{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "964990b7-f33f-4fbb-8549-92457d71b4b0",
          "code": "205650-65-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=205650-65-3",
          "code_system": "CAS",
          "references": [
            "0497049c-ba20-4aef-9116-9f575ad0e665",
            "9c6589fa-03f4-4f08-ace4-74fc1cc4c115"
          ]
        },
        {
          "uuid": "493681e2-b508-4263-bf66-81b69f6c7cfd",
          "code": "22673275",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/22673275",
          "code_system": "PUBCHEM",
          "references": [
            "0497049c-ba20-4aef-9116-9f575ad0e665"
          ]
        },
        {
          "uuid": "aaade4d0-0913-6b7b-b12c-b650a36c3f89",
          "code": "DTXSID0043719",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0043719",
          "code_system": "EPA CompTox",
          "references": [
            "bfda47d7-0280-58f0-c6b4-3d3c30d185ab"
          ]
        },
        {
          "uuid": "b9352396-c669-46f7-a472-c9afd2cadb81",
          "code": "A9Y6W9QM9D",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "e7b9acf6-5a2b-4bad-b6e8-f44921c82294",
          "type": "PARENT->DEGRADENT",
          "related_substance": {
            "uuid": "80c1a7bf-64e0-49bd-8eb0-28cad7fc954e",
            "refuuid": "7fab2e02-70b6-414b-aea3-401acf0e0d1f",
            "name": "FIPRONIL",
            "unii": "QGH063955F",
            "linking_id": "QGH063955F",
            "ref_pname": "FIPRONIL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e3312e57-8a20-420f-8c9d-f62e7df95cab",
          "name": "1H-PYRAZOLE-3-CARBONITRILE, 5-AMINO-1-(2,6-DICHLORO-4-(TRIFLUOROMETHYL)PHENYL)-4-(TRIFLUOROMETHYL)-",
          "stdName": "1H-PYRAZOLE-3-CARBONITRILE, 5-AMINO-1-(2,6-DICHLORO-4-(TRIFLUOROMETHYL)PHENYL)-4-(TRIFLUOROMETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a04d328-7807-426a-a5f9-1abf9da0f4c4"
          ],
          "display_name": false
        },
        {
          "uuid": "9272979d-3b1a-4994-b9e9-7ac94b83f749",
          "name": "5-AMINO-1-(2,6-DICHLORO-4-(TRIFLUOROMETHYL)PHENYL)-4-(TRIFLUOROMETHYL)-1H-PYRAZOLE-3-CARBONITRILE",
          "stdName": "5-AMINO-1-(2,6-DICHLORO-4-(TRIFLUOROMETHYL)PHENYL)-4-(TRIFLUOROMETHYL)-1H-PYRAZOLE-3-CARBONITRILE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "560be827-2162-4439-900c-1e9bc9a4d1b7"
          ],
          "display_name": true
        },
        {
          "uuid": "14253b37-c067-4fb3-8f56-f8053189d963",
          "name": "DESULFINYLFIPRONIL",
          "stdName": "DESULFINYLFIPRONIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a04d328-7807-426a-a5f9-1abf9da0f4c4"
          ],
          "display_name": false
        },
        {
          "uuid": "8be9dc58-a726-4755-bd29-453b4f6d00c6",
          "name": "FIPRONIL DESULFINYL",
          "stdName": "FIPRONIL DESULFINYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a04d328-7807-426a-a5f9-1abf9da0f4c4"
          ],
          "display_name": false
        },
        {
          "uuid": "f509635c-cc00-4ef4-87d1-afc865fb023a",
          "name": "FIPRONIL METABOLITE 46513",
          "stdName": "FIPRONIL METABOLITE 46513",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a04d328-7807-426a-a5f9-1abf9da0f4c4"
          ],
          "display_name": false
        },
        {
          "uuid": "5b56a072-4510-4ea0-b4e7-f4a820ca2b7b",
          "name": "J783.262A",
          "stdName": "J783.262A",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d00de68d-f411-491b-8296-8c01b7e51237"
          ],
          "display_name": false
        },
        {
          "uuid": "1028c69f-ded1-4ec8-be7b-eff4c9ea49f6",
          "name": "MB-46513",
          "stdName": "MB-46513",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a04d328-7807-426a-a5f9-1abf9da0f4c4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "560be827-2162-4439-900c-1e9bc9a4d1b7",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1a04d328-7807-426a-a5f9-1abf9da0f4c4",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d00de68d-f411-491b-8296-8c01b7e51237",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J783.262A",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J783.262A",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0497049c-ba20-4aef-9116-9f575ad0e665",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392052000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e951c6d1-59cd-40c5-86a8-917c3b9e6ba7",
          "citation": "SRS import [A9Y6W9QM9D]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=A9Y6W9QM9D",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392052000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bfda47d7-0280-58f0-c6b4-3d3c30d185ab",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=205650-65-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9c6589fa-03f4-4f08-ace4-74fc1cc4c115",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "11e5d758-ee88-46c9-a812-13ddc287ca07",
          "id": "11e5d758-ee88-46c9-a812-13ddc287ca07",
          "molfile": "\n  Marvin  01132101092D          \n\n 24 25  0  0  0  0            999 V2000\n    2.3813   -2.8872    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1249   -2.0980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3424   -1.8416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3424   -1.0254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1249   -0.7690    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6107   -1.4301    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4336   -1.4301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8586   -0.7218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4336    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.6816   -0.7218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0931   -1.4301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6816   -2.1452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8586   -2.1452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4336   -2.8603    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.9229   -1.4301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9229   -0.6004    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7459   -1.4301    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9229   -2.2599    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6746   -0.5396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0135   -0.0472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6678   -2.3341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.8198    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1822   -1.6662    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1468   -3.0019    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  6  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 21  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4 19  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 13  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 11 15  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n 19 20  3  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 21 24  1  0  0  0  0\nM  END",
          "smiles": "c1c(cc(c(c1Cl)-n2c(c(c(C#N)n2)C(F)(F)F)N)Cl)C(F)(F)F",
          "formula": "C12H4Cl2F6N4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7fbfa226-f86d-4992-8baa-043cbfae6cb8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "389.0837",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b860ad10-a914-402c-851f-5c5404dda283",
      "version": "4",
      "structure": {
        "id": "20ee7805-233d-4670-ad97-ab8e72c5f081",
        "molfile": "\n  Marvin  01132101522D          \n\n 24 25  0  0  0  0            999 V2000\n    2.6107   -1.4301    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4336   -1.4301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1249   -2.0980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1249   -0.7690    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8586   -0.7218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8586   -2.1452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3424   -1.8416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3813   -2.8872    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3424   -1.0254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6816   -0.7218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4336    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.6816   -2.1452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4336   -2.8603    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.6678   -2.3341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6746   -0.5396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0931   -1.4301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.8198    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1822   -1.6662    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0135   -0.0472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9229   -1.4301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9229   -0.6004    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7459   -1.4301    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9229   -2.2599    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1468   -3.0019    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  2  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  2  0  0  0  0\n  3  8  1  0  0  0  0\n  4  9  2  0  0  0  0\n  5 10  1  0  0  0  0\n  5 11  1  0  0  0  0\n  6 12  2  0  0  0  0\n  6 13  1  0  0  0  0\n  7 14  1  0  0  0  0\n  7  9  1  0  0  0  0\n  9 15  1  0  0  0  0\n 10 16  2  0  0  0  0\n 12 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 14 18  1  0  0  0  0\n 14 24  1  0  0  0  0\n 15 19  3  0  0  0  0\n 16 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 20 23  1  0  0  0  0\nM  END",
        "smiles": "c1c(cc(c(c1Cl)-n2c(c(c(C#N)n2)C(F)(F)F)N)Cl)C(F)(F)F",
        "formula": "C12H4Cl2F6N4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "389.0837",
        "optical_activity": "NONE",
        "references": [
          "560be827-2162-4439-900c-1e9bc9a4d1b7",
          "e951c6d1-59cd-40c5-86a8-917c3b9e6ba7"
        ],
        "stereo_centers": 0
      },
      "unii": "A9Y6W9QM9D"
    }
  ]
}