{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7beb9a6b-c722-474d-92da-be9b287a3986",
          "code": "177406-68-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=177406-68-7",
          "code_system": "CAS",
          "references": [
            "ec46e3c2-c668-4076-9e77-9b320ed64a38",
            "ca780596-31ea-4b32-8119-de2c663e03f3"
          ]
        },
        {
          "uuid": "4c7d4042-91a1-4325-9b1b-205ea9e4ef48",
          "code": "98379",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1714",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "ec46e3c2-c668-4076-9e77-9b320ed64a38"
          ]
        },
        {
          "uuid": "c63aec25-a049-4ca5-b305-7369cfa2223b",
          "code": "m2325",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2325?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ec46e3c2-c668-4076-9e77-9b320ed64a38"
          ]
        },
        {
          "uuid": "fa51eb89-74be-476b-90f5-66dab931a399",
          "code": "53297381",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/53297381",
          "code_system": "PUBCHEM",
          "references": [
            "ec46e3c2-c668-4076-9e77-9b320ed64a38"
          ]
        },
        {
          "uuid": "ec5c1037-dd3b-0630-58de-2264382cd4d5",
          "code": "7501",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7501",
          "code_system": "HSDB",
          "references": [
            "53429339-f234-23ee-8699-78d5bf5a860c"
          ]
        },
        {
          "uuid": "26fcdb8d-3e85-1b4e-c1de-0289ccc5f28e",
          "code": "DTXSID9058232",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9058232",
          "code_system": "EPA CompTox",
          "references": [
            "ec168610-d8ee-d482-4ddb-ec02d3734f26"
          ]
        },
        {
          "uuid": "7f6aca72-275b-49c4-a1b6-fbc1eb0b7159",
          "code": "AJ55PMS5IT",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "37ee9394-7395-2974-478d-ecaa1a211e40",
          "code": "81732",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:81732",
          "code_system": "CHEBI",
          "references": [
            "edb0ab71-2580-4961-62dc-0e3e34e025db"
          ]
        },
        {
          "uuid": "7b645625-72a0-35be-0a5b-9c685630ae07",
          "code": "benthiavalicarb-isopropyl",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/benthiavalicarb-isopropyl.html",
          "code_system": "ALANWOOD",
          "references": [
            "f8623efe-0b0a-3d69-3e40-6d4bd36ee7a2"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e4ef900f-617d-425c-a921-c2d6455b3a3d",
          "name": "1-METHYLETHYL ((1S)-1-((((1R)-1-(6-FLUORO-2-BENZOTHIAZOLYL)ETHYL)AMINO)CARBONYL)-2-METHYLPROPYL)CARBAMATE",
          "stdName": "1-METHYLETHYL ((1S)-1-((((1R)-1-(6-FLUORO-2-BENZOTHIAZOLYL)ETHYL)AMINO)CARBONYL)-2-METHYLPROPYL)CARBAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c09db5c-a27d-497f-a1c7-2daa93bc3598",
            "70911577-64c7-45fd-b51b-9b6f65c1a266"
          ],
          "display_name": false
        },
        {
          "uuid": "1f312960-8076-4c78-845e-a2d1d489c381",
          "name": "BENTHIAVALICARB ISOPROPYL",
          "stdName": "BENTHIAVALICARB ISOPROPYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c09db5c-a27d-497f-a1c7-2daa93bc3598",
            "e5ef1e77-8723-44e9-bc05-b866bedaacac",
            "8c6eca3f-837d-4711-b6f6-e0ddcc3b8126",
            "70911577-64c7-45fd-b51b-9b6f65c1a266"
          ],
          "display_name": false
        },
        {
          "uuid": "7e5f7a96-dc12-4854-9785-d75b8f97addb",
          "name": "BENTHIAVALICARB ISOPROPYL [HSDB]",
          "stdName": "BENTHIAVALICARB ISOPROPYL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5ef1e77-8723-44e9-bc05-b866bedaacac",
            "70911577-64c7-45fd-b51b-9b6f65c1a266"
          ],
          "display_name": false
        },
        {
          "uuid": "719166d7-b200-4d6f-81ac-32f1da46684c",
          "name": "BENTHIAVALICARB-ISOPROPYL",
          "stdName": "BENTHIAVALICARB-ISOPROPYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5ef1e77-8723-44e9-bc05-b866bedaacac",
            "70911577-64c7-45fd-b51b-9b6f65c1a266",
            "e307a220-34c4-4962-bcf1-452ef43cff64",
            "8d660386-c0c3-420f-8ef2-32bbc09e35f2",
            "638049e6-4f23-4a8a-beb6-4d36d5e7043e",
            "ac526d74-f157-40c6-9c47-3ce074b7b025"
          ],
          "display_name": true
        },
        {
          "uuid": "550e5bbc-d931-4cdc-8526-bc95b492a194",
          "name": "BENTHIAVALICARB-ISOPROPYL [ISO]",
          "stdName": "BENTHIAVALICARB-ISOPROPYL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5ef1e77-8723-44e9-bc05-b866bedaacac",
            "70911577-64c7-45fd-b51b-9b6f65c1a266"
          ],
          "display_name": false
        },
        {
          "uuid": "4a526393-842d-4b32-b30e-89769bc67c04",
          "name": "BENTHIAVALICARB-ISOPROPYL [MI]",
          "stdName": "BENTHIAVALICARB-ISOPROPYL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70911577-64c7-45fd-b51b-9b6f65c1a266",
            "638049e6-4f23-4a8a-beb6-4d36d5e7043e"
          ],
          "display_name": false
        },
        {
          "uuid": "a3ae5fbb-d6ce-4609-81f3-d219d10fe942",
          "name": "CARBAMIC ACID, ((1S)-1-((((1R)-1-(6-FLUORO-2-BENZOTHIAZOLYL)ETHYL)AMINO)CARBONYL)-2-METHYLPROPYL)-, 1-METHYLETHYL ESTER",
          "stdName": "CARBAMIC ACID, ((1S)-1-((((1R)-1-(6-FLUORO-2-BENZOTHIAZOLYL)ETHYL)AMINO)CARBONYL)-2-METHYLPROPYL)-, 1-METHYLETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c09db5c-a27d-497f-a1c7-2daa93bc3598",
            "70911577-64c7-45fd-b51b-9b6f65c1a266"
          ],
          "display_name": false
        },
        {
          "uuid": "63a52448-d6e4-40d0-bd4d-5211dd54a019",
          "name": "CARBAMIC ACID, (1-(((1-(6-FLUORO-2-BENZOTHIAZOLYL)ETHYL)AMINO)CARBONYL)-2-METHYLPROPYL)-, 1-METHYLETHYL ESTER, (S-(R*,S*))-",
          "stdName": "CARBAMIC ACID, (1-(((1-(6-FLUORO-2-BENZOTHIAZOLYL)ETHYL)AMINO)CARBONYL)-2-METHYLPROPYL)-, 1-METHYLETHYL ESTER, (S-(R*,S*))-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c09db5c-a27d-497f-a1c7-2daa93bc3598",
            "70911577-64c7-45fd-b51b-9b6f65c1a266"
          ],
          "display_name": false
        },
        {
          "uuid": "8db566a1-483a-48c3-b14c-b4b6539f47a2",
          "name": "CARBAMIC ACID, N-((1S)-1-((((1R)-1-(6-FLUORO-2-BENZOTHIAZOLYL)ETHYL)AMINO)CARBONYL)-2-METHYLPROPYL)-, 1-METHYLETHYL ESTER",
          "stdName": "CARBAMIC ACID, N-((1S)-1-((((1R)-1-(6-FLUORO-2-BENZOTHIAZOLYL)ETHYL)AMINO)CARBONYL)-2-METHYLPROPYL)-, 1-METHYLETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c09db5c-a27d-497f-a1c7-2daa93bc3598",
            "70911577-64c7-45fd-b51b-9b6f65c1a266"
          ],
          "display_name": false
        },
        {
          "uuid": "c0a9f0c9-6df6-4c96-9b37-23b7e2bedfc9",
          "name": "ISOPROPYL ((S)-1-(((1R)-1-(6-FLUORO-1,3-BENZOTHIAZOL-2- YL)ETHYL)CARBAMOYL)-2-METHYLPROPYL)CARBAMATE",
          "stdName": "ISOPROPYL ((S)-1-(((1R)-1-(6-FLUORO-1,3-BENZOTHIAZOL-2- YL)ETHYL)CARBAMOYL)-2-METHYLPROPYL)CARBAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5ef1e77-8723-44e9-bc05-b866bedaacac",
            "70911577-64c7-45fd-b51b-9b6f65c1a266"
          ],
          "display_name": false
        },
        {
          "uuid": "70d8093f-40a8-445d-a0ca-842df6df8e8e",
          "name": "KIF-230",
          "stdName": "KIF-230",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5ef1e77-8723-44e9-bc05-b866bedaacac",
            "70911577-64c7-45fd-b51b-9b6f65c1a266"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2c09db5c-a27d-497f-a1c7-2daa93bc3598",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "70911577-64c7-45fd-b51b-9b6f65c1a266",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5ef1e77-8723-44e9-bc05-b866bedaacac",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e307a220-34c4-4962-bcf1-452ef43cff64",
          "citation": "http://www.alanwood.net",
          "url": "http://www.alanwood.net",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "638049e6-4f23-4a8a-beb6-4d36d5e7043e",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec46e3c2-c668-4076-9e77-9b320ed64a38",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392494000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e6bd161-f645-4318-aa44-8c3e133f7934",
          "citation": "SRS import [AJ55PMS5IT]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=AJ55PMS5IT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392494000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8d660386-c0c3-420f-8ef2-32bbc09e35f2",
          "citation": "BENTHIAVALICARB-ISOPROPYL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8c6eca3f-837d-4711-b6f6-e0ddcc3b8126",
          "citation": "BENTHIAVALICARB ISOPROPYL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ac526d74-f157-40c6-9c47-3ce074b7b025",
          "citation": "BENTHIAVALICARB-ISOPROPYL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "53429339-f234-23ee-8699-78d5bf5a860c",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+177406-68-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ec168610-d8ee-d482-4ddb-ec02d3734f26",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=177406-68-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f8623efe-0b0a-3d69-3e40-6d4bd36ee7a2",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "edb0ab71-2580-4961-62dc-0e3e34e025db",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ca780596-31ea-4b32-8119-de2c663e03f3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "fc977fd9-4409-8abd-b434-0041f28c1a50",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3af64a9b-1b02-44a3-a3c9-87c0f472ff98",
          "id": "3af64a9b-1b02-44a3-a3c9-87c0f472ff98",
          "molfile": "\n  Marvin  01132103082D          \n\n 26 27  0  0  1  0            999 V2000\n    5.9943   -2.2754    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.4068   -2.9899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4068   -1.5609    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2318   -1.5609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6443   -0.8464    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6443   -2.2754    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.2318   -2.9899    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6443   -3.7043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2318   -4.4188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4693   -3.7043    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8819   -4.4188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4693   -5.1332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7069   -4.4188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4693   -2.2754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8818   -2.9898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8818   -1.5609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1693   -2.2754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6844   -1.6080    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8997   -1.8629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1853   -1.4504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4708   -1.8629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4708   -2.6879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7563   -3.1004    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1853   -3.1004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8997   -2.6879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6844   -2.9428    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 17  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6 14  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 26  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 25  2  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 24 22  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\nM  END",
          "smiles": "CC(C)[C@@H](C(=O)N[C@H](C)c1nc2ccc(cc2s1)F)NC(=O)OC(C)C",
          "formula": "C18H24FN3O3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "44203687-e300-4556-80c9-8db236ac2537"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "381.4666",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0cffcec9-fe85-446f-a804-1339fa61d6bd",
      "version": "8",
      "structure": {
        "id": "f6e0539c-579b-477c-b544-8986d2f6023f",
        "molfile": "\n  Marvin  01132112482D          \n\n 26 27  0  0  1  0            999 V2000\n    5.9943   -2.2754    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.6443   -2.2754    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4068   -1.5609    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2318   -1.5609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2318   -2.9899    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6443   -3.7043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2318   -4.4188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4693   -3.7043    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8819   -4.4188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4693   -5.1332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7069   -4.4188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4693   -2.2754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8818   -2.9898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8818   -1.5609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6443   -0.8464    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4068   -2.9899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1693   -2.2754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6844   -1.6080    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8997   -1.8629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8997   -2.6879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1853   -3.1004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4708   -2.6879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4708   -1.8629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1853   -1.4504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7563   -3.1004    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6844   -2.9428    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  1  3  1  6  0  0  0\n  4  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  2  5  1  6  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  2 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n  4 15  2  0  0  0  0\n  1 16  1  0  0  0  0\n  1 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  2  0  0  0  0\n 19 24  2  0  0  0  0\n 24 23  1  0  0  0  0\n 22 25  1  0  0  0  0\n 26 20  1  0  0  0  0\n 17 26  1  0  0  0  0\nM  END",
        "smiles": "CC(C)[C@@H](C(=O)N[C@H](C)c1nc2ccc(cc2s1)F)NC(=O)OC(C)C",
        "formula": "C18H24FN3O3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "381.4666",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "2c09db5c-a27d-497f-a1c7-2daa93bc3598",
          "9e6bd161-f645-4318-aa44-8c3e133f7934"
        ],
        "stereo_centers": 2
      },
      "unii": "AJ55PMS5IT"
    }
  ]
}