a8e-ac7b-5cf59f1cfe41",
          "name": "1-PROPANESULFONIC ACID, 2-HYDROXY-3-(OCTYLOXY)-, MONOSODIUM SALT",
          "stdName": "1-PROPANESULFONIC ACID, 2-HYDROXY-3-(OCTYLOXY)-, MONOSODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f586212-a50a-49e2-9375-ab014dbea26b",
            "71661b1f-952b-43e7-870e-ea8e846d3dfb"
          ],
          "display_name": false
        },
        {
          "uuid": "08258e5b-b3cc-4ef1-9096-bfbfd51dfa1f",
          "name": "1-PROPANESULFONIC ACID, 2-HYDROXY-3-(OCTYLOXY)-, SODIUM SALT",
          "stdName": "1-PROPANESULFONIC ACID, 2-HYDROXY-3-(OCTYLOXY)-, SODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f586212-a50a-49e2-9375-ab014dbea26b",
            "71661b1f-952b-43e7-870e-ea8e846d3dfb"
          ],
          "display_name": false
        },
        {
          "uuid": "0818fda0-23d6-480d-b0cb-43d96194eadd",
          "name": "1-PROPANESULFONIC ACID, 2-HYDROXY-3-(OCTYLOXY)-, SODIUM SALT (1:1)",
          "stdName": "1-PROPANESULFONIC ACID, 2-HYDROXY-3-(OCTYLOXY)-, SODIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f586212-a50a-49e2-9375-ab014dbea26b",
            "71661b1f-952b-43e7-870e-ea8e846d3dfb"
          ],
          "display_name": false
        },
        {
          "uuid": "9b94c6a3-a680-4183-8946-93d39864c741",
          "name": "AGS-898",
          "stdName": "AGS-898",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73bce695-4a1c-4982-9dde-e9c1141a4e38",
            "71661b1f-952b-43e7-870e-ea8e846d3dfb"
          ],
          "display_name": false
        },
        {
          "uuid": "9fa86dc0-eaf3-46b8-9c62-e1d36bc2c81d",
          "name": "SODIUM 2-HYDROXY-3-OCTYLOXY-1-PROPANESULFONATE",
          "stdName": "SODIUM 2-HYDROXY-3-OCTYLOXY-1-PROPANESULFONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f586212-a50a-49e2-9375-ab014dbea26b",
            "71661b1f-952b-43e7-870e-ea8e846d3dfb"
          ],
          "display_name": false
        },
        {
          "uuid": "1b85ca2a-eef9-4674-864f-a8353884d0e4",
          "name": "SODIUM 2-HYDROXY-3-OCTYLOXYPROPYLSULFONATE",
          "stdName": "SODIUM 2-HYDROXY-3-OCTYLOXYPROPYLSULFONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f586212-a50a-49e2-9375-ab014dbea26b",
            "71661b1f-952b-43e7-870e-ea8e846d3dfb"
          ],
          "display_name": false
        },
        {
          "uuid": "8cbac3f1-6109-44c9-aff3-7409399c524e",
          "name": "SODIUM CAPRYLYL PG-SULFONATE",
          "stdName": "SODIUM CAPRYLYL PG-SULFONATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73bce695-4a1c-4982-9dde-e9c1141a4e38",
            "71661b1f-952b-43e7-870e-ea8e846d3dfb",
            "63a4477a-df40-4289-b6ab-9384c26ed007"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "d4d6f631-6c1e-44da-a416-6e9442e1bfc5",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "73bce695-4a1c-4982-9dde-e9c1141a4e38",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "71661b1f-952b-43e7-870e-ea8e846d3dfb",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f586212-a50a-49e2-9375-ab014dbea26b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "368efe82-235d-4a0b-a235-787e15e9b5be",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391594000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1ad4fa0-211f-4e1f-aac3-6fdf9db5f699",
          "citation": "SRS import [AP6892L90I]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=AP6892L90I",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391594000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "63a4477a-df40-4289-b6ab-9384c26ed007",
          "citation": "SODIUM CAPRYLYL PG-SULFONATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "41dab629-7849-424b-b40b-32831844047a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "10734cea-5775-46ce-22a7-4232b7b527aa",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9bc5cb4f-1736-4117-9bf2-8f98b88f91ae",
          "id": "9bc5cb4f-1736-4117-9bf2-8f98b88f91ae",
          "molfile": "\n  Marvin  01132108062D          \n\n  1  0  0  0  0  0            999 V2000\n   17.9488  -26.1487    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3303f25a-1642-4244-b7cd-73a2c0380ac4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "2e406e72-bc8f-43be-af24-21895e0e1630",
          "id": "2e406e72-bc8f-43be-af24-21895e0e1630",
          "molfile": "\n  Marvin  01132102292D          \n\n 17 16  0  0  0  0            999 V2000\n    8.1961  -26.1487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9151  -26.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5893  -26.1487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3084  -26.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9826  -26.1487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7017  -26.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3759  -26.1487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0949  -26.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7691  -26.1487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4882  -26.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1624  -26.1487    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   15.1624  -25.3397    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   15.8815  -26.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5557  -26.1487    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2747  -25.7442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1512  -25.4295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9602  -26.8228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 14 17  2  0  0  0  0\nM  CHG  1  12  -1\nM  END",
          "smiles": "CCCCCCCCOCC(CS(=O)(=O)O)[O-]",
          "formula": "C11H23O5S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cf5577f5-17ab-4ca2-91ff-03c8c51667ea"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "267.3638",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "42a0598a-44e9-45e8-a21f-161bc983ddf1",
      "version": "7",
      "structure": {
        "id": "605f0181-1b6b-4fd8-a1b6-c19a9c12c767",
        "molfile": "\n  Marvin  01132104592D          \n\n 18 16  0  0  0  0            999 V2000\n   15.1624  -25.3397    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1961  -26.1487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9151  -26.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5893  -26.1487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3084  -26.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9826  -26.1487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7017  -26.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3759  -26.1487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0949  -26.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7691  -26.1487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2747  -25.7442    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   16.1512  -25.4295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9602  -26.8228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5557  -26.1487    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4882  -26.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1624  -26.1487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8815  -26.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9488  -26.1487    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n 16  1  1  0  0  0  0\n 15 10  1  0  0  0  0\n 10  9  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 17 14  1  0  0  0  0\n 14 11  1  0  0  0  0\n 14 12  2  0  0  0  0\n 14 13  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\nM  CHG  2  11  -1  18   1\nM  END",
        "smiles": "CCCCCCCCOCC(CS(=O)(=O)[O-])O.[Na+]",
        "formula": "C11H23O5S.Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "290.3536",
        "optical_activity": "( + / - )",
        "references": [
          "1f586212-a50a-49e2-9375-ab014dbea26b",
          "a1ad4fa0-211f-4e1f-aac3-6fdf9db5f699"
        ],
        "stereo_centers": 1
      },
      "unii": "AP6892L90I"
    }
  ]
}