{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9e280366-2ba9-49ca-9880-2d40468f332e",
          "code": "21 CFR 700.11",
          "comments": "PART 700 ? GENERAL|Subpart B--Requirements for Specific Cosmetic Products|Sec. 700.11 Cosmetics containing bithionol.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=700.11",
          "code_system": "CFR",
          "references": [
            "d1f793c7-a4ef-4452-b443-b55065e09aa1"
          ]
        },
        {
          "uuid": "16c64f24-4ba2-4efc-b0c5-095798769edc",
          "code": "SUB05857MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d1f793c7-a4ef-4452-b443-b55065e09aa1"
          ]
        },
        {
          "uuid": "90d93b0d-bd1a-4e05-9dbd-347bb8b476dc",
          "code": "64201",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3272",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "d1f793c7-a4ef-4452-b443-b55065e09aa1"
          ]
        },
        {
          "uuid": "342e03f1-de84-4ace-9a1c-8c7b7297d298",
          "code": "201",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=201",
          "code_system": "INN",
          "references": [
            "d1f793c7-a4ef-4452-b443-b55065e09aa1"
          ]
        },
        {
          "uuid": "2ce6d4d9-59af-45ab-afc5-3b41810518bf",
          "code": "202-565-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.333",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d1f793c7-a4ef-4452-b443-b55065e09aa1"
          ]
        },
        {
          "uuid": "2d3def09-5e1d-4e7a-b49a-b9ec029bf334",
          "code": "m2577",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2577?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d1f793c7-a4ef-4452-b443-b55065e09aa1"
          ]
        },
        {
          "uuid": "b2da96a7-d63e-40fb-849e-c8530532e624",
          "code": "CHEMBL290106",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL290106",
          "code_system": "ChEMBL",
          "references": [
            "d1f793c7-a4ef-4452-b443-b55065e09aa1"
          ]
        },
        {
          "uuid": "d4466797-87dd-4f3f-90b4-002f5236233c",
          "code": "2406",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2406",
          "code_system": "PUBCHEM",
          "references": [
            "d1f793c7-a4ef-4452-b443-b55065e09aa1"
          ]
        },
        {
          "uuid": "1fa703a4-61d5-4684-8ce9-e87ac32b5462",
          "code": "P02BX01",
          "comments": "ATC|ANTIPARASITIC PRODUCTS, INSECTICIDES AND REPELLENTS|ANTHELMINTICS|ANTITREMATODALS|Other antitrematodal agents|bithionol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=P02BX01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "d1f793c7-a4ef-4452-b443-b55065e09aa1"
          ]
        },
        {
          "uuid": "b85c17a9-8bc2-42ef-80cb-211a47241f6b",
          "code": "D10AB01",
          "comments": "ATC|DERMATOLOGICALS|ANTI-ACNE PREPARATIONS|ANTI-ACNE PREPARATIONS FOR TOPICAL USE|Preparations containing sulfur|bithionol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=D10AB01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "d1f793c7-a4ef-4452-b443-b55065e09aa1"
          ]
        },
        {
          "uuid": "332f7cc4-fd40-4cce-9f23-9cfb4bed2f6f",
          "code": "QD10AB01",
          "comments": "VATC|ANTI-ACNE PREPARATIONS|ANTI-ACNE PREPARATIONS FOR TOPICAL USE|Preparations containing sulfur|bithionol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QD10AB01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "d1f793c7-a4ef-4452-b443-b55065e09aa1"
          ]
        },
        {
          "uuid": "faf8e15d-49d6-4319-86e1-fd72ad4797fb",
          "code": "QP52AG07",
          "comments": "VATC|ANTHELMINTICS|ANTHELMINTICS|Phenol derivatives, incl. salicylanilides|bithionol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QP52AG07&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "d1f793c7-a4ef-4452-b443-b55065e09aa1"
          ]
        },
        {
          "uuid": "80281dfa-870e-4ff8-ba58-cc78ff0b0cba",
          "code": "97-18-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=97-18-7",
          "code_system": "CAS",
          "references": [
            "d1f793c7-a4ef-4452-b443-b55065e09aa1",
            "426e1df0-0e16-45fc-831e-78468e981888"
          ]
        },
        {
          "uuid": "05eb7c4f-4fd9-430b-9859-d1852f1ca9ca",
          "code": "C77030",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C77030",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d1f793c7-a4ef-4452-b443-b55065e09aa1"
          ]
        },
        {
          "uuid": "4510decf-c8d3-440b-a819-3457510e01a6",
          "code": "D001735",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68001735",
          "code_system": "MESH",
          "references": [
            "d1f793c7-a4ef-4452-b443-b55065e09aa1"
          ]
        },
        {
          "uuid": "b6a2180d-713c-4e13-871b-84d13c37c10e",
          "code": "BITHIONOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bithionol",
          "code_system": "WIKIPEDIA",
          "references": [
            "d1f793c7-a4ef-4452-b443-b55065e09aa1"
          ]
        },
        {
          "uuid": "6e9b1ffc-1da2-21a4-1d41-ca8ffa35922f",
          "code": "6380",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6380",
          "code_system": "HSDB",
          "references": [
            "240ee7c8-927c-8641-5e73-679db3a6c32c"
          ]
        },
        {
          "uuid": "6fd8e8bd-4471-1d09-c757-25862c08b28e",
          "code": "DTXSID9021342",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9021342",
          "code_system": "EPA CompTox",
          "references": [
            "7bfa9734-1643-1101-cde8-983c77631d38"
          ]
        },
        {
          "uuid": "cf0cbc3b-05e9-6b08-12da-8e105de94085",
          "code": "C28394",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Topical Anti-Infective Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28394",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a3e42e94-418b-c1d9-037b-2f519dcd1374"
          ]
        },
        {
          "uuid": "6347f37f-d294-4645-8f2c-f06068b4f558",
          "code": "AMT77LS62O",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "be6c5313-e0b6-cc48-6cba-5c76b9de315d",
          "code": "3032",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3032",
          "code_system": "DRUG CENTRAL",
          "references": [
            "a3e42e94-418b-c1d9-037b-2f519dcd1374"
          ]
        },
        {
          "uuid": "1f7c0048-e6f9-0489-c164-791bc7f9b5e3",
          "code": "DB04813",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB04813",
          "code_system": "DRUG BANK",
          "references": [
            "a3e42e94-418b-c1d9-037b-2f519dcd1374"
          ]
        },
        {
          "uuid": "d9b38e32-1da2-0386-b152-56959352d896",
          "code": "3131",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3131",
          "code_system": "CHEBI",
          "references": [
            "a3e42e94-418b-c1d9-037b-2f519dcd1374"
          ]
        },
        {
          "uuid": "9de184e8-d20a-c86f-5ba1-c9d59270d158",
          "code": "100000086322",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "92bd7ad5-4949-3f10-d70d-e246ae902b72"
          ]
        },
        {
          "uuid": "cf2d6dc9-a0a3-5e7b-73de-75f7326273d2",
          "code": "47129",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=47129",
          "code_system": "NSC",
          "references": [
            "97373bca-5e85-55a8-3e77-772798d58515"
          ]
        },
        {
          "uuid": "c0eeb798-3ba8-916f-d8ce-71502a8e815d",
          "code": "bithionol",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/bithionol.html",
          "code_system": "ALANWOOD",
          "references": [
            "eff59a78-ea69-56a0-0ed4-d9baa3c23e6f"
          ]
        },
        {
          "uuid": "13bb21d6-d155-5a2e-2ece-38a1af9261ed",
          "code": "21 CFR 216.24",
          "comments": "PART 216 -- HUMAN DRUG COMPOUNDING|Subpart B--Compounded Drug Products|Sec. 216.24 Drug products withdrawn or removed from the market for reasons of safety or effectiveness.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=216.24",
          "code_system": "CFR",
          "references": [
            "5f7817b4-6c25-ed5f-b589-e9665b1d1c2e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "b3abfc2b-556c-4602-ab77-acf28f8a5dde",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "9a3a2bbf-4095-4167-b341-88c179d5678d",
            "refuuid": "b8c759f1-14fd-4ffc-826a-af31ac6f8105",
            "name": "BITHIONOL",
            "unii": "AMT77LS62O",
            "linking_id": "AMT77LS62O",
            "ref_pname": "BITHIONOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "24d6a34b-2905-47c5-8915-cf69fead23df",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "6878727d-c601-4fc8-8963-94394df672af",
            "refuuid": "2ce28498-aa96-4685-af6d-cea8e428fb86",
            "name": "BITHIONOLATE SODIUM",
            "unii": "66V0139H9A",
            "linking_id": "66V0139H9A",
            "ref_pname": "BITHIONOLATE SODIUM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f8c7970d-4650-48d2-9ec7-bd5323dc6477",
          "name": "2,2'-THIOBIS(4,6-DICHLOROPHENOL)",
          "stdName": "2,2'-THIOBIS(4,6-DICHLOROPHENOL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd59607f-a703-4824-aa06-f825b2b90244"
          ],
          "display_name": false
        },
        {
          "uuid": "9efebc1e-d512-461d-ab9c-fd6a7eae335a",
          "name": "BITHIN",
          "stdName": "BITHIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2349572c-9e0f-4230-a475-98cd75b94778",
            "470fd298-a399-432c-997b-f35f952348cb"
          ],
          "display_name": false
        },
        {
          "uuid": "f6a40e6a-f04b-4e9f-b1b3-9fed8f93d65d",
          "name": "BITHIONOL",
          "stdName": "BITHIONOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d47a7bd-4db5-43a9-a945-939b6e496f73",
            "b40d5239-48fe-455f-97e1-a4697fa85328",
            "24c79bf2-e6cd-468a-b611-e0bbbbf2926e",
            "3299f4b9-bb75-4be3-be42-f31a45f2fd08",
            "ad9ae9bb-ff4d-4d23-ba7b-246c4c3b9659",
            "c0ac1adc-4fa8-4144-a866-45a360ef2420",
            "93f80b17-0cdb-49c1-962e-375be8570d1f",
            "1f8eb636-7195-4219-a6eb-c42e4e09cd2d",
            "792cbed4-e423-4deb-a586-d898378e3330",
            "470fd298-a399-432c-997b-f35f952348cb",
            "9c17ce3b-d418-40ed-b67b-5505dcc7baa3",
            "8e90b3f6-9b8c-45b5-979d-b08033778e51",
            "4c2d6fb6-a8fb-4ae0-b922-aba71063086b",
            "9c64d91e-496c-4388-811a-8d58af2444bc"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "528ea99c-2b81-4885-bf5a-b74735792901",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "ae9efe4b-d5cd-4fdd-97d6-aa7489e61b73",
          "name": "BITHIONOL [HSDB]",
          "stdName": "BITHIONOL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f8eb636-7195-4219-a6eb-c42e4e09cd2d",
            "8e90b3f6-9b8c-45b5-979d-b08033778e51"
          ],
          "display_name": false
        },
        {
          "uuid": "ec4e146e-f847-4b9f-877e-c591caa96539",
          "name": "BITHIONOL [JAN]",
          "stdName": "BITHIONOL [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e90b3f6-9b8c-45b5-979d-b08033778e51",
            "470fd298-a399-432c-997b-f35f952348cb"
          ],
          "display_name": false
        },
        {
          "uuid": "d343c9ab-10e7-459b-b49b-755542b95c86",
          "name": "BITHIONOL [MART.]",
          "stdName": "BITHIONOL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c64d91e-496c-4388-811a-8d58af2444bc"
          ],
          "display_name": false
        },
        {
          "uuid": "e1c40b5b-e720-4663-984e-a9df21b78c15",
          "name": "BITHIONOL [MI]",
          "stdName": "BITHIONOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e90b3f6-9b8c-45b5-979d-b08033778e51",
            "9c17ce3b-d418-40ed-b67b-5505dcc7baa3"
          ],
          "display_name": false
        },
        {
          "uuid": "2b7c08af-460b-5485-f955-7c32783d18bf",
          "name": "Bithionol [WHO-DD]",
          "stdName": "BITHIONOL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34e7e693-546e-606a-6e79-38c0ce087fd5"
          ],
          "display_name": false
        },
        {
          "uuid": "e3811dda-4689-4834-a0dd-bab4076de6e8",
          "name": "LOROTHIDOL",
          "stdName": "LOROTHIDOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd59607f-a703-4824-aa06-f825b2b90244"
          ],
          "display_name": false
        },
        {
          "uuid": "d50212e5-deea-4010-a475-c4f17c741369",
          "name": "NSC-47129",
          "stdName": "NSC-47129",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e90b3f6-9b8c-45b5-979d-b08033778e51",
            "309a5f5c-77bb-4f60-8b0b-1ff8c377826f"
          ],
          "display_name": false
        },
        {
          "uuid": "9c538262-8ed9-4d91-a678-12641c95179c",
          "name": "bithionol [INN]",
          "stdName": "BITHIONOL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0ac1adc-4fa8-4144-a866-45a360ef2420"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "24c79bf2-e6cd-468a-b611-e0bbbbf2926e",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cd59607f-a703-4824-aa06-f825b2b90244",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c0ac1adc-4fa8-4144-a866-45a360ef2420",
          "citation": "INN Proposed List 1",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "470fd298-a399-432c-997b-f35f952348cb",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e90b3f6-9b8c-45b5-979d-b08033778e51",
          "citation": "KEGG",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c64d91e-496c-4388-811a-8d58af2444bc",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c17ce3b-d418-40ed-b67b-5505dcc7baa3",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2349572c-9e0f-4230-a475-98cd75b94778",
          "citation": "D00802",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f8eb636-7195-4219-a6eb-c42e4e09cd2d",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad9ae9bb-ff4d-4d23-ba7b-246c4c3b9659",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "309a5f5c-77bb-4f60-8b0b-1ff8c377826f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1f793c7-a4ef-4452-b443-b55065e09aa1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389652000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5cf9583-6856-45f7-849a-b338ee13abdc",
          "citation": "SRS import [AMT77LS62O]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=AMT77LS62O",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389652000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93f80b17-0cdb-49c1-962e-375be8570d1f",
          "citation": "BITHIONOL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3299f4b9-bb75-4be3-be42-f31a45f2fd08",
          "citation": "BITHIONOL [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4c2d6fb6-a8fb-4ae0-b922-aba71063086b",
          "citation": "BITHIONOL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1d47a7bd-4db5-43a9-a945-939b6e496f73",
          "citation": "BITHIONOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b40d5239-48fe-455f-97e1-a4697fa85328",
          "citation": "BITHIONOL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "792cbed4-e423-4deb-a586-d898378e3330",
          "citation": "BITHIONOL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "240ee7c8-927c-8641-5e73-679db3a6c32c",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+97-18-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7bfa9734-1643-1101-cde8-983c77631d38",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=97-18-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a3e42e94-418b-c1d9-037b-2f519dcd1374",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "426e1df0-0e16-45fc-831e-78468e981888",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "eff59a78-ea69-56a0-0ed4-d9baa3c23e6f",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "34e7e693-546e-606a-6e79-38c0ce087fd5",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "97373bca-5e85-55a8-3e77-772798d58515",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "92bd7ad5-4949-3f10-d70d-e246ae902b72",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "5f7817b4-6c25-ed5f-b589-e9665b1d1c2e",
          "citation": "21 CFR 216.24",
          "doc_type": "CFR",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c889fbb9-78b8-40bc-8235-ef20f5ad25e3",
          "id": "c889fbb9-78b8-40bc-8235-ef20f5ad25e3",
          "molfile": "\n  Marvin  01132110222D          \n\n 19 20  0  0  0  0            999 V2000\n    1.4346   -0.0258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4346   -0.8463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7147   -1.2565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8463    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.7147   -2.0770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4346   -2.4873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4501   -3.3077    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.1518   -2.0770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1518   -1.2565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8562   -0.8463    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5709   -1.2307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5709   -2.0538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2882   -2.4614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2676   -3.2845    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.0106   -2.0538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0106   -1.2307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7227   -0.8231    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.2882   -0.8231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2882    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  9  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 18 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 16  1  0  0  0  0\n 16 18  1  0  0  0  0\n 19 18  1  0  0  0  0\nM  END",
          "smiles": "c1c(cc(c(c1Cl)O)Sc2cc(cc(c2O)Cl)Cl)Cl",
          "formula": "C12H6Cl4O2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "de79d7c8-e018-483d-9a02-950d65856347"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "356.0531",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b8c759f1-14fd-4ffc-826a-af31ac6f8105",
      "version": "16",
      "structure": {
        "id": "e77f2315-1bdf-4d6b-b39b-db009bd4451d",
        "molfile": "\n  Marvin  01132111592D          \n\n 19 20  0  0  0  0            999 V2000\n    2.1518   -1.2565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5709   -1.2307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8562   -0.8463    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4346   -0.8463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2882   -0.8231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7147   -1.2565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0106   -1.2307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5709   -2.0538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1518   -2.0770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7147   -2.0770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0106   -2.0538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2882   -2.4614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4346   -2.4873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8463    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.7227   -0.8231    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.4346   -0.0258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2882    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2676   -3.2845    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.4501   -3.3077    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  2  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10 13  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12  8  2  0  0  0  0\n 13  9  2  0  0  0  0\n 14  6  1  0  0  0  0\n 15  7  1  0  0  0  0\n 16  4  1  0  0  0  0\n 17  5  1  0  0  0  0\n 18 12  1  0  0  0  0\n 19 13  1  0  0  0  0\n 10  6  2  0  0  0  0\n 11  7  2  0  0  0  0\nM  END",
        "smiles": "c1c(cc(c(c1Cl)O)Sc2cc(cc(c2O)Cl)Cl)Cl",
        "formula": "C12H6Cl4O2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "356.0531",
        "optical_activity": "NONE",
        "references": [
          "24c79bf2-e6cd-468a-b611-e0bbbbf2926e",
          "b5cf9583-6856-45f7-849a-b338ee13abdc",
          "c0ac1adc-4fa8-4144-a866-45a360ef2420"
        ],
        "stereo_centers": 0
      },
      "unii": "AMT77LS62O"
    }
  ]
}