{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "10375066-b451-4a52-b454-5e1c84be0d9e", "code": "7614-21-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=7614-21-3", "code_system": "CAS", "references": [ "6fe8f8bf-781b-42d3-9d98-e1eab8b24b4d", "0ca27f3d-b14c-4744-a627-b2fedbdb33af" ] }, { "uuid": "73108c86-b072-4576-85e1-8ab33f1ce6b5", "code": "GERANYLGERANIOL", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Geranylgeraniol", "code_system": "WIKIPEDIA", "references": [ "6fe8f8bf-781b-42d3-9d98-e1eab8b24b4d" ] }, { "uuid": "a2f7f267-b35e-46d9-9ce5-bd53e34aba90", "code": "5281365", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5281365", "code_system": "PUBCHEM", "references": [ "6fe8f8bf-781b-42d3-9d98-e1eab8b24b4d" ] }, { "uuid": "b63adcbf-60fb-4113-906a-8dba522b3a53", "code": "AIA02AJA3A", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "f2a97b2d-5740-022f-2f82-c6336ffbb1c2", "code": "46762", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:46762", "code_system": "CHEBI", "references": [ "0377875d-d507-fa01-7111-0b9c26891fd2" ] }, { "uuid": "cb9db92e-8395-6156-b6ec-e629393d56c9", "code": "DTXSID301029793", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID301029793", "code_system": "EPA CompTox", "references": [ "0377875d-d507-fa01-7111-0b9c26891fd2" ] } ], "substance_class": "chemical", "names": [ { "uuid": "8b039060-cc3c-4c11-ac60-15b5514a2a9b", "name": "(2E,6E,10E)-3,7,11,15-TETRAMETHYLHEXADECA-2,6,10,14-TETRAEN-1-OL", "stdName": "(2E,6E,10E)-3,7,11,15-TETRAMETHYLHEXADECA-2,6,10,14-TETRAEN-1-OL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d848d23e-6be0-4c23-b74e-f9bf21edc4ee" ], "display_name": false }, { "uuid": "c33bca70-df4f-466f-9c38-e11540d20909", "name": "GERANYLGERANIOL", "stdName": "GERANYLGERANIOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "63f608c2-abb3-4f62-b252-08c545151f56" ], "display_name": true }, { "uuid": "97dfbfca-c63b-4e39-bc8e-8f0b18578d3f", "name": "TETRAPRENOL", "stdName": "TETRAPRENOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d848d23e-6be0-4c23-b74e-f9bf21edc4ee" ], "display_name": false } ], "references": [ { "uuid": "63f608c2-abb3-4f62-b252-08c545151f56", "citation": "ICSAS BATCH 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "d848d23e-6be0-4c23-b74e-f9bf21edc4ee", "citation": "http://en.wikipedia.org/wiki/Geranylgeraniol", "url": "http://en.wikipedia.org/wiki/Geranylgeraniol", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6fe8f8bf-781b-42d3-9d98-e1eab8b24b4d", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390948000, "tags": [ "NOMEN" ] }, { "uuid": "c8abbe9c-3763-4c38-9a1f-068a53f4cd37", "citation": "SRS import [AIA02AJA3A]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=AIA02AJA3A", "doc_type": "SRS", "public_domain": true, "document_date": 1493390948000, "tags": [ "NOMEN" ] }, { "uuid": "59a699bd-6e91-4043-aa7f-ce5fefe439b0", "citation": "CHEMID 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "44332ac4-4717-3b11-8b33-da3b8c8ad8ef", "citation": "PCPC", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true }, { "uuid": "0ca27f3d-b14c-4744-a627-b2fedbdb33af", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "0377875d-d507-fa01-7111-0b9c26891fd2", "doc_type": "SYSTEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "6eaa18ea-364c-4245-a385-ba17b8166689", "id": "6eaa18ea-364c-4245-a385-ba17b8166689", "molfile": "\n Marvin 01132105452D \n\n 21 20 0 0 0 0 999 V2000\n 11.3704 -3.6982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9577 -4.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3704 -5.1271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1325 -4.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7198 -5.1271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8944 -5.1271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4817 -5.8415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8944 -6.5559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6563 -5.8415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2438 -6.5559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4184 -6.5559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0057 -5.8415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4184 -5.1271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1803 -5.8415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7676 -5.1271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1803 -4.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7676 -3.6982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1803 -2.9838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9424 -3.6982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5297 -2.9838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7043 -2.9838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 7 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 12 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 19 17 2 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 0 0 0 0\nM END", "smiles": "CC(=CCC/C(=C/CC/C(=C/CC/C(=C/CO)/C)/C)/C)C", "formula": "C20H34O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "5655b341-a01d-49bf-900f-6a3a18560c52" }, "defined_stereo": 0, "ez_centers": 3, "molecular_weight": "290.4841", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "a9ebc8f4-8dc7-40f4-9384-8440d3b9dc84", "version": "5", "structure": { "id": "3b633fee-fab4-40af-9bfe-b71d264a61be", "molfile": "\n Marvin 01132103092D \n\n 21 20 0 0 0 0 999 V2000\n 3.5297 -2.9838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9424 -3.6982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7676 -3.6982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1803 -4.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7676 -5.1271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1803 -5.8415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0057 -5.8415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4184 -6.5559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2438 -6.5559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6563 -5.8415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4817 -5.8415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8944 -5.1271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7198 -5.1271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1325 -4.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9577 -4.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3704 -3.6982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3704 -5.1271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8944 -6.5559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4184 -5.1271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1803 -2.9838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7043 -2.9838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 11 18 1 0 0 0 0\n 7 19 1 0 0 0 0\n 3 20 1 0 0 0 0\n 1 21 1 0 0 0 0\nM END", "smiles": "CC(=CCC/C(=C/CC/C(=C/CC/C(=C/CO)/C)/C)/C)C", "formula": "C20H34O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 3, "molecular_weight": "290.4841", "optical_activity": "NONE", "references": [ "59a699bd-6e91-4043-aa7f-ce5fefe439b0", "c8abbe9c-3763-4c38-9a1f-068a53f4cd37" ], "stereo_centers": 0 }, "unii": "AIA02AJA3A" } ] }