{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9427b232-66c3-45fd-a690-dd228a9edab7",
          "code": "m5189",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5189?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "85a517ac-c550-4ab1-904e-76ceed7170cc"
          ]
        },
        {
          "uuid": "e2111991-8d5d-454d-837e-3470c26ba5ab",
          "code": "DB09166",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB09166",
          "code_system": "DRUG BANK",
          "references": [
            "85a517ac-c550-4ab1-904e-76ceed7170cc"
          ]
        },
        {
          "uuid": "330b072c-3303-4a1a-86cd-f2007eebbd66",
          "code": "CHEMBL1289779",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1289779",
          "code_system": "ChEMBL",
          "references": [
            "85a517ac-c550-4ab1-904e-76ceed7170cc"
          ]
        },
        {
          "uuid": "cd9260ce-8ffe-4417-879b-0b3bd9b2753b",
          "code": "3307",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3307",
          "code_system": "PUBCHEM",
          "references": [
            "85a517ac-c550-4ab1-904e-76ceed7170cc"
          ]
        },
        {
          "uuid": "4be0b521-1d81-4f81-9284-a0767847122e",
          "code": "N05BA19",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOLEPTICS|ANXIOLYTICS|Benzodiazepine derivatives|etizolam",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N05BA19&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "85a517ac-c550-4ab1-904e-76ceed7170cc"
          ]
        },
        {
          "uuid": "84d45152-3b01-4d8d-8441-8362f38e43f9",
          "code": "40054-69-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=40054-69-1",
          "code_system": "CAS",
          "references": [
            "85a517ac-c550-4ab1-904e-76ceed7170cc",
            "5375b2d3-f30d-4f64-a385-615b4aa76dc9"
          ]
        },
        {
          "uuid": "621ea750-ee07-4b93-ae00-2c73a61b0469",
          "code": "C044610",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67044610",
          "code_system": "MESH",
          "references": [
            "85a517ac-c550-4ab1-904e-76ceed7170cc"
          ]
        },
        {
          "uuid": "1ea79f78-7b3d-4dfb-8056-cc6f0f6d1483",
          "code": "ETIZOLAM",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Etizolam",
          "code_system": "WIKIPEDIA",
          "references": [
            "85a517ac-c550-4ab1-904e-76ceed7170cc"
          ]
        },
        {
          "uuid": "fe86c11b-f2fb-4376-9a6c-a8a187cac120",
          "code": "QN05BA19",
          "comments": "VATC|PSYCHOLEPTICS|ANXIOLYTICS|Benzodiazepine derivatives|etizolam",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN05BA19&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "85a517ac-c550-4ab1-904e-76ceed7170cc"
          ]
        },
        {
          "uuid": "32f77a26-3a15-4678-8224-91639726d5cc",
          "code": "SUB07313MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "85a517ac-c550-4ab1-904e-76ceed7170cc"
          ]
        },
        {
          "uuid": "cadd37f6-1147-4779-8734-80b2ee78ff51",
          "code": "4563",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4563",
          "code_system": "INN",
          "references": [
            "85a517ac-c550-4ab1-904e-76ceed7170cc"
          ]
        },
        {
          "uuid": "d1dae97c-4b0a-453f-801f-3c828c4c712f",
          "code": "C65583",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C65583",
          "code_system": "NCI_THESAURUS",
          "references": [
            "85a517ac-c550-4ab1-904e-76ceed7170cc"
          ]
        },
        {
          "uuid": "8edac337-5caf-9aa1-a671-f6e7a7fa4fc5",
          "code": "DTXSID0023030",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0023030",
          "code_system": "EPA CompTox",
          "references": [
            "a81fa67c-e96f-7caa-243c-418628ee47ab"
          ]
        },
        {
          "uuid": "140a9839-ba4e-5f74-14d9-9ccc5f43a78d",
          "code": "C1012",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antianxiety Agent[C28197]|Benzodiazepine",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1012",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ee24d976-6f31-2158-ac0c-e40278982108"
          ]
        },
        {
          "uuid": "9ddc2c4c-347a-4696-8402-e52eeaadeeca",
          "code": "A76XI0HL37",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ae8f3cca-7790-7393-fb72-932225b68ee5",
          "code": "1102",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1102",
          "code_system": "DRUG CENTRAL",
          "references": [
            "ee24d976-6f31-2158-ac0c-e40278982108"
          ]
        },
        {
          "uuid": "2806fff1-e94c-c45b-dfbf-e03dd6f7a915",
          "code": "Designer-drugs-Etizolam",
          "comments": "Wikipedia|List of designer drugs|Sedatives|Thienodiazepines",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "ee24d976-6f31-2158-ac0c-e40278982108"
          ]
        },
        {
          "uuid": "521d0096-354b-e90b-71a4-77247603a9da",
          "code": "100000082100",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "31d9cf46-0aed-f70a-7e06-fd0932262e9c"
          ]
        },
        {
          "uuid": "b4ccf22e-f77c-4215-b879-8440d6730806",
          "code": "2780",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I.|Temporary listing of substances subject to emergency scheduling",
          "type": "PRIMARY",
          "url": "https://www.ecfr.gov/current/title-21/chapter-II/part-1308",
          "code_system": "DEA NO.",
          "references": [
            "ab8631a1-1bfb-4b66-bc63-30239e61e2d6"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "60b686e9-ea9c-492a-a19f-238a08de3525",
          "amount": {
            "uuid": "c0c21d80-15e3-4c81-bd42-6b4eb1fb08c1"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "91f44d37-c42a-46f3-a52a-89ee15a6bc9f",
            "refuuid": "db4c9884-745a-4355-992b-089dac99285d",
            "name": "ETIZOLAM",
            "unii": "A76XI0HL37",
            "linking_id": "A76XI0HL37",
            "ref_pname": "ETIZOLAM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "95db0f42-efc6-444a-8314-51d8203798bc",
          "amount": {
            "uuid": "b83062b2-ebc5-42ad-8658-0f0947231086"
          },
          "comments": "Etizolam acts as a full agonist at the benzodiazepine/GABAa receptor to produce its range of therapeutic and adverse effects.",
          "type": "TARGET->AGONIST",
          "references": [
            "40cf4ef2-2772-4a22-ac12-90e25bbe21aa"
          ],
          "related_substance": {
            "uuid": "da25911d-ac96-4ad3-b5bf-a9bcdf0f5b48",
            "refuuid": "45411db4-378d-416f-a8ad-88c8ddb55cdd",
            "name": "GABAA RECEPTOR",
            "unii": "RU3465V8V1",
            "linking_id": "RU3465V8V1",
            "ref_pname": "GABAA RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3114a62a-aeb7-4bc8-b07e-2ab328f0bc72",
          "amount": {
            "uuid": "69631c85-043d-46f3-a505-a3c1ca11ba67"
          },
          "type": "METABOLITE->PARENT",
          "interaction_type": "MAJOR",
          "references": [
            "1fbca732-c950-4713-b375-5f11c929ec71"
          ],
          "related_substance": {
            "uuid": "d6fa98b7-02b7-4739-9732-7e66b1aa751c",
            "refuuid": "f74bf5f1-cfb2-495b-ab02-de80bc8957a8",
            "name": ".ALPHA.-HYDROXYETIZOLAM",
            "unii": "AYC2I7NE1D",
            "linking_id": "AYC2I7NE1D",
            "ref_pname": ".ALPHA.-HYDROXYETIZOLAM"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "73bf0be6-8109-4a19-a31e-9b699e46b16a",
          "name": "4-(2-Chlorophenyl)-2-ethyl-9-methyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine",
          "stdName": "4-(2-CHLOROPHENYL)-2-ETHYL-9-METHYL-6H-THIENO(3,2-F)(1,2,4)TRIAZOLO(4,3-A)(1,4)DIAZEPINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5375b2d3-f30d-4f64-a385-615b4aa76dc9"
          ],
          "display_name": false
        },
        {
          "uuid": "bdac5320-9cf9-4331-9b3b-c3ea32feaf39",
          "name": "4-(O-CHLOROPHENYL)-2-ETHYL-9-METHYL-6H-THIENO(3,2-F)-S-TRIAZOLO(4,3-A)(1,4)DIAZEPINE",
          "stdName": "4-(O-CHLOROPHENYL)-2-ETHYL-9-METHYL-6H-THIENO(3,2-F)-S-TRIAZOLO(4,3-A)(1,4)DIAZEPINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ebd01f00-9770-4f60-8b12-6327281fbc96"
          ],
          "display_name": false
        },
        {
          "uuid": "df34048f-0f5c-4c01-a888-7b743fabcd9b",
          "name": "DEA NO. 2780",
          "stdName": "DEA NO. 2780",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab8631a1-1bfb-4b66-bc63-30239e61e2d6"
          ],
          "display_name": false
        },
        {
          "uuid": "19af93a3-15ca-4649-8c90-390bc9f372ad",
          "name": "ETIZOLAM",
          "stdName": "ETIZOLAM",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ebd01f00-9770-4f60-8b12-6327281fbc96",
            "1346b408-a482-46c0-a296-fbd7ced39d34",
            "87932b6e-2ce1-4ae0-b689-b7432722eb5b",
            "72b46362-a1a4-4564-a86a-0e1a85f00c50",
            "a87df356-028f-4e48-98fb-8207db1df074",
            "11f528c5-2144-4a18-8036-e37a8d6c3f6a",
            "6347efae-2ead-4012-bf4d-15a863b80d02",
            "2ff54eb0-9e79-4a84-b306-850bec958b30",
            "ecd1b1df-defd-45f1-a9cf-9c8a4b2cf71d"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "4305f0c2-5697-44f4-a64c-81a53b1778b5",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "b1937dd4-2a37-e3ba-71bd-8b768a191fdc",
          "name": "ETIZOLAM [JAN]",
          "stdName": "ETIZOLAM [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e8616f60-b895-22d0-9e0d-ef4b92c502b5"
          ],
          "display_name": false
        },
        {
          "uuid": "79680731-7d0a-4bf0-9157-b03b7923740c",
          "name": "ETIZOLAM [MART.]",
          "stdName": "ETIZOLAM [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87932b6e-2ce1-4ae0-b689-b7432722eb5b"
          ],
          "display_name": false
        },
        {
          "uuid": "a3473fd9-f603-4964-8acd-2a235ceeb951",
          "name": "ETIZOLAM [MI]",
          "stdName": "ETIZOLAM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ecd1b1df-defd-45f1-a9cf-9c8a4b2cf71d"
          ],
          "display_name": false
        },
        {
          "uuid": "9b3c3f55-8d73-d82d-90fe-f4b8dc63bc2d",
          "name": "Etizolam [WHO-DD]",
          "stdName": "ETIZOLAM [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "31249949-4162-4b48-0e03-91ee4d809b3e"
          ],
          "display_name": false
        },
        {
          "uuid": "408e4717-eacd-4e43-a240-944de006621a",
          "name": "SEDEKOPAN",
          "stdName": "SEDEKOPAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "13ca340d-1824-4810-ad7c-54b228c52278",
            "b9949a8b-e7b2-4a99-8027-384920638c8c"
          ],
          "display_name": false
        },
        {
          "uuid": "07ba17f1-9cc8-4745-9f2a-af13ec305576",
          "name": "etizolam [INN]",
          "stdName": "ETIZOLAM [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "72b46362-a1a4-4564-a86a-0e1a85f00c50"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ebd01f00-9770-4f60-8b12-6327281fbc96",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "72b46362-a1a4-4564-a86a-0e1a85f00c50",
          "citation": "INN Proposed List 40",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL40.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "87932b6e-2ce1-4ae0-b689-b7432722eb5b",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ecd1b1df-defd-45f1-a9cf-9c8a4b2cf71d",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9949a8b-e7b2-4a99-8027-384920638c8c",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13ca340d-1824-4810-ad7c-54b228c52278",
          "citation": "D01514",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ff54eb0-9e79-4a84-b306-850bec958b30",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85a517ac-c550-4ab1-904e-76ceed7170cc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390631000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "667d60ac-2258-4eee-9966-da183110c484",
          "citation": "SRS import [A76XI0HL37]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=A76XI0HL37",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390631000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "65cf3f0b-dd94-4d5e-bc43-1852d35d37e4",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a87df356-028f-4e48-98fb-8207db1df074",
          "citation": "ETIZOLAM [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "11f528c5-2144-4a18-8036-e37a8d6c3f6a",
          "citation": "ETIZOLAM [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1346b408-a482-46c0-a296-fbd7ced39d34",
          "citation": "ETIZOLAM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6347efae-2ead-4012-bf4d-15a863b80d02",
          "citation": "ETIZOLAM [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a81fa67c-e96f-7caa-243c-418628ee47ab",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=40054-69-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ee24d976-6f31-2158-ac0c-e40278982108",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e8616f60-b895-22d0-9e0d-ef4b92c502b5",
          "citation": "JAN",
          "doc_type": "JAN",
          "public_domain": true
        },
        {
          "uuid": "5375b2d3-f30d-4f64-a385-615b4aa76dc9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1fbca732-c950-4713-b375-5f11c929ec71",
          "citation": "Eur J Clin Pharmacol 1991;40(2):181",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "495fa309-1209-400f-ba69-abbd9551c3cf",
          "citation": "https://en.wikipedia.org/wiki/Etizolam",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0477f3a6-f23b-4909-8ee7-6275c0777a86",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "40cf4ef2-2772-4a22-ac12-90e25bbe21aa",
          "citation": "https://en.wikipedia.org/wiki/Etizolam",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f0a8edfe-22eb-4f6f-b4aa-860ec1c1a3b5",
          "citation": "https://en.wikipedia.org/wiki/Etizolam",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "31249949-4162-4b48-0e03-91ee4d809b3e",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "31d9cf46-0aed-f70a-7e06-fd0932262e9c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "ab8631a1-1bfb-4b66-bc63-30239e61e2d6",
          "citation": "CFR",
          "url": "https://www.ecfr.gov/current/title-21/chapter-II/part-1308",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fe947160-673e-46e6-9d2a-5dac3c552db6",
          "id": "fe947160-673e-46e6-9d2a-5dac3c552db6",
          "molfile": "\n  Marvin  01132113112D          \n\n 23 26  0  0  0  0            999 V2000\n    4.8689   -0.9280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6304   -0.5992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2963   -1.0986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2838   -1.9226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0695   -2.1908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5645   -1.5356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0906   -0.8531    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3854   -1.5064    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8140   -0.8073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4977   -0.0457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6203   -0.9987    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6703   -1.8019    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9175   -2.1223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7601   -2.9315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0334   -3.3193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2802   -2.9864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9765   -3.7549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4923   -4.4020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1918   -5.1729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3759   -5.2953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8634   -4.6532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1637   -3.8806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6459   -3.2278    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  7  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5 16  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 13  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 17 22  2  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "CCc1cc2C(=NCc3nnc(C)n3-c2s1)c4ccccc4Cl",
          "formula": "C17H15ClN4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "43180aa4-335a-4d24-af11-a7aa6f35da00"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "342.8475",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "db4c9884-745a-4355-992b-089dac99285d",
      "version": "22",
      "structure": {
        "id": "cb879174-e810-4b1e-8d6f-e1ab6856d66e",
        "molfile": "\n  Marvin  01132110312D          \n\n 23 26  0  0  0  0            999 V2000\n    8.8140   -0.8073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3854   -1.5064    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9175   -2.1223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6703   -1.8019    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6203   -0.9987    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2802   -2.9864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0334   -3.3193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7601   -2.9315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0695   -2.1908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2963   -1.0986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2838   -1.9226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0906   -0.8531    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5645   -1.5356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9765   -3.7549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1637   -3.8806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8634   -4.6532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3759   -5.2953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1918   -5.1729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4923   -4.4020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6459   -3.2278    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.6304   -0.5992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8689   -0.9280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4977   -0.0457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 12 10  1  0  0  0  0\n 11  9  1  0  0  0  0\n 13  9  2  0  0  0  0\n  1  2  1  0  0  0  0\n 13  2  1  0  0  0  0\n  8  3  1  0  0  0  0\n  6 14  1  0  0  0  0\n  2  3  1  0  0  0  0\n 14 15  2  0  0  0  0\n  3  4  2  0  0  0  0\n 15 16  1  0  0  0  0\n  7  8  1  0  0  0  0\n 16 17  2  0  0  0  0\n  9  6  1  0  0  0  0\n 17 18  1  0  0  0  0\n 10 11  2  0  0  0  0\n 18 19  2  0  0  0  0\n 19 14  1  0  0  0  0\n  4  5  1  0  0  0  0\n 15 20  1  0  0  0  0\n  1  5  2  0  0  0  0\n 10 21  1  0  0  0  0\n  6  7  2  0  0  0  0\n 21 22  1  0  0  0  0\n 13 12  1  0  0  0  0\n  1 23  1  0  0  0  0\nM  END",
        "smiles": "CCc1cc2C(=NCc3nnc(C)n3-c2s1)c4ccccc4Cl",
        "formula": "C17H15ClN4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "342.8475",
        "optical_activity": "NONE",
        "references": [
          "65cf3f0b-dd94-4d5e-bc43-1852d35d37e4",
          "667d60ac-2258-4eee-9966-da183110c484",
          "72b46362-a1a4-4564-a86a-0e1a85f00c50"
        ],
        "stereo_centers": 0
      },
      "unii": "A76XI0HL37"
    }
  ]
}