{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0b247c46-10b8-423b-b04d-627cf7919fb4",
          "code": "A14AB02",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|ANABOLIC AGENTS FOR SYSTEMIC USE|ANABOLIC STEROIDS|Estren derivatives|ethylestrenol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A14AB02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "7912ce2a-2c9b-47eb-8f96-8142bf80bc41"
          ]
        },
        {
          "uuid": "54ee4e0d-5fc4-45a8-8570-3d66a579cb54",
          "code": "QA14AB02",
          "comments": "VATC|ANABOLIC AGENTS FOR SYSTEMIC USE|ANABOLIC STEROIDS|Estren derivatives|ethylestrenol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA14AB02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "7912ce2a-2c9b-47eb-8f96-8142bf80bc41"
          ]
        },
        {
          "uuid": "4629ffe5-7628-4177-a2c8-8e64a31b6086",
          "code": "965-90-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=965-90-2",
          "code_system": "CAS",
          "references": [
            "7912ce2a-2c9b-47eb-8f96-8142bf80bc41",
            "0f8f0be1-a063-4191-8574-4d380e979553"
          ]
        },
        {
          "uuid": "b8b1f2ef-8562-4fc8-9dca-4bb315a5913f",
          "code": "C65568",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C65568",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7912ce2a-2c9b-47eb-8f96-8142bf80bc41"
          ]
        },
        {
          "uuid": "85b53bd9-896a-47e5-b12a-33b7d38fd8b7",
          "code": "D005032",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68005032",
          "code_system": "MESH",
          "references": [
            "7912ce2a-2c9b-47eb-8f96-8142bf80bc41"
          ]
        },
        {
          "uuid": "6823a613-d7e5-484e-9a90-362df9af4f95",
          "code": "ETHYLESTRENOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Ethylestrenol",
          "code_system": "WIKIPEDIA",
          "references": [
            "7912ce2a-2c9b-47eb-8f96-8142bf80bc41"
          ]
        },
        {
          "uuid": "f14c910c-acdd-4000-83a6-a725b372166b",
          "code": "SUB07291MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "7912ce2a-2c9b-47eb-8f96-8142bf80bc41"
          ]
        },
        {
          "uuid": "ff392fc1-07a3-4d24-839d-ec05a6baa24e",
          "code": "1107",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1107",
          "code_system": "INN",
          "references": [
            "7912ce2a-2c9b-47eb-8f96-8142bf80bc41"
          ]
        },
        {
          "uuid": "a78cee54-a23b-41e1-9e36-94530d1c75f0",
          "code": "4000",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "7912ce2a-2c9b-47eb-8f96-8142bf80bc41"
          ]
        },
        {
          "uuid": "93e3bf56-3bff-43fa-914f-3274f5775da7",
          "code": "6948",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=6948",
          "code_system": "IUPHAR",
          "references": [
            "7912ce2a-2c9b-47eb-8f96-8142bf80bc41"
          ]
        },
        {
          "uuid": "83710a12-6c77-40ad-b7ba-954103db731a",
          "code": "4162",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/4162/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7912ce2a-2c9b-47eb-8f96-8142bf80bc41"
          ]
        },
        {
          "uuid": "e61870e1-d044-4718-81f2-24e5bb5aec70",
          "code": "m5130",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5130?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7912ce2a-2c9b-47eb-8f96-8142bf80bc41"
          ]
        },
        {
          "uuid": "dc43123a-fb1a-4c16-b066-d2715fad70b9",
          "code": "CHEMBL1200623",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1200623",
          "code_system": "ChEMBL",
          "references": [
            "7912ce2a-2c9b-47eb-8f96-8142bf80bc41"
          ]
        },
        {
          "uuid": "aadb0632-1e73-4643-9057-e1c1cbb66b4f",
          "code": "213-523-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.294",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7912ce2a-2c9b-47eb-8f96-8142bf80bc41"
          ]
        },
        {
          "uuid": "f79a04d8-268a-4890-97ca-02886a6fa1cc",
          "code": "13765",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13765",
          "code_system": "PUBCHEM",
          "references": [
            "7912ce2a-2c9b-47eb-8f96-8142bf80bc41"
          ]
        },
        {
          "uuid": "f8dadc85-bb98-24c0-36d4-1a1da6a99b89",
          "code": "3327",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3327",
          "code_system": "HSDB",
          "references": [
            "3fe2898c-910a-d1fd-08a9-7925b3482c41"
          ]
        },
        {
          "uuid": "b0ec7131-3a61-5949-3c3c-106fc0c6e118",
          "code": "DTXSID6023024",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6023024",
          "code_system": "EPA CompTox",
          "references": [
            "c6f6f20f-3a01-3aa2-46e0-688cdd10a5c2"
          ]
        },
        {
          "uuid": "07e3db70-a162-7333-8775-89630df761ff",
          "code": "C2360",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Anabolic Steroid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2360",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8c49e948-115b-c326-8ca0-c1e3eeca417a"
          ]
        },
        {
          "uuid": "f3438f67-309d-45bd-8840-4d72a7d62ff0",
          "code": "ADC79EK5Q8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "555823f8-f24b-46bc-c537-738499edae1b",
          "code": "DB01493",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB01493",
          "code_system": "DRUG BANK",
          "references": [
            "8c49e948-115b-c326-8ca0-c1e3eeca417a"
          ]
        },
        {
          "uuid": "007c6a84-927f-deee-ba0f-cae32f393f15",
          "code": "1094",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1094",
          "code_system": "DRUG CENTRAL",
          "references": [
            "8c49e948-115b-c326-8ca0-c1e3eeca417a"
          ]
        },
        {
          "uuid": "71542cea-9097-5e54-9ef9-5d582b6b8d73",
          "code": "31578",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:31578",
          "code_system": "CHEBI",
          "references": [
            "8c49e948-115b-c326-8ca0-c1e3eeca417a"
          ]
        },
        {
          "uuid": "d0a32d7c-debc-914a-dcc4-9c4c9ddfd061",
          "code": "100000082069",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "176c0f22-0153-2f09-93d9-20568d172efb"
          ]
        },
        {
          "uuid": "a504a9e3-e144-6bc9-f556-57c8974117e1",
          "code": "37726",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=37726",
          "code_system": "NSC",
          "references": [
            "c8e12d2b-a1af-7dc4-199f-16e3ecf98915"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "b9bcac88-3bd8-47f0-a448-fc2e0e535e7e",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "9dd60403-710e-4a43-bef0-51fe0462f986",
            "refuuid": "5f3b7409-fea4-4666-83b6-632045a27a85",
            "name": "ETHYLESTRENOL",
            "unii": "ADC79EK5Q8",
            "linking_id": "ADC79EK5Q8",
            "ref_pname": "ETHYLESTRENOL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "09fd35a9-f959-411d-ac4e-cd3a3abac96a",
          "name": "19-NORPREGN-4-EN-17-OL, (17.ALPHA.)",
          "stdName": "19-NORPREGN-4-EN-17-OL, (17.ALPHA.)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a5bb9e37-72d6-433a-a972-37f1e7782f0b"
          ],
          "display_name": false
        },
        {
          "uuid": "1a6661e3-fe4a-42b6-91ac-623dbd0777dd",
          "name": "19-Nor-17α-pregn-4-en-17β-ol",
          "stdName": "19-NOR-17.ALPHA.-PREGN-4-EN-17.BETA.-OL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a5bb9e37-72d6-433a-a972-37f1e7782f0b"
          ],
          "display_name": false
        },
        {
          "uuid": "e59d28d8-4782-43c0-97a4-a6b26a957621",
          "name": "DURABOLIN-O",
          "stdName": "DURABOLIN-O",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9ae5f9e7-d870-4c6e-a02d-f0657d7d18cb"
          ],
          "display_name": false
        },
        {
          "uuid": "a8bf9174-058c-4865-8cbc-0336ba1b2e59",
          "name": "DURABORAL",
          "stdName": "DURABORAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9ae5f9e7-d870-4c6e-a02d-f0657d7d18cb"
          ],
          "display_name": false
        },
        {
          "uuid": "badb1a1b-90a9-43bb-8e46-548275c012ed",
          "name": "ETHYLESTRENOL",
          "stdName": "ETHYLESTRENOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d743d5b3-758b-4981-b4f7-73f8ad8df4e5",
            "a0518f67-f947-4d22-8f9f-a85649aff933",
            "17a0fcc4-48c7-4e16-bfea-99e4ba984c64",
            "846229eb-8dcc-4224-abb5-c930c90b168b",
            "a5bb9e37-72d6-433a-a972-37f1e7782f0b",
            "c2ad9ecd-d304-4ea2-a37b-2a597d28c8ac",
            "6feb16e9-e04b-4848-a6c7-355bd4e3ccdd",
            "cafe274b-e5cb-427c-b935-fa28784111f7",
            "5a073716-26f3-4f8b-a105-d6b15c2d1776",
            "d2f0290e-a247-4999-91cf-876a1955320b",
            "d1c53b69-797e-4477-809a-bbdfdaa0023e",
            "af82543a-a15f-4c04-88ff-312ba8ad8e1d",
            "d9ee1321-013f-499e-990d-c875688545c9",
            "c8d5966e-26b9-4504-8910-f48a23ae3ba3",
            "7c8e1eaa-7ab4-42de-9941-8204ed096a01",
            "607ca4cb-6156-4a86-8901-23c8d7cf94de",
            "e52482f0-91d9-4fc1-a8ae-b68a6359403c"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "7cc6cc9e-b4e7-476d-861c-b5fc67708ff7",
              "name_org": "INN"
            },
            {
              "uuid": "003539da-6c19-490a-a9dd-4a0d436df921",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "7dc1b484-ba6a-4eec-b7fb-494fec827d9d",
          "name": "ETHYLESTRENOL [HSDB]",
          "stdName": "ETHYLESTRENOL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "607ca4cb-6156-4a86-8901-23c8d7cf94de"
          ],
          "display_name": false
        },
        {
          "uuid": "3d3c1ca2-5d07-4c0b-9ac5-2ea03f0726f8",
          "name": "ETHYLESTRENOL [MART.]",
          "stdName": "ETHYLESTRENOL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cafe274b-e5cb-427c-b935-fa28784111f7"
          ],
          "display_name": false
        },
        {
          "uuid": "9b00c483-cf60-4d18-81db-eb495d23693e",
          "name": "ETHYLESTRENOL [MI]",
          "stdName": "ETHYLESTRENOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af82543a-a15f-4c04-88ff-312ba8ad8e1d"
          ],
          "display_name": false
        },
        {
          "uuid": "b8cd37f4-b831-4832-96de-08e7b91fd566",
          "name": "ETHYLESTRENOL [ORANGE BOOK]",
          "stdName": "ETHYLESTRENOL [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1c53b69-797e-4477-809a-bbdfdaa0023e"
          ],
          "display_name": false
        },
        {
          "uuid": "370d8b44-65b9-4978-b262-b114176189ff",
          "name": "ETHYLESTRENOL [USAN]",
          "stdName": "ETHYLESTRENOL [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9ee1321-013f-499e-990d-c875688545c9"
          ],
          "display_name": false
        },
        {
          "uuid": "6e05f689-1df2-44ff-9983-ba01bec74b82",
          "name": "ETHYLESTRENOL [VANDF]",
          "stdName": "ETHYLESTRENOL [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "846229eb-8dcc-4224-abb5-c930c90b168b"
          ],
          "display_name": false
        },
        {
          "uuid": "7c3098c0-2e8b-48ce-a35e-9295941b7666",
          "name": "ETHYLNANDROL",
          "stdName": "ETHYLNANDROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cfc562ca-4ada-4a2b-8185-7715db967630",
            "5a8ccdf3-e8ba-4662-8f2f-c3d7d1ca18bf"
          ],
          "display_name": false
        },
        {
          "uuid": "6f8b3a25-2b74-4dbd-9f86-86ef0ce4417d",
          "name": "ETHYLNANDROL [JAN]",
          "stdName": "ETHYLNANDROL [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cfc562ca-4ada-4a2b-8185-7715db967630"
          ],
          "display_name": false
        },
        {
          "uuid": "7edd7dfe-7022-ab6a-5d1a-19bab9708b4b",
          "name": "Ethylestrenol [WHO-DD]",
          "stdName": "ETHYLESTRENOL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c7bc34e-daf7-c5a9-60c0-2052eed17a26"
          ],
          "display_name": false
        },
        {
          "uuid": "bd7ba40f-d9c7-4b9b-8fab-1dc5c74a188f",
          "name": "MAXIBOLIN",
          "stdName": "MAXIBOLIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a5bb9e37-72d6-433a-a972-37f1e7782f0b"
          ],
          "display_name": false
        },
        {
          "uuid": "1e3bc269-6fb4-484b-acc8-29d4d8c35857",
          "name": "NSC-37726",
          "stdName": "NSC-37726",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "043e61bd-f66a-4474-b48d-0399db2dcd55"
          ],
          "display_name": false
        },
        {
          "uuid": "54e44602-c1ce-4806-800d-4df3ea48c61f",
          "name": "ORABOLIN",
          "stdName": "ORABOLIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8beb61bf-20a0-40da-adcf-bc05ce3a1a97",
            "ca719eda-d175-4dde-852d-98eb9ccd5a79"
          ],
          "display_name": false
        },
        {
          "uuid": "11475e66-ebfe-4ade-be44-aa4cd293a8ed",
          "name": "ethylestrenol [INN]",
          "stdName": "ETHYLESTRENOL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a0518f67-f947-4d22-8f9f-a85649aff933"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a5bb9e37-72d6-433a-a972-37f1e7782f0b",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a0518f67-f947-4d22-8f9f-a85649aff933",
          "citation": "INN Proposed List 13",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL13.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d9ee1321-013f-499e-990d-c875688545c9",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1c53b69-797e-4477-809a-bbdfdaa0023e",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cafe274b-e5cb-427c-b935-fa28784111f7",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af82543a-a15f-4c04-88ff-312ba8ad8e1d",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8beb61bf-20a0-40da-adcf-bc05ce3a1a97",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca719eda-d175-4dde-852d-98eb9ccd5a79",
          "citation": "D01414",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "607ca4cb-6156-4a86-8901-23c8d7cf94de",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e52482f0-91d9-4fc1-a8ae-b68a6359403c",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cfc562ca-4ada-4a2b-8185-7715db967630",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "846229eb-8dcc-4224-abb5-c930c90b168b",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9ae5f9e7-d870-4c6e-a02d-f0657d7d18cb",
          "citation": "DEA LIST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "043e61bd-f66a-4474-b48d-0399db2dcd55",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7912ce2a-2c9b-47eb-8f96-8142bf80bc41",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390703000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f8048c7-1753-4f02-a254-f37e10160b40",
          "citation": "SRS import [ADC79EK5Q8]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ADC79EK5Q8",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390703000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c1a8dd89-b255-4f2e-9d5c-85ca111b7b6f",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "17a0fcc4-48c7-4e16-bfea-99e4ba984c64",
          "citation": "ETHYLESTRENOL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5a073716-26f3-4f8b-a105-d6b15c2d1776",
          "citation": "ETHYLESTRENOL [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c2ad9ecd-d304-4ea2-a37b-2a597d28c8ac",
          "citation": "ETHYLESTRENOL [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d2f0290e-a247-4999-91cf-876a1955320b",
          "citation": "ETHYLESTRENOL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c8d5966e-26b9-4504-8910-f48a23ae3ba3",
          "citation": "ETHYLESTRENOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7c8e1eaa-7ab4-42de-9941-8204ed096a01",
          "citation": "ETHYLESTRENOL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d743d5b3-758b-4981-b4f7-73f8ad8df4e5",
          "citation": "ETHYLESTRENOL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5a8ccdf3-e8ba-4662-8f2f-c3d7d1ca18bf",
          "citation": "ETHYLNANDROL [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6feb16e9-e04b-4848-a6c7-355bd4e3ccdd",
          "citation": "ETHYLESTRENOL [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3fe2898c-910a-d1fd-08a9-7925b3482c41",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+965-90-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c6f6f20f-3a01-3aa2-46e0-688cdd10a5c2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=965-90-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8c49e948-115b-c326-8ca0-c1e3eeca417a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0f8f0be1-a063-4191-8574-4d380e979553",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c8e12d2b-a1af-7dc4-199f-16e3ecf98915",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "0c7bc34e-daf7-c5a9-60c0-2052eed17a26",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "176c0f22-0153-2f09-93d9-20568d172efb",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1a37bf36-17e9-403a-b94f-307fcfd4a828",
          "id": "1a37bf36-17e9-403a-b94f-307fcfd4a828",
          "molfile": "\n  Marvin  01132101322D          \n\n 21 24  0  0  1  0            999 V2000\n    2.2509   -2.3816    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.0409   -2.6343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5288   -1.9722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0409   -1.3157    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.0526   -0.4938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7496   -0.9004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4642   -1.3128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2509   -1.5684    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.2509   -0.7465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5394   -1.1560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8365   -1.5684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8365   -2.3816    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    0.1191   -2.7941    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   -0.6041   -2.3816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3186   -2.7941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3186   -3.6218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6041   -4.0342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1191   -3.6218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8365   -4.0342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5394   -3.6218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5394   -2.7941    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n  1  2  1  1  0  0  0\n  1  8  1  0  0  0  0\n 21  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  4  6  1  0  0  0  0\n  8  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  9  1  1  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  1  0  0  0\n 12 13  1  0  0  0  0\n 21 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 18  1  6  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 20  1  6  0  0  0\nM  END",
          "smiles": "CC[C@@]1(CC[C@H]2[C@@H]3CCC4=CCCC[C@@H]4[C@H]3CC[C@@]21C)O",
          "formula": "C20H32O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1f1b07ac-9aa0-4943-92c9-a589ecd1b55b"
          },
          "defined_stereo": 6,
          "ez_centers": 0,
          "molecular_weight": "288.4682",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 6
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5f3b7409-fea4-4666-83b6-632045a27a85",
      "version": "14",
      "structure": {
        "id": "8b84ea7b-8cfd-4067-9a9c-f77ce83334f8",
        "molfile": "\n  Marvin  01132107152D          \n\n 25 28  0  0  1  0            999 V2000\n    2.2577   -1.5731    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.2577   -2.3888    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.5441   -2.8026    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.8391   -2.3888    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.1195   -2.8026    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.0501   -1.3197    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.1195   -3.6327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5441   -1.1595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8391   -1.5731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0501   -2.6423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5441   -3.6327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8391   -4.0464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5395   -1.9781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6059   -4.0464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0618   -0.4953    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2577   -0.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6059   -2.3888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7609   -0.9032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3226   -3.6327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4777   -1.3168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3226   -2.8026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1195   -1.9781    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5441   -1.9781    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8391   -3.2132    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2577   -3.2133    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  9  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11  3  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13  6  1  0  0  0  0\n 14  7  2  0  0  0  0\n  6 15  1  1  0  0  0\n  1 16  1  1  0  0  0\n 17  5  1  0  0  0  0\n  6 18  1  6  0  0  0\n 19 21  1  0  0  0  0\n 20 18  1  0  0  0  0\n 21 17  1  0  0  0  0\n  5 22  1  1  0  0  0\n  3 23  1  1  0  0  0\n  4 24  1  6  0  0  0\n  2 25  1  6  0  0  0\n 10 13  1  0  0  0  0\n  3  4  1  0  0  0  0\n  7 12  1  0  0  0  0\n 14 19  1  0  0  0  0\nM  END",
        "smiles": "CC[C@@]1(CC[C@@]2([H])[C@]3([H])CCC4=CCCC[C@]4([H])[C@@]3([H])CC[C@@]21C)O",
        "formula": "C20H32O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 6,
        "ez_centers": 0,
        "molecular_weight": "288.4682",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "c1a8dd89-b255-4f2e-9d5c-85ca111b7b6f",
          "2f8048c7-1753-4f02-a254-f37e10160b40",
          "a0518f67-f947-4d22-8f9f-a85649aff933"
        ],
        "stereo_centers": 6
      },
      "unii": "ADC79EK5Q8"
    }
  ]
}