{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1f89445f-ceef-6291-6342-52afc898af75",
          "code": "69093374",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/69093374",
          "code_system": "PUBCHEM",
          "references": [
            "a219164c-fbdb-9b3d-95ef-c08c146b64ab"
          ]
        },
        {
          "uuid": "cb43d7d8-b1af-2d58-6718-6702c660e1f3",
          "code": "1374828-69-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1374828-69-9",
          "code_system": "CAS",
          "references": [
            "35969949-cd1f-4ae7-ba77-29c0d29e0ed4"
          ]
        },
        {
          "uuid": "82327ca6-1a6d-4ecf-a121-370cd11672bc",
          "code": "ANGHS285FG",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "93af5364-a9bc-8c58-2d99-883094be1a95",
          "code": "300000016060",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8d536a33-0671-1a6e-6f7c-878c826378be"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "25423cf8-ee80-789a-5af6-96989ea15695",
          "citation": "J. Med. Chem., 2014, 57 (3), pp 921–936",
          "url": "http://pubs.acs.org/doi/pdf/10.1021/jm401654j",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a219164c-fbdb-9b3d-95ef-c08c146b64ab",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "35969949-cd1f-4ae7-ba77-29c0d29e0ed4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d25bf158-634e-4f52-911d-74d7853a55d2",
          "citation": "Jennings, Danna, et al. \"Preclinical and clinical evaluation of the LRRK2 inhibitor DNL201 for Parkinson’s disease.\" Science Translational Medicine 14.648 (2022): eabj2658.",
          "url": "https://www.science.org/doi/pdf/10.1126/scitranslmed.abj2658",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8d536a33-0671-1a6e-6f7c-878c826378be",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "110f46ca-80c2-b7ba-b139-160a8a235f4a",
          "id": "110f46ca-80c2-b7ba-b139-160a8a235f4a",
          "molfile": "\n  Marvin  01132101072D          \n\n 24 25  0  0  0  0            999 V2000\n   14.1284   -4.8213    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7221   -4.3306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5227   -4.3306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2734   -4.9303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9523   -3.4158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9229   -4.8213    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5227   -3.3613    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8549   -4.3306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5464   -2.6222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6550   -3.4158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3171   -4.3306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9229   -2.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4607   -4.8213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7113   -4.8213    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3171   -3.3613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1574   -4.8213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8060   -5.6633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1093   -5.6633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9905   -4.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7113   -2.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8540   -4.8213    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1056   -3.3613    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3600   -2.0286    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0567   -2.0286    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  2  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  3  7  2  0  0  0  0\n  4  8  1  0  0  0  0\n  5  9  1  0  0  0  0\n  5 10  2  0  0  0  0\n  6 11  2  0  0  0  0\n  7 12  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 11 15  1  0  0  0  0\n 12 15  2  0  0  0  0\n 13 16  1  0  0  0  0\n 13 17  1  0  0  0  0\n 13 18  1  0  0  0  0\n 14 19  1  0  0  0  0\n 15 20  1  0  0  0  0\n 16 21  3  0  0  0  0\n 20 22  1  0  0  0  0\n 20 23  1  0  0  0  0\n 20 24  1  0  0  0  0\nM  END",
          "smiles": "Cc1c(cn(C(C)(C)C#N)n1)Nc2ncc(c(NC)n2)C(F)(F)F",
          "formula": "C14H16F3N7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5d193c3c-8ae8-4d04-8737-c26f24f8ffd7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "339.3195",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "317e49e3-0ccd-47d2-a4e1-28f68255accc",
      "version": "19",
      "structure": {
        "id": "bc48db17-6176-fc84-13e5-1cd7cd77c10e",
        "molfile": "1H-Pyrazole-1-acetonitrile, .alpha.,.alpha.,3-trimethyl-4-[[4-(methylamino)-5...\n  Marvin  01132109442D          \n\n 24 25  0  0  0  0            999 V2000\n   15.1432   -5.1991    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8576   -4.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6113   -5.1222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1633   -4.5091    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7508   -3.7946    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9438   -3.9662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3308   -3.4141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9838   -4.5953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4686   -3.9279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.9536   -3.2605    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6512   -5.0803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8975   -5.4158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4287   -4.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7142   -5.1991    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9998   -4.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2853   -5.1991    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5709   -4.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9998   -3.9616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7142   -3.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4287   -3.9616    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2853   -3.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5709   -3.9616    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5709   -3.1366    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2853   -2.7241    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  2  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  3  0  0  0  0\n  8 11  1  0  0  0  0\n  8 12  1  0  0  0  0\n  1 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 13 20  2  0  0  0  0\n 18 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 21 24  1  0  0  0  0\nM  END",
        "smiles": "Cc1c(cn(C(C)(C)C#N)n1)Nc2ncc(c(NC)n2)C(F)(F)F",
        "formula": "C14H16F3N7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "339.3195",
        "optical_activity": "NONE",
        "references": [
          "25423cf8-ee80-789a-5af6-96989ea15695"
        ],
        "stereo_centers": 0
      },
      "unii": "ANGHS285FG",
      "relationships": [
        {
          "uuid": "4f4b617b-0d5b-45a0-97e1-4882ee3d75db",
          "amount": {
            "uuid": "dc6871d1-f92c-459d-abfe-c45ba1d1b699",
            "average": 0.7,
            "units": "MICROMOLAR"
          },
          "qualification": "IC50",
          "type": "METABOLIC ENZYME->INHIBITOR",
          "references": [
            "25423cf8-ee80-789a-5af6-96989ea15695"
          ],
          "related_substance": {
            "uuid": "d64bd6eb-5b37-40ba-a2a3-2b0bfee85cf3",
            "refuuid": "2964cc53-40a9-4b2b-b19c-d61342fadb5a",
            "name": "CYTOCHROME P450 1A2",
            "unii": "VK4SQL11C0",
            "linking_id": "VK4SQL11C0",
            "ref_pname": "CYTOCHROME P450 1A2",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "da8dbf0b-1f81-41b2-8f87-ebb601895612",
          "amount": {
            "uuid": "0f23bf5e-c4e3-4186-8ada-4c783c3e5f09"
          },
          "type": "TRANSPORTER->NON-SUBSTRATE",
          "references": [
            "25423cf8-ee80-789a-5af6-96989ea15695"
          ],
          "related_substance": {
            "uuid": "90ad71e4-08ea-4073-8cfc-3923f6fc11bb",
            "refuuid": "3921aa0b-fd6d-40ec-9c07-d83e5c6f124a",
            "name": "MULTIDRUG RESISTANCE PROTEIN 1",
            "unii": "22ES734693",
            "linking_id": "22ES734693",
            "ref_pname": "MULTIDRUG RESISTANCE PROTEIN 1",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0263c7a2-b8da-463d-843d-f7e8d35b008a",
          "amount": {
            "uuid": "00ee0a01-d6fd-4030-9487-059c5b3f7eda"
          },
          "type": "METABOLIC ENZYME->INDUCER",
          "references": [
            "25423cf8-ee80-789a-5af6-96989ea15695"
          ],
          "related_substance": {
            "uuid": "d3dcef46-4c91-41ed-85c9-598b48a6acde",
            "refuuid": "2964cc53-40a9-4b2b-b19c-d61342fadb5a",
            "name": "CYTOCHROME P450 1A2",
            "unii": "VK4SQL11C0",
            "linking_id": "VK4SQL11C0",
            "ref_pname": "CYTOCHROME P450 1A2",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "11aa8c39-f8bb-46df-a840-27ccd164f51b",
          "amount": {
            "uuid": "6b472b06-baa1-4cc7-8493-253a0f1cd8f3"
          },
          "type": "METABOLIC ENZYME->INDUCER",
          "references": [
            "25423cf8-ee80-789a-5af6-96989ea15695"
          ],
          "related_substance": {
            "uuid": "51841865-d09f-4257-a44c-745c0fc0174c",
            "refuuid": "4275827d-e329-4907-95b5-7d690692872a",
            "name": "CYTOCHROME P450 3A4",
            "unii": "PUO0521HZV",
            "linking_id": "PUO0521HZV",
            "ref_pname": "CYTOCHROME P450 3A4",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f2db02d5-cf6e-41f0-b32e-5ce9bb9efa5d",
          "amount": {
            "uuid": "454c7fe9-bea3-4aea-be7a-704401ff535b"
          },
          "type": "METABOLIC ENZYME->INDUCER",
          "references": [
            "25423cf8-ee80-789a-5af6-96989ea15695"
          ],
          "related_substance": {
            "uuid": "522ad6c8-fc3b-4dff-ad5b-748d75efc28f",
            "refuuid": "83e3f07e-be5b-48ac-be08-0c68c20e8bf0",
            "name": "CYTOCHROME P450 2B6",
            "unii": "0UY97CSG1T",
            "linking_id": "0UY97CSG1T",
            "ref_pname": "CYTOCHROME P450 2B6",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e171148c-8cb4-4487-9114-10133b0fdd18",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "455cd053-8666-4261-8466-5d6f2e5f35b6",
            "refuuid": "317e49e3-0ccd-47d2-a4e1-28f68255accc",
            "name": "DNL-201",
            "unii": "ANGHS285FG",
            "linking_id": "ANGHS285FG",
            "ref_pname": "DNL-201",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "85a01a5c-a279-4297-ba88-c15ca93f942b",
          "amount": {
            "uuid": "a06149c9-73de-4743-8b45-16c56d693503",
            "average": 3,
            "units": "NANOMOLAR"
          },
          "qualification": "IC50",
          "type": "TARGET->INHIBITOR",
          "references": [
            "25423cf8-ee80-789a-5af6-96989ea15695"
          ],
          "related_substance": {
            "uuid": "6b702d4b-7cb8-4a54-9a75-98e2acca705e",
            "refuuid": "638fd2f5-14ee-4127-9374-5e4a4a103ee5",
            "name": "LEUCINE-RICH REPEAT SERINE/THREONINE-PROTEIN KINASE 2",
            "unii": "LC31QDE6K8",
            "linking_id": "LC31QDE6K8",
            "ref_pname": "LEUCINE-RICH REPEAT SERINE/THREONINE-PROTEIN KINASE 2",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "79f794e0-d4a2-419c-b816-fa7723cb0caa",
          "name": "1H-PYRAZOLE-1-ACETONITRILE, .ALPHA.,.ALPHA.,3-TRIMETHYL-4-((4-(METHYLAMINO)-5-(TRIFLUOROMETHYL)-2-PYRIMIDINYL)AMINO)-",
          "stdName": "1H-PYRAZOLE-1-ACETONITRILE, .ALPHA.,.ALPHA.,3-TRIMETHYL-4-((4-(METHYLAMINO)-5-(TRIFLUOROMETHYL)-2-PYRIMIDINYL)AMINO)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25423cf8-ee80-789a-5af6-96989ea15695"
          ],
          "display_name": false
        },
        {
          "uuid": "0a520397-7b90-428b-abb7-dd687dcf4c10",
          "name": "DNL-201",
          "stdName": "DNL-201",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d25bf158-634e-4f52-911d-74d7853a55d2"
          ],
          "display_name": true
        },
        {
          "uuid": "849f8348-0096-461c-a607-13102b3fdaca",
          "name": "DNL201",
          "stdName": "DNL201",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d25bf158-634e-4f52-911d-74d7853a55d2"
          ],
          "display_name": false
        },
        {
          "uuid": "2e5a806d-100f-4a08-8767-ed1abcca7c77",
          "name": "GNE-0877",
          "stdName": "GNE-0877",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25423cf8-ee80-789a-5af6-96989ea15695"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "9baee911-495e-426b-b58e-cea2716b0ebd",
          "name": "CSF/PLASMA RATIO",
          "value": {
            "uuid": "c350c111-d972-4660-be6e-2f4c58816c60",
            "type": "MOL RATIO",
            "average": 1.2,
            "non_numeric_value": "Cynomolgus monkeys"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC"
        }
      ]
    }
  ]
}