{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "69c7e4e0-fc84-42e9-8a05-cf5c9284bf70", "code": "930050-18-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=930050-18-3", "code_system": "CAS", "references": [ "68b8647e-83f2-41fa-9cd0-9b46e3bd41a4", "2dab2889-c30a-4ce8-bf73-1e1a92c22d23" ] }, { "uuid": "e0472a11-cd7a-4d64-8b64-a2c4911b684c", "code": "16117395", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16117395", "code_system": "PUBCHEM", "references": [ "68b8647e-83f2-41fa-9cd0-9b46e3bd41a4" ] }, { "uuid": "394625f5-f1ab-4a76-bdf8-89b0853e0244", "code": "AME10783QJ", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "2239737e-37e7-41e4-8eeb-1c1c9990af43", "name": "ACTOWHITE HD251", "stdName": "ACTOWHITE HD251", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "87f73b53-57ac-4524-8181-c8a2046d8cf8", "a7dcc49c-1fa5-4f71-b31d-68a2335734a6" ], "display_name": false }, { "uuid": "c6cb2d68-06de-4693-8314-d057ddf1223e", "name": "HEXANAMIDE, N-(2-(3,4-DIHYDROXYPHENYL)ETHYL)-", "stdName": "HEXANAMIDE, N-(2-(3,4-DIHYDROXYPHENYL)ETHYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "6f775623-6d4a-4136-9fd0-f2c761317591", "87f73b53-57ac-4524-8181-c8a2046d8cf8" ], "display_name": false }, { "uuid": "6b0b10db-2807-4124-a67e-26973cf5baf2", "name": "N-CAPROYL DOPAMINE", "stdName": "N-CAPROYL DOPAMINE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "87f73b53-57ac-4524-8181-c8a2046d8cf8", "a7dcc49c-1fa5-4f71-b31d-68a2335734a6", "b8f8c15a-06e5-4ff6-886a-5a80122863d4" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "7fc263c4-ca87-4d73-a1b4-f9c71f4bd1f4", "name_org": "INCI" } ] } ], "references": [ { "uuid": "a7dcc49c-1fa5-4f71-b31d-68a2335734a6", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "87f73b53-57ac-4524-8181-c8a2046d8cf8", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6f775623-6d4a-4136-9fd0-f2c761317591", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "68b8647e-83f2-41fa-9cd0-9b46e3bd41a4", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393363000, "tags": [ "NOMEN" ] }, { "uuid": "8c4ac579-2af1-472c-aa5d-eb544d26c205", "citation": "SRS import [AME10783QJ]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=AME10783QJ", "doc_type": "SRS", "public_domain": true, "document_date": 1493393363000, "tags": [ "NOMEN" ] }, { "uuid": "b8f8c15a-06e5-4ff6-886a-5a80122863d4", "citation": "N-CAPROYL DOPAMINE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "2dab2889-c30a-4ce8-bf73-1e1a92c22d23", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c21d6a98-2b4f-4927-9448-9a0a3b7a6c87", "id": "c21d6a98-2b4f-4927-9448-9a0a3b7a6c87", "molfile": "\n Marvin 01132110022D \n\n 18 18 0 0 0 0 999 V2000\n 16.0853 -1.7056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3708 -2.1180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6564 -1.7056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9419 -2.1180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2273 -1.7056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5128 -2.1180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5128 -2.9431 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7983 -1.7056 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0838 -2.1181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3693 -1.7056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6548 -2.1181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6548 -2.9431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9403 -3.3555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2258 -2.9431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5114 -3.3557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2258 -2.1181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5113 -1.7056 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9403 -1.7056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 2 0 0 0 0\n 8 6 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 18 2 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 14 2 0 0 0 0\n 16 17 1 0 0 0 0\n 18 16 1 0 0 0 0\nM END", "smiles": "CCCCCC(=O)NCCc1ccc(c(c1)O)O", "formula": "C14H21NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "4af39211-b56f-4bda-a1f0-7f399684a9f7" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "251.322", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "6e8177dd-ca3c-4f7c-9131-aa76cb156108", "version": "3", "structure": { "id": "e096a598-36a0-4795-8a3b-c5b7ee624000", "molfile": "\n Marvin 01132111382D \n\n 18 18 0 0 0 0 999 V2000\n 10.3693 -1.7056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6548 -2.1181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6548 -2.9431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9403 -3.3555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2258 -2.9431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5114 -3.3557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2258 -2.1181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5113 -1.7056 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9403 -1.7056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0838 -2.1181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7983 -1.7056 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5128 -2.1180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5128 -2.9431 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2273 -1.7056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9419 -2.1180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6564 -1.7056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3708 -2.1180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0853 -1.7056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 5 2 0 0 0 0\n 7 8 1 0 0 0 0\n 9 7 1 0 0 0 0\n 2 9 2 0 0 0 0\n 1 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\nM END", "smiles": "CCCCCC(=O)NCCc1ccc(c(c1)O)O", "formula": "C14H21NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "251.322", "optical_activity": "NONE", "references": [ "6f775623-6d4a-4136-9fd0-f2c761317591", "8c4ac579-2af1-472c-aa5d-eb544d26c205" ], "stereo_centers": 0 }, "unii": "AME10783QJ" } ] }