{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d625e40c-44c0-4692-9841-ea13f46ace86", "code": "5045-40-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=5045-40-9", "code_system": "CAS", "references": [ "4b07484f-613a-4ca5-a586-934f509b8915", "939057b1-791e-4a53-a3b2-9dcd032fc903" ] }, { "uuid": "d750b506-6b03-466c-b930-22e530fdf716", "code": "225-744-5", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.023.404", "code_system": "ECHA (EC/EINECS)", "references": [ "4b07484f-613a-4ca5-a586-934f509b8915" ] }, { "uuid": "8a10f6ab-84d9-990b-04b5-2531c7039c24", "code": "DTXSID9052137", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9052137", "code_system": "EPA CompTox", "references": [ "b6191758-73ff-01b1-9ffb-26f3a347ca16" ] }, { "uuid": "8b782eaa-38d0-3e38-73db-80df2063d883", "code": "135481898", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135481898", "code_system": "PUBCHEM", "references": [ "b928c7bc-5e95-45e2-8184-ca9c7848a7de" ] }, { "uuid": "e2de4655-ba22-f70a-6e1e-a91ceab84d46", "code": "1999676", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1999676/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "d2fd7e26-ac6c-7e1c-2491-286d15edc156" ] }, { "uuid": "85f3d33d-76b3-41e1-aa09-afb81271a484", "code": "AFB0QQM2VZ", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "c566e525-1479-e85d-8635-2d90a8a5185b", "code": "AFB0QQM2VZ", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=AFB0QQM2VZ", "code_system": "DAILYMED", "references": [ "d3cfeeda-7e37-4c6e-a718-8d40c0ea39be" ] } ], "substance_class": "chemical", "names": [ { "uuid": "2a92d905-e832-4521-9520-2b2e7f6f4ac2", "name": "1H-ISOINDOL-1-ONE, 3,3'-((2-METHYL-1,3-PHENYLENE)DIIMINO)BIS(4,5,6,7-TETRACHLORO-", "stdName": "1H-ISOINDOL-1-ONE, 3,3'-((2-METHYL-1,3-PHENYLENE)DIIMINO)BIS(4,5,6,7-TETRACHLORO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "96075f44-85ea-4129-bc77-17dbac366a52", "b4c509c3-2f1c-45dc-b0de-4c5ff169740a" ], "display_name": false }, { "uuid": "5dc8ac6f-d17e-4070-9160-35a32527147e", "name": "C.I. 56284", "stdName": "C.I. 56284", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "96075f44-85ea-4129-bc77-17dbac366a52", "b4c509c3-2f1c-45dc-b0de-4c5ff169740a" ], "display_name": false }, { "uuid": "1d084f88-a6c7-4e54-a867-45a7c9fb345b", "name": "C.I. PIGMENT YELLOW 109", "stdName": "C.I. PIGMENT YELLOW 109", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "efb0aaef-71fb-496b-8060-073285d4f682" ], "display_name": false }, { "uuid": "0c3202cf-0af6-4773-a709-86b0f58da200", "name": "CI 56284", "stdName": "CI 56284", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6a6b7c39-6629-4115-a914-c1ef99d107fe", "96075f44-85ea-4129-bc77-17dbac366a52" ], "display_name": false }, { "uuid": "87bce3dd-b2fe-4806-924c-dea3b1977e43", "name": "ISOINDOLINONE YELLOW", "stdName": "ISOINDOLINONE YELLOW", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "96075f44-85ea-4129-bc77-17dbac366a52", "b4c509c3-2f1c-45dc-b0de-4c5ff169740a" ], "display_name": false }, { "uuid": "7836526a-95a5-4162-ae4c-313a648deeb0", "name": "PIGMENT YELLOW 109", "stdName": "PIGMENT YELLOW 109", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6a6b7c39-6629-4115-a914-c1ef99d107fe", "96075f44-85ea-4129-bc77-17dbac366a52" ], "display_name": true } ], "references": [ { "uuid": "efb0aaef-71fb-496b-8060-073285d4f682", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "6a6b7c39-6629-4115-a914-c1ef99d107fe", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "96075f44-85ea-4129-bc77-17dbac366a52", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b4c509c3-2f1c-45dc-b0de-4c5ff169740a", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4b07484f-613a-4ca5-a586-934f509b8915", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391007000, "tags": [ "NOMEN" ] }, { "uuid": "40f43077-0a26-4724-9066-d08cddac0163", "citation": "SRS import [AFB0QQM2VZ]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=AFB0QQM2VZ", "doc_type": "SRS", "public_domain": true, "document_date": 1493391007000, "tags": [ "NOMEN" ] }, { "uuid": "026fde41-4dde-4d72-9e92-5564b05ed1a9", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b6191758-73ff-01b1-9ffb-26f3a347ca16", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5045-40-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "b928c7bc-5e95-45e2-8184-ca9c7848a7de", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "d2fd7e26-ac6c-7e1c-2491-286d15edc156", "citation": "RXNORM", "doc_type": "NLM", "public_domain": true }, { "uuid": "939057b1-791e-4a53-a3b2-9dcd032fc903", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "d3cfeeda-7e37-4c6e-a718-8d40c0ea39be", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "32aa5b84-54fa-48ab-a6a8-793aef80c268", "id": "32aa5b84-54fa-48ab-a6a8-793aef80c268", "molfile": "\n Marvin 01132102432D \n\n 37 41 0 0 0 0 999 V2000\n 7.4502 -5.6185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4502 -4.7887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1694 -4.3752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8830 -4.7864 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8830 -5.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8830 -6.4379 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5976 -6.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5976 -7.6825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3112 -6.4382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3112 -5.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0206 -5.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0206 -4.3820 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7301 -5.6201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4427 -5.2029 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7301 -6.4441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4410 -6.8585 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0152 -6.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0152 -7.6756 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1694 -3.5439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4482 -3.1354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7329 -3.5481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7329 -4.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0196 -4.7876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0196 -5.6173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0196 -6.4423 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3061 -6.8572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3061 -7.6821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5887 -6.4374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5887 -5.6173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8846 -5.1989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8846 -4.3739 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1693 -5.6103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4535 -5.1956 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1693 -6.4348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4563 -6.8469 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8787 -6.8434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8787 -7.6684 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 22 2 2 0 0 0 0\n 3 4 1 0 0 0 0\n 3 19 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 10 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 1 0 0 0 0\n 10 9 1 0 0 0 0\n 9 17 2 0 0 0 0\n 11 10 2 0 0 0 0\n 11 12 1 0 0 0 0\n 13 11 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 13 2 0 0 0 0\n 15 16 1 0 0 0 0\n 17 15 1 0 0 0 0\n 17 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 25 24 2 0 0 0 0\n 24 29 1 0 0 0 0\n 26 25 1 0 0 0 0\n 26 27 2 0 0 0 0\n 28 26 1 0 0 0 0\n 28 29 1 0 0 0 0\n 36 28 2 0 0 0 0\n 29 30 2 0 0 0 0\n 30 31 1 0 0 0 0\n 30 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 32 34 2 0 0 0 0\n 34 35 1 0 0 0 0\n 34 36 1 0 0 0 0\n 36 37 1 0 0 0 0\nM END", "smiles": "Cc1c(cccc1NC2=NC(=O)c3c2c(c(c(c3Cl)Cl)Cl)Cl)NC4=NC(=O)c5c4c(c(c(c5Cl)Cl)Cl)Cl", "formula": "C23H8Cl8N4O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "3ad4a893-0985-446d-b2b2-ad294ba38d3e" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "655.9596", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "43e5053f-3b22-4adc-956c-5a5fe51cc2fc", "version": "10", "structure": { "id": "f12459b7-56b3-450d-af22-c4b581ed22b9", "molfile": "\n Marvin 01132112312D \n\n 37 41 0 0 0 0 999 V2000\n 8.8830 -5.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8830 -6.4379 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5976 -6.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5976 -7.6825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3112 -6.4382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3112 -5.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0206 -5.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7301 -5.6201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7301 -6.4441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0152 -6.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0152 -7.6756 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4410 -6.8585 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4427 -5.2029 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0206 -4.3820 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8830 -4.7864 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1694 -4.3752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4502 -4.7887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7329 -4.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7329 -3.5481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4482 -3.1354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1694 -3.5439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0196 -4.7876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0196 -5.6173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0196 -6.4423 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3061 -6.8572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5887 -6.4374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5887 -5.6173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8846 -5.1989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1693 -5.6103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1693 -6.4348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8787 -6.8434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8787 -7.6684 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4563 -6.8469 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4535 -5.1956 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8846 -4.3739 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3061 -7.6821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4502 -5.6185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 3 5 1 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 5 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 9 12 1 0 0 0 0\n 8 13 1 0 0 0 0\n 7 14 1 0 0 0 0\n 6 1 1 0 0 0 0\n 15 1 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 2 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 2 0 0 0 0\n 16 21 1 0 0 0 0\n 18 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 24 23 2 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 31 26 1 0 0 0 0\n 31 32 1 0 0 0 0\n 30 33 1 0 0 0 0\n 29 34 1 0 0 0 0\n 28 35 1 0 0 0 0\n 23 27 1 0 0 0 0\n 25 36 2 0 0 0 0\n 17 37 1 0 0 0 0\nM END", "smiles": "Cc1c(cccc1NC2=NC(=O)c3c2c(c(c(c3Cl)Cl)Cl)Cl)NC4=NC(=O)c5c4c(c(c(c5Cl)Cl)Cl)Cl", "formula": "C23H8Cl8N4O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "655.9596", "optical_activity": "NONE", "references": [ "026fde41-4dde-4d72-9e92-5564b05ed1a9", "40f43077-0a26-4724-9066-d08cddac0163" ], "stereo_centers": 0 }, "unii": "AFB0QQM2VZ" } ] }