{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e57e679a-9a4a-4161-91a9-ba1452d76a9e",
          "code": "2764-72-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2764-72-9",
          "code_system": "CAS",
          "references": [
            "0bb57631-92d9-4249-abce-66a7702e1735",
            "ac73f065-0c8e-4126-a6ad-eaa3b285a12f"
          ]
        },
        {
          "uuid": "e8d84080-88bc-4d47-89f2-8d7ced6615bf",
          "code": "D004178",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68004178",
          "code_system": "MESH",
          "references": [
            "0bb57631-92d9-4249-abce-66a7702e1735"
          ]
        },
        {
          "uuid": "422973c8-a9b4-40b8-a920-9772a54a1844",
          "code": "DIQUAT",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Diquat",
          "code_system": "WIKIPEDIA",
          "references": [
            "0bb57631-92d9-4249-abce-66a7702e1735"
          ]
        },
        {
          "uuid": "f426b2d7-88d1-463c-bc77-b833fff570cc",
          "code": "32202",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2198",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "0bb57631-92d9-4249-abce-66a7702e1735"
          ]
        },
        {
          "uuid": "8c9879ce-95e4-42c8-a6e1-96cb57ea68c3",
          "code": "220-433-0",
          "type": "PRIMARY",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0bb57631-92d9-4249-abce-66a7702e1735"
          ]
        },
        {
          "uuid": "6747bd80-9e5f-418f-9a63-3f70806173a1",
          "code": "6795",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6795",
          "code_system": "PUBCHEM",
          "references": [
            "0bb57631-92d9-4249-abce-66a7702e1735"
          ]
        },
        {
          "uuid": "b86eea69-66ba-826d-f145-3ae4e1c0b108",
          "code": "DTXSID6034554",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6034554",
          "code_system": "EPA CompTox",
          "references": [
            "4a06a30e-c875-68e4-29b5-ca847692476d"
          ]
        },
        {
          "uuid": "037025a8-3302-44b1-b6f9-46b36025f31f",
          "code": "A9A615U4MP",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0337e3a6-4975-d067-1e10-b169243134a8",
          "code": "64163",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:64163",
          "code_system": "CHEBI",
          "references": [
            "cce99da3-7924-844a-0307-956209ddd992"
          ]
        },
        {
          "uuid": "a499ea27-f777-17ad-2ef4-abebce19383a",
          "code": "diquat",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/diquat.html",
          "code_system": "ALANWOOD",
          "references": [
            "8944193e-755d-50b7-5f41-e229ad72251c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "d8d2ed7b-2ef9-45e6-8338-4c4e29f4eae0",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "3a4b39f8-ddc6-4a93-a697-ae863a0a2f82",
            "refuuid": "fadfff3b-56ce-4c2a-bb26-0ff6d8f41a96",
            "name": "DIQUAT",
            "unii": "A9A615U4MP",
            "linking_id": "A9A615U4MP",
            "ref_pname": "DIQUAT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7e03bcd5-4c1b-4f9f-81b6-f9cb5777328e",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "5daee6ea-abc5-4903-8734-606586727f4b",
            "refuuid": "127896c2-a46c-411f-9613-bbccf336ad3d",
            "name": "DIQUAT DIBROMIDE",
            "unii": "6BDV3T272W",
            "linking_id": "6BDV3T272W",
            "ref_pname": "DIQUAT DIBROMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "056f54f0-3f13-4898-a754-651fabbe6179",
          "amount": {
            "uuid": "d7f3b3a6-0881-4cd4-84d4-49ae1c5c5ff9"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "55166d08-5207-433e-b650-2010bab2278c"
          ],
          "related_substance": {
            "uuid": "84903614-7d35-4f2e-9cbc-7cf4f9249dde",
            "refuuid": "343b8cc7-aeb6-4372-9940-6e17bea395a9",
            "name": "Diquat Dichloride",
            "unii": "H28Z5RJK9Y",
            "linking_id": "H28Z5RJK9Y",
            "ref_pname": "Diquat Dichloride",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1329ff64-71cf-47d8-9bf0-3ed33564b218",
          "name": "6,7-DIHYDRODIPYRIDO(1,2-A:2',1'-C)PYRAZINEDIIUM",
          "stdName": "6,7-DIHYDRODIPYRIDO(1,2-A:2',1'-C)PYRAZINEDIIUM",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d669083a-3576-4acb-88ab-1a5ba668b182",
            "99b77285-dabe-47c5-9f2b-0db8c3de84b8"
          ],
          "display_name": false
        },
        {
          "uuid": "248ff7cd-f363-48bb-a195-1024c8728bda",
          "name": "9,10-DIHYDRO-8A,10A-DIAZONIAPHENANTHRENE",
          "stdName": "9,10-DIHYDRO-8A,10A-DIAZONIAPHENANTHRENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8add9c3-568d-4f34-a412-503e17571ad1",
            "99b77285-dabe-47c5-9f2b-0db8c3de84b8"
          ],
          "display_name": false
        },
        {
          "uuid": "9e623dd1-f3a8-4f26-9c14-72bcc2101707",
          "name": "DIQUAT",
          "stdName": "DIQUAT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8e2aae3-5b5d-45c9-a939-5a2c368748b1",
            "1ffbadb1-2efa-4f9a-8b27-ba53baafcaff",
            "513526c9-b3c7-4595-bf08-aeb6b21f0c59"
          ],
          "display_name": true
        },
        {
          "uuid": "a409f45e-99d2-4698-a307-49a8270d1cfc",
          "name": "DIQUAT [ISO]",
          "stdName": "DIQUAT [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ffbadb1-2efa-4f9a-8b27-ba53baafcaff"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f8e2aae3-5b5d-45c9-a939-5a2c368748b1",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "99b77285-dabe-47c5-9f2b-0db8c3de84b8",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8add9c3-568d-4f34-a412-503e17571ad1",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d669083a-3576-4acb-88ab-1a5ba668b182",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ffbadb1-2efa-4f9a-8b27-ba53baafcaff",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0bb57631-92d9-4249-abce-66a7702e1735",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389713000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af7e8ea6-36c4-44e9-bff1-346da246422e",
          "citation": "SRS import [A9A615U4MP]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=A9A615U4MP",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389713000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "513526c9-b3c7-4595-bf08-aeb6b21f0c59",
          "citation": "DIQUAT [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4a06a30e-c875-68e4-29b5-ca847692476d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2764-72-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8944193e-755d-50b7-5f41-e229ad72251c",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "cce99da3-7924-844a-0307-956209ddd992",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ac73f065-0c8e-4126-a6ad-eaa3b285a12f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "55166d08-5207-433e-b650-2010bab2278c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9480394f-423b-4814-ace9-b1a642190951",
          "id": "9480394f-423b-4814-ace9-b1a642190951",
          "molfile": "\n  Marvin  01132107422D          \n\n 14 16  0  0  0  0            999 V2000\n   -1.8306   -8.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0505   -8.0459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6411   -7.3121    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    0.1957   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6179   -6.6015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1777   -5.9038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6540   -5.9115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0659   -6.6453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8589   -6.6453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2709   -5.9347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1205   -5.9347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5350   -6.6556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0948   -7.3327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2632   -7.3198    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n 14  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  8  3  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 14  2  0  0  0  0\n 11 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\nM  CHG  2   3   1  14   1\nM  END",
          "smiles": "c1cc[n+]2CC[n+]3ccccc3-c2c1",
          "formula": "C12H12N2",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e16db7c8-439e-4394-9aff-23edb823096f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "184.2375",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fadfff3b-56ce-4c2a-bb26-0ff6d8f41a96",
      "version": "6",
      "structure": {
        "id": "b224d596-eb1a-4290-a189-877a0f3efefe",
        "molfile": "\n  Marvin  01132109142D          \n\n 14 16  0  0  0  0            999 V2000\n   -0.6411   -7.3121    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   -2.2632   -7.3198    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   -1.8589   -6.6453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0659   -6.6453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8306   -8.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0505   -8.0459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1957   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0948   -7.3327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6540   -5.9115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2709   -5.9347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5350   -6.6556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6179   -6.6015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1205   -5.9347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1777   -5.9038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  5  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  1  2  0  0  0  0\n  8  2  1  0  0  0  0\n  9  4  2  0  0  0  0\n 10  3  1  0  0  0  0\n 11  8  2  0  0  0  0\n 12  7  1  0  0  0  0\n 13 10  2  0  0  0  0\n 14 12  2  0  0  0  0\n  3  2  2  0  0  0  0\n 14  9  1  0  0  0  0\n 13 11  1  0  0  0  0\nM  CHG  2   1   1   2   1\nM  END",
        "smiles": "c1cc[n+]2CC[n+]3ccccc3-c2c1",
        "formula": "C12H12N2",
        "atropisomerism": "No",
        "charge": 2,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "184.2375",
        "optical_activity": "NONE",
        "references": [
          "f8e2aae3-5b5d-45c9-a939-5a2c368748b1",
          "af7e8ea6-36c4-44e9-bff1-346da246422e"
        ],
        "stereo_centers": 0
      },
      "unii": "A9A615U4MP"
    }
  ]
}