{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "51003797-d9b8-473a-b1ce-e6be48afdc5a",
          "code": "BETA-IONONE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=1767",
          "code_system": "JECFA EVALUATION",
          "references": [
            "b846e685-b951-4e2c-b7e3-d3fdcfdbfaa3"
          ]
        },
        {
          "uuid": "1a2977ba-4945-468d-87f9-e5d7b092b1ac",
          "code": "79-77-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=79-77-6",
          "code_system": "CAS",
          "references": [
            "b846e685-b951-4e2c-b7e3-d3fdcfdbfaa3",
            "6faab808-aa25-4365-892a-2b3bbfcc4718"
          ]
        },
        {
          "uuid": "75f3cf17-bcc9-40d7-983f-3b5cda85cd18",
          "code": "C008157",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67008157",
          "code_system": "MESH",
          "references": [
            "b846e685-b951-4e2c-b7e3-d3fdcfdbfaa3"
          ]
        },
        {
          "uuid": "ca0a2ed3-fbc4-4d4d-8303-269e79d12840",
          "code": "21 CFR 172.515",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart F--Flavoring Agents and Related Substances|Sec. 172.515 Synthetic flavoring substances and adjuvants.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=172.515",
          "code_system": "CFR",
          "references": [
            "b846e685-b951-4e2c-b7e3-d3fdcfdbfaa3"
          ]
        },
        {
          "uuid": "cb92644b-3e20-434f-86b2-22f53bc022b8",
          "code": "14901-07-6",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=14901-07-6",
          "code_system": "CAS",
          "references": [
            "b846e685-b951-4e2c-b7e3-d3fdcfdbfaa3",
            "52c249a1-c34a-47a0-adb0-388aef961722"
          ]
        },
        {
          "uuid": "18428330-a85d-4297-8024-64a60d029683",
          "code": "BETA-IONONE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=1767",
          "code_system": "JECFA EVALUATION",
          "references": [
            "b846e685-b951-4e2c-b7e3-d3fdcfdbfaa3"
          ]
        },
        {
          "uuid": "1b0543cd-34da-47d2-a3cc-172029e01bca",
          "code": "IONONE",
          "comments": "The ionones are a series of closely related chemical substances that are part of a group of compounds known as rose ketones, which also includes damascones and damascenones.",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Ionone",
          "code_system": "WIKIPEDIA",
          "references": [
            "b846e685-b951-4e2c-b7e3-d3fdcfdbfaa3"
          ]
        },
        {
          "uuid": "61686dfb-8ef2-459c-8321-7e74e05dd2fe",
          "code": "201-224-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.114",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b846e685-b951-4e2c-b7e3-d3fdcfdbfaa3"
          ]
        },
        {
          "uuid": "59b15cbf-9900-42c4-86ce-da3332891eef",
          "code": "m6369",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6369?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b846e685-b951-4e2c-b7e3-d3fdcfdbfaa3"
          ]
        },
        {
          "uuid": "24cefda5-3820-41ce-848b-b47bf76c59c8",
          "code": "SUB70211",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "b846e685-b951-4e2c-b7e3-d3fdcfdbfaa3"
          ]
        },
        {
          "uuid": "3bfceec8-330c-471a-bcc2-93c0c9edbbe9",
          "code": "238-969-9",
          "type": "ALTERNATIVE",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.035.412",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b846e685-b951-4e2c-b7e3-d3fdcfdbfaa3"
          ]
        },
        {
          "uuid": "b55bfb14-21b3-4cbc-b9d3-fa9493c780cb",
          "code": "638014",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/638014",
          "code_system": "PUBCHEM",
          "references": [
            "b846e685-b951-4e2c-b7e3-d3fdcfdbfaa3"
          ]
        },
        {
          "uuid": "3c957f94-1af2-4ee2-5c3a-7482adc13a2e",
          "code": "14901-07-6",
          "type": "PRIMARY",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+14901-07-6",
          "code_system": "HSDB",
          "references": [
            "ecb103a6-cfe7-4270-2153-85a15cab6dd3"
          ]
        },
        {
          "uuid": "c81a8381-d5c0-381d-5185-93064d6c92b8",
          "code": "2371702",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2371702/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "f7ac7c16-0c7e-e363-1a92-264657fab557"
          ]
        },
        {
          "uuid": "da78cfe7-d3e5-4ccb-8ee3-eee7a6d8dd81",
          "code": "A7NRR1HLH6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ed1daa20-b505-076a-cb14-e456fced0627",
          "code": "32325",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:32325",
          "code_system": "CHEBI",
          "references": [
            "22a97b8c-d541-525d-7b86-0c28ce88347d"
          ]
        },
        {
          "uuid": "ac0679e2-a560-012c-394a-b919831148a9",
          "code": "100000135279",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "e44249dd-76dc-7ad7-4286-eed057da1426"
          ]
        },
        {
          "uuid": "e058be92-c1d1-abe4-25e8-6cfd67ab83cf",
          "code": "46137",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=46137",
          "code_system": "NSC",
          "references": [
            "fde24d88-800f-553d-4b48-39c12063e7a1"
          ]
        },
        {
          "uuid": "ca040659-c5a6-caf3-539e-a9a91a8ff8d3",
          "code": "A7NRR1HLH6",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=A7NRR1HLH6",
          "code_system": "DAILYMED",
          "references": [
            "14267e9f-39c1-a184-f57d-29f635f84fdd"
          ]
        },
        {
          "uuid": "b2d23188-d2f3-360c-a254-7930651a4e4f",
          "code": "402758",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=402758",
          "code_system": "NSC",
          "references": [
            "fde24d88-800f-553d-4b48-39c12063e7a1"
          ]
        },
        {
          "uuid": "94a53cda-c7ed-e639-a853-ea9311f6bdfc",
          "code": "342",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/342/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "10a28e4d-e3a1-0243-dea1-d6ab2366df11"
          ]
        },
        {
          "uuid": "6a29e924-8331-2347-0407-fe5be12e01e3",
          "code": "DTXSID4021769",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4021769",
          "code_system": "EPA CompTox",
          "references": [
            "1cafcb50-97f5-0818-1b10-403557ca133c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "a11a9a2c-fc3e-4610-a57c-c00c5146b79c",
          "amount": {
            "uuid": "71ba1188-f3ce-481e-b5fa-2ef77344ec64"
          },
          "comments": "Calendula officinalis flower volatile oil constituent.",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "94fd6c7d-28b3-42a6-aa10-788498b6591c"
          ],
          "related_substance": {
            "uuid": "914b813d-7404-4dfa-8732-1120b7f7b484",
            "refuuid": "e2dbbdeb-f16f-4daa-8570-a3f703139cb9",
            "name": "CALENDULA OFFICINALIS FLOWER",
            "unii": "P0M7O4Y7YD",
            "linking_id": "P0M7O4Y7YD",
            "ref_pname": "CALENDULA OFFICINALIS FLOWER",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ea5bfd3f-cf31-4030-9220-86638834c60c",
          "name": "(E)-.BETA.-IONONE",
          "stdName": "(E)-.BETA.-IONONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2107f0f5-9b4c-4d93-8fc1-c52d914cb373",
            "30318bfe-4160-4fca-9178-497005f9336a"
          ],
          "display_name": false
        },
        {
          "uuid": "20d32b1c-3364-4409-bc5d-5ed46b28f815",
          "name": "(E)-4-(2,6,6-TRIMETHYL-1-CYCLOHEXEN-1-YL)-3-BUTEN-2-ONE",
          "stdName": "(E)-4-(2,6,6-TRIMETHYL-1-CYCLOHEXEN-1-YL)-3-BUTEN-2-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30318bfe-4160-4fca-9178-497005f9336a",
            "4dc1c6ae-3f9b-41c9-8c8c-d509a947e52c"
          ],
          "display_name": false
        },
        {
          "uuid": "ef1631f9-439e-4d59-a778-b59d8b4ba314",
          "name": ".BETA.-IONONE [FHFI]",
          "stdName": ".BETA.-IONONE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30318bfe-4160-4fca-9178-497005f9336a",
            "7569fe81-5a2b-4b80-82e9-983d163550e3"
          ],
          "display_name": false
        },
        {
          "uuid": "43171509-3c94-4070-8a85-5b689f373ab8",
          "name": ".BETA.-IONONE [MI]",
          "stdName": ".BETA.-IONONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30318bfe-4160-4fca-9178-497005f9336a",
            "4dc1c6ae-3f9b-41c9-8c8c-d509a947e52c"
          ],
          "display_name": false
        },
        {
          "uuid": "32c24c50-8508-46f9-9654-556f8f3d4eaf",
          "name": "3-BUTEN-2-ONE, 4-(2,6,6-TRIMETHYL-1-CYCLOHEXEN-1-YL)-, (3E)-",
          "stdName": "3-BUTEN-2-ONE, 4-(2,6,6-TRIMETHYL-1-CYCLOHEXEN-1-YL)-, (3E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2107f0f5-9b4c-4d93-8fc1-c52d914cb373",
            "30318bfe-4160-4fca-9178-497005f9336a"
          ],
          "display_name": false
        },
        {
          "uuid": "3e45d4c0-af61-4c9e-ad4c-44d952f6a94e",
          "name": "3-BUTEN-2-ONE, 4-(2,6,6-TRIMETHYL-1-CYCLOHEXEN-1-YL)-, (E)-",
          "stdName": "3-BUTEN-2-ONE, 4-(2,6,6-TRIMETHYL-1-CYCLOHEXEN-1-YL)-, (E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2107f0f5-9b4c-4d93-8fc1-c52d914cb373",
            "30318bfe-4160-4fca-9178-497005f9336a"
          ],
          "display_name": false
        },
        {
          "uuid": "7f063bac-9b88-4e96-a6b1-8b4184047ca4",
          "name": "4-(2,6,6-TRIMETHYL-1-CYCLOHEXEN-1-YL)-3-BUTEN-2-ONE",
          "stdName": "4-(2,6,6-TRIMETHYL-1-CYCLOHEXEN-1-YL)-3-BUTEN-2-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30318bfe-4160-4fca-9178-497005f9336a",
            "9e72bd61-d6f9-47d0-8a82-3d948cc58998"
          ],
          "display_name": false
        },
        {
          "uuid": "49680d6e-b173-424d-bb6e-bc4d76ecbfb0",
          "name": "BETA-IONONE",
          "stdName": "BETA-IONONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30318bfe-4160-4fca-9178-497005f9336a",
            "5b95259b-1d79-4d62-b0a2-380274d127fa",
            "eba5fae4-0026-4d4a-96bd-3680617663ce"
          ],
          "display_name": false
        },
        {
          "uuid": "8efcd048-e63a-46fb-b012-21eb7c7975a2",
          "name": "BETA-IONONE [FCC]",
          "stdName": "BETA-IONONE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30318bfe-4160-4fca-9178-497005f9336a",
            "eba5fae4-0026-4d4a-96bd-3680617663ce"
          ],
          "display_name": false
        },
        {
          "uuid": "9c457273-3fa9-4912-aca7-09d1b705286f",
          "name": "FEMA NO. 2595",
          "stdName": "FEMA NO. 2595",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30318bfe-4160-4fca-9178-497005f9336a",
            "9e7602b5-93d1-44d8-8bba-91f691785711"
          ],
          "display_name": false
        },
        {
          "uuid": "7aa6900a-6f21-46a8-b3b3-71a3bde4cdf4",
          "name": "IONONE, .BETA.-",
          "stdName": "IONONE, .BETA.-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30318bfe-4160-4fca-9178-497005f9336a",
            "241470f0-36d1-4e7e-acc1-6a89cfa6b623"
          ],
          "display_name": false
        },
        {
          "uuid": "9571fcc9-5f66-4f73-b9a5-00b8e23cb18e",
          "name": "NSC-402758",
          "stdName": "NSC-402758",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30318bfe-4160-4fca-9178-497005f9336a",
            "9e7602b5-93d1-44d8-8bba-91f691785711"
          ],
          "display_name": false
        },
        {
          "uuid": "54192238-2e00-4731-897e-fdc1853b1856",
          "name": "NSC-46137",
          "stdName": "NSC-46137",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30318bfe-4160-4fca-9178-497005f9336a",
            "b55291e1-5877-480b-9db2-470c656aec91"
          ],
          "display_name": false
        },
        {
          "uuid": "225dc0b1-8849-4427-8256-3a4f8e8d1d82",
          "name": "TRANS-.BETA.-IONONE",
          "stdName": "TRANS-.BETA.-IONONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2107f0f5-9b4c-4d93-8fc1-c52d914cb373",
            "30318bfe-4160-4fca-9178-497005f9336a"
          ],
          "display_name": false
        },
        {
          "uuid": "e8366416-953e-47cd-bac4-a19965a16f44",
          "name": "β-Ionone",
          "stdName": ".BETA.-IONONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30318bfe-4160-4fca-9178-497005f9336a",
            "4dc1c6ae-3f9b-41c9-8c8c-d509a947e52c",
            "1b4d1643-cf1d-4bb3-b3fd-baa54316dae5",
            "7569fe81-5a2b-4b80-82e9-983d163550e3",
            "7055e53c-5bd7-4387-a140-4200ec9972c1"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "b55291e1-5877-480b-9db2-470c656aec91",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e72bd61-d6f9-47d0-8a82-3d948cc58998",
          "citation": "YES",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b846e685-b951-4e2c-b7e3-d3fdcfdbfaa3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389672000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94fd6c7d-28b3-42a6-aa10-788498b6591c",
          "citation": "HERBAL MEDICINES 4TH ED 2103",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e772a1e8-6d3a-451f-8ceb-791a4863b737",
          "citation": "AN OVERVIEW OF THE EFFECTS OF TOBACCO INGREDIENTS ON SMOKE CHEMISTRY AND TOXICITY; FOOD AND CHEMICAL TOXICOLOGY; BAKER, RR; 42(SUPPL):53-83, 2004",
          "url": "http://www.sciencedirect.com/science/article/pii/S0278691504000043",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd4a625d-33b4-42dd-8e2e-58485e6ad766",
          "citation": "SRS import [A7NRR1HLH6]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=A7NRR1HLH6",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389672000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5b95259b-1d79-4d62-b0a2-380274d127fa",
          "citation": "BETA-IONONE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1b4d1643-cf1d-4bb3-b3fd-baa54316dae5",
          "citation": ".BETA.-IONONE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7055e53c-5bd7-4387-a140-4200ec9972c1",
          "citation": ".BETA.-IONONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4dc1c6ae-3f9b-41c9-8c8c-d509a947e52c",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "30318bfe-4160-4fca-9178-497005f9336a",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2107f0f5-9b4c-4d93-8fc1-c52d914cb373",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eba5fae4-0026-4d4a-96bd-3680617663ce",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7569fe81-5a2b-4b80-82e9-983d163550e3",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e7602b5-93d1-44d8-8bba-91f691785711",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "241470f0-36d1-4e7e-acc1-6a89cfa6b623",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ecb103a6-cfe7-4270-2153-85a15cab6dd3",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+14901-07-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "54a46f3e-58de-f5fd-87e2-ccc0253e5165",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=14901-07-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f7ac7c16-0c7e-e363-1a92-264657fab557",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "52c249a1-c34a-47a0-adb0-388aef961722",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6faab808-aa25-4365-892a-2b3bbfcc4718",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "22a97b8c-d541-525d-7b86-0c28ce88347d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "14267e9f-39c1-a184-f57d-29f635f84fdd",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "fde24d88-800f-553d-4b48-39c12063e7a1",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e44249dd-76dc-7ad7-4286-eed057da1426",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "1cafcb50-97f5-0818-1b10-403557ca133c",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "10a28e4d-e3a1-0243-dea1-d6ab2366df11",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "387778f1-434b-4376-ba09-2f34832a4507",
          "id": "387778f1-434b-4376-ba09-2f34832a4507",
          "molfile": "\n  CDK     02272522402D\n\n 14 14  0  0  0  0  0  0  0  0999 V2000\n   23.3488  -10.0364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.9980   -9.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.9980   -7.6962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3488   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7000   -7.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.0508   -6.9156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.0506   -5.3556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.4019   -7.6954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6460   -6.9162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6487   -5.7211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.6434   -5.7211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.2941   -7.6962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.2941   -9.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6460  -10.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  3  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  2 14  1  0  0  0  0\nM  END",
          "smiles": "CC1=C(/C=C/C(=O)C)C(C)(C)CCC1",
          "formula": "C13H20O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c192720c-3f6b-47c0-b293-2474ae474b75"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "192.2978",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "956dd897-9c31-438b-acb0-652764349009",
      "version": "14",
      "structure": {
        "id": "d520853c-0d8c-4a7a-848c-2506ae1c0d7c",
        "molfile": "\n   JSDraw202272522402D\n\n 14 14  0  0  0  0              0 V2000\n   23.3488  -10.0364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.9980   -9.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.9980   -7.6962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3488   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7000   -7.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.0508   -6.9156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.0506   -5.3556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.4019   -7.6954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6460   -6.9162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6487   -5.7211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.6434   -5.7211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.2941   -7.6962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.2941   -9.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6460  -10.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  3  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  2 14  1  0  0  0  0\nM  END",
        "smiles": "CC1=C(/C=C/C(=O)C)C(C)(C)CCC1",
        "formula": "C13H20O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "192.2978",
        "optical_activity": "NONE",
        "references": [
          "4dc1c6ae-3f9b-41c9-8c8c-d509a947e52c",
          "dd4a625d-33b4-42dd-8e2e-58485e6ad766"
        ],
        "stereo_centers": 0
      },
      "unii": "A7NRR1HLH6"
    }
  ]
}