{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "51d56b73-b576-4658-8bb6-dfd5222a504b", "code": "1645-21-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1645-21-2", "code_system": "CAS", "references": [ "b4eed49e-cc60-40b6-b68c-d13d1ac21bcf", "05db64b3-87f1-446d-bdae-b529dd98b8d2" ] }, { "uuid": "34065a80-4910-4e88-ad5f-85eb0d569711", "code": "261391", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/261391", "code_system": "PUBCHEM", "references": [ "b4eed49e-cc60-40b6-b68c-d13d1ac21bcf" ] }, { "uuid": "7be084ec-b3eb-4a3c-9e32-31f42c779e88", "code": "A96898YA6S", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "bc14f29f-af4f-3796-2784-07421002c975", "code": "93392", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=93392", "code_system": "NSC", "references": [ "8d59e8b1-dcbe-fc88-bb65-bc5dedfa7041" ] }, { "uuid": "3dd62811-1943-7666-1d7a-4ac27f2ee4f7", "code": "DTXSID40293999", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40293999", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "52eb62ff-cf4d-4bbc-9170-86b50da8acf8", "name": "2-(4-FLUORO-PHENYL)-CHROMEN-4-ONE", "stdName": "2-(4-FLUORO-PHENYL)-CHROMEN-4-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ebe6b5ff-a78c-4dbc-b881-16fa221cc812", "d0ba57c7-ec05-417d-a476-f9a1b4dd254b" ], "display_name": false }, { "uuid": "7bbf43a0-22a2-4101-a026-20352856907d", "name": "2-(4-FLUOROPHENYL)-1-BENZOPYRAN-4-ONE", "stdName": "2-(4-FLUOROPHENYL)-1-BENZOPYRAN-4-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ebe6b5ff-a78c-4dbc-b881-16fa221cc812", "d0ba57c7-ec05-417d-a476-f9a1b4dd254b" ], "display_name": false }, { "uuid": "32cd5c49-89fa-4acd-9644-5fada51f69fe", "name": "4'-FLUOROFLAVONE", "stdName": "4'-FLUOROFLAVONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d0ba57c7-ec05-417d-a476-f9a1b4dd254b", "17f65297-c9ed-49d0-bed1-d7d52c67fbcd" ], "display_name": true }, { "uuid": "52f91b3b-2a7f-6f3b-6d15-a2ceb8fb1860", "name": "NSC-93392", "stdName": "NSC-93392", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "8d59e8b1-dcbe-fc88-bb65-bc5dedfa7041" ], "display_name": false } ], "references": [ { "uuid": "17f65297-c9ed-49d0-bed1-d7d52c67fbcd", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "d0ba57c7-ec05-417d-a476-f9a1b4dd254b", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ebe6b5ff-a78c-4dbc-b881-16fa221cc812", "citation": "NLM", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b4eed49e-cc60-40b6-b68c-d13d1ac21bcf", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393576000, "tags": [ "NOMEN" ] }, { "uuid": "1bf6b413-d406-41f5-8338-d2cd3990e508", "citation": "SRS import [A96898YA6S]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=A96898YA6S", "doc_type": "SRS", "public_domain": true, "document_date": 1493393576000, "tags": [ "NOMEN" ] }, { "uuid": "05a3a332-a446-4a2b-b824-125f8c722d30", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "05db64b3-87f1-446d-bdae-b529dd98b8d2", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "8d59e8b1-dcbe-fc88-bb65-bc5dedfa7041", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a4fd384e-d07c-434c-bfb0-fd1ed9e60143", "id": "a4fd384e-d07c-434c-bfb0-fd1ed9e60143", "molfile": "\n Marvin 01132108342D \n\n 18 20 0 0 0 0 999 V2000\n 4.3772 -5.5298 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2036 -5.5298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6120 -6.2467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4336 -6.2467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8468 -5.5298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4336 -4.8180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6120 -4.8180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6683 -5.5298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0767 -6.2467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9033 -6.2467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3115 -6.9587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3115 -5.5298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1376 -5.5298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5510 -4.8180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1376 -4.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3115 -4.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9033 -4.8180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0767 -4.8180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 7 2 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 2 0 0 0 0\n 8 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 9 2 0 0 0 0\n 8 18 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 17 2 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 2 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 0 0 0 0\nM END", "smiles": "c1ccc2c(c1)c(=O)cc(-c3ccc(cc3)F)o2", "formula": "C15H9FO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "fcb0a6eb-0e0b-45a4-906f-671b0a99d30f" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "240.2297", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "228fe26c-3b9b-4c0c-984e-f5f303c612e6", "version": "5", "structure": { "id": "be0f727a-c5a3-4a5c-8578-74a865801e8e", "molfile": "\n Marvin 01132109502D \n\n 18 20 0 0 0 0 999 V2000\n 7.6683 -5.5298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0767 -6.2467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9033 -6.2467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3115 -5.5298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9033 -4.8180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0767 -4.8180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3115 -4.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1376 -4.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5510 -4.8180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1376 -5.5298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3115 -6.9587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8468 -5.5298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4336 -6.2467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6120 -6.2467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2036 -5.5298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6120 -4.8180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4336 -4.8180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3772 -5.5298 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 1 6 1 0 0 0 0\n 5 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 4 10 2 0 0 0 0\n 3 11 2 0 0 0 0\n 1 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 12 17 2 0 0 0 0\n 15 18 1 0 0 0 0\nM END", "smiles": "c1ccc2c(c1)c(=O)cc(-c3ccc(cc3)F)o2", "formula": "C15H9FO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "240.2297", "optical_activity": "NONE", "references": [ "05a3a332-a446-4a2b-b824-125f8c722d30", "1bf6b413-d406-41f5-8338-d2cd3990e508" ], "stereo_centers": 0 }, "unii": "A96898YA6S" } ] }