{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5d0bdaee-b873-4f1d-b22a-69dcabcec5b8",
          "code": "4547-24-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4547-24-4",
          "code_system": "CAS",
          "references": [
            "473a0b34-42aa-40e4-a997-4872313da93e",
            "c8126bc0-6edf-472e-91d1-b56ab171b55e"
          ]
        },
        {
          "uuid": "762caf63-64ac-402c-b9ff-2537026ff162",
          "code": "SUB26449",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "473a0b34-42aa-40e4-a997-4872313da93e"
          ]
        },
        {
          "uuid": "8f25c9f2-a5c3-4efb-90ef-14180302c33d",
          "code": "6918774",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6918774",
          "code_system": "PUBCHEM",
          "references": [
            "473a0b34-42aa-40e4-a997-4872313da93e"
          ]
        },
        {
          "uuid": "26805ac0-47c5-4122-b339-fa522fa48d48",
          "code": "Corosolic acid",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Corosolic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "dac6527a-5cc1-cc84-9ff8-f2fec591f506"
          ]
        },
        {
          "uuid": "33fabd48-daa5-60ad-670e-5b4d1706484d",
          "code": "3391 (Number of products:8)",
          "comments": "Dietary Supplement Label Database|chemical|corosolic acid",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3391&item=corosolic acid",
          "code_system": "DSLD",
          "references": [
            "04a47ea8-0395-c4f5-4e33-e2a644f832bc"
          ]
        },
        {
          "uuid": "e2753ee5-a2a3-4c96-a9ae-f74fdb918e64",
          "code": "AMX2I57A98",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7a0f5a39-f1d3-a178-be0c-c860597aa752",
          "code": "1148737",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1148737",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "04a47ea8-0395-c4f5-4e33-e2a644f832bc"
          ]
        },
        {
          "uuid": "8b8a64b2-a562-755d-70cf-ce51cfa0953f",
          "code": "100000089654",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "01fda993-cf49-bded-a4ad-c6515267be21"
          ]
        },
        {
          "uuid": "01a07093-34fc-4d4e-6b89-a769e8558db1",
          "code": "DTXSID70904142",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70904142",
          "code_system": "EPA CompTox",
          "references": [
            "3665e008-23cf-39a3-e944-3a085fd25ea9"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ef840a38-d435-432e-b9d2-4ffea4703154",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "6d2899bf-cf4e-4a97-b17d-b0327027fa9c"
          ],
          "related_substance": {
            "uuid": "c5dbcbc5-c016-4ae1-87d3-8b0f00e0490e",
            "refuuid": "2658cbca-abfb-460f-9f40-15dad3f2b7dd",
            "name": "LAGERSTROEMIA SPECIOSA LEAF",
            "unii": "OUK5B3W9E4",
            "linking_id": "OUK5B3W9E4",
            "ref_pname": "LAGERSTROEMIA SPECIOSA LEAF",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "34b05405-b824-4c7b-a3f7-d1c201a9f800",
          "name": "2-.ALPHA.-HYDROXYURSOLIC ACID",
          "stdName": "2-.ALPHA.-HYDROXYURSOLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c2d2662-d691-479b-811b-a41801ba1c7f"
          ],
          "display_name": false
        },
        {
          "uuid": "4159d333-e511-4476-97e3-dd83b2442583",
          "name": "COROSOLIC ACID",
          "stdName": "COROSOLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e17dae70-16a4-43a7-af1f-e45faf11c815",
            "9e1f4abe-60ce-4674-8e59-cd63ea5c4ea3",
            "2d657061-c8ff-40a4-b279-98bea9bd91d6"
          ],
          "display_name": true
        },
        {
          "uuid": "71737e69-fc00-488f-b476-06f9136bfe21",
          "name": "COROSOLIC ACID (CONSTITUENT OF BANABA LEAF) [DSC]",
          "stdName": "COROSOLIC ACID (CONSTITUENT OF BANABA LEAF) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "949441f8-bda9-40e0-877d-1ebcd20d8116"
          ],
          "display_name": false
        },
        {
          "uuid": "44886ea2-3aa6-455b-8a83-88fb83c517ca",
          "name": "COROSOLIC ACID [USP-RS]",
          "stdName": "COROSOLIC ACID [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d657061-c8ff-40a4-b279-98bea9bd91d6"
          ],
          "display_name": false
        },
        {
          "uuid": "2f5d927d-5b5a-4cff-8e1a-f468576f5c05",
          "name": "URS-12-EN-28-OIC ACID, 2,3-DIHYDROXY-, (2.ALPHA.,3.BETA.)-",
          "stdName": "URS-12-EN-28-OIC ACID, 2,3-DIHYDROXY-, (2.ALPHA.,3.BETA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c2d2662-d691-479b-811b-a41801ba1c7f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2d657061-c8ff-40a4-b279-98bea9bd91d6",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1c2d2662-d691-479b-811b-a41801ba1c7f",
          "citation": "chemid",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e1f4abe-60ce-4674-8e59-cd63ea5c4ea3",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "949441f8-bda9-40e0-877d-1ebcd20d8116",
          "citation": "DSC, VOL.2, 2015",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "473a0b34-42aa-40e4-a997-4872313da93e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392089000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d2899bf-cf4e-4a97-b17d-b0327027fa9c",
          "citation": "USP DIETARY SUPPLEMENTS COMPENDIUM",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f03ef004-5751-4c4e-9be6-cf858131acdf",
          "citation": "SRS import [AMX2I57A98]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=AMX2I57A98",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392089000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e17dae70-16a4-43a7-af1f-e45faf11c815",
          "citation": "COROSOLIC ACID [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dac6527a-5cc1-cc84-9ff8-f2fec591f506",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Cuscohygrine",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "04a47ea8-0395-c4f5-4e33-e2a644f832bc",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c8126bc0-6edf-472e-91d1-b56ab171b55e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3665e008-23cf-39a3-e944-3a085fd25ea9",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "01fda993-cf49-bded-a4ad-c6515267be21",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0e445af4-7d18-4ddf-995d-e9fc755ac21e",
          "id": "0e445af4-7d18-4ddf-995d-e9fc755ac21e",
          "molfile": "\n  Marvin  01132100592D          \n\n 34 38  0  0  1  0            999 V2000\n    8.6465   -3.7004    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.6465   -2.8812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3659   -4.1165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3659   -4.9356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6465   -5.3470    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.6465   -6.1745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9367   -6.5869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2222   -6.1745    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.2222   -6.9982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2222   -5.3470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5076   -4.9356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7930   -5.3470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7930   -6.1745    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.1180   -6.5869    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.1180   -5.7630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3686   -6.1745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6540   -6.5869    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.9442   -6.1745    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6540   -7.4097    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    2.9442   -7.8255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3686   -7.8255    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.6699   -8.6603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3686   -8.8348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1180   -7.4795    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.7930   -7.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5076   -7.4097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5076   -6.5869    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.5076   -5.7630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9367   -4.9356    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.9367   -4.1165    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.2222   -3.7004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3659   -5.7630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0757   -5.3470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3659   -6.5869    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n 30  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 29  1  0  0  0  0\n  5 32  1  1  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  6  0  0  0\n  8 10  1  0  0  0  0\n 27  8  1  0  0  0  0\n 10 11  2  0  0  0  0\n 29 10  1  6  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  1  0  0  0\n 14 13  1  0  0  0  0\n 13 27  1  0  0  0  0\n 14 15  1  1  0  0  0\n 14 16  1  0  0  0  0\n 14 24  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  6  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  1  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 24 21  1  1  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 27 26  1  0  0  0  0\n 27 28  1  1  0  0  0\n 29 30  1  0  0  0  0\n 30 31  1  1  0  0  0\n 32 33  1  0  0  0  0\n 32 34  2  0  0  0  0\nM  END",
          "smiles": "C[C@@H]1CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@H]([C@@H](C(C)(C)[C@@H]5CC[C@]43C)O)O)[C@@H]2[C@H]1C)C(=O)O",
          "formula": "C30H48O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9163dcd1-5fc0-4a8f-8798-80b133286341"
          },
          "defined_stereo": 11,
          "ez_centers": 0,
          "molecular_weight": "472.7009",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 11
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9a50748a-aac6-4ae6-9f9d-d01bf5cce3c7",
      "version": "14",
      "structure": {
        "id": "4ed03729-0b41-4416-b717-d0b0a14c458f",
        "molfile": "\n  Marvin  01132104072D          \n\n 37 41  0  0  1  0            999 V2000\n    3.6540   -7.4097    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.6540   -6.5869    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.3686   -6.1745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1180   -6.5869    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.1180   -7.4795    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.3686   -7.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6699   -8.6603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3686   -8.8348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7930   -7.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5076   -7.4097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5076   -6.5869    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.5076   -5.7630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2222   -6.1745    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.2222   -6.9982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9367   -6.5869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6465   -6.1745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6465   -5.3470    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.3659   -5.7630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0757   -5.3470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3659   -6.5869    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3659   -4.9356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3659   -4.1165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6465   -3.7004    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.6465   -2.8812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9367   -4.1165    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.2222   -3.7004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9367   -4.9356    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.2222   -4.5277    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2222   -5.3470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5076   -4.9356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7930   -5.3470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7930   -6.1745    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.7930   -6.9982    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0387   -8.3676    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1180   -5.7630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9442   -6.1745    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9442   -7.8255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  5  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  1  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  6  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  1  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 17 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  6  0  0  0\n 23 25  1  0  0  0  0\n 25 26  1  1  0  0  0\n 25 27  1  0  0  0  0\n 17 27  1  0  0  0  0\n 27 28  1  1  0  0  0\n 27 29  1  0  0  0  0\n 13 29  1  0  0  0  0\n 29 30  2  0  0  0  0\n 30 31  1  0  0  0  0\n 31 32  1  0  0  0  0\n 11 32  1  0  0  0  0\n 32  4  1  0  0  0  0\n 32 33  1  6  0  0  0\n  5 34  1  6  0  0  0\n  4 35  1  1  0  0  0\n  2 36  1  6  0  0  0\n  1 37  1  1  0  0  0\nM  END",
        "smiles": "C[C@@H]1CC[C@@]2(CC[C@]3(C)C(=CC[C@]4([H])[C@@]5(C)C[C@H]([C@@H](C(C)(C)[C@]5([H])CC[C@]43C)O)O)[C@]2([H])[C@H]1C)C(=O)O",
        "formula": "C30H48O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 11,
        "ez_centers": 0,
        "molecular_weight": "472.7009",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "f03ef004-5751-4c4e-9be6-cf858131acdf",
          "9e1f4abe-60ce-4674-8e59-cd63ea5c4ea3"
        ],
        "stereo_centers": 11
      },
      "unii": "AMX2I57A98"
    }
  ]
}