{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "44301d2f-2d37-4da6-9d63-f24630a458d1", "code": "25225-08-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=25225-08-5", "code_system": "CAS", "references": [ "a96de7ed-c543-42e6-a907-69df8948f811", "49b23e68-8409-4697-957f-2db36705c8c0" ] }, { "uuid": "c53c4f71-c88d-4e62-ad31-a957086a50c2", "code": "246-735-2", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.042.472", "code_system": "ECHA (EC/EINECS)", "references": [ "a96de7ed-c543-42e6-a907-69df8948f811" ] }, { "uuid": "b9ba2a1b-8b43-47ab-9e1a-d2a52eb354d3", "code": "92288033", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/92288033", "code_system": "PUBCHEM", "references": [ "a96de7ed-c543-42e6-a907-69df8948f811" ] }, { "uuid": "6fa3304e-decd-4346-a8c7-81e3d911903c", "code": "ABL7XFD0MO", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "2da9ccbe-702b-484c-7a28-5c79f7f97eac", "code": "DTXSID20865193", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20865193", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "35b8e054-2c82-827c-905b-6a5da805380e", "name": "(1R)-1-((1S)-3,3-DIMETHYLCYCLOHEXYL)ETHYL FORMATE", "stdName": "(1R)-1-((1S)-3,3-DIMETHYLCYCLOHEXYL)ETHYL FORMATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "51aaa4a4-950e-7d8e-196c-c65ef7c4c11b" ], "display_name": true }, { "uuid": "4eb462b6-f490-3216-f5e1-375dbd32bbc1", "name": "1-(3,3-DIMETHYLCYCLOHEXYL)ETHYL FORMATE", "stdName": "1-(3,3-DIMETHYLCYCLOHEXYL)ETHYL FORMATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a03c00fd-6332-3d4f-625f-e7beb70a4c55" ], "display_name": false }, { "uuid": "da23c0d4-b915-4e3f-b9b1-0f425cd00d9a", "name": "CYCLOHEXANEMETHANOL, ALPHA,3,3-TRIMETHYL-, 1-FORMATE", "stdName": "CYCLOHEXANEMETHANOL, ALPHA,3,3-TRIMETHYL-, 1-FORMATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "231680f5-feba-4eff-9f98-0c6f23e3a03a" ], "display_name": false } ], "references": [ { "uuid": "231680f5-feba-4eff-9f98-0c6f23e3a03a", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a96de7ed-c543-42e6-a907-69df8948f811", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392170000, "tags": [ "NOMEN" ] }, { "uuid": "a03c00fd-6332-3d4f-625f-e7beb70a4c55", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "51aaa4a4-950e-7d8e-196c-c65ef7c4c11b", "citation": "EC", "doc_type": "ECHA (EC/EINECS)", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "49b23e68-8409-4697-957f-2db36705c8c0", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "bee3e8af-9df0-24ec-649e-97f6b3a0d6b3", "id": "bee3e8af-9df0-24ec-649e-97f6b3a0d6b3", "molfile": "\n Marvin 01132109522D \n\n 14 14 0 0 1 0 999 V2000\n 17.0977 -4.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8121 -4.0701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3832 -4.0701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6687 -4.4825 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 15.6687 -5.3075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9543 -4.0701 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.2398 -4.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5253 -4.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5253 -3.2451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2398 -2.8325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9543 -3.2451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2432 -4.8453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7129 -3.9268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9543 -4.8951 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 1 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 6 0 0 0\n 4 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 11 1 0 0 0 0\n 6 14 1 1 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 12 1 0 0 0 0\n 8 13 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\nM END", "smiles": "C[C@H]([C@@]1([H])CCCC(C)(C)C1)OC=O", "formula": "C11H20O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e54a1a58-3712-42e4-b946-de2a370b15ba" }, "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "184.2757", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "452730e1-2636-43f7-a8f0-476aae74ea3c", "version": "10", "structure": { "id": "f706b388-c1c3-4c68-98b2-df7b9f5efd6e", "molfile": "chem6.mol\n Marvin 01132112482D \n\n 14 14 0 0 1 0 999 V2000\n 17.0977 -4.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8121 -4.0701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3832 -4.0701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6687 -4.4825 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 15.6687 -5.3075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9543 -4.0701 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.2398 -4.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5253 -4.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5253 -3.2451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2398 -2.8325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9543 -3.2451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2432 -4.8453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7129 -3.9268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9543 -4.8951 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 1 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 6 0 0 0\n 4 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 6 11 1 0 0 0 0\n 8 12 1 0 0 0 0\n 8 13 1 0 0 0 0\n 6 14 1 1 0 0 0\nM END", "smiles": "C[C@H]([C@@]1([H])CCCC(C)(C)C1)OC=O", "formula": "C11H20O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "184.2757", "optical_activity": "UNSPECIFIED", "references": [ "231680f5-feba-4eff-9f98-0c6f23e3a03a" ], "stereo_centers": 2 }, "unii": "ABL7XFD0MO" } ] }