{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "bd8280a8-897b-47cc-bdd9-fd09e1929fc4", "code": "17949-65-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=17949-65-4", "code_system": "CAS", "references": [ "aeb95593-71f8-4247-ba92-157399568432", "a0d0937b-a2d4-40bf-ba32-8b76ae5c1815" ] }, { "uuid": "b831e653-87d6-4cf6-ba72-056be98d5f4e", "code": "C87350", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87350", "code_system": "NCI_THESAURUS", "references": [ "aeb95593-71f8-4247-ba92-157399568432" ] }, { "uuid": "88d5a579-0070-4f6c-9312-14d10a935752", "code": "C030614", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67030614", "code_system": "MESH", "references": [ "aeb95593-71f8-4247-ba92-157399568432" ] }, { "uuid": "e6a52b4c-c516-4ef9-9e08-df4204a4ee6b", "code": "58301", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/58301/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "aeb95593-71f8-4247-ba92-157399568432" ] }, { "uuid": "78724951-3f60-4195-aaf2-043f31cacfad", "code": "SUB32915", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "aeb95593-71f8-4247-ba92-157399568432" ] }, { "uuid": "e76c700e-835b-428b-84fe-2a20268a76d6", "code": "9904746", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9904746", "code_system": "PUBCHEM", "references": [ "aeb95593-71f8-4247-ba92-157399568432" ] }, { "uuid": "ba2f5958-41a9-ac0f-0a7e-51813e974254", "code": "DTXSID60170814", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60170814", "code_system": "EPA CompTox", "references": [ "2752ecea-8ed5-4c8b-a6c5-537849d0060d" ] }, { "uuid": "d7257674-51ec-d503-f8c6-25a5ff811fde", "code": "C1505", "comments": "Dietary Supplement", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505", "code_system": "NCI_THESAURUS", "references": [ "cb0c9b72-e038-1b42-4d82-d77cc00dec81" ] }, { "uuid": "92603d8a-59de-f3b0-c00f-a23c75da6928", "code": "2939 (Number of products:7)", "comments": "Dietary Supplement Label Database|chemical|Zinc Picolinate", "type": "PRIMARY", "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2939&item=Zinc Picolinate", "code_system": "DSLD", "references": [ "cb0c9b72-e038-1b42-4d82-d77cc00dec81" ] }, { "uuid": "aea757f0-5fe0-237d-6b6c-d3778d92f57b", "code": "DB11175", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB11175", "code_system": "DRUG BANK", "references": [ "cb0c9b72-e038-1b42-4d82-d77cc00dec81" ] }, { "uuid": "3c579da2-8616-42f3-a9f9-cab2c7651c27", "code": "ALO92O31SE", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "764e78bf-8229-979a-b7d1-2f1695cb4f05", "code": "Zinc picolinate", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Zinc_picolinate", "code_system": "WIKIPEDIA", "references": [ "474056e0-1b3c-aa3a-7ab6-20aa8f7e7980" ] }, { "uuid": "cf47d7c2-f673-c8b6-1f10-b799bdf70121", "code": "ALO92O31SE", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=ALO92O31SE", "code_system": "DAILYMED", "references": [ "51fda24a-ba45-2b83-8144-47111632b2df" ] }, { "uuid": "2c7cc017-222f-e3cb-8cd4-b55cf05d80c9", "code": "100000126049", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "9eeb7181-2892-9f65-8045-37ae03bc26fd" ] } ], "relationships": [ { "uuid": "742abfbd-931d-434f-8a3e-5a6fba3531bb", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "5888d6a4-4336-4fde-87d8-3fcbf9a1d7da", "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c", "name": "ZINC CATION", "unii": "13S1S8SF37", "linking_id": "13S1S8SF37", "ref_pname": "ZINC CATION", "substance_class": "reference" } }, { "uuid": "1569c22b-3bc2-466d-aca5-8a357f5bb38e", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "d567e0c6-9053-4d87-8b40-4f3ddaca0c04", "refuuid": "f65fc87f-684c-416b-89bf-f16f12658ed3", "name": "PICOLINIC ACID", "unii": "QZV2W997JQ", "linking_id": "QZV2W997JQ", "ref_pname": "PICOLINIC ACID", "substance_class": "reference" } }, { "uuid": "a6e2e762-1249-4817-8b32-c65efe45864f", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "7bf61e14-89cd-4ead-ac3a-084733cf3e0c", "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c", "name": "ZINC CATION", "unii": "13S1S8SF37", "linking_id": "13S1S8SF37", "ref_pname": "ZINC CATION", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "8114adc8-e1e6-49c2-a11e-28b5dd598ac2", "name": "2-PYRIDINECARBOXYLIC ACID, ZINC COMPLEX", "stdName": "2-PYRIDINECARBOXYLIC ACID, ZINC COMPLEX", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f63fe41f-2f96-4966-ae07-207fa0c6f9e0", "2d70bfe6-120a-4c6d-a20e-f2d2446ec06d" ], "display_name": false }, { "uuid": "25787b86-fcc4-491d-94aa-e13dcb52f9ee", "name": "ZINC PICOLINATE", "stdName": "ZINC PICOLINATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "f63fe41f-2f96-4966-ae07-207fa0c6f9e0", "a750c7da-ddb4-4c25-8b9b-9a29e8eb53b4", "b8ae1a36-3f97-49f2-ae31-d1e01e1df882", "2d70bfe6-120a-4c6d-a20e-f2d2446ec06d", "765b9e08-5fae-4b44-ab6b-513339329365", "b6ff986d-28bb-46ff-995a-c4271753f35b" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "a154004f-862a-4566-bd11-c02f21082b6d", "name_org": "INCI" } ] }, { "uuid": "b8966da6-ef12-8251-0e9c-1cf32a93e16a", "name": "Zinc picolinate [WHO-DD]", "stdName": "ZINC PICOLINATE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6895640e-e4e3-fb54-0ded-9a1c0524b06b" ], "display_name": false } ], "references": [ { "uuid": "f63fe41f-2f96-4966-ae07-207fa0c6f9e0", "citation": "CTFA", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "2d70bfe6-120a-4c6d-a20e-f2d2446ec06d", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b8ae1a36-3f97-49f2-ae31-d1e01e1df882", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a750c7da-ddb4-4c25-8b9b-9a29e8eb53b4", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "aeb95593-71f8-4247-ba92-157399568432", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389916000, "tags": [ "NOMEN" ] }, { "uuid": "e81131d3-3402-4419-abc4-764db40590e3", "citation": "SRS import [ALO92O31SE]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ALO92O31SE", "doc_type": "SRS", "public_domain": true, "document_date": 1493389916000, "tags": [ "NOMEN" ] }, { "uuid": "765b9e08-5fae-4b44-ab6b-513339329365", "citation": "ZINC PICOLINATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "b6ff986d-28bb-46ff-995a-c4271753f35b", "citation": "ZINC PICOLINATE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "2752ecea-8ed5-4c8b-a6c5-537849d0060d", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=17949-65-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "cb0c9b72-e038-1b42-4d82-d77cc00dec81", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "474056e0-1b3c-aa3a-7ab6-20aa8f7e7980", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "a0d0937b-a2d4-40bf-ba32-8b76ae5c1815", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "51fda24a-ba45-2b83-8144-47111632b2df", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "6895640e-e4e3-fb54-0ded-9a1c0524b06b", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "9eeb7181-2892-9f65-8045-37ae03bc26fd", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4b993287-8922-4c2c-bcef-7bc8919c8d15", "id": "4b993287-8922-4c2c-bcef-7bc8919c8d15", "molfile": "\n Marvin 01132103572D \n\n 1 0 0 0 0 0 999 V2000\n 4.3960 -1.1690 0.0000 Zn 0 2 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 2\nM END", "smiles": "[Zn+2]", "formula": "Zn", "atropisomerism": "No", "charge": 2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "56781452-682b-46a9-9db0-36b36141e2f0" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "65.3956", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "7701a4c9-b8be-4ae8-8226-06cc3874b14a", "id": "7701a4c9-b8be-4ae8-8226-06cc3874b14a", "molfile": "\n Marvin 01132106112D \n\n 9 9 0 0 0 0 999 V2000\n 3.1833 -1.1923 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 2.4604 -0.7783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4546 0.0525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7374 -1.1981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7374 -2.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0232 -2.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3031 -2.0173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3031 -1.2040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0232 -0.7871 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 2 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 9 4 2 0 0 0 0\n 6 5 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\nM CHG 1 1 -1\nM END", "smiles": "c1ccnc(c1)C(=O)[O-]", "formula": "C6H4NO2", "atropisomerism": "No", "charge": -1, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "c5db7e0c-3c46-4705-ad10-2ada266a2cbb" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "122.1017", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "58070d3f-d296-4b70-9946-f951aad68869", "version": "13", "structure": { "id": "7601e093-0324-49ea-ab1e-984f3e4cdb3d", "molfile": "\n Marvin 01132106072D \n\n 19 18 0 0 0 0 999 V2000\n 2.4604 -0.7783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7374 -1.1981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0232 -0.7871 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1833 -1.1923 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 2.4546 0.0525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3031 -1.2040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7374 -2.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3031 -2.0173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0232 -2.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3960 -1.1690 0.0000 Zn 0 2 0 0 0 0 0 0 0 0 0 0\n 2.4604 -0.7783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7374 -1.1981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0232 -0.7871 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1833 -1.1923 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 2.4546 0.0525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3031 -1.2040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7374 -2.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3031 -2.0173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0232 -2.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0 0 0 0\n 4 1 1 0 0 0 0\n 5 1 2 0 0 0 0\n 6 3 2 0 0 0 0\n 7 2 2 0 0 0 0\n 8 6 1 0 0 0 0\n 9 7 1 0 0 0 0\n 9 8 2 0 0 0 0\n 2 1 1 0 0 0 0\n 14 11 1 0 0 0 0\n 15 11 2 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 17 12 2 0 0 0 0\n 16 13 2 0 0 0 0\n 18 16 1 0 0 0 0\n 19 17 1 0 0 0 0\n 19 18 2 0 0 0 0\nM CHG 3 4 -1 10 2 14 -1\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 15 1 2 3 4 5 6 7 8 9 11 12 13 14 15 16\nM SAL 1 3 17 18 19\nM SPA 1 9 1 2 3 4 5 6 7 8 9\nM SDI 1 4 -0.1169 -2.8541 -0.1169 0.4725\nM SDI 1 4 3.6033 0.4725 3.6033 -2.8541\nM SMT 1 2\nM END", "smiles": "c1ccnc(c1)C(=O)[O-].c1ccnc(c1)C(=O)[O-].[Zn+2]", "formula": "2C6H4NO2.Zn", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "309.5989", "optical_activity": "NONE", "references": [ "f63fe41f-2f96-4966-ae07-207fa0c6f9e0", "e81131d3-3402-4419-abc4-764db40590e3" ], "stereo_centers": 0 }, "unii": "ALO92O31SE" } ] }