{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9782ae7c-5f05-4627-84c9-63f0814266c5",
          "code": "16118-49-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=16118-49-3",
          "code_system": "CAS",
          "references": [
            "b264d6e5-b6e1-4399-a366-fceb648fcb5d",
            "d40d0245-ff5f-4231-bb0c-6b8edb32dd45"
          ]
        },
        {
          "uuid": "e5b77ce9-6f93-4d44-89d2-54284b8a0fd1",
          "code": "240-286-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.036.608",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b264d6e5-b6e1-4399-a366-fceb648fcb5d"
          ]
        },
        {
          "uuid": "2ea25266-109a-43f8-bb4a-25dfd4ecaf3d",
          "code": "152031",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/152031",
          "code_system": "PUBCHEM",
          "references": [
            "b264d6e5-b6e1-4399-a366-fceb648fcb5d"
          ]
        },
        {
          "uuid": "04b42f13-d409-e4ea-498d-4a6da1e6d7fe",
          "code": "DTXSID7041756",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7041756",
          "code_system": "EPA CompTox",
          "references": [
            "186366f0-e011-0c71-5f3d-30315898458e"
          ]
        },
        {
          "uuid": "9f0f280d-51e8-458f-b639-6c6dc8eb8003",
          "code": "A75ON2B2V7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "50a29cd2-b642-1d4c-ff79-633b785e71b4",
          "code": "carbetamide",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/carbetamide.html",
          "code_system": "ALANWOOD",
          "references": [
            "d7fcd334-98b3-0ac8-9f61-6b11161038ce"
          ]
        },
        {
          "uuid": "3b27d491-fac0-1f7c-6b59-26b1db97961a",
          "code": "300000052879",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "47a59175-17e1-21a4-dc0c-a7f80c6c4beb"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c2533374-a576-47f6-a804-994bb3cc91ef",
          "name": "CARBETAMEX",
          "stdName": "CARBETAMEX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62ebce40-a795-4e8b-81fc-ab5ccd0a1918",
            "ac02393a-ff75-4db3-aed6-931f4504fe6e"
          ],
          "display_name": false
        },
        {
          "uuid": "48401ea4-a98e-4a50-bb8f-ff5e8ba539e9",
          "name": "CARBETAMIDE",
          "stdName": "CARBETAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a873f17-b2e0-482b-82eb-e41d30fa8398",
            "804067de-cb42-4842-819e-4694f4db21b7",
            "03cb667f-a0ce-4717-9d0c-2fa984c33fbe",
            "ac02393a-ff75-4db3-aed6-931f4504fe6e"
          ],
          "display_name": true
        },
        {
          "uuid": "bf9660cf-9180-47aa-bf9e-5cdced695a0f",
          "name": "CARBETAMIDE [ISO]",
          "stdName": "CARBETAMIDE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "804067de-cb42-4842-819e-4694f4db21b7",
            "ac02393a-ff75-4db3-aed6-931f4504fe6e"
          ],
          "display_name": false
        },
        {
          "uuid": "d02de893-2560-4ea7-b738-e92702ffd9be",
          "name": "CARBETHAMIDE",
          "stdName": "CARBETHAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62ebce40-a795-4e8b-81fc-ab5ccd0a1918",
            "ac02393a-ff75-4db3-aed6-931f4504fe6e"
          ],
          "display_name": false
        },
        {
          "uuid": "f2bf33d8-d6e2-4ef3-bc50-f2e0cec740f4",
          "name": "LEGURAME PM",
          "stdName": "LEGURAME PM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62ebce40-a795-4e8b-81fc-ab5ccd0a1918",
            "ac02393a-ff75-4db3-aed6-931f4504fe6e"
          ],
          "display_name": false
        },
        {
          "uuid": "977c8fce-43ef-47c0-9f0f-3e31169a2b0c",
          "name": "PROPANAMIDE, N-ETHYL-2-(((PHENYLAMINO)CARBONYL)OXY)-, (2R)-",
          "stdName": "PROPANAMIDE, N-ETHYL-2-(((PHENYLAMINO)CARBONYL)OXY)-, (2R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62ebce40-a795-4e8b-81fc-ab5ccd0a1918",
            "ac02393a-ff75-4db3-aed6-931f4504fe6e"
          ],
          "display_name": false
        },
        {
          "uuid": "32fde9c5-f42b-4c83-9941-ad53b6d29176",
          "name": "RP-11561",
          "stdName": "RP-11561",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62ebce40-a795-4e8b-81fc-ab5ccd0a1918",
            "ac02393a-ff75-4db3-aed6-931f4504fe6e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "804067de-cb42-4842-819e-4694f4db21b7",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ac02393a-ff75-4db3-aed6-931f4504fe6e",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "62ebce40-a795-4e8b-81fc-ab5ccd0a1918",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a873f17-b2e0-482b-82eb-e41d30fa8398",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b264d6e5-b6e1-4399-a366-fceb648fcb5d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392092000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "45161c34-8301-4773-bd23-f0e855bfa9f9",
          "citation": "SRS import [A75ON2B2V7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=A75ON2B2V7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392092000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "03cb667f-a0ce-4717-9d0c-2fa984c33fbe",
          "citation": "CARBETAMIDE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "186366f0-e011-0c71-5f3d-30315898458e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=16118-49-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d7fcd334-98b3-0ac8-9f61-6b11161038ce",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "d40d0245-ff5f-4231-bb0c-6b8edb32dd45",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "47a59175-17e1-21a4-dc0c-a7f80c6c4beb",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2a4fe074-4b4d-476f-a885-d46afe82687f",
          "id": "2a4fe074-4b4d-476f-a885-d46afe82687f",
          "molfile": "\n  Marvin  01132102182D          \n\n 17 17  0  0  1  0            999 V2000\n    7.1541   -6.5031    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.1541   -5.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8760   -6.9285    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5721   -6.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5721   -5.6781    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2940   -6.9285    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0158   -6.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0158   -5.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7377   -5.2656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4467   -5.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4467   -6.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7377   -6.9285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4322   -6.9285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4322   -7.7470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7104   -6.5031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7104   -5.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0014   -5.2656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 13  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 12  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "CCNC(=O)[C@@H](C)OC(=O)Nc1ccccc1",
          "formula": "C12H16N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ad2e731b-4777-4bda-8cfa-1556d0646054"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "236.2675",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7eaf7835-fea3-40ef-be14-193614d49501",
      "version": "5",
      "structure": {
        "id": "720ed736-4025-4d5e-bbc6-b664b6c614de",
        "molfile": "\n  Marvin  01132105552D          \n\n 17 17  0  0  1  0            999 V2000\n    6.4322   -6.9285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1541   -6.5031    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.1541   -5.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8760   -6.9285    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5721   -6.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5721   -5.6781    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2940   -6.9285    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0158   -6.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0158   -5.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7377   -5.2656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4467   -5.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4467   -6.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7377   -6.9285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7104   -6.5031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7104   -5.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0014   -5.2656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4322   -7.7470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  1  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 11  1  0  0  0  0\n  8 13  1  0  0  0  0\n 13 12  2  0  0  0  0\n  1 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n  1 17  2  0  0  0  0\nM  END",
        "smiles": "CCNC(=O)[C@@H](C)OC(=O)Nc1ccccc1",
        "formula": "C12H16N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "236.2675",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "5a873f17-b2e0-482b-82eb-e41d30fa8398",
          "45161c34-8301-4773-bd23-f0e855bfa9f9"
        ],
        "stereo_centers": 1
      },
      "unii": "A75ON2B2V7"
    }
  ]
}