{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "58abe961-ed56-460b-97b3-03dbafc17e2b",
          "code": "C01DA07",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|CARDIAC THERAPY|VASODILATORS USED IN CARDIAC DISEASES|Organic nitrates|propatylnitrate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C01DA07&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "6eee34d4-d8b4-40f5-9195-b0fc7b52490f"
          ]
        },
        {
          "uuid": "0e6a98e7-1a7e-42e3-bae3-a6835340f8c3",
          "code": "QC01DA07",
          "comments": "VATC|CARDIAC THERAPY|VASODILATATORS USED IN CARDIAC DISEASE|Organic nitrates|propatylnitrate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC01DA07&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "6eee34d4-d8b4-40f5-9195-b0fc7b52490f"
          ]
        },
        {
          "uuid": "ce8478ea-c840-4ac6-8c9e-3ffb2ca5fb23",
          "code": "QC01DA57",
          "comments": "VATC|CARDIAC THERAPY|VASODILATATORS USED IN CARDIAC DISEASE|Organic nitrates|propatylnitrate, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC01DA57&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "6eee34d4-d8b4-40f5-9195-b0fc7b52490f"
          ]
        },
        {
          "uuid": "faa86f43-0a81-4e31-b6f2-e9421ba25e27",
          "code": "2921-92-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2921-92-8",
          "code_system": "CAS",
          "references": [
            "6eee34d4-d8b4-40f5-9195-b0fc7b52490f",
            "21d8ce80-ef14-4c46-b0da-418942c44a6c"
          ]
        },
        {
          "uuid": "1b6651c3-7be9-4ca2-99ca-8d558bcbd6e4",
          "code": "C026352",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67026352",
          "code_system": "MESH",
          "references": [
            "6eee34d4-d8b4-40f5-9195-b0fc7b52490f"
          ]
        },
        {
          "uuid": "d37786af-9229-4a04-af9f-80c74ea54c17",
          "code": "PROPATYLNITRATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Propatylnitrate",
          "code_system": "WIKIPEDIA",
          "references": [
            "6eee34d4-d8b4-40f5-9195-b0fc7b52490f"
          ]
        },
        {
          "uuid": "ff191d4c-1739-4369-9776-6f1abc9f3409",
          "code": "C01DA57",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|CARDIAC THERAPY|VASODILATORS USED IN CARDIAC DISEASES|Organic nitrates|propatylnitrate, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C01DA57&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "6eee34d4-d8b4-40f5-9195-b0fc7b52490f"
          ]
        },
        {
          "uuid": "1deaed77-558c-411b-93ec-6a1f2ff39083",
          "code": "SUB10099MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "6eee34d4-d8b4-40f5-9195-b0fc7b52490f"
          ]
        },
        {
          "uuid": "0f229fc7-c6b1-43ba-a4b1-e683bf93428f",
          "code": "1236",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1236",
          "code_system": "INN",
          "references": [
            "6eee34d4-d8b4-40f5-9195-b0fc7b52490f"
          ]
        },
        {
          "uuid": "cc110c3b-f400-4ef2-8b29-3cd1690ecfda",
          "code": "220-866-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.018.970",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "6eee34d4-d8b4-40f5-9195-b0fc7b52490f"
          ]
        },
        {
          "uuid": "022ab3cf-1e43-4725-9055-7d44ecd142fc",
          "code": "C74425",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C74425",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6eee34d4-d8b4-40f5-9195-b0fc7b52490f"
          ]
        },
        {
          "uuid": "e5612e39-9ff5-4c40-96a4-721e49f11712",
          "code": "m9195",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9195?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "6eee34d4-d8b4-40f5-9195-b0fc7b52490f"
          ]
        },
        {
          "uuid": "aa50d3ca-8207-4c3c-8ddc-533fbf8ec584",
          "code": "CHEMBL488280",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL488280",
          "code_system": "ChEMBL",
          "references": [
            "6eee34d4-d8b4-40f5-9195-b0fc7b52490f"
          ]
        },
        {
          "uuid": "7e148fd1-0731-4587-91aa-9aab70fc8ba3",
          "code": "66261",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/66261",
          "code_system": "PUBCHEM",
          "references": [
            "6eee34d4-d8b4-40f5-9195-b0fc7b52490f"
          ]
        },
        {
          "uuid": "6a13775d-41f7-fc22-6d3c-1bb2a662ecad",
          "code": "DTXSID40183467",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40183467",
          "code_system": "EPA CompTox",
          "references": [
            "fe01feeb-6cff-1fa0-e8ea-bc4fd39ca107"
          ]
        },
        {
          "uuid": "c042eac3-e128-4132-b3c2-ddaea4860736",
          "code": "C29707",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Cardiovascular System[C78274]|Vasodilating Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29707",
          "code_system": "NCI_THESAURUS",
          "references": [
            "9f6c4f76-ac14-baa7-0f5e-29a4ec633123"
          ]
        },
        {
          "uuid": "4066e23d-3ac2-4eb7-9d1f-12876770f6ad",
          "code": "AJT2YN495R",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d5edc880-fea6-fe20-70d1-b3cc974f32cd",
          "code": "DB13255",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13255",
          "code_system": "DRUG BANK",
          "references": [
            "9f6c4f76-ac14-baa7-0f5e-29a4ec633123"
          ]
        },
        {
          "uuid": "e1209d30-739f-6daa-f5ab-819cb50edb07",
          "code": "2295",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2295",
          "code_system": "DRUG CENTRAL",
          "references": [
            "9f6c4f76-ac14-baa7-0f5e-29a4ec633123"
          ]
        },
        {
          "uuid": "208137c0-271e-78c1-0d56-5c7ab2db3a9f",
          "code": "100000081132",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b6e4fb8d-31db-d9ab-4790-bbb6ec759671"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "02bdf4d2-835b-4f3c-b89f-94c47ecab56f",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "3850d841-607d-48bd-8351-445736fa0c6b",
            "refuuid": "0f69a7d1-1b37-4693-be3c-1e1e4a076a07",
            "name": "PROPATYL NITRATE",
            "unii": "AJT2YN495R",
            "linking_id": "AJT2YN495R",
            "ref_pname": "PROPATYL NITRATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0e3027be-309f-4b3d-9555-1acfc960ede8",
          "name": "1,3-PROPANEDIOL, 2-ETHYL-2-((NITROOXY)METHYL)-, DINITRATE (ESTER)",
          "stdName": "1,3-PROPANEDIOL, 2-ETHYL-2-((NITROOXY)METHYL)-, DINITRATE (ESTER)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "abd53dfa-070c-41c8-a2e2-3e7c2f395c5a"
          ],
          "display_name": false
        },
        {
          "uuid": "dc0bc553-238c-4878-a853-e556534a29e2",
          "name": "2-Ethyl-2-(hydroxymethyl)-1,3-propanediol trinitrate",
          "stdName": "2-ETHYL-2-(HYDROXYMETHYL)-1,3-PROPANEDIOL TRINITRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "abd53dfa-070c-41c8-a2e2-3e7c2f395c5a"
          ],
          "display_name": false
        },
        {
          "uuid": "33b6d01c-a50d-4031-8901-9591ba70716a",
          "name": "ETRYNIT",
          "stdName": "ETRYNIT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "abd53dfa-070c-41c8-a2e2-3e7c2f395c5a"
          ],
          "display_name": false
        },
        {
          "uuid": "ce98f2db-de9a-4d1f-8738-9150d8ce7a68",
          "name": "ETT-N",
          "stdName": "ETT-N",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "da01235c-ccf1-4d5e-b3f2-3a9de4c4b987"
          ],
          "display_name": false
        },
        {
          "uuid": "9a047d63-7884-438e-8814-85daece51c1f",
          "name": "ETTN",
          "stdName": "ETTN",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "da01235c-ccf1-4d5e-b3f2-3a9de4c4b987"
          ],
          "display_name": false
        },
        {
          "uuid": "c7c91e3a-3b58-48c1-bc5f-0b4b8dfa6491",
          "name": "PROPATYL NITRATE",
          "stdName": "PROPATYL NITRATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b89144f5-af60-4220-910e-6fa0b129ec6b",
            "22291f24-7e15-4100-b0ee-c8f72b048c1a",
            "18b759d1-2975-4ff7-80ab-2456c321db13",
            "e052fa90-2fe3-4348-81a4-212e407176b2",
            "3cbb5da9-535f-4b40-a1ca-f919fef30c27"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "22db4bc1-a280-40b4-9566-3e51442f38da",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "22533485-0372-4dbe-afe2-5d70b6011277",
          "name": "PROPATYL NITRATE [MI]",
          "stdName": "PROPATYL NITRATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cbb5da9-535f-4b40-a1ca-f919fef30c27"
          ],
          "display_name": false
        },
        {
          "uuid": "e774bb09-19e2-4654-8a82-a328d28fcc40",
          "name": "PROPATYL NITRATE [USAN]",
          "stdName": "PROPATYL NITRATE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22291f24-7e15-4100-b0ee-c8f72b048c1a"
          ],
          "display_name": false
        },
        {
          "uuid": "c03eb12c-7c9d-4f45-9711-e2fa1c34825d",
          "name": "PROPATYLNITRATE",
          "stdName": "PROPATYLNITRATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e83700e8-a1d7-4f1d-90e3-1514559224c8",
            "67baed5b-4eb0-4f3a-bfcd-1b96dddb11d3",
            "7f69a760-a39c-473a-9c19-859db440b7a8",
            "641b3e39-3c3f-47b8-a618-2e9d4e8bfe63",
            "5fe035f3-135c-4a33-b73f-603d9f4d4c9e",
            "7b9876c1-0b48-4599-b565-e7d27c718cd5",
            "d63a62f4-027f-4698-8da3-d925366454d3"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "5e872995-92de-4b29-8e49-747b1e3243cc",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "d112d56c-3c53-45b7-aab4-f6e956e3a817",
          "name": "PROPATYLNITRATE [MART.]",
          "stdName": "PROPATYLNITRATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "641b3e39-3c3f-47b8-a618-2e9d4e8bfe63"
          ],
          "display_name": false
        },
        {
          "uuid": "30cbb8a1-ca46-adee-741a-26896f7b5ef5",
          "name": "Propatylnitrate [WHO-DD]",
          "stdName": "PROPATYLNITRATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86e736b4-f459-f3a3-360c-a70e0cc96b76"
          ],
          "display_name": false
        },
        {
          "uuid": "7d2edd80-2301-4ad7-b479-3564bb9e432b",
          "name": "WIN 9317",
          "stdName": "WIN 9317",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "da01235c-ccf1-4d5e-b3f2-3a9de4c4b987"
          ],
          "display_name": false
        },
        {
          "uuid": "c37f2a57-1995-4882-a3b5-985fe2995fd7",
          "name": "WIN-9317",
          "stdName": "WIN-9317",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35208fb3-4216-42f7-b9aa-5956fad5970a"
          ],
          "display_name": false
        },
        {
          "uuid": "9ccecd93-2d97-4a22-a25a-dcc92ac7a9ae",
          "name": "propatylnitrate [INN]",
          "stdName": "PROPATYLNITRATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67baed5b-4eb0-4f3a-bfcd-1b96dddb11d3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5fe035f3-135c-4a33-b73f-603d9f4d4c9e",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "abd53dfa-070c-41c8-a2e2-3e7c2f395c5a",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b89144f5-af60-4220-910e-6fa0b129ec6b",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35208fb3-4216-42f7-b9aa-5956fad5970a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67baed5b-4eb0-4f3a-bfcd-1b96dddb11d3",
          "citation": "INN Proposed List 12",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL12.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "22291f24-7e15-4100-b0ee-c8f72b048c1a",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "641b3e39-3c3f-47b8-a618-2e9d4e8bfe63",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3cbb5da9-535f-4b40-a1ca-f919fef30c27",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e83700e8-a1d7-4f1d-90e3-1514559224c8",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "da01235c-ccf1-4d5e-b3f2-3a9de4c4b987",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6eee34d4-d8b4-40f5-9195-b0fc7b52490f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390589000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9caf587-a195-4bc9-8cef-1c010f253b4e",
          "citation": "SRS import [AJT2YN495R]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=AJT2YN495R",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390589000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d63a62f4-027f-4698-8da3-d925366454d3",
          "citation": "PROPATYLNITRATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e052fa90-2fe3-4348-81a4-212e407176b2",
          "citation": "PROPATYL NITRATE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7b9876c1-0b48-4599-b565-e7d27c718cd5",
          "citation": "PROPATYLNITRATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "18b759d1-2975-4ff7-80ab-2456c321db13",
          "citation": "PROPATYL NITRATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7f69a760-a39c-473a-9c19-859db440b7a8",
          "citation": "PROPATYLNITRATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fe01feeb-6cff-1fa0-e8ea-bc4fd39ca107",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2921-92-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9f6c4f76-ac14-baa7-0f5e-29a4ec633123",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "21d8ce80-ef14-4c46-b0da-418942c44a6c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "86e736b4-f459-f3a3-360c-a70e0cc96b76",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b6e4fb8d-31db-d9ab-4790-bbb6ec759671",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4aecd5e0-be61-4063-83a9-af1b6e09624d",
          "id": "4aecd5e0-be61-4063-83a9-af1b6e09624d",
          "molfile": "\n  Marvin  01132103552D          \n\n 18 17  0  0  0  0            999 V2000\n    2.6659   -1.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3725   -1.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0943   -1.8186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8009   -1.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3851   -1.8573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0888   -1.4209    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    6.7473   -1.9150    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.0825   -0.5959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1064   -2.6436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3996   -3.0683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4118   -3.8933    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.0474   -4.4197    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.6962   -4.3036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0880   -0.9936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3662   -0.5877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3600    0.2373    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.0696    0.6593    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.6812    0.7109    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  9  1  0  0  0  0\n  3 14  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  2  0  0  0  0\nM  CHG  6   6   1   7  -1  11   1  12  -1  16   1  17  -1\nM  END",
          "smiles": "CCC(CO[N+](=O)[O-])(CO[N+](=O)[O-])CO[N+](=O)[O-]",
          "formula": "C6H11N3O9",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b756fd35-a45d-4631-b924-5413243d2911"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "269.1665",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0f69a7d1-1b37-4693-be3c-1e1e4a076a07",
      "version": "10",
      "structure": {
        "id": "9360a672-505f-4201-9524-72011b6c58b5",
        "molfile": "\n  Marvin  01132107382D          \n\n 18 17  0  0  0  0            999 V2000\n    6.0888   -1.4209    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    5.3851   -1.8573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7473   -1.9150    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.0825   -0.5959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8009   -1.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0943   -1.8186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3725   -1.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6659   -1.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1064   -2.6436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3996   -3.0683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4118   -3.8933    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.0474   -4.4197    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.6962   -4.3036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0880   -0.9936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3662   -0.5877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3600    0.2373    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.0696    0.6593    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.6812    0.7109    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  5  1  0  0  0  0\n  9 10  1  0  0  0  0\n  1  3  1  0  0  0  0\n 10 11  1  0  0  0  0\n  5  6  1  0  0  0  0\n 11 12  1  0  0  0  0\n  1  2  1  0  0  0  0\n 11 13  2  0  0  0  0\n  6  7  1  0  0  0  0\n  6 14  1  0  0  0  0\n  1  4  2  0  0  0  0\n 14 15  1  0  0  0  0\n  7  8  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n  6  9  1  0  0  0  0\n 16 18  2  0  0  0  0\nM  CHG  6   1   1   3  -1  11   1  12  -1  16   1  17  -1\nM  END",
        "smiles": "CCC(CO[N+](=O)[O-])(CO[N+](=O)[O-])CO[N+](=O)[O-]",
        "formula": "C6H11N3O9",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "269.1665",
        "optical_activity": "NONE",
        "references": [
          "b89144f5-af60-4220-910e-6fa0b129ec6b",
          "a9caf587-a195-4bc9-8cef-1c010f253b4e",
          "67baed5b-4eb0-4f3a-bfcd-1b96dddb11d3"
        ],
        "stereo_centers": 0
      },
      "unii": "AJT2YN495R"
    }
  ]
}