{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "354aa2d3-1292-41dc-94d3-805be3ef5e8a",
          "code": "505-32-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=505-32-8",
          "code_system": "CAS",
          "references": [
            "4db81124-3c29-419c-b288-ada542fc296f",
            "bb134416-b0fa-4ef5-9355-7b88fc93667f"
          ]
        },
        {
          "uuid": "dc95a5a1-7783-4b8c-b46f-b89f71f098d1",
          "code": "C549875",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67549875",
          "code_system": "MESH",
          "references": [
            "4db81124-3c29-419c-b288-ada542fc296f"
          ]
        },
        {
          "uuid": "f0652676-c3db-48c3-9a6c-d28d11275acf",
          "code": "m6514",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6514?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4db81124-3c29-419c-b288-ada542fc296f"
          ]
        },
        {
          "uuid": "4e435bd8-da86-46ec-87e7-0f6bb5511f5e",
          "code": "SUB41332",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4db81124-3c29-419c-b288-ada542fc296f"
          ]
        },
        {
          "uuid": "e6a29781-66ae-4ebf-8dfe-7160cb88c2ef",
          "code": "208-008-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.281",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4db81124-3c29-419c-b288-ada542fc296f"
          ]
        },
        {
          "uuid": "38f2cf67-71c8-4e7f-a982-4aa1a0f23fa3",
          "code": "10453",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10453",
          "code_system": "PUBCHEM",
          "references": [
            "4db81124-3c29-419c-b288-ada542fc296f"
          ]
        },
        {
          "uuid": "ef52342c-ffd9-9544-aca1-144fb85d7741",
          "code": "5673",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5673",
          "code_system": "HSDB",
          "references": [
            "0869cec5-80d7-921b-9e0b-e53410a5abb2"
          ]
        },
        {
          "uuid": "b76a150f-1b52-5d01-9a28-30f7b0f81b17",
          "code": "DTXSID2025474",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2025474",
          "code_system": "EPA CompTox",
          "references": [
            "71ab046d-56da-9c18-78f9-aab67bcb3567"
          ]
        },
        {
          "uuid": "4ff2951e-c3f8-4051-88a6-608633282a43",
          "code": "A831ZI6VIM",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "924b539e-4851-8a29-a10d-b5017fa47e43",
          "code": "Isophytol",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Isophytol",
          "code_system": "WIKIPEDIA",
          "references": [
            "28cc3e9f-f297-fdfc-91f2-41c88e6c6288"
          ]
        },
        {
          "uuid": "2675bf37-6f5f-c2cf-fb5a-7a1e362aecf5",
          "code": "93744",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=93744",
          "code_system": "NSC",
          "references": [
            "ea12df6f-cf3b-cffc-d886-901ae2cf52ff"
          ]
        },
        {
          "uuid": "6e87fa99-1188-e20d-012a-d48c4646eeb7",
          "code": "100000130096",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "0ed2a848-32e4-7b14-c01c-4b5071af70d9"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "46605c7b-926e-4fc5-ade3-5ca2a02908e6",
          "name": "1-HEXADECEN-3-OL, 3,7,11,15-TETRAMETHYL-",
          "stdName": "1-HEXADECEN-3-OL, 3,7,11,15-TETRAMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f96cfc1-289f-4848-8ed5-04f8f1bf2231",
            "84cf7f13-7e72-4966-919a-ff62c7250b1b"
          ],
          "display_name": false
        },
        {
          "uuid": "d11a1f5d-b9d5-498f-965b-ed097bee086d",
          "name": "2,6,10,14-TETRAMETHYLHEXADEC-15-EN-14-OL",
          "stdName": "2,6,10,14-TETRAMETHYLHEXADEC-15-EN-14-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f96cfc1-289f-4848-8ed5-04f8f1bf2231",
            "56d6f8f6-8c7b-4015-a04f-ca105708837b"
          ],
          "display_name": false
        },
        {
          "uuid": "b7402289-99c4-4ca4-ad05-00dd0a22cb28",
          "name": "2,6,10-TRIMETHYL-14-VINYLPENTADECAN-14-OL",
          "stdName": "2,6,10-TRIMETHYL-14-VINYLPENTADECAN-14-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f96cfc1-289f-4848-8ed5-04f8f1bf2231",
            "56d6f8f6-8c7b-4015-a04f-ca105708837b"
          ],
          "display_name": false
        },
        {
          "uuid": "797123d8-4289-4346-81eb-6f0579283b4b",
          "name": "3,7,11,15-TETRAMETHYLHEXADEC-1-EN-3-OL",
          "stdName": "3,7,11,15-TETRAMETHYLHEXADEC-1-EN-3-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f96cfc1-289f-4848-8ed5-04f8f1bf2231",
            "56d6f8f6-8c7b-4015-a04f-ca105708837b"
          ],
          "display_name": false
        },
        {
          "uuid": "bb7ef507-b009-4b51-bdf5-04372dafa427",
          "name": "ISOPHYTOL",
          "stdName": "ISOPHYTOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f96cfc1-289f-4848-8ed5-04f8f1bf2231",
            "a9cd9e09-9348-429e-91d7-12d08b11d30f",
            "0b620278-3f1d-4fa0-bc03-532f10305b77",
            "56d6f8f6-8c7b-4015-a04f-ca105708837b",
            "63b2aaca-4cf6-45d8-8cc8-98ca98d0b888",
            "8595c7a0-119f-4e33-8e7d-86bef0cd7816"
          ],
          "display_name": true
        },
        {
          "uuid": "151c43d0-86df-4d75-8122-0ab3a5784ca8",
          "name": "ISOPHYTOL [HSDB]",
          "stdName": "ISOPHYTOL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f96cfc1-289f-4848-8ed5-04f8f1bf2231",
            "0b620278-3f1d-4fa0-bc03-532f10305b77"
          ],
          "display_name": false
        },
        {
          "uuid": "3448b808-a441-427b-9be5-1ac97707aa01",
          "name": "ISOPHYTOL [MI]",
          "stdName": "ISOPHYTOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a9cd9e09-9348-429e-91d7-12d08b11d30f",
            "8f96cfc1-289f-4848-8ed5-04f8f1bf2231"
          ],
          "display_name": false
        },
        {
          "uuid": "4357d7cb-f778-4966-9cf0-48c561e7d0b4",
          "name": "NSC-93744",
          "stdName": "NSC-93744",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f96cfc1-289f-4848-8ed5-04f8f1bf2231",
            "84cf7f13-7e72-4966-919a-ff62c7250b1b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8f96cfc1-289f-4848-8ed5-04f8f1bf2231",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "84cf7f13-7e72-4966-919a-ff62c7250b1b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b620278-3f1d-4fa0-bc03-532f10305b77",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9cd9e09-9348-429e-91d7-12d08b11d30f",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4db81124-3c29-419c-b288-ada542fc296f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391320000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f82a5236-56d7-4f38-9568-f70c88c07bf6",
          "citation": "SRS import [A831ZI6VIM]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=A831ZI6VIM",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391320000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "63b2aaca-4cf6-45d8-8cc8-98ca98d0b888",
          "citation": "ISOPHYTOL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8595c7a0-119f-4e33-8e7d-86bef0cd7816",
          "citation": "ISOPHYTOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "56d6f8f6-8c7b-4015-a04f-ca105708837b",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0869cec5-80d7-921b-9e0b-e53410a5abb2",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+505-32-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "71ab046d-56da-9c18-78f9-aab67bcb3567",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=505-32-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "28cc3e9f-f297-fdfc-91f2-41c88e6c6288",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "ea12df6f-cf3b-cffc-d886-901ae2cf52ff",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "bb134416-b0fa-4ef5-9355-7b88fc93667f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0ed2a848-32e4-7b14-c01c-4b5071af70d9",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0437ca83-0989-416c-8c14-caf16a5cc242",
          "id": "0437ca83-0989-416c-8c14-caf16a5cc242",
          "molfile": "\n  Marvin  01132100312D          \n\n 21 20  0  0  0  0            999 V2000\n    4.6349   -6.7032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3477   -7.1182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3448   -7.9433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0637   -6.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7767   -7.1235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4927   -6.7136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2057   -7.1287    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    8.2027   -7.9537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9216   -6.7188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6346   -7.1339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3506   -6.7240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0635   -7.1392    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   11.0605   -7.9641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7796   -6.7293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4926   -7.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2085   -6.7344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9215   -7.1496    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   13.5064   -7.8626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3313   -7.8656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6374   -6.7397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3504   -7.1548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 20 21  2  0  0  0  0\nM  END",
          "smiles": "C=CC(C)(CCCC(C)CCCC(C)CCCC(C)C)O",
          "formula": "C20H40O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4ca0cc8b-8f02-4abe-9e17-dbe060ceefde"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "296.5318",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "32d4bc39-3e34-4103-834d-f163bc2b59ac",
      "version": "7",
      "structure": {
        "id": "c9dfb1a6-90b0-4784-bf76-a27e493083cc",
        "molfile": "\n  Marvin  01132110252D          \n\n 21 20  0  0  0  0            999 V2000\n   11.0635   -7.1392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7796   -6.7293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4926   -7.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2085   -6.7344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9215   -7.1496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6374   -6.7397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3504   -7.1548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5064   -7.8626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3313   -7.8656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3506   -6.7240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6346   -7.1339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9216   -6.7188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2057   -7.1287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4927   -6.7136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7767   -7.1235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0637   -6.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3477   -7.1182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6349   -6.7032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3448   -7.9433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2027   -7.9537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0605   -7.9641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  6  7  2  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  8  1  0  0  0  0\n  5  9  1  0  0  0  0\n  1 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 13 20  1  0  0  0  0\n  1 21  1  0  0  0  0\nM  END",
        "smiles": "C=CC(C)(CCCC(C)CCCC(C)CCCC(C)C)O",
        "formula": "C20H40O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "296.5318",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "56d6f8f6-8c7b-4015-a04f-ca105708837b",
          "f82a5236-56d7-4f38-9568-f70c88c07bf6"
        ],
        "stereo_centers": 3
      },
      "unii": "A831ZI6VIM"
    }
  ]
}