{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5e862a5a-29ed-4ecc-82ec-245301cc1613",
          "code": "65983-31-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=65983-31-5",
          "code_system": "CAS",
          "references": [
            "d2640746-b6e9-4b2d-8212-d80d8399eb39",
            "4284a6aa-ef95-44a8-810e-103feff78720"
          ]
        },
        {
          "uuid": "794aab16-ce71-4dcc-9b2d-e19e97ab5183",
          "code": "265-991-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.059.974",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d2640746-b6e9-4b2d-8212-d80d8399eb39"
          ]
        },
        {
          "uuid": "de7d7d52-819d-48c2-a4cb-689a8cd0eb38",
          "code": "93359",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/93359",
          "code_system": "PUBCHEM",
          "references": [
            "d2640746-b6e9-4b2d-8212-d80d8399eb39"
          ]
        },
        {
          "uuid": "0bde714b-b677-3f5c-4afe-054ca8bc56d7",
          "code": "DTXSID7044970",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7044970",
          "code_system": "EPA CompTox",
          "references": [
            "b21f974a-38f1-0ff5-b54d-96be09b3f439"
          ]
        },
        {
          "uuid": "64358b3f-2dc6-42f2-b014-42ca533a468b",
          "code": "AJ47YDC6TQ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c0880387-54f8-483f-b86d-a1e49f420a04",
          "name": "2-((3A,4,5,6,7,7A-HEXAHYDRO-4,7-METHANO-1H-INDEN-6-YL)OXY)ETHYL ACRYLATE",
          "stdName": "2-((3A,4,5,6,7,7A-HEXAHYDRO-4,7-METHANO-1H-INDEN-6-YL)OXY)ETHYL ACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b465a858-f1b2-4630-9d0d-8d46db17dbaa"
          ],
          "display_name": false
        },
        {
          "uuid": "c843d5ed-adb2-479e-9b9a-1913bbffeb32",
          "name": "2-(DICYCLOPENTEN-6-YLOXY)ETHYL ACRYLATE",
          "stdName": "2-(DICYCLOPENTEN-6-YLOXY)ETHYL ACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b3860ea-a6ef-488d-9419-31ea53d71c3d"
          ],
          "display_name": false
        },
        {
          "uuid": "9b220af6-aa8a-4aba-9504-0d6ea8b39ef5",
          "name": "2-PROPENOIC ACID, 2-((3A,4,5,6,7,7A-HEXAHYDRO-4,7-METHANO-1H-INDEN-6-YL)OXY)ETHYL ESTER",
          "stdName": "2-PROPENOIC ACID, 2-((3A,4,5,6,7,7A-HEXAHYDRO-4,7-METHANO-1H-INDEN-6-YL)OXY)ETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aab20600-203f-4e08-83c5-f947372590dd"
          ],
          "display_name": false
        },
        {
          "uuid": "dcd430d3-d5d7-48ed-a5bf-5db3a681f0cc",
          "name": "ACRYLIC ACID 2-(TRICYCLE(5.2.1.0(SUP 2,6))DEC-3-EN-8-YLOXY)ETHYL ESTER",
          "stdName": "ACRYLIC ACID 2-(TRICYCLE(5.2.1.0(SUP 2,6))DEC-3-EN-8-YLOXY)ETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f682a5ba-e233-4386-8701-b18545464a95"
          ],
          "display_name": false
        },
        {
          "uuid": "1c950e0b-51b3-4082-a890-a8b2d8663fed",
          "name": "DICYCLOPENTENYLOXYETHYL ACRYLATE",
          "stdName": "DICYCLOPENTENYLOXYETHYL ACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc6d83f8-41df-4db2-a64d-9e0a7c3bae34",
            "4284a6aa-ef95-44a8-810e-103feff78720"
          ],
          "display_name": true
        },
        {
          "uuid": "6485db6f-0061-4117-9fe6-96100d1fe45d",
          "name": "J211.873D",
          "stdName": "J211.873D",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f682a5ba-e233-4386-8701-b18545464a95"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "bc6d83f8-41df-4db2-a64d-9e0a7c3bae34",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "aab20600-203f-4e08-83c5-f947372590dd",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f682a5ba-e233-4386-8701-b18545464a95",
          "citation": "http://jglobal.jst.go.jp/en/detail?JGLOBAL_ID=200907092757027315&q=J211.873D&t=7",
          "url": "http://jglobal.jst.go.jp/en/detail?JGLOBAL_ID=200907092757027315&q=J211.873D&t=7",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b3860ea-a6ef-488d-9419-31ea53d71c3d",
          "citation": "http://chem.sis.nlm.nih.gov/chemidplus/rn/65983-31-5",
          "url": "http://chem.sis.nlm.nih.gov/chemidplus/rn/65983-31-5",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b465a858-f1b2-4630-9d0d-8d46db17dbaa",
          "citation": "http://echa.europa.eu/substance-information/-/substanceinfo/100.059.974",
          "url": "http://echa.europa.eu/substance-information/-/substanceinfo/100.059.974",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d2640746-b6e9-4b2d-8212-d80d8399eb39",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391585000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b21f974a-38f1-0ff5-b54d-96be09b3f439",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=65983-31-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4284a6aa-ef95-44a8-810e-103feff78720",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8f7a2f1e-8d50-49a7-aabf-b19d489d6182",
          "id": "8f7a2f1e-8d50-49a7-aabf-b19d489d6182",
          "molfile": "\n  Marvin  01132107262D          \n\n 18 20  0  0  0  0            999 V2000\n    0.0000   -1.6161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7157   -1.2082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4237   -1.6238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4160   -2.4472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1393   -1.2159    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8474   -1.6315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5630   -1.2236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2788   -1.6469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9944   -1.2390    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.9944   -0.4078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7102    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.2561   -0.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7024   -1.6623    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.4258   -1.2390    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.2031   -1.4929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6956   -0.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2108   -0.1539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4258   -0.4078    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 13  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 18 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 18  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\nM  END",
          "smiles": "C=CC(=O)OCCOC1CC2CC1C3CC=CC23",
          "formula": "C15H20O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e714858a-5ee4-483b-9dab-8f960ee092cf"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "248.3181",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7370a723-4bdf-41bc-94d1-c4da66d0010d",
      "version": "6",
      "structure": {
        "id": "1b2f6888-bab2-49c7-9902-201d9847229b",
        "molfile": "\n  Marvin  01132101352D          \n\n 18 20  0  0  0  0            999 V2000\n    4.2788   -1.6469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5630   -1.2236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8474   -1.6315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1393   -1.2159    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4237   -1.6238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7157   -1.2082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4160   -2.4472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.6161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7024   -1.6623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4258   -1.2390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9944   -1.2390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2561   -0.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4258   -0.4078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2031   -1.4929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9944   -0.4078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7102    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2108   -0.1539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6956   -0.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 11  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  6  8  2  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n 10 14  1  0  0  0  0\n 11 15  1  0  0  0  0\n 12 16  1  0  0  0  0\n 13 16  1  0  0  0  0\n 13 17  1  0  0  0  0\n 14 18  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  2  0  0  0  0\nM  END",
        "smiles": "C=CC(=O)OCCOC1CC2CC1C3CC=CC23",
        "formula": "C15H20O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "248.3181",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "bc6d83f8-41df-4db2-a64d-9e0a7c3bae34",
          "4284a6aa-ef95-44a8-810e-103feff78720"
        ],
        "stereo_centers": 5
      },
      "unii": "AJ47YDC6TQ"
    }
  ]
}