{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "23010952-d210-4b4f-abf1-31f52f38453b",
          "code": "302776-68-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=302776-68-7",
          "code_system": "CAS",
          "references": [
            "a068312b-e12b-456a-9bd6-835b7b03c4be",
            "a408e5d2-6d6e-4a50-a9c0-a1708e39f914"
          ]
        },
        {
          "uuid": "d6c0c412-a457-45cd-8ed7-c759f4c0920e",
          "code": "1426392",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426392/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a068312b-e12b-456a-9bd6-835b7b03c4be"
          ]
        },
        {
          "uuid": "d3fc83be-b55f-4638-bfe3-4a11bdb5f548",
          "code": "SUB184267",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a068312b-e12b-456a-9bd6-835b7b03c4be"
          ]
        },
        {
          "uuid": "ae0a8cbd-78ef-4c95-ac1f-0d022fa16c6e",
          "code": "10111431",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10111431",
          "code_system": "PUBCHEM",
          "references": [
            "a068312b-e12b-456a-9bd6-835b7b03c4be"
          ]
        },
        {
          "uuid": "ae5497e7-b36a-5c8d-fbf6-9cb7fef52511",
          "code": "Diethylamino hydroxybenzoyl hexyl benzoate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Diethylamino_hydroxybenzoyl%20hexyl%20benzoate",
          "code_system": "WIKIPEDIA",
          "references": [
            "5dd4df23-ee01-4323-a63b-9678c352531a"
          ]
        },
        {
          "uuid": "9b77a5b7-c387-2ae4-8f13-0183cf131b06",
          "code": "DTXSID60184370",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60184370",
          "code_system": "EPA CompTox",
          "references": [
            "0f55b55e-9748-45fe-9814-f131a28bc83e"
          ]
        },
        {
          "uuid": "d73af034-9697-1805-bddb-7f0c8239cb55",
          "code": "m11780",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11780",
          "code_system": "MERCK INDEX",
          "references": [
            "fb27151f-a7cb-cd52-0674-651897353919"
          ]
        },
        {
          "uuid": "bb20c47d-720a-05b0-609f-9a1134d07c2c",
          "code": "4602",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4602",
          "code_system": "DRUG CENTRAL",
          "references": [
            "fb27151f-a7cb-cd52-0674-651897353919"
          ]
        },
        {
          "uuid": "ab18f442-2206-2556-0010-d724130668fe",
          "code": "DB11269",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11269",
          "code_system": "DRUG BANK",
          "references": [
            "fb27151f-a7cb-cd52-0674-651897353919"
          ]
        },
        {
          "uuid": "0b4ea518-3b13-41a3-89fb-f304ee5133a8",
          "code": "ANQ870JD20",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "44fb362a-8320-a069-7f8d-7685135779c1",
          "code": "100000170390",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c273560c-d11f-5e2e-2d6d-1447f2aa7201"
          ]
        },
        {
          "uuid": "5089538e-b603-a83e-498e-9d96833c186e",
          "code": "ANQ870JD20",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=ANQ870JD20",
          "code_system": "DAILYMED",
          "references": [
            "ed7d154c-d2d1-fe48-1db9-96f5f8df9d90"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "176856de-5d68-4fe7-b35d-f37d02401edc",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "5f470e51-d6bb-4ffe-b562-c270ee99820b",
            "refuuid": "28b8531f-ebd1-4756-8dd7-74d6945a6ec7",
            "name": "DIETHYLAMINO HYDROXYBENZOYL HEXYL BENZOATE",
            "unii": "ANQ870JD20",
            "linking_id": "ANQ870JD20",
            "ref_pname": "DIETHYLAMINO HYDROXYBENZOYL HEXYL BENZOATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0c10dda8-5232-43d3-9191-472f223f2aea",
          "name": "BENZOIC ACID, 2-(4-(DIETHYLAMINO)-2-HYDROXYBENZOYL)-, HEXYL ESTER",
          "stdName": "BENZOIC ACID, 2-(4-(DIETHYLAMINO)-2-HYDROXYBENZOYL)-, HEXYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f6bf79f-c702-47d0-9cae-008489e7e8c0",
            "3b8c3cd3-764a-40df-b771-d4c702efd9ce"
          ],
          "display_name": false
        },
        {
          "uuid": "9a4d00cc-5c54-4ffc-ac7c-4a8671478a77",
          "name": "DIETHYLAMINO HYDROXYBENZOYL HEXYL BENZOATE",
          "stdName": "DIETHYLAMINO HYDROXYBENZOYL HEXYL BENZOATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f3e044b-1d84-408e-ad04-1cc06a167813",
            "3b8c3cd3-764a-40df-b771-d4c702efd9ce",
            "59669c8b-34c9-44f9-8bad-612b5868620f"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3f20d3a7-7743-43e8-a7e4-15474bdcb89c",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "6879550d-6fe3-25ee-d07f-869e0e0eb9a2",
          "name": "DIETHYLAMINO HYDROXYBENZOYL HEXYL BENZOATE [MI]",
          "stdName": "DIETHYLAMINO HYDROXYBENZOYL HEXYL BENZOATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "752c9083-e28a-c06a-9971-77c36ebe2cee"
          ],
          "display_name": false
        },
        {
          "uuid": "231ffe8e-1ea7-b5cc-8643-e1a474cce234",
          "name": "Diethylamino hydroxybenzoyl hexyl benzoate [WHO-DD]",
          "stdName": "DIETHYLAMINO HYDROXYBENZOYL HEXYL BENZOATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ef040b6-189b-189b-f961-2a74ec35a287"
          ],
          "display_name": false
        },
        {
          "uuid": "055b220b-12c4-47bc-91c3-b8fc1a79309f",
          "name": "HEXYL 2-(4-(DIETHYLAMINO)-2-HYDROXYBENZOYL)BENZOATE",
          "stdName": "HEXYL 2-(4-(DIETHYLAMINO)-2-HYDROXYBENZOYL)BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f6f0b93-a9f1-481b-bdea-9f030562523a",
            "3b8c3cd3-764a-40df-b771-d4c702efd9ce"
          ],
          "display_name": false
        },
        {
          "uuid": "339e4768-1222-405b-babb-cde8cab8c23b",
          "name": "UVINUL A PLUS",
          "stdName": "UVINUL A PLUS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f6bf79f-c702-47d0-9cae-008489e7e8c0",
            "3b8c3cd3-764a-40df-b771-d4c702efd9ce"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0f6bf79f-c702-47d0-9cae-008489e7e8c0",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3b8c3cd3-764a-40df-b771-d4c702efd9ce",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59669c8b-34c9-44f9-8bad-612b5868620f",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5f6f0b93-a9f1-481b-bdea-9f030562523a",
          "citation": "Wikipedia",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a068312b-e12b-456a-9bd6-835b7b03c4be",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390841000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "df48fd3b-d9f0-4843-a543-c32cd2645ca4",
          "citation": "SRS import [ANQ870JD20]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ANQ870JD20",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390841000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f3e044b-1d84-408e-ad04-1cc06a167813",
          "citation": "DIETHYLAMINO HYDROXYBENZOYL HEXYL BENZOATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5dd4df23-ee01-4323-a63b-9678c352531a",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Diethylamino_hydroxybenzoyl%20hexyl%20benzoate",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0f55b55e-9748-45fe-9814-f131a28bc83e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=302776-68-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "01f7aea5-277e-479e-8f53-39630e091447",
          "citation": "WHO DRUG DICTIONARY 2019",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "a408e5d2-6d6e-4a50-a9c0-a1708e39f914",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "fb27151f-a7cb-cd52-0674-651897353919",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "752c9083-e28a-c06a-9971-77c36ebe2cee",
          "citation": "MI",
          "doc_type": "MERCK INDEX",
          "public_domain": true
        },
        {
          "uuid": "ed7d154c-d2d1-fe48-1db9-96f5f8df9d90",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "2ef040b6-189b-189b-f961-2a74ec35a287",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c273560c-d11f-5e2e-2d6d-1447f2aa7201",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2b8e9c81-079c-4c6c-a82e-8c0391fd9e8a",
          "id": "2b8e9c81-079c-4c6c-a82e-8c0391fd9e8a",
          "molfile": "\n  Marvin  01132102212D          \n\n 29 30  0  0  0  0            999 V2000\n    5.1527    3.3202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4421    2.9088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4421    2.0818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7335    1.6682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7316    0.8435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0210    0.4321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0251   -0.3906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3187   -0.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5998   -0.3989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3272   -1.6311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0499   -2.0387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0557   -2.8640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3349   -3.2821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6210   -2.8707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6164   -2.0444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8976   -1.6331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8934   -0.8103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1795   -2.0532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1823   -2.8816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5322   -3.2937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2450   -2.8820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2439   -2.0569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5339   -1.6452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5360   -0.8186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9655   -3.3035    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9530   -4.1305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2383   -4.5377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6885   -2.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3991   -3.3160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 15  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 16  1  0  0  0  0\n 19 18  1  0  0  0  0\n 18 23  2  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 21 25  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 28  1  0  0  0  0\n 26 27  1  0  0  0  0\n 28 29  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCOC(=O)c1ccccc1C(=O)c2ccc(cc2O)N(CC)CC",
          "formula": "C24H31NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "65016dd4-17af-4309-9177-8837b75bd5b4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "397.5081",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "28b8531f-ebd1-4756-8dd7-74d6945a6ec7",
      "version": "15",
      "structure": {
        "id": "49927c3b-0810-4b54-aaa1-657875ead8d8",
        "molfile": "\n  Marvin  01132103512D          \n\n 29 30  0  0  0  0            999 V2000\n   -1.2439   -2.0569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2450   -2.8820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5322   -3.2937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1823   -2.8816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1795   -2.0532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5339   -1.6452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8976   -1.6331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6164   -2.0444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6210   -2.8707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3349   -3.2821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0557   -2.8640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0499   -2.0387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3272   -1.6311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8934   -0.8103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5360   -0.8186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9655   -3.3035    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6885   -2.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9530   -4.1305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2383   -4.5377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3991   -3.3160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3187   -0.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5998   -0.3989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0251   -0.3906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0210    0.4321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7316    0.8435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7335    1.6682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4421    2.0818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4421    2.9088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1527    3.3202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  7 14  2  0  0  0  0\n  5  7  1  0  0  0  0\n  6 15  1  0  0  0  0\n  3  4  2  0  0  0  0\n  2 16  1  0  0  0  0\n  7  8  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n  8  9  2  0  0  0  0\n 18 19  1  0  0  0  0\n  4  5  1  0  0  0  0\n 17 20  1  0  0  0  0\n  9 10  1  0  0  0  0\n 13 21  1  0  0  0  0\n  2  3  1  0  0  0  0\n 21 22  2  0  0  0  0\n 10 11  2  0  0  0  0\n 21 23  1  0  0  0  0\n  5  6  2  0  0  0  0\n 23 24  1  0  0  0  0\n 11 12  1  0  0  0  0\n 24 25  1  0  0  0  0\n  6  1  1  0  0  0  0\n 25 26  1  0  0  0  0\n 12 13  2  0  0  0  0\n 26 27  1  0  0  0  0\n 13  8  1  0  0  0  0\n 27 28  1  0  0  0  0\n  1  2  2  0  0  0  0\n 28 29  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCOC(=O)c1ccccc1C(=O)c2ccc(cc2O)N(CC)CC",
        "formula": "C24H31NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "397.5081",
        "optical_activity": "NONE",
        "references": [
          "0f6bf79f-c702-47d0-9cae-008489e7e8c0",
          "df48fd3b-d9f0-4843-a543-c32cd2645ca4"
        ],
        "stereo_centers": 0
      },
      "unii": "ANQ870JD20"
    }
  ]
}