{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "108a32cf-e730-4f6a-9c55-e820f4ae7b6c", "code": "1707-68-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1707-68-2", "code_system": "CAS", "references": [ "5147d8b7-9c86-4e16-ac9d-8174ca9c9028", "dd1df6bf-05ff-4690-8b44-782e7ba7d13b" ] }, { "uuid": "0b58b8eb-822d-419d-9895-c5f3d48320b5", "code": "216-952-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.015.411", "code_system": "ECHA (EC/EINECS)", "references": [ "5147d8b7-9c86-4e16-ac9d-8174ca9c9028" ] }, { "uuid": "e5868cba-d9a7-475d-952e-b33f1394875b", "code": "74357", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/74357", "code_system": "PUBCHEM", "references": [ "5147d8b7-9c86-4e16-ac9d-8174ca9c9028" ] }, { "uuid": "1945a700-7d9b-b26e-088c-30a497c9b15d", "code": "DTXSID3061895", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3061895", "code_system": "EPA CompTox", "references": [ "57aa2ae0-933f-b1fe-7b4a-8d5b01c862a7" ] }, { "uuid": "133cf99f-5ca5-4680-ac14-4187ca842b26", "code": "A7F5M8MB5X", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "69f01963-ce03-4d0a-9810-dabfa9687662", "name": "1,1′-Bi-1H-imidazole, 2,2′-bis(2-chlorophenyl)-4,4′,5,5′-tetraphenyl-", "stdName": "1,1'-BI-1H-IMIDAZOLE, 2,2'-BIS(2-CHLOROPHENYL)-4,4',5,5'-TETRAPHENYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "86e8a771-afbe-4de0-81c1-3390ac586dda", "e50de674-493e-4184-a3ad-f72df11a0aa4" ], "display_name": false }, { "uuid": "24a9c6de-34d8-4acc-9ca8-f4abdef39b4a", "name": "2,2′-Bis(2-chlorophenyl)-4,4′,5,5′-tetraphenyl-1,1′-bi-1H-imidazole", "stdName": "2,2'-BIS(2-CHLOROPHENYL)-4,4',5,5'-TETRAPHENYL-1,1'-BI-1H-IMIDAZOLE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "dd1df6bf-05ff-4690-8b44-782e7ba7d13b" ], "display_name": true } ], "references": [ { "uuid": "86e8a771-afbe-4de0-81c1-3390ac586dda", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e50de674-493e-4184-a3ad-f72df11a0aa4", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5147d8b7-9c86-4e16-ac9d-8174ca9c9028", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393926000, "tags": [ "NOMEN" ] }, { "uuid": "57aa2ae0-933f-b1fe-7b4a-8d5b01c862a7", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1707-68-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "dd1df6bf-05ff-4690-8b44-782e7ba7d13b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "0a1cb82a-44a3-4299-bc28-1c0bcdfce4e2", "id": "0a1cb82a-44a3-4299-bc28-1c0bcdfce4e2", "molfile": "\n Marvin 01132100472D \n\n 48 55 0 0 0 0 999 V2000\n -1.1530 -3.9603 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3282 -4.0122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1298 -3.3179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9588 -3.3701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3259 -4.1116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8688 -4.7980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0396 -4.7499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4130 -5.4409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2350 -5.3959 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5292 -6.1647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8957 -6.6827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8707 -7.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5859 -7.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5964 -8.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8836 -9.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1680 -8.8450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1611 -8.0165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1795 -6.2394 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2399 -6.7083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4496 -7.5011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2718 -7.5461 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5659 -6.7774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9324 -6.2592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9074 -5.3464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6226 -4.9432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6330 -4.1183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9203 -3.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2046 -4.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1978 -4.9255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3336 -6.4710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4786 -5.6680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2479 -5.3829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8861 -5.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7371 -6.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9636 -6.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9971 -8.1921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1679 -8.1441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7108 -8.8304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0779 -9.5719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9068 -9.6241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3649 -8.9299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1897 -8.9818 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2970 -6.4711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4420 -7.2740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2113 -7.5591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8494 -7.0220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7005 -6.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9269 -5.9425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 7 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 2 0 0 0 0\n 8 18 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 43 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 18 1 0 0 0 0\n 12 13 1 0 0 0 0\n 17 12 2 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 20 19 1 0 0 0 0\n 23 19 1 0 0 0 0\n 21 20 2 0 0 0 0\n 20 36 1 0 0 0 0\n 22 21 1 0 0 0 0\n 22 23 2 0 0 0 0\n 22 30 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 29 24 2 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 31 30 1 0 0 0 0\n 35 30 2 0 0 0 0\n 32 31 2 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 2 0 0 0 0\n 34 35 1 0 0 0 0\n 37 36 1 0 0 0 0\n 41 36 2 0 0 0 0\n 38 37 2 0 0 0 0\n 39 38 1 0 0 0 0\n 40 39 2 0 0 0 0\n 40 41 1 0 0 0 0\n 42 41 1 0 0 0 0\n 44 43 1 0 0 0 0\n 48 43 2 0 0 0 0\n 45 44 2 0 0 0 0\n 45 46 1 0 0 0 0\n 46 47 2 0 0 0 0\n 47 48 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)-c2c(-c3ccccc3)n(c(-c4ccccc4Cl)n2)-n5c(-c6ccccc6)c(-c7ccccc7)nc5-c8ccccc8Cl", "formula": "C42H28Cl2N4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "2ef479a7-0c78-4211-8a13-400b6f808772" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "659.6059", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "2045727a-77ba-4bdf-b17b-c013975365e7", "version": "5", "structure": { "id": "dec1de1d-1586-41e1-b224-53da1da65d72", "molfile": "\n Marvin 01132111332D \n\n 48 55 0 0 0 0 999 V2000\n -0.1795 -6.2394 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0396 -4.7499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3282 -4.0122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1530 -3.9603 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8688 -4.7980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1298 -3.3179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3259 -4.1116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9588 -3.3701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2970 -6.4711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4420 -7.2740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9269 -5.9425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2113 -7.5591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7005 -6.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.8494 -7.0220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5859 -7.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5964 -8.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8836 -9.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1680 -8.8450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1611 -8.0165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8707 -7.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4130 -5.4409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8957 -6.6827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2350 -5.3959 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5292 -6.1647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2399 -6.7083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9971 -8.1921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3649 -8.9299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1897 -8.9818 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1679 -8.1441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9068 -9.6241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7108 -8.8304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0779 -9.5719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3336 -6.4710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4786 -5.6680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9636 -6.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2479 -5.3829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7371 -6.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8861 -5.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6226 -4.9432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6330 -4.1183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9203 -3.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2046 -4.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1978 -4.9255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9074 -5.3464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4496 -7.5011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9324 -6.2592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2718 -7.5461 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5659 -6.7774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21 1 1 0 0 0 0\n 22 1 1 0 0 0 0\n 23 21 2 0 0 0 0\n 24 22 2 0 0 0 0\n 1 25 1 0 0 0 0\n 24 23 1 0 0 0 0\n 22 20 1 0 0 0 0\n 24 9 1 0 0 0 0\n 21 2 1 0 0 0 0\n 11 9 1 0 0 0 0\n 12 10 1 0 0 0 0\n 13 11 2 0 0 0 0\n 14 13 1 0 0 0 0\n 12 14 2 0 0 0 0\n 6 3 1 0 0 0 0\n 7 5 2 0 0 0 0\n 15 16 2 0 0 0 0\n 8 7 1 0 0 0 0\n 16 17 1 0 0 0 0\n 6 8 2 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 15 1 0 0 0 0\n 3 2 2 0 0 0 0\n 4 3 1 0 0 0 0\n 5 2 1 0 0 0 0\n 10 9 2 0 0 0 0\n 48 47 1 0 0 0 0\n 46 44 1 0 0 0 0\n 48 33 1 0 0 0 0\n 45 26 1 0 0 0 0\n 35 33 1 0 0 0 0\n 36 34 1 0 0 0 0\n 37 35 2 0 0 0 0\n 38 37 1 0 0 0 0\n 36 38 2 0 0 0 0\n 30 27 1 0 0 0 0\n 31 29 2 0 0 0 0\n 39 40 2 0 0 0 0\n 32 31 1 0 0 0 0\n 40 41 1 0 0 0 0\n 30 32 2 0 0 0 0\n 41 42 2 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 2 0 0 0 0\n 44 39 1 0 0 0 0\n 27 26 2 0 0 0 0\n 28 27 1 0 0 0 0\n 29 26 1 0 0 0 0\n 34 33 2 0 0 0 0\n 45 25 1 0 0 0 0\n 46 25 1 0 0 0 0\n 47 45 2 0 0 0 0\n 48 46 2 0 0 0 0\nM END", "smiles": "c1ccc(cc1)-c2c(-c3ccccc3)n(c(-c4ccccc4Cl)n2)-n5c(-c6ccccc6)c(-c7ccccc7)nc5-c8ccccc8Cl", "formula": "C42H28Cl2N4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "659.6059", "optical_activity": "NONE", "references": [ "86e8a771-afbe-4de0-81c1-3390ac586dda" ], "stereo_centers": 0 }, "unii": "A7F5M8MB5X" } ] }