{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "66bcde5c-3d23-4131-9f8d-3c3fa6b98f78",
          "code": "96682-10-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=96682-10-9",
          "code_system": "CAS",
          "references": [
            "22ee8984-0f3b-4fd5-9820-6b79584d7506",
            "07b816d8-1810-4169-8932-f397a1b30065"
          ]
        },
        {
          "uuid": "4dc7b586-4351-43a9-87f3-b666d187087f",
          "code": "734597",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/734597",
          "code_system": "PUBCHEM",
          "references": [
            "22ee8984-0f3b-4fd5-9820-6b79584d7506"
          ]
        },
        {
          "uuid": "1c12ed64-bad5-0b07-f1df-720dae2e14da",
          "code": "DTXSID0072982",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0072982",
          "code_system": "EPA CompTox",
          "references": [
            "427d4ac1-de06-cc87-2302-13cbd0a61f30"
          ]
        },
        {
          "uuid": "0ed145e9-6cac-4bdd-9d17-262863829c38",
          "code": "AIK54GD6I2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e078a48f-8d11-444f-9e29-2959d2d82e60",
          "name": "BENZOIC ACID, 4-(BENZOYLOXY)-, PHENYLMETHYL ESTER",
          "stdName": "BENZOIC ACID, 4-(BENZOYLOXY)-, PHENYLMETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "971d1b7f-dbb1-41f0-a492-861f86241773",
            "5a159394-a24a-42dc-b2b7-272a32ae4b4e"
          ],
          "display_name": false
        },
        {
          "uuid": "0e0b722f-8002-452d-aed6-32e85946621a",
          "name": "BENZYL 4-(BENZOYLOXY)BENZOATE",
          "stdName": "BENZYL 4-(BENZOYLOXY)BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "971d1b7f-dbb1-41f0-a492-861f86241773",
            "5a159394-a24a-42dc-b2b7-272a32ae4b4e"
          ],
          "display_name": false
        },
        {
          "uuid": "a467bd96-b0a5-4a6a-9d7a-3dbe548977d1",
          "name": "BENZYL BENZOYLOXYBENZOATE",
          "stdName": "BENZYL BENZOYLOXYBENZOATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3fbe7f13-6a5a-4878-b570-42ee79b8f097",
            "971d1b7f-dbb1-41f0-a492-861f86241773",
            "c51c74a2-49aa-41f5-a78b-9f76a6546eba"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "6aa08f6b-44ca-4b4f-b798-fb2fd67a3a46",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "cac09d2f-f8c5-435b-9a2a-d5510800691a",
          "name": "FIXATEUR BBB",
          "stdName": "FIXATEUR BBB",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3fbe7f13-6a5a-4878-b570-42ee79b8f097",
            "971d1b7f-dbb1-41f0-a492-861f86241773"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3fbe7f13-6a5a-4878-b570-42ee79b8f097",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "971d1b7f-dbb1-41f0-a492-861f86241773",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a159394-a24a-42dc-b2b7-272a32ae4b4e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22ee8984-0f3b-4fd5-9820-6b79584d7506",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391415000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ddbf5ba-9772-402c-b90d-30bf31f3209f",
          "citation": "SRS import [AIK54GD6I2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=AIK54GD6I2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391415000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c51c74a2-49aa-41f5-a78b-9f76a6546eba",
          "citation": "BENZYL BENZOYLOXYBENZOATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "427d4ac1-de06-cc87-2302-13cbd0a61f30",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=96682-10-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "07b816d8-1810-4169-8932-f397a1b30065",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "69055bee-818f-4e7a-8ae1-0e20b241fc9f",
          "id": "69055bee-818f-4e7a-8ae1-0e20b241fc9f",
          "molfile": "\n  Marvin  01132105282D          \n\n 25 27  0  0  0  0            999 V2000\n   10.7432   -6.6706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7434   -5.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4581   -5.4334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1724   -5.8461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8870   -5.4339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8873   -4.6089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6019   -4.1966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3162   -4.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3159   -5.4343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6013   -5.8466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0291   -5.4329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0294   -4.6079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3151   -4.1951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6004   -4.6074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8861   -4.1946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1715   -4.6069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1712   -5.4319    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4572   -4.1942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7426   -4.6064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0282   -4.1937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0285   -3.3687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7431   -2.9564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4574   -3.3692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6002   -5.4324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3145   -5.8451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  2  3  1  0  0  0  0\n 11  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 25 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 24  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 18 23  2  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)COC(=O)c2ccc(cc2)OC(=O)c3ccccc3",
          "formula": "C21H16O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f0f90e48-3894-4db3-b9b4-5e2feed41761"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "332.3501",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c793a2ef-858f-4a83-a3e3-8c39713151c0",
      "version": "4",
      "structure": {
        "id": "535360d0-9afb-45c5-8155-c4b747884241",
        "molfile": "\n  Marvin  01132104202D          \n\n 25 27  0  0  0  0            999 V2000\n    8.6004   -4.6074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3151   -4.1951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0294   -4.6079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0291   -5.4329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3145   -5.8451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6002   -5.4324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8861   -4.1946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1715   -4.6069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7434   -5.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4581   -5.4334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1724   -5.8461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4572   -4.1942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8870   -5.4339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7426   -4.6064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0282   -4.1937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0285   -3.3687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7431   -2.9564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4574   -3.3692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8873   -4.6089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6019   -4.1966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3162   -4.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3159   -5.4343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6013   -5.8466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1712   -5.4319    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7432   -6.6706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  1  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  4  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n  8 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 14 12  2  0  0  0  0\n 12 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 19 13  2  0  0  0  0\n 13 23  1  0  0  0  0\n  8 24  2  0  0  0  0\n  9 25  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)COC(=O)c2ccc(cc2)OC(=O)c3ccccc3",
        "formula": "C21H16O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "332.3501",
        "optical_activity": "NONE",
        "references": [
          "7ddbf5ba-9772-402c-b90d-30bf31f3209f",
          "5a159394-a24a-42dc-b2b7-272a32ae4b4e"
        ],
        "stereo_centers": 0
      },
      "unii": "AIK54GD6I2"
    }
  ]
}