{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c90641ca-3a54-4315-a05b-3e41d08c11fd",
          "code": "J01XX07",
          "comments": "ATC|ANTIINFECTIVES FOR SYSTEMIC USE|ANTIBACTERIALS FOR SYSTEMIC USE|OTHER ANTIBACTERIALS|Other antibacterials|nitroxoline",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=J01XX07&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "469b53a0-ff4a-42ad-801a-23f1b6cfb543"
          ]
        },
        {
          "uuid": "bd15d656-d57f-4f25-9871-859472ff07d2",
          "code": "QJ01XX07",
          "comments": "VATC|ANTIBACTERIALS FOR SYSTEMIC USE|OTHER ANTIBACTERIALS|Other antibacterials|nitroxoline",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QJ01XX07&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "469b53a0-ff4a-42ad-801a-23f1b6cfb543"
          ]
        },
        {
          "uuid": "77a15fa3-73ac-41c2-b908-4e6653d70c66",
          "code": "4008-48-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4008-48-4",
          "code_system": "CAS",
          "references": [
            "469b53a0-ff4a-42ad-801a-23f1b6cfb543",
            "935eeca2-b21a-4f08-bb2c-e1ce8a7b4f84"
          ]
        },
        {
          "uuid": "f5b2b170-2cb5-4b32-829f-cac0230f9d2f",
          "code": "C72634",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C72634",
          "code_system": "NCI_THESAURUS",
          "references": [
            "469b53a0-ff4a-42ad-801a-23f1b6cfb543"
          ]
        },
        {
          "uuid": "75f157e3-7ce5-4f9e-8cf7-c87c5ce459bd",
          "code": "C005308",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67005308",
          "code_system": "MESH",
          "references": [
            "469b53a0-ff4a-42ad-801a-23f1b6cfb543"
          ]
        },
        {
          "uuid": "720ce040-851f-49e9-b6d6-d070837e1504",
          "code": "NITROXOLINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Nitroxoline",
          "code_system": "WIKIPEDIA",
          "references": [
            "469b53a0-ff4a-42ad-801a-23f1b6cfb543"
          ]
        },
        {
          "uuid": "98790299-94a1-452e-a790-a88d46599d3f",
          "code": "SUB09331MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "469b53a0-ff4a-42ad-801a-23f1b6cfb543"
          ]
        },
        {
          "uuid": "b4a87041-81cb-4eaf-ad56-dc4c22f1b36b",
          "code": "1833",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1833",
          "code_system": "INN",
          "references": [
            "469b53a0-ff4a-42ad-801a-23f1b6cfb543"
          ]
        },
        {
          "uuid": "efbe6f61-4600-4001-b28a-72cbd106fb32",
          "code": "223-662-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.021.513",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "469b53a0-ff4a-42ad-801a-23f1b6cfb543"
          ]
        },
        {
          "uuid": "8c5831c0-f8de-493a-b889-8b35b8b7ab2a",
          "code": "31901",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/31901/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "469b53a0-ff4a-42ad-801a-23f1b6cfb543"
          ]
        },
        {
          "uuid": "8dede1e1-84ff-4515-8700-6a591f610d0c",
          "code": "m8012",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8012?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "469b53a0-ff4a-42ad-801a-23f1b6cfb543"
          ]
        },
        {
          "uuid": "29f65c5f-1eab-4f8b-9d65-d9f69eae5ac8",
          "code": "DB01422",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01422",
          "code_system": "DRUG BANK",
          "references": [
            "469b53a0-ff4a-42ad-801a-23f1b6cfb543"
          ]
        },
        {
          "uuid": "c173bed4-4a10-47d4-9525-c56a65d2979b",
          "code": "CHEMBL1454910",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1454910",
          "code_system": "ChEMBL",
          "references": [
            "469b53a0-ff4a-42ad-801a-23f1b6cfb543"
          ]
        },
        {
          "uuid": "656534b0-8cdd-4771-a196-4a1fa7af224a",
          "code": "19910",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/19910",
          "code_system": "PUBCHEM",
          "references": [
            "469b53a0-ff4a-42ad-801a-23f1b6cfb543"
          ]
        },
        {
          "uuid": "40788919-8dbc-ca5e-3264-c872117e56b5",
          "code": "DTXSID4046284",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4046284",
          "code_system": "EPA CompTox",
          "references": [
            "c50d6855-e55c-bb13-a654-2ce4cc740b6d"
          ]
        },
        {
          "uuid": "fd0f2f7b-3a44-7e78-41f9-eae8064dd26d",
          "code": "C795",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antibiotic[C258]|Quinolone Antibiotic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C795",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e63acf40-31a5-242c-4961-a5546389a98b"
          ]
        },
        {
          "uuid": "09ce2e3b-f4a9-4192-a2bd-997d89414b03",
          "code": "A8M33244M6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e373a296-6e22-8171-092f-53ccd7d50fff",
          "code": "1954",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1954",
          "code_system": "DRUG CENTRAL",
          "references": [
            "e63acf40-31a5-242c-4961-a5546389a98b"
          ]
        },
        {
          "uuid": "13ae17b6-bfe6-72e4-34f6-50b129409a46",
          "code": "67121",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:67121",
          "code_system": "CHEBI",
          "references": [
            "e63acf40-31a5-242c-4961-a5546389a98b"
          ]
        },
        {
          "uuid": "8d8fec50-fc65-3c8f-afc5-51998ed6e3dc",
          "code": "74947",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=74947",
          "code_system": "NSC",
          "references": [
            "97a56e2c-5027-f90f-a320-a2a798b61f7c"
          ]
        },
        {
          "uuid": "57bf8e69-7320-76f5-7c87-af93e920f803",
          "code": "100000084124",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a988c03d-0d7e-69bf-1b4f-c438e68af539"
          ]
        },
        {
          "uuid": "03de3470-838a-4b19-95eb-00b75f67f85d",
          "code": "948823",
          "comments": "ORPHAN DRUG|Designated|Treatment of Neurofibromatosis type 1 (NF1)",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=948823",
          "code_system": "FDA ORPHAN DRUG"
        }
      ],
      "relationships": [
        {
          "uuid": "c357b995-b487-4313-b493-4d4583bd14ac",
          "amount": {
            "uuid": "4a20fb97-dee1-4a32-9242-385be9b6f1fd"
          },
          "comments": "Proven to be very effective at combating biofilm infections.",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "dffdc38a-7a3c-4027-9688-6167a82f1838",
            "refuuid": "c2963564-9093-4193-bf3e-2444bc8e9021",
            "name": "Nitroxoline",
            "unii": "A8M33244M6",
            "linking_id": "A8M33244M6",
            "ref_pname": "Nitroxoline",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fc366bc4-1db3-4270-b5c6-af5af5d262fb",
          "amount": {
            "uuid": "07f6febc-3983-486a-96be-1532a7afed6b"
          },
          "type": "TARGET->LIGAND",
          "references": [
            "6fddbe56-79e2-489d-894e-6afdfbc9b8d3"
          ],
          "related_substance": {
            "uuid": "9bc1f729-15c2-4c04-a892-cd03efbf59da",
            "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c",
            "name": "ZINC CATION",
            "unii": "13S1S8SF37",
            "linking_id": "13S1S8SF37",
            "ref_pname": "ZINC CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "30e3dbab-fcb9-424c-9866-fd2c56236f54",
          "amount": {
            "uuid": "4dc0cc78-96f1-46a1-9c22-356b6c038dca"
          },
          "type": "TARGET->LIGAND",
          "references": [
            "6fddbe56-79e2-489d-894e-6afdfbc9b8d3"
          ],
          "related_substance": {
            "uuid": "e41c69fb-6ccf-4551-8b4a-1065c72c36c8",
            "refuuid": "3963b0fc-3b47-4ee5-8f3a-4a92b7438c3d",
            "name": "FERROUS CATION",
            "unii": "GW89581OWR",
            "linking_id": "GW89581OWR",
            "ref_pname": "FERROUS CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1539275e-2217-4fdc-b8d1-fdf774cb4856",
          "amount": {
            "uuid": "8e07fede-3169-446f-9123-55988f2cee1c"
          },
          "type": "TARGET ORGANISM->INHIBITOR",
          "references": [
            "6fddbe56-79e2-489d-894e-6afdfbc9b8d3"
          ],
          "related_substance": {
            "uuid": "78c93bfc-7d49-4dd2-8903-77dc2c2dc1ee",
            "refuuid": "5c8fef70-fb16-4952-bc11-01cce7070048",
            "name": "PSEUDOMONAS AERUGINOSA",
            "unii": "Y793W5V55N",
            "linking_id": "Y793W5V55N",
            "ref_pname": "PSEUDOMONAS AERUGINOSA",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "31a6741b-7283-4716-b252-737bc7f28f10",
          "name": "5-NITRO-8-QUINOLINOL",
          "stdName": "5-NITRO-8-QUINOLINOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7067734e-f62d-4d46-951b-bdfe9672cd26"
          ],
          "display_name": false
        },
        {
          "uuid": "a5841dee-9a1a-468e-9d69-c6d9d1f79891",
          "name": "A-82",
          "stdName": "A-82",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7067734e-f62d-4d46-951b-bdfe9672cd26"
          ],
          "display_name": false
        },
        {
          "uuid": "347fb034-623f-4f38-94d5-505616d16be1",
          "name": "NITROXOLINE [MART.]",
          "stdName": "NITROXOLINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be37c231-3c46-46d0-afc5-d3a978bafae8"
          ],
          "display_name": false
        },
        {
          "uuid": "9625cb2f-2302-42ae-8382-287e27985181",
          "name": "NITROXOLINE [MI]",
          "stdName": "NITROXOLINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e25cbd2e-958f-409e-9867-498b61d272de",
            "164695f1-d9f1-408b-b280-2a18facfac5b"
          ],
          "display_name": false
        },
        {
          "uuid": "6865cf86-4ef7-4c59-8f31-16c691cdfe22",
          "name": "NSC-74947",
          "stdName": "NSC-74947",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "164695f1-d9f1-408b-b280-2a18facfac5b",
            "3f38f98c-f244-4726-af80-5a2798442177"
          ],
          "display_name": false
        },
        {
          "uuid": "031b86da-f80d-4b4f-a4d1-371cad6577c7",
          "name": "Nitroxoline",
          "stdName": "NITROXOLINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e25cbd2e-958f-409e-9867-498b61d272de",
            "7067734e-f62d-4d46-951b-bdfe9672cd26",
            "164695f1-d9f1-408b-b280-2a18facfac5b",
            "be37c231-3c46-46d0-afc5-d3a978bafae8",
            "b91dcbdb-fba8-4597-9022-3ca566ca0e7b",
            "8acca50b-9694-4380-b4c1-94ff19c63510",
            "baa78a22-d884-4bcb-91f3-b2016942cc13",
            "ad9fc396-ec7f-4370-a7e0-30bf1cdebf31",
            "d3ba78b3-b3a5-45a0-8694-fd1aeae112b0",
            "bc8bd3fb-5376-4d51-877f-f0c4e46e6b16"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "4c2f4fc7-ab07-458c-8420-6ee724194448",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "464881a2-1ffc-38ae-b2a7-ec387e332139",
          "name": "Nitroxoline [WHO-DD]",
          "stdName": "NITROXOLINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04c95113-606f-c080-1861-39adfa25d6f6"
          ],
          "display_name": false
        },
        {
          "uuid": "1255f8b8-63fe-4d36-aaf9-c2b7feadf90a",
          "name": "nitroxoline [INN]",
          "stdName": "NITROXOLINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "baa78a22-d884-4bcb-91f3-b2016942cc13"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7067734e-f62d-4d46-951b-bdfe9672cd26",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "baa78a22-d884-4bcb-91f3-b2016942cc13",
          "citation": "INN Proposed List 15",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL15.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "be37c231-3c46-46d0-afc5-d3a978bafae8",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e25cbd2e-958f-409e-9867-498b61d272de",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "164695f1-d9f1-408b-b280-2a18facfac5b",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d3ba78b3-b3a5-45a0-8694-fd1aeae112b0",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3f38f98c-f244-4726-af80-5a2798442177",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "469b53a0-ff4a-42ad-801a-23f1b6cfb543",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389672000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7757faee-4236-4d3d-9f8b-9473c3787837",
          "citation": "SRS import [A8M33244M6]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=A8M33244M6",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389672000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b91dcbdb-fba8-4597-9022-3ca566ca0e7b",
          "citation": "NITROXOLINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bc8bd3fb-5376-4d51-877f-f0c4e46e6b16",
          "citation": "NITROXOLINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ad9fc396-ec7f-4370-a7e0-30bf1cdebf31",
          "citation": "NITROXOLINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8acca50b-9694-4380-b4c1-94ff19c63510",
          "citation": "NITROXOLINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c50d6855-e55c-bb13-a654-2ce4cc740b6d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4008-48-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e63acf40-31a5-242c-4961-a5546389a98b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "935eeca2-b21a-4f08-bb2c-e1ce8a7b4f84",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "97a56e2c-5027-f90f-a320-a2a798b61f7c",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "04c95113-606f-c080-1861-39adfa25d6f6",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "a988c03d-0d7e-69bf-1b4f-c438e68af539",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "6fddbe56-79e2-489d-894e-6afdfbc9b8d3",
          "citation": "https://en.wikipedia.org/wiki/Nitroxoline",
          "url": "https://en.wikipedia.org/wiki/Nitroxoline",
          "doc_type": "WEB PAGE",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "921b2e97-cf75-41a1-8a7f-c536d816dde7",
          "id": "921b2e97-cf75-41a1-8a7f-c536d816dde7",
          "molfile": "\n  CDK     08292416072D\n\n 14 15  0  0  0  0  0  0  0  0999 V2000\n   27.8705   -7.3062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5192   -6.5266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1680   -7.3062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8168   -6.5266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4655   -7.3062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4655   -8.8654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8168   -9.6449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1680   -8.8654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5192   -9.6449    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8705   -8.8654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8168  -11.2041    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8168   -4.9675    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   22.4665   -4.1879    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1670   -4.1879    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  3  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  1 10  1  0  0  0  0\n  7 11  1  0  0  0  0\n  4 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\nM  CHG  1  12   1\nM  CHG  1  14  -1\nM  END",
          "smiles": "c1cc2c(ccc(c2nc1)O)[N+](=O)[O-]",
          "formula": "C9H6N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "83592947-b75d-4e18-8253-671b0b0189de"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "190.1559",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c2963564-9093-4193-bf3e-2444bc8e9021",
      "version": "22",
      "structure": {
        "id": "f2db453a-0b96-4bc6-8132-dcba066d8078",
        "molfile": "\n   JSDraw208292416072D\n\n 14 15  0  0  0  0              0 V2000\n   27.8705   -7.3062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5192   -6.5266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1680   -7.3062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8168   -6.5266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4655   -7.3062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4655   -8.8654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8168   -9.6449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1680   -8.8654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5192   -9.6449    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8705   -8.8654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8168  -11.2041    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8168   -4.9675    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   22.4665   -4.1879    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1670   -4.1879    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  3  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  1 10  1  0  0  0  0\n  7 11  1  0  0  0  0\n  4 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\nM  CHG  2  12   1  14  -1\nM  END",
        "smiles": "c1cc2c(ccc(c2nc1)O)[N+](=O)[O-]",
        "formula": "C9H6N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "190.1559",
        "optical_activity": "NONE",
        "references": [
          "7067734e-f62d-4d46-951b-bdfe9672cd26",
          "7757faee-4236-4d3d-9f8b-9473c3787837",
          "baa78a22-d884-4bcb-91f3-b2016942cc13"
        ],
        "stereo_centers": 0
      },
      "unii": "A8M33244M6"
    }
  ]
}